diff options
Diffstat (limited to 'src/game/Player.cpp')
| -rw-r--r-- | src/game/Player.cpp | 5080 |
1 files changed, 3352 insertions, 1728 deletions
diff --git a/src/game/Player.cpp b/src/game/Player.cpp index cdec0f53eca..35317d9ded8 100644 --- a/src/game/Player.cpp +++ b/src/game/Player.cpp @@ -1,7 +1,7 @@ /* - * Copyright (C) 2005-2008 MaNGOS <http://www.mangosproject.org/> + * Copyright (C) 2005-2009 MaNGOS <http://getmangos.com/> * - * Copyright (C) 2008 Trinity <http://www.trinitycore.org/> + * Copyright (C) 2008-2009 Trinity <http://www.trinitycore.org/> * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by @@ -23,13 +23,13 @@ #include "Database/DatabaseEnv.h" #include "Log.h" #include "Opcodes.h" -#include "ObjectMgr.h" #include "SpellMgr.h" #include "World.h" #include "WorldPacket.h" #include "WorldSession.h" #include "UpdateMask.h" #include "Player.h" +#include "Vehicle.h" #include "SkillDiscovery.h" #include "QuestDef.h" #include "GossipDef.h" @@ -49,7 +49,6 @@ #include "Group.h" #include "Guild.h" #include "Pet.h" -#include "SpellAuras.h" #include "Util.h" #include "Transports.h" #include "Weather.h" @@ -63,11 +62,12 @@ #include "Database/DatabaseImpl.h" #include "Spell.h" #include "SocialMgr.h" -#include "GameEvent.h" +#include "GameEventMgr.h" +#include "AchievementMgr.h" #include <cmath> -#define ZONE_UPDATE_INTERVAL 1000 +#define ZONE_UPDATE_INTERVAL (1*IN_MILISECONDS) #define PLAYER_SKILL_INDEX(x) (PLAYER_SKILL_INFO_1_1 + ((x)*3)) #define PLAYER_SKILL_VALUE_INDEX(x) (PLAYER_SKILL_INDEX(x)+1) @@ -132,7 +132,7 @@ PlayerTaxi::PlayerTaxi() memset(m_taximask, 0, sizeof(m_taximask)); } -void PlayerTaxi::InitTaxiNodesForLevel(uint32 race, uint32 level) +void PlayerTaxi::InitTaxiNodesForLevel(uint32 race, uint32 chrClass, uint32 level) { // capital and taxi hub masks switch(race) @@ -149,6 +149,13 @@ void PlayerTaxi::InitTaxiNodesForLevel(uint32 race, uint32 level) case RACE_BLOODELF: SetTaximaskNode(82); break; // Blood Elf case RACE_DRAENEI: SetTaximaskNode(94); break; // Draenei } + + switch(chrClass) + { + case CLASS_DEATH_KNIGHT: // TODO: figure out initial known nodes + break; + } + // new continent starting masks (It will be accessible only at new map) switch(Player::TeamForRace(race)) { @@ -188,7 +195,7 @@ void PlayerTaxi::AppendTaximaskTo( ByteBuffer& data, bool all ) } } -bool PlayerTaxi::LoadTaxiDestinationsFromString( const std::string& values ) +bool PlayerTaxi::LoadTaxiDestinationsFromString( const std::string& values, uint32 team ) { ClearTaxiDestinations(); @@ -216,6 +223,10 @@ bool PlayerTaxi::LoadTaxiDestinationsFromString( const std::string& values ) return false; } + // can't load taxi path without mount set (quest taxi path?) + if(!objmgr.GetTaxiMount(GetTaxiSource(),team)) + return false; + return true; } @@ -245,13 +256,22 @@ uint32 PlayerTaxi::GetCurrentTaxiPath() const return path; } +std::ostringstream& operator<< (std::ostringstream& ss, PlayerTaxi const& taxi) +{ + ss << "'"; + for(int i = 0; i < TaxiMaskSize; ++i) + ss << taxi.m_taximask[i] << " "; + ss << "'"; + return ss; +} + //== Player ==================================================== const int32 Player::ReputationRank_Length[MAX_REPUTATION_RANK] = {36000, 3000, 3000, 3000, 6000, 12000, 21000, 1000}; UpdateMask Player::updateVisualBits; -Player::Player (WorldSession *session): Unit() +Player::Player (WorldSession *session): Unit(), m_achievementMgr(this) { m_transport = 0; @@ -280,6 +300,7 @@ Player::Player (WorldSession *session): Unit() m_comboPoints = 0; m_usedTalentCount = 0; + m_questRewardTalentCount = 0; m_regenTimer = 0; m_weaponChangeTimer = 0; @@ -306,7 +327,7 @@ Player::Player (WorldSession *session): Unit() // group is initialized in the reference constructor SetGroupInvite(NULL); m_groupUpdateMask = 0; - m_auraUpdateMask = 0; + m_auraRaidUpdateMask = 0; duel = NULL; @@ -334,8 +355,11 @@ Player::Player (WorldSession *session): Unit() m_regenTimer = 0; m_weaponChangeTimer = 0; - m_breathTimer = 0; - m_isunderwater = 0; + for (int i=0; i<MAX_TIMERS; i++) + m_MirrorTimer[i] = DISABLED_MIRROR_TIMER; + + m_MirrorTimerFlags = UNDERWATER_NONE; + m_MirrorTimerFlagsLast = UNDERWATER_NONE; m_isInWater = false; m_drunkTimer = 0; m_drunk = 0; @@ -345,12 +369,13 @@ Player::Player (WorldSession *session): Unit() m_swingErrorMsg = 0; - m_DetectInvTimer = 1000; + m_DetectInvTimer = 1*IN_MILISECONDS; m_bgBattleGroundID = 0; + m_bgTypeID = BATTLEGROUND_TYPE_NONE; for (int j=0; j < PLAYER_MAX_BATTLEGROUND_QUEUES; j++) { - m_bgBattleGroundQueueID[j].bgQueueType = 0; + m_bgBattleGroundQueueID[j].bgQueueTypeId = BATTLEGROUND_QUEUE_NONE; m_bgBattleGroundQueueID[j].invitedToInstance = 0; } m_bgTeam = 0; @@ -362,6 +387,7 @@ Player::Player (WorldSession *session): Unit() m_canParry = false; m_canBlock = false; m_canDualWield = false; + m_canTitanGrip = false; m_ammoDPS = 0.0f; m_temporaryUnsummonedPetNumber = 0; @@ -400,12 +426,22 @@ Player::Player (WorldSession *session): Unit() m_InstanceValid = true; m_dungeonDifficulty = DIFFICULTY_NORMAL; + m_lastPotionId = 0; + for (int i = 0; i < BASEMOD_END; i++) { m_auraBaseMod[i][FLAT_MOD] = 0.0f; m_auraBaseMod[i][PCT_MOD] = 1.0f; } + for (int i = 0; i < MAX_COMBAT_RATING; i++) + m_baseRatingValue[i] = 0; + + m_baseSpellDamage = 0; + m_baseSpellHealing = 0; + m_baseFeralAP = 0; + m_baseManaRegen = 0; + // Honor System m_lastHonorUpdateTime = time(NULL); @@ -419,7 +455,9 @@ Player::Player (WorldSession *session): Unit() //Default movement to run mode m_unit_movement_flags = 0; - m_miniPet = 0; + m_mover = this; + m_seer = this; + m_bgAfkReportedTimer = 0; m_contestedPvPTimer = 0; @@ -428,6 +466,8 @@ Player::Player (WorldSession *session): Unit() m_isActive = true; m_farsightVision = false; + + m_runes = NULL; } Player::~Player () @@ -472,6 +512,7 @@ Player::~Player () itr->second.save->RemovePlayer(this); delete m_declinedname; + delete m_runes; } void Player::CleanupsBeforeDelete() @@ -517,24 +558,8 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 uint8 powertype = cEntry->powerType; - uint32 unitfield; - - switch(powertype) - { - case POWER_ENERGY: - case POWER_MANA: - unitfield = 0x00000000; - break; - case POWER_RAGE: - unitfield = 0x00110000; - break; - default: - sLog.outError("Invalid default powertype %u for player (class %u)",powertype,class_); - return false; - } - - SetFloatValue(UNIT_FIELD_BOUNDINGRADIUS, DEFAULT_WORLD_OBJECT_SIZE ); - SetFloatValue(UNIT_FIELD_COMBATREACH, DEFAULT_COMBAT_REACH ); + SetFloatValue(UNIT_FIELD_BOUNDINGRADIUS, DEFAULT_WORLD_OBJECT_SIZE); + SetFloatValue(UNIT_FIELD_COMBATREACH, 1.5f); switch(gender) { @@ -557,12 +582,13 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 uint32 RaceClassGender = ( race ) | ( class_ << 8 ) | ( gender << 16 ); SetUInt32Value(UNIT_FIELD_BYTES_0, ( RaceClassGender | ( powertype << 24 ) ) ); - SetUInt32Value(UNIT_FIELD_BYTES_1, unitfield); - SetByteValue(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_SANCTUARY | UNIT_BYTE2_FLAG_UNK5 ); - SetUInt32Value(UNIT_FIELD_FLAGS, UNIT_FLAG_PVP_ATTACKABLE ); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_PVP ); + SetFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_PVP_ATTACKABLE ); + SetFlag(UNIT_FIELD_FLAGS_2, UNIT_FLAG2_REGENERATE_POWER); SetFloatValue(UNIT_MOD_CAST_SPEED, 1.0f); // fix cast time showed in spell tooltip on client + SetFloatValue(UNIT_FIELD_HOVERHEIGHT, 1.0f); // default for players in 3.0.3 - //-1 is default value + // -1 is default value SetUInt32Value(PLAYER_FIELD_WATCHED_FACTION_INDEX, uint32(-1)); SetUInt32Value(PLAYER_BYTES, (skin | (face << 8) | (hairStyle << 16) | (hairColor << 24))); @@ -574,6 +600,7 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 SetUInt32Value( PLAYER_GUILD_TIMESTAMP, 0 ); SetUInt64Value( PLAYER__FIELD_KNOWN_TITLES, 0 ); // 0=disabled + SetUInt64Value( PLAYER__FIELD_KNOWN_TITLES1, 0 ); // 0=disabled SetUInt32Value( PLAYER_CHOSEN_TITLE, 0 ); SetUInt32Value( PLAYER_FIELD_KILLS, 0 ); SetUInt32Value( PLAYER_FIELD_LIFETIME_HONORBALE_KILLS, 0 ); @@ -581,10 +608,20 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 SetUInt32Value( PLAYER_FIELD_YESTERDAY_CONTRIBUTION, 0 ); // set starting level + uint32 start_level = getClass() != CLASS_DEATH_KNIGHT + ? sWorld.getConfig(CONFIG_START_PLAYER_LEVEL) + : sWorld.getConfig(CONFIG_START_HEROIC_PLAYER_LEVEL); + if (GetSession()->GetSecurity() >= SEC_MODERATOR) - SetUInt32Value (UNIT_FIELD_LEVEL, sWorld.getConfig(CONFIG_START_GM_LEVEL)); - else - SetUInt32Value (UNIT_FIELD_LEVEL, sWorld.getConfig(CONFIG_START_PLAYER_LEVEL)); + { + uint32 gm_level = sWorld.getConfig(CONFIG_START_GM_LEVEL); + if(gm_level > start_level) + start_level = gm_level; + } + + SetUInt32Value(UNIT_FIELD_LEVEL, start_level); + + InitRunes(); SetUInt32Value (PLAYER_FIELD_COINAGE, sWorld.getConfig(CONFIG_START_PLAYER_MONEY)); SetUInt32Value (PLAYER_FIELD_HONOR_CURRENCY, sWorld.getConfig(CONFIG_START_HONOR_POINTS)); @@ -648,6 +685,7 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 // base stats and related field values InitStatsForLevel(); InitTaxiNodesForLevel(); + InitGlyphsForLevel(); InitTalentForLevel(); InitPrimaryProffesions(); // to max set before any spell added @@ -660,8 +698,16 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 SetPower(POWER_MANA,GetMaxPower(POWER_MANA)); } + if(getPowerType() == POWER_RUNIC_POWER) + { + SetPower(POWER_RUNE, 8); + SetMaxPower(POWER_RUNE, 8); + SetPower(POWER_RUNIC_POWER, 0); + SetMaxPower(POWER_RUNIC_POWER, 1000); + } + // original spells - learnDefaultSpells(true); + learnDefaultSpells(); // original action bar std::list<uint16>::const_iterator action_itr[4]; @@ -703,6 +749,11 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 uint32 item_id = oEntry->ItemId[j]; + + // Hack for not existed item id in dbc 3.0.3 + if(item_id==40582) + continue; + ItemPrototype const* iProto = objmgr.GetItemPrototype(item_id); if(!iProto) { @@ -710,7 +761,9 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 continue; } - uint32 count = iProto->Stackable; // max stack by default (mostly 1) + // max stack by default (mostly 1), 1 for infinity stackable + uint32 count = iProto->Stackable > 0 ? uint32(iProto->Stackable) : 1; + if(iProto->Class==ITEM_CLASS_CONSUMABLE && iProto->SubClass==ITEM_SUBCLASS_FOOD) { switch(iProto->Spells[0].SpellCategory) @@ -760,9 +813,9 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 } // if this is ammo then use it - uint8 msg = CanUseAmmo( pItem->GetProto()->ItemId ); + uint8 msg = CanUseAmmo( pItem->GetEntry() ); if( msg == EQUIP_ERR_OK ) - SetAmmo( pItem->GetProto()->ItemId ); + SetAmmo( pItem->GetEntry() ); } } } @@ -806,25 +859,14 @@ bool Player::StoreNewItemInBestSlots(uint32 titem_id, uint32 titem_amount) return false; } -void Player::StartMirrorTimer(MirrorTimerType Type, uint32 MaxValue) -{ - uint32 BreathRegen = (uint32)-1; - - WorldPacket data(SMSG_START_MIRROR_TIMER, (21)); - data << (uint32)Type; - data << MaxValue; - data << MaxValue; - data << BreathRegen; - data << (uint8)0; - data << (uint32)0; // spell id - GetSession()->SendPacket(&data); -} - -void Player::ModifyMirrorTimer(MirrorTimerType Type, uint32 MaxValue, uint32 CurrentValue, uint32 Regen) +void Player::SendMirrorTimer(MirrorTimerType Type, uint32 MaxValue, uint32 CurrentValue, int32 Regen) { - if(Type==BREATH_TIMER) - m_breathTimer = ((MaxValue + 1000) - CurrentValue) / Regen; - + if (MaxValue == DISABLED_MIRROR_TIMER) + { + if (CurrentValue!=DISABLED_MIRROR_TIMER) + StopMirrorTimer(Type); + return; + } WorldPacket data(SMSG_START_MIRROR_TIMER, (21)); data << (uint32)Type; data << CurrentValue; @@ -837,9 +879,7 @@ void Player::ModifyMirrorTimer(MirrorTimerType Type, uint32 MaxValue, uint32 Cur void Player::StopMirrorTimer(MirrorTimerType Type) { - if(Type==BREATH_TIMER) - m_breathTimer = 0; - + m_MirrorTimer[Type] = DISABLED_MIRROR_TIMER; WorldPacket data(SMSG_STOP_MIRROR_TIMER, 4); data << (uint32)Type; GetSession()->SendPacket( &data ); @@ -847,140 +887,191 @@ void Player::StopMirrorTimer(MirrorTimerType Type) void Player::EnvironmentalDamage(uint64 guid, EnviromentalDamage type, uint32 damage) { + if(!isAlive() || isGameMaster()) + return; + + // Absorb, resist some environmental damage type + uint32 absorb = 0; + uint32 resist = 0; + if (type == DAMAGE_LAVA) + CalcAbsorbResist(this, SPELL_SCHOOL_MASK_FIRE, DIRECT_DAMAGE, damage, &absorb, &resist); + else if (type == DAMAGE_SLIME) + CalcAbsorbResist(this, SPELL_SCHOOL_MASK_NATURE, DIRECT_DAMAGE, damage, &absorb, &resist); + + damage-=absorb+resist; + WorldPacket data(SMSG_ENVIRONMENTALDAMAGELOG, (21)); data << (uint64)guid; data << (uint8)(type!=DAMAGE_FALL_TO_VOID ? type : DAMAGE_FALL); data << (uint32)damage; - data << (uint32)0; - data << (uint32)0; + data << (uint32)absorb; // absorb + data << (uint32)resist; // resist SendMessageToSet(&data, true); DealDamage(this, damage, NULL, SELF_DAMAGE, SPELL_SCHOOL_MASK_NORMAL, NULL, false); - if(type==DAMAGE_FALL && !isAlive()) // DealDamage not apply item durability loss at self damage + if(!isAlive()) { - DEBUG_LOG("We are fall to death, loosing 10 percents durability"); - DurabilityLossAll(0.10f,false); - // durability lost message - WorldPacket data(SMSG_DURABILITY_DAMAGE_DEATH, 0); - GetSession()->SendPacket(&data); + if(type==DAMAGE_FALL) // DealDamage not apply item durability loss at self damage + { + DEBUG_LOG("We are fall to death, loosing 10 percents durability"); + DurabilityLossAll(0.10f,false); + // durability lost message + WorldPacket data(SMSG_DURABILITY_DAMAGE_DEATH, 0); + GetSession()->SendPacket(&data); + } + + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATHS_FROM, 1, type); } } -void Player::HandleDrowning() +int32 Player::getMaxTimer(MirrorTimerType timer) { - if(!m_isunderwater) - return; - - //if player is GM, have waterbreath, is dead or if breathing is disabled then return - if(waterbreath || isGameMaster() || !isAlive() || GetSession()->GetSecurity() >= sWorld.getConfig(CONFIG_DISABLE_BREATHING)) + switch (timer) { - StopMirrorTimer(BREATH_TIMER); - m_isunderwater = 0; - return; + case FATIGUE_TIMER: + return MINUTE*IN_MILISECONDS; + case BREATH_TIMER: + { + if (!isAlive() || HasAuraType(SPELL_AURA_WATER_BREATHING) || GetSession()->GetSecurity() >= sWorld.getConfig(CONFIG_DISABLE_BREATHING)) + return DISABLED_MIRROR_TIMER; + int32 UnderWaterTime = 3*MINUTE*IN_MILISECONDS; + AuraList const& mModWaterBreathing = GetAurasByType(SPELL_AURA_MOD_WATER_BREATHING); + for(AuraList::const_iterator i = mModWaterBreathing.begin(); i != mModWaterBreathing.end(); ++i) + UnderWaterTime = uint32(UnderWaterTime * (100.0f + (*i)->GetModifier()->m_amount) / 100.0f); + return UnderWaterTime; + } + case FIRE_TIMER: + { + if (!isAlive()) + return DISABLED_MIRROR_TIMER; + return 1*IN_MILISECONDS; + } + default: + return 0; } + return 0; +} - uint32 UnderWaterTime = 1*MINUTE*1000; // default length 1 min +void Player::UpdateMirrorTimers() +{ + // Desync flags for update on next HandleDrowning + if (m_MirrorTimerFlags) + m_MirrorTimerFlagsLast = ~m_MirrorTimerFlags; +} - AuraList const& mModWaterBreathing = GetAurasByType(SPELL_AURA_MOD_WATER_BREATHING); - for(AuraList::const_iterator i = mModWaterBreathing.begin(); i != mModWaterBreathing.end(); ++i) - UnderWaterTime = uint32(UnderWaterTime * (100.0f + (*i)->GetModifierValue()) / 100.0f); +void Player::HandleDrowning(uint32 time_diff) +{ + if (!m_MirrorTimerFlags) + return; - if ((m_isunderwater & 0x01) && !(m_isunderwater & 0x80) && isAlive()) + // In water + if (m_MirrorTimerFlags & UNDERWATER_INWATER) { - //single trigger timer - if (!(m_isunderwater & 0x02)) + // Breath timer not activated - activate it + if (m_MirrorTimer[BREATH_TIMER] == DISABLED_MIRROR_TIMER) { - m_isunderwater|= 0x02; - m_breathTimer = UnderWaterTime + 1000; + m_MirrorTimer[BREATH_TIMER] = getMaxTimer(BREATH_TIMER); + SendMirrorTimer(BREATH_TIMER, m_MirrorTimer[BREATH_TIMER], m_MirrorTimer[BREATH_TIMER], -1); } - //single trigger "Breathbar" - if ( m_breathTimer <= UnderWaterTime && !(m_isunderwater & 0x04)) + else // If activated - do tick { - m_isunderwater|= 0x04; - StartMirrorTimer(BREATH_TIMER, UnderWaterTime); - } - //continuous trigger drowning "Damage" - if ((m_breathTimer == 0) && (m_isunderwater & 0x01)) - { - //TODO: Check this formula - uint64 guid = GetGUID(); - uint32 damage = GetMaxHealth() / 5 + urand(0, getLevel()-1); - - EnvironmentalDamage(guid, DAMAGE_DROWNING,damage); - m_breathTimer = 2000; + m_MirrorTimer[BREATH_TIMER]-=time_diff; + // Timer limit - need deal damage + if (m_MirrorTimer[BREATH_TIMER] < 0) + { + m_MirrorTimer[BREATH_TIMER]+= 1*IN_MILISECONDS; + // Calculate and deal damage + // TODO: Check this formula + uint32 damage = GetMaxHealth() / 5 + urand(0, getLevel()-1); + EnvironmentalDamage(GetGUID(), DAMAGE_DROWNING, damage); + } + else if (!(m_MirrorTimerFlagsLast & UNDERWATER_INWATER)) // Update time in client if need + SendMirrorTimer(BREATH_TIMER, getMaxTimer(BREATH_TIMER), m_MirrorTimer[BREATH_TIMER], -1); } } - //single trigger retract bar - else if (!(m_isunderwater & 0x01) && !(m_isunderwater & 0x08) && (m_isunderwater & 0x02) && (m_breathTimer > 0) && isAlive()) - { - m_isunderwater = 0x08; - - uint32 BreathRegen = 10; - ModifyMirrorTimer(BREATH_TIMER, UnderWaterTime, m_breathTimer,BreathRegen); - m_isunderwater = 0x10; - } - //remove bar - else if ((m_breathTimer < 50) && !(m_isunderwater & 0x01) && (m_isunderwater == 0x10)) + else if (m_MirrorTimer[BREATH_TIMER] != DISABLED_MIRROR_TIMER) // Regen timer { - StopMirrorTimer(BREATH_TIMER); - m_isunderwater = 0; + int32 UnderWaterTime = getMaxTimer(BREATH_TIMER); + // Need breath regen + m_MirrorTimer[BREATH_TIMER]+=10*time_diff; + if (m_MirrorTimer[BREATH_TIMER] >= UnderWaterTime || !isAlive()) + StopMirrorTimer(BREATH_TIMER); + else if (m_MirrorTimerFlagsLast & UNDERWATER_INWATER) + SendMirrorTimer(BREATH_TIMER, UnderWaterTime, m_MirrorTimer[BREATH_TIMER], 10); } -} - -void Player::HandleLava() -{ - bool ValidArea = false; - if ((m_isunderwater & 0x80) && isAlive()) + // In dark water + if (m_MirrorTimerFlags & UNDERWARER_INDARKWATER) { - //Single trigger Set BreathTimer - if (!(m_isunderwater & 0x80)) + // Fatigue timer not activated - activate it + if (m_MirrorTimer[FATIGUE_TIMER] == DISABLED_MIRROR_TIMER) { - m_isunderwater|= 0x04; - m_breathTimer = 1000; + m_MirrorTimer[FATIGUE_TIMER] = getMaxTimer(FATIGUE_TIMER); + SendMirrorTimer(FATIGUE_TIMER, m_MirrorTimer[FATIGUE_TIMER], m_MirrorTimer[FATIGUE_TIMER], -1); } - //Reset BreathTimer and still in the lava - if (!m_breathTimer) + else { - uint64 guid = GetGUID(); - uint32 damage = urand(600, 700); // TODO: Get more detailed information about lava damage - uint32 dmgZone = GetZoneId(); // TODO: Find correct "lava dealing zone" flag in Area Table - - // Deal lava damage only in lava zones. - switch(dmgZone) + m_MirrorTimer[FATIGUE_TIMER]-=time_diff; + // Timer limit - need deal damage or teleport ghost to graveyard + if (m_MirrorTimer[FATIGUE_TIMER] < 0) { - case 0x8D: - ValidArea = false; - break; - case 0x94: - ValidArea = false; - break; - case 0x2CE: - ValidArea = false; - break; - case 0x2CF: - ValidArea = false; - break; - default: - if (dmgZone / 5 & 0x408) - ValidArea = true; + m_MirrorTimer[FATIGUE_TIMER]+= 1*IN_MILISECONDS; + if (isAlive()) // Calculate and deal damage + { + uint32 damage = GetMaxHealth() / 5 + urand(0, getLevel()-1); + EnvironmentalDamage(GetGUID(), DAMAGE_EXHAUSTED, damage); + } + else if (HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_GHOST)) // Teleport ghost to graveyard + RepopAtGraveyard(); } - - // if is valid area and is not gamemaster then deal damage - if ( ValidArea && !isGameMaster() ) - EnvironmentalDamage(guid, DAMAGE_LAVA, damage); - - m_breathTimer = 1000; + else if (!(m_MirrorTimerFlagsLast & UNDERWARER_INDARKWATER)) + SendMirrorTimer(FATIGUE_TIMER, getMaxTimer(FATIGUE_TIMER), m_MirrorTimer[FATIGUE_TIMER], -1); } - } - //Death timer disabled and WaterFlags reset - else if (m_deathState == DEAD) + else if (m_MirrorTimer[FATIGUE_TIMER] != DISABLED_MIRROR_TIMER) // Regen timer { - m_breathTimer = 0; - m_isunderwater = 0; + int32 DarkWaterTime = getMaxTimer(FATIGUE_TIMER); + m_MirrorTimer[FATIGUE_TIMER]+=10*time_diff; + if (m_MirrorTimer[FATIGUE_TIMER] >= DarkWaterTime || !isAlive()) + StopMirrorTimer(FATIGUE_TIMER); + else if (m_MirrorTimerFlagsLast & UNDERWARER_INDARKWATER) + SendMirrorTimer(FATIGUE_TIMER, DarkWaterTime, m_MirrorTimer[FATIGUE_TIMER], 10); } + + if (m_MirrorTimerFlags & (UNDERWATER_INLAVA|UNDERWATER_INSLIME)) + { + // Breath timer not activated - activate it + if (m_MirrorTimer[FIRE_TIMER] == DISABLED_MIRROR_TIMER) + m_MirrorTimer[FIRE_TIMER] = getMaxTimer(FIRE_TIMER); + else + { + m_MirrorTimer[FIRE_TIMER]-=time_diff; + if (m_MirrorTimer[FIRE_TIMER] < 0) + { + m_MirrorTimer[FIRE_TIMER]+= 1*IN_MILISECONDS; + // Calculate and deal damage + // TODO: Check this formula + uint32 damage = urand(600, 700); + if (m_MirrorTimerFlags&UNDERWATER_INLAVA) + EnvironmentalDamage(GetGUID(), DAMAGE_LAVA, damage); + else + EnvironmentalDamage(GetGUID(), DAMAGE_SLIME, damage); + } + } + } + else + m_MirrorTimer[FIRE_TIMER] = DISABLED_MIRROR_TIMER; + + // Recheck timers flag + m_MirrorTimerFlags&=~UNDERWATER_EXIST_TIMERS; + for (int i = 0; i< MAX_TIMERS; ++i) + if (m_MirrorTimer[i]!=DISABLED_MIRROR_TIMER) + { + m_MirrorTimerFlags|=UNDERWATER_EXIST_TIMERS; + break; + } + m_MirrorTimerFlagsLast = m_MirrorTimerFlags; } ///The player sobers by 256 every 10 seconds @@ -1203,14 +1294,15 @@ void Player::Update( uint32 p_time ) { if(p_time >= m_zoneUpdateTimer) { - uint32 newzone = GetZoneId(); + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + if( m_zoneUpdateId != newzone ) - UpdateZone(newzone); // also update area + UpdateZone(newzone,newarea); // also update area else { // use area updates as well // needed for free far all arenas for example - uint32 newarea = GetAreaId(); if( m_areaUpdateId != newarea ) UpdateArea(newarea); @@ -1245,21 +1337,8 @@ void Player::Update( uint32 p_time ) } } - //Breathtimer - if(m_breathTimer > 0) - { - if(p_time >= m_breathTimer) - m_breathTimer = 0; - else - m_breathTimer -= p_time; - - } - //Handle Water/drowning - HandleDrowning(); - - //Handle lava - HandleLava(); + HandleDrowning(p_time); //Handle detect stealth players if (m_DetectInvTimer > 0) @@ -1286,7 +1365,7 @@ void Player::Update( uint32 p_time ) { m_drunkTimer += p_time; - if (m_drunkTimer > 10000) + if (m_drunkTimer > 10*IN_MILISECONDS) HandleSobering(); } @@ -1311,6 +1390,7 @@ void Player::Update( uint32 p_time ) Pet* pet = GetPet(); if(pet && !IsWithinDistInMap(pet, OWNER_MAX_DISTANCE) && !pet->isPossessed()) + //if(pet && !IsWithinDistInMap(pet, OWNER_MAX_DISTANCE) && (GetCharmGUID() && (pet->GetGUID() != GetCharmGUID()))) { RemovePet(pet, PET_SAVE_NOT_IN_SLOT, true); return; @@ -1344,16 +1424,15 @@ void Player::setDeathState(DeathState s) //FIXME: is pet dismissed at dying or releasing spirit? if second, add setDeathState(DEAD) to HandleRepopRequestOpcode and define pet unsummon here with (s == DEAD) RemovePet(NULL, PET_SAVE_NOT_IN_SLOT, true); - // remove uncontrolled pets - RemoveMiniPet(); - RemoveGuardians(); - // save value before aura remove in Unit::setDeathState ressSpellId = GetUInt32Value(PLAYER_SELF_RES_SPELL); // passive spell if(!ressSpellId) ressSpellId = GetResurrectionSpellId(); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATH_AT_MAP, 1); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATH, 1); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATH_IN_DUNGEON, 1); } Unit::setDeathState(s); @@ -1374,13 +1453,15 @@ void Player::setDeathState(DeathState s) void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) { - *p_data << GetGUID(); + Field *fields = result->Fetch(); + + *p_data << uint64(GetGUID()); *p_data << m_name; - *p_data << getRace(); + *p_data << uint8(getRace()); uint8 pClass = getClass(); - *p_data << pClass; - *p_data << getGender(); + *p_data << uint8(pClass); + *p_data << uint8(getGender()); uint32 bytes = GetUInt32Value(PLAYER_BYTES); *p_data << uint8(bytes); @@ -1393,16 +1474,17 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) *p_data << uint8(getLevel()); // player level // do not use GetMap! it will spawn a new instance since the bound instances are not loaded - uint32 zoneId = MapManager::Instance().GetZoneId(GetMapId(), GetPositionX(),GetPositionY()); + uint32 zoneId = MapManager::Instance().GetZoneId(GetMapId(), GetPositionX(),GetPositionY(),GetPositionZ()); sLog.outDebug("Player::BuildEnumData: m:%u, x:%f, y:%f, z:%f zone:%u", GetMapId(), GetPositionX(), GetPositionY(), GetPositionZ(), zoneId); - *p_data << zoneId; - *p_data << GetMapId(); + *p_data << uint32(zoneId); + *p_data << uint32(GetMapId()); *p_data << GetPositionX(); *p_data << GetPositionY(); *p_data << GetPositionZ(); - *p_data << (result ? result->Fetch()[13].GetUInt32() : 0); + // guild id + *p_data << (result ? fields[13].GetUInt32() : 0); uint32 char_flags = 0; if(HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_HIDE_HELM)) @@ -1413,14 +1495,13 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) char_flags |= CHARACTER_FLAG_GHOST; if(HasAtLoginFlag(AT_LOGIN_RENAME)) char_flags |= CHARACTER_FLAG_RENAME; - // always send the flag if declined names aren't used - // to let the client select a default method of declining the name - if(!sWorld.getConfig(CONFIG_DECLINED_NAMES_USED) || (result && result->Fetch()[14].GetCppString() != "")) + if(sWorld.getConfig(CONFIG_DECLINED_NAMES_USED) && (fields[14].GetCppString() != "")) char_flags |= CHARACTER_FLAG_DECLINED; - *p_data << (uint32)char_flags; // character flags - - *p_data << (uint8)1; // unknown + *p_data << uint32(char_flags); // character flags + // character customize (flags?) + *p_data << uint32(HasAtLoginFlag(AT_LOGIN_CUSTOMIZE) ? 1 : 0); + *p_data << uint8(1); // unknown // Pets info { @@ -1431,8 +1512,6 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) // show pet at selection character in character list only for non-ghost character if(result && isAlive() && (pClass == CLASS_WARLOCK || pClass == CLASS_HUNTER)) { - Field* fields = result->Fetch(); - uint32 entry = fields[10].GetUInt32(); CreatureInfo const* cInfo = sCreatureStorage.LookupEntry<CreatureInfo>(entry); if(cInfo) @@ -1443,36 +1522,11 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) } } - *p_data << (uint32)petDisplayId; - *p_data << (uint32)petLevel; - *p_data << (uint32)petFamily; + *p_data << uint32(petDisplayId); + *p_data << uint32(petLevel); + *p_data << uint32(petFamily); } - /*ItemPrototype const *items[EQUIPMENT_SLOT_END]; - for (int i = 0; i < EQUIPMENT_SLOT_END; i++) - items[i] = NULL; - - QueryResult *result = CharacterDatabase.PQuery("SELECT slot,item_template FROM character_inventory WHERE guid = '%u' AND bag = 0",GetGUIDLow()); - if (result) - { - do - { - Field *fields = result->Fetch(); - uint8 slot = fields[0].GetUInt8() & 255; - uint32 item_id = fields[1].GetUInt32(); - if( slot >= EQUIPMENT_SLOT_END ) - continue; - - items[slot] = objmgr.GetItemPrototype(item_id); - if(!items[slot]) - { - sLog.outError( "Player::BuildEnumData: Player %s have unknown item (id: #%u) in inventory, skipped.", GetName(),item_id ); - continue; - } - } while (result->NextRow()); - delete result; - }*/ - for (uint8 slot = 0; slot < EQUIPMENT_SLOT_END; slot++) { uint32 visualbase = PLAYER_VISIBLE_ITEM_1_0 + (slot * MAX_VISIBLE_ITEM_OFFSET); @@ -1489,20 +1543,20 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) if (proto != NULL) { - *p_data << (uint32)proto->DisplayInfoID; - *p_data << (uint8)proto->InventoryType; - *p_data << (uint32)(enchant?enchant->aura_id:0); + *p_data << uint32(proto->DisplayInfoID); + *p_data << uint8(proto->InventoryType); + *p_data << uint32(enchant ? enchant->aura_id : 0); } else { - *p_data << (uint32)0; - *p_data << (uint8)0; - *p_data << (uint32)0; // enchant? + *p_data << uint32(0); + *p_data << uint8(0); + *p_data << uint32(0); // enchant? } } - *p_data << (uint32)0; // first bag display id - *p_data << (uint8)0; // first bag inventory type - *p_data << (uint32)0; // enchant? + *p_data << uint32(0); // first bag display id + *p_data << uint8(0); // first bag inventory type + *p_data << uint32(0); // enchant? } bool Player::ToggleAFK() @@ -1566,19 +1620,6 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati if(!InBattleGround() && mEntry->IsBattleGroundOrArena()) return false; - // 449 - Champions' Hall (Alliance) // 450 - Hall of Legends (Horde) - if(mapid == 449 && GetTeam()==HORDE) - { - GetSession()->SendNotification(LANG_NO_ENTER_CHAMPIONS_HALL); - return false; - } - - if(mapid == 450 && GetTeam() == ALLIANCE) - { - GetSession()->SendNotification(LANG_NO_ENTER_HALL_OF_LEGENDS); - return false; - } - // client without expansion support if(GetSession()->Expansion() < mEntry->Expansion()) { @@ -1587,13 +1628,13 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati if(GetTransport()) RepopAtGraveyard(); // teleport to near graveyard if on transport, looks blizz like :) - SendTransferAborted(mapid, TRANSFER_ABORT_INSUF_EXPAN_LVL1); + SendTransferAborted(mapid, TRANSFER_ABORT_INSUF_EXPAN_LVL, mEntry->Expansion()); return false; // normal client can't teleport to this map... } else { - sLog.outDebug("Player %s will teleported to map %u", GetName(), mapid); + sLog.outDebug("Player %s is being teleported to map %u", GetName(), mapid); } // if we were on a transport, leave @@ -1639,6 +1680,7 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati else // this will be used instead of the current location in SaveToDB m_teleport_dest = WorldLocation(mapid, x, y, z, orientation); + SetFallInformation(0, z); //BuildHeartBeatMsg(&data); @@ -1673,16 +1715,19 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati } } + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + if(!GetSession()->PlayerLogout()) { // don't reset teleport semaphore while logging out, otherwise m_teleport_dest won't be used in Player::SaveToDB SetSemaphoreTeleport(false); - UpdateZone(GetZoneId()); + UpdateZone(newzone,newarea); } // new zone - if(old_zone != GetZoneId()) + if(old_zone != newzone) { // honorless target if(pvpInfo.inHostileArea) @@ -1838,9 +1883,6 @@ void Player::RemoveFromWorld() ///- Release charmed creatures, unsummon totems and remove pets/guardians StopCastingCharm(); StopCastingBindSight(); - UnsummonAllTotems(); - RemoveMiniPet(); - RemoveGuardians(); } for(int i = PLAYER_SLOT_START; i < PLAYER_SLOT_END; i++) @@ -1894,13 +1936,20 @@ void Player::RegenerateAll() { RegenerateHealth(); if (!isInCombat() && !HasAuraType(SPELL_AURA_INTERRUPT_REGEN)) + { Regenerate(POWER_RAGE); + if(getClass() == CLASS_DEATH_KNIGHT) + Regenerate(POWER_RUNIC_POWER); + } } Regenerate( POWER_ENERGY ); Regenerate( POWER_MANA ); + if(getClass() == CLASS_DEATH_KNIGHT) + Regenerate( POWER_RUNE ); + m_regenTimer = regenDelay; } @@ -1920,11 +1969,11 @@ void Player::Regenerate(Powers power) if (recentCast) { // Trinity Updates Mana in intervals of 2s, which is correct - addvalue = GetFloatValue(PLAYER_FIELD_MOD_MANA_REGEN_INTERRUPT) * ManaIncreaseRate * 2.00f; + addvalue = GetFloatValue(UNIT_FIELD_POWER_REGEN_INTERRUPTED_FLAT_MODIFIER) * ManaIncreaseRate * 2.00f; } else { - addvalue = GetFloatValue(PLAYER_FIELD_MOD_MANA_REGEN) * ManaIncreaseRate * 2.00f; + addvalue = GetFloatValue(UNIT_FIELD_POWER_REGEN_FLAT_MODIFIER) * ManaIncreaseRate * 2.00f; } } break; case POWER_RAGE: // Regenerate rage @@ -1935,6 +1984,17 @@ void Player::Regenerate(Powers power) case POWER_ENERGY: // Regenerate energy (rogue) addvalue = 20; break; + case POWER_RUNIC_POWER: + { + float RunicPowerDecreaseRate = sWorld.getRate(RATE_POWER_RUNICPOWER_LOSS); + addvalue = 30 * RunicPowerDecreaseRate; // 3 RunicPower by tick + } break; + case POWER_RUNE: + { + for(uint32 i = 0; i < MAX_RUNES; ++i) + if(uint8 cd = GetRuneCooldown(i)) // if we have cooldown, reduce it... + SetRuneCooldown(i, cd - 1); // ... by 2 sec (because update is every 2 sec) + } break; case POWER_FOCUS: case POWER_HAPPINESS: break; @@ -1947,10 +2007,10 @@ void Player::Regenerate(Powers power) AuraList const& ModPowerRegenPCTAuras = GetAurasByType(SPELL_AURA_MOD_POWER_REGEN_PERCENT); for(AuraList::const_iterator i = ModPowerRegenPCTAuras.begin(); i != ModPowerRegenPCTAuras.end(); ++i) if ((*i)->GetModifier()->m_miscvalue == power) - addvalue *= ((*i)->GetModifierValue() + 100) / 100.0f; + addvalue *= ((*i)->GetModifier()->m_amount + 100) / 100.0f; } - if (power != POWER_RAGE) + if (power != POWER_RAGE && power != POWER_RUNIC_POWER) { curValue += uint32(addvalue); if (curValue > maxValue) @@ -1988,7 +2048,7 @@ void Player::RegenerateHealth() { AuraList const& mModHealthRegenPct = GetAurasByType(SPELL_AURA_MOD_HEALTH_REGEN_PERCENT); for(AuraList::const_iterator i = mModHealthRegenPct.begin(); i != mModHealthRegenPct.end(); ++i) - addvalue *= (100.0f + (*i)->GetModifierValue()) / 100.0f; + addvalue *= (100.0f + (*i)->GetModifier()->m_amount) / 100.0f; } else if(HasAuraType(SPELL_AURA_MOD_REGEN_DURING_COMBAT)) addvalue *= GetTotalAuraModifier(SPELL_AURA_MOD_REGEN_DURING_COMBAT) / 100.0f; @@ -2048,21 +2108,27 @@ void Player::SetGameMaster(bool on) setFaction(35); SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_GM); - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP); + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); ResetContestedPvP(); getHostilRefManager().setOnlineOfflineState(false); CombatStop(); + + SetPhaseMask(PHASEMASK_ANYWHERE,false); // see and visible in all phases } else { + // restore phase + AuraList const& phases = GetAurasByType(SPELL_AURA_PHASE); + SetPhaseMask(!phases.empty() ? phases.front()->GetMiscValue() : PHASEMASK_NORMAL,false); + m_ExtraFlags &= ~ PLAYER_EXTRA_GM_ON; setFactionForRace(getRace()); RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_GM); // restore FFA PvP Server state if(sWorld.IsFFAPvPRealm()) - SetFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); // restore FFA PvP area state, remove not allowed for GM mounts UpdateArea(m_areaUpdateId); @@ -2126,7 +2192,7 @@ void Player::UninviteFromGroup() group->RemoveInvite(this); - if(group->GetMembersCount() <= 1) // group has just 1 member => disband + if(group->GetMembersCount() <= 1) // group has just 1 member => disband { if(group->IsCreated()) { @@ -2186,7 +2252,7 @@ void Player::GiveXP(uint32 xp, Unit* victim) // handle SPELL_AURA_MOD_XP_PCT auras Unit::AuraList const& ModXPPctAuras = GetAurasByType(SPELL_AURA_MOD_XP_PCT); for(Unit::AuraList::const_iterator i = ModXPPctAuras.begin();i != ModXPPctAuras.end(); ++i) - xp = uint32(xp*(1.0f + (*i)->GetModifierValue() / 100.0f)); + xp = uint32(xp*(1.0f + (*i)->GetModifier()->m_amount / 100.0f)); // XP resting bonus for kill uint32 rested_bonus_xp = victim ? GetXPRestBonus(xp) : 0; @@ -2234,13 +2300,15 @@ void Player::GiveLevel(uint32 level) data << uint32(0); data << uint32(0); data << uint32(0); + data << uint32(0); + data << uint32(0); // end for for(int i = STAT_STRENGTH; i < MAX_STATS; ++i) // Stats loop (0-4) data << uint32(int32(info.stats[i]) - GetCreateStat(Stats(i))); GetSession()->SendPacket(&data); - SetUInt32Value(PLAYER_NEXT_LEVEL_XP, Trinity::XP::xp_to_level(level)); + SetUInt32Value(PLAYER_NEXT_LEVEL_XP, objmgr.GetXPForLevel(level)); //update level, max level of skills if(getLevel()!= level) @@ -2257,6 +2325,7 @@ void Player::GiveLevel(uint32 level) InitTalentForLevel(); InitTaxiNodesForLevel(); + InitGlyphsForLevel(); UpdateAllStats(); @@ -2276,6 +2345,7 @@ void Player::GiveLevel(uint32 level) Pet* pet = GetPet(); if(pet && pet->getPetType()==SUMMON_PET) pet->GivePetLevel(level); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_LEVEL); } void Player::InitTalentForLevel() @@ -2293,7 +2363,8 @@ void Player::InitTalentForLevel() } else { - uint32 talentPointsForLevel = uint32((level-9)*sWorld.getRate(RATE_TALENT)); + uint32 talentPointsForLevel = CalculateTalentsPoints(); + // if used more that have then reset if(m_usedTalentCount > talentPointsForLevel) { @@ -2320,7 +2391,7 @@ void Player::InitStatsForLevel(bool reapplyMods) objmgr.GetPlayerLevelInfo(getRace(),getClass(),getLevel(),&info); SetUInt32Value(PLAYER_FIELD_MAX_LEVEL, sWorld.getConfig(CONFIG_MAX_PLAYER_LEVEL) ); - SetUInt32Value(PLAYER_NEXT_LEVEL_XP, Trinity::XP::xp_to_level(getLevel())); + SetUInt32Value(PLAYER_NEXT_LEVEL_XP, objmgr.GetXPForLevel(getLevel())); UpdateSkillsForLevel (); @@ -2370,11 +2441,11 @@ void Player::InitStatsForLevel(bool reapplyMods) SetFloatValue(UNIT_FIELD_MINRANGEDDAMAGE, 0.0f ); SetFloatValue(UNIT_FIELD_MAXRANGEDDAMAGE, 0.0f ); - SetUInt32Value(UNIT_FIELD_ATTACK_POWER, 0 ); - SetUInt32Value(UNIT_FIELD_ATTACK_POWER_MODS, 0 ); + SetInt32Value(UNIT_FIELD_ATTACK_POWER, 0 ); + SetInt32Value(UNIT_FIELD_ATTACK_POWER_MODS, 0 ); SetFloatValue(UNIT_FIELD_ATTACK_POWER_MULTIPLIER,0.0f); - SetUInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER, 0 ); - SetUInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER_MODS,0 ); + SetInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER, 0 ); + SetInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER_MODS,0 ); SetFloatValue(UNIT_FIELD_RANGED_ATTACK_POWER_MULTIPLIER,0.0f); // Base crit values (will be recalculated in UpdateAllStats() at loading and in _ApplyAllStatBonuses() at reset @@ -2412,6 +2483,9 @@ void Player::InitStatsForLevel(bool reapplyMods) SetFloatValue(UNIT_FIELD_POWER_COST_MODIFIER+i,0.0f); SetFloatValue(UNIT_FIELD_POWER_COST_MULTIPLIER+i,0.0f); } + // Reset no reagent cost field + for(int i = 0; i < 3; i++) + SetUInt32Value(PLAYER_NO_REAGENT_COST_1 + i, 0); // Init data for form but skip reapply item mods for form InitDataForForm(reapplyMods); @@ -2428,15 +2502,18 @@ void Player::InitStatsForLevel(bool reapplyMods) RemoveFlag( UNIT_FIELD_FLAGS, UNIT_FLAG_NON_ATTACKABLE | UNIT_FLAG_DISABLE_MOVE | UNIT_FLAG_NOT_ATTACKABLE_1 | UNIT_FLAG_PET_IN_COMBAT | UNIT_FLAG_SILENCED | UNIT_FLAG_PACIFIED | - UNIT_FLAG_DISABLE_ROTATE | UNIT_FLAG_IN_COMBAT | UNIT_FLAG_DISARMED | + UNIT_FLAG_STUNNED | UNIT_FLAG_IN_COMBAT | UNIT_FLAG_DISARMED | UNIT_FLAG_CONFUSED | UNIT_FLAG_FLEEING | UNIT_FLAG_NOT_SELECTABLE | UNIT_FLAG_SKINNABLE | UNIT_FLAG_MOUNT | UNIT_FLAG_TAXI_FLIGHT ); SetFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_PVP_ATTACKABLE ); // must be set + SetFlag(UNIT_FIELD_FLAGS_2,UNIT_FLAG2_REGENERATE_POWER);// must be set + // cleanup player flags (will be re-applied if need at aura load), to avoid have ghost flag without ghost aura, for example. - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_AFK | PLAYER_FLAGS_DND | PLAYER_FLAGS_GM | PLAYER_FLAGS_GHOST | PLAYER_FLAGS_FFA_PVP); + RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_AFK | PLAYER_FLAGS_DND | PLAYER_FLAGS_GM | PLAYER_FLAGS_GHOST | PLAYER_ALLOW_ONLY_ABILITY); - SetByteValue(UNIT_FIELD_BYTES_1, 2, 0x00); // one form stealth modified bytes + RemoveStandFlags(UNIT_STAND_FLAGS_ALL); // one form stealth modified bytes + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP | UNIT_BYTE2_FLAG_SANCTUARY); // restore if need some important flags SetUInt32Value(PLAYER_FIELD_BYTES2, 0 ); // flags empty by default @@ -2452,10 +2529,14 @@ void Player::InitStatsForLevel(bool reapplyMods) SetPower(POWER_RAGE, GetMaxPower(POWER_RAGE)); SetPower(POWER_FOCUS, 0); SetPower(POWER_HAPPINESS, 0); + SetPower(POWER_RUNIC_POWER, 0); } void Player::SendInitialSpells() { + time_t curTime = time(NULL); + time_t infTime = curTime + MONTH/2; + uint16 spellCount = 0; WorldPacket data(SMSG_INITIAL_SPELLS, (1+2+4*m_spells.size()+2+m_spellCooldowns.size()*(2+2+2+4+4))); @@ -2488,12 +2569,15 @@ void Player::SendInitialSpells() if(!sEntry) continue; + // not send infinity cooldown + if(itr->second.end > infTime) + continue; + data << uint16(itr->first); time_t cooldown = 0; - time_t curTime = time(NULL); if(itr->second.end > curTime) - cooldown = (itr->second.end-curTime)*1000; + cooldown = (itr->second.end-curTime)*IN_MILISECONDS; data << uint16(itr->second.itemid); // cast item id data << uint16(sEntry->Category); // spell category @@ -2584,13 +2668,13 @@ void Player::AddNewMailDeliverTime(time_t deliver_time) } } -bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, uint16 slot_id, bool disabled) +bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool dependent, bool disabled) { SpellEntry const *spellInfo = sSpellStore.LookupEntry(spell_id); if (!spellInfo) { // do character spell book cleanup (all characters) - if(loading && !learning) // spell load case + if(!IsInWorld() && !learning) // spell load case { sLog.outError("Player::addSpell: Non-existed in SpellStore spell #%u request, deleting for all characters in `character_spell`.",spell_id); CharacterDatabase.PExecute("DELETE FROM character_spell WHERE spell = '%u'",spell_id); @@ -2604,7 +2688,7 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, if(!SpellMgr::IsSpellValid(spellInfo,this,false)) { // do character spell book cleanup (all characters) - if(loading && !learning) // spell load case + if(!IsInWorld() && !learning) // spell load case { sLog.outError("Player::addSpell: Broken spell #%u learning not allowed, deleting for all characters in `character_spell`.",spell_id); CharacterDatabase.PExecute("DELETE FROM character_spell WHERE spell = '%u'",spell_id); @@ -2617,29 +2701,80 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, PlayerSpellState state = learning ? PLAYERSPELL_NEW : PLAYERSPELL_UNCHANGED; + bool dependent_set = false; bool disabled_case = false; bool superceded_old = false; PlayerSpellMap::iterator itr = m_spells.find(spell_id); if (itr != m_spells.end()) { + uint32 next_active_spell_id = 0; + // fix activate state for non-stackable low rank (and find next spell for !active case) + if(!SpellMgr::canStackSpellRanks(spellInfo) && spellmgr.GetSpellRank(spellInfo->Id) != 0) + { + if(uint32 next = spellmgr.GetNextSpellInChain(spell_id)) + { + if(HasSpell(next)) + { + // high rank already known so this must !active + active = false; + next_active_spell_id = next; + } + } + } + + // not do anything if already known in expected state + if(itr->second->state != PLAYERSPELL_REMOVED && itr->second->active == active && + itr->second->dependent == dependent && itr->second->disabled == disabled) + { + if(!IsInWorld() && !learning) // explicitly load from DB and then exist in it already and set correctly + itr->second->state = PLAYERSPELL_UNCHANGED; + + return false; + } + + // dependent spell known as not dependent, overwrite state + if (itr->second->state != PLAYERSPELL_REMOVED && !itr->second->dependent && dependent) + { + itr->second->dependent = dependent; + if (itr->second->state != PLAYERSPELL_NEW) + itr->second->state = PLAYERSPELL_CHANGED; + dependent_set = true; + } + // update active state for known spell if(itr->second->active != active && itr->second->state != PLAYERSPELL_REMOVED && !itr->second->disabled) { itr->second->active = active; - // loading && !learning == explicitly load from DB and then exist in it already and set correctly - if(loading && !learning) + if(!IsInWorld() && !learning && !dependent_set) // explicitly load from DB and then exist in it already and set correctly itr->second->state = PLAYERSPELL_UNCHANGED; else if(itr->second->state != PLAYERSPELL_NEW) itr->second->state = PLAYERSPELL_CHANGED; - if(!active) + if(active) { - WorldPacket data(SMSG_REMOVED_SPELL, 4); - data << uint16(spell_id); - GetSession()->SendPacket(&data); + if (IsPassiveSpell(spell_id) && IsNeedCastPassiveSpellAtLearn(spellInfo)) + CastSpell (this,spell_id,true); + } + else if(IsInWorld()) + { + if(next_active_spell_id) + { + // update spell ranks in spellbook and action bar + WorldPacket data(SMSG_SUPERCEDED_SPELL, (4)); + data << uint16(spell_id); + data << uint16(next_active_spell_id); + GetSession()->SendPacket( &data ); + } + else + { + WorldPacket data(SMSG_REMOVED_SPELL, 4); + data << uint16(spell_id); + GetSession()->SendPacket(&data); + } } + return active; // learn (show in spell book if active now) } @@ -2668,7 +2803,7 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, default: // known not saved yet spell (new or modified) { // can be in case spell loading but learned at some previous spell loading - if(loading && !learning) + if(!IsInWorld() && !learning && !dependent_set) itr->second->state = PLAYERSPELL_UNCHANGED; return false; @@ -2683,17 +2818,13 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, { if(TalentEntry const *talentInfo = sTalentStore.LookupEntry( talentPos->talent_id )) { - for(int i=0; i <5; ++i) + for(int i=0; i < MAX_TALENT_RANK; ++i) { // skip learning spell and no rank spell case uint32 rankSpellId = talentInfo->RankID[i]; if(!rankSpellId || rankSpellId==spell_id) continue; - // skip unknown ranks - if(!HasSpell(rankSpellId)) - continue; - removeSpell(rankSpellId); } } @@ -2701,16 +2832,17 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, // non talent spell: learn low ranks (recursive call) else if(uint32 prev_spell = spellmgr.GetPrevSpellInChain(spell_id)) { - if(loading) // at spells loading, no output, but allow save - addSpell(prev_spell,active,true,loading,SPELL_WITHOUT_SLOT_ID,disabled); + if(!IsInWorld() || disabled) // at spells loading, no output, but allow save + addSpell(prev_spell,active,true,true,disabled); else // at normal learning - learnSpell(prev_spell); + learnSpell(prev_spell,true); } PlayerSpell *newspell = new PlayerSpell; - newspell->active = active; - newspell->state = state; - newspell->disabled = disabled; + newspell->state = state; + newspell->active = active; + newspell->dependent = dependent; + newspell->disabled = disabled; // replace spells in action bars and spellbook to bigger rank if only one spell rank must be accessible if(newspell->active && !newspell->disabled && !SpellMgr::canStackSpellRanks(spellInfo) && spellmgr.GetSpellRank(spellInfo->Id) != 0) @@ -2727,7 +2859,7 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, { if(spellmgr.IsHighRankOfSpell(spell_id,itr->first)) { - if(!loading) // not send spell (re-/over-)learn packets at loading + if(IsInWorld()) // not send spell (re-/over-)learn packets at loading { WorldPacket data(SMSG_SUPERCEDED_SPELL, (4)); data << uint16(itr->first); @@ -2737,12 +2869,13 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, // mark old spell as disable (SMSG_SUPERCEDED_SPELL replace it in client by new) itr->second->active = false; - itr->second->state = PLAYERSPELL_CHANGED; + if(itr->second->state != PLAYERSPELL_NEW) + itr->second->state = PLAYERSPELL_CHANGED; superceded_old = true; // new spell replace old in action bars and spell book. } else if(spellmgr.IsHighRankOfSpell(itr->first,spell_id)) { - if(!loading) // not send spell (re-/over-)learn packets at loading + if(IsInWorld()) // not send spell (re-/over-)learn packets at loading { WorldPacket data(SMSG_SUPERCEDED_SPELL, (4)); data << uint16(spell_id); @@ -2760,23 +2893,6 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, } } - uint16 tmpslot=slot_id; - - if (tmpslot == SPELL_WITHOUT_SLOT_ID) - { - uint16 maxid = 0; - PlayerSpellMap::iterator itr; - for (itr = m_spells.begin(); itr != m_spells.end(); ++itr) - { - if(itr->second->state == PLAYERSPELL_REMOVED) - continue; - if (itr->second->slotId > maxid) - maxid = itr->second->slotId; - } - tmpslot = maxid + 1; - } - - newspell->slotId = tmpslot; m_spells[spell_id] = newspell; // return false if spell disabled @@ -2796,23 +2912,8 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, // also cast passive spells (including all talents without SPELL_EFFECT_LEARN_SPELL) with additional checks else if (IsPassiveSpell(spell_id)) { - // if spell doesn't require a stance or the player is in the required stance - if( ( !spellInfo->Stances && - spell_id != 5420 && spell_id != 5419 && spell_id != 7376 && - spell_id != 7381 && spell_id != 21156 && spell_id != 21009 && - spell_id != 21178 && spell_id != 33948 && spell_id != 40121 ) || - m_form != 0 && (spellInfo->Stances & (1<<(m_form-1))) || - (spell_id == 5420 && m_form == FORM_TREE) || - (spell_id == 5419 && m_form == FORM_TRAVEL) || - (spell_id == 7376 && m_form == FORM_DEFENSIVESTANCE) || - (spell_id == 7381 && m_form == FORM_BERSERKERSTANCE) || - (spell_id == 21156 && m_form == FORM_BATTLESTANCE)|| - (spell_id == 21178 && (m_form == FORM_BEAR || m_form == FORM_DIREBEAR) ) || - (spell_id == 33948 && m_form == FORM_FLIGHT) || - (spell_id == 40121 && m_form == FORM_FLIGHT_EPIC) ) - //Check CasterAuraStates - if (!spellInfo->CasterAuraState || HasAuraState(AuraState(spellInfo->CasterAuraState))) - CastSpell(this, spell_id, true); + if(IsNeedCastPassiveSpellAtLearn(spellInfo)) + CastSpell(this, spell_id, true); } else if( IsSpellHaveEffect(spellInfo,SPELL_EFFECT_SKILL_STEP) ) { @@ -2866,10 +2967,8 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, continue; if(_spell_idx->second->learnOnGetSkill == ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL || - // poison special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_POISONS && _spell_idx->second->max_value==0 || - // lockpicking special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_LOCKPICKING && _spell_idx->second->max_value==0 ) + // lockpicking/runeforging special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL + (pSkill->id==SKILL_LOCKPICKING || pSkill->id==SKILL_RUNEFORGING) && _spell_idx->second->max_value==0 ) { switch(GetSkillRangeType(pSkill,_spell_idx->second->racemask!=0)) { @@ -2897,37 +2996,71 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, { if(!itr->second.autoLearned) { - if(loading) // at spells loading, no output, but allow save - addSpell(itr->second.spell,true,true,loading); + if(!IsInWorld() || !itr->second.active) // at spells loading, no output, but allow save + addSpell(itr->second.spell,itr->second.active,true,true,false); else // at normal learning - learnSpell(itr->second.spell); + learnSpell(itr->second.spell,true); } } + if(IsInWorld()) + { + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SPELL,spell_id); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SKILLLINE_SPELLS,spell_id); + } + // return true (for send learn packet) only if spell active (in case ranked spells) and not replace old spell return active && !disabled && !superceded_old; } -void Player::learnSpell(uint32 spell_id) +bool Player::IsNeedCastPassiveSpellAtLearn(SpellEntry const* spellInfo) const +{ + bool need_cast = false; + + switch(spellInfo->Id) + { + // some spells not have stance data expacted cast at form change or present + case 5420: need_cast = (m_form == FORM_TREE); break; + case 5419: need_cast = (m_form == FORM_TRAVEL); break; + case 7376: need_cast = (m_form == FORM_DEFENSIVESTANCE); break; + case 7381: need_cast = (m_form == FORM_BERSERKERSTANCE); break; + case 21156: need_cast = (m_form == FORM_BATTLESTANCE); break; + case 21178: need_cast = (m_form == FORM_BEAR || m_form == FORM_DIREBEAR); break; + case 33948: need_cast = (m_form == FORM_FLIGHT); break; + case 34764: need_cast = (m_form == FORM_FLIGHT); break; + case 40121: need_cast = (m_form == FORM_FLIGHT_EPIC); break; + case 40122: need_cast = (m_form == FORM_FLIGHT_EPIC); break; + // another spells have proper stance data + default: need_cast = !spellInfo->Stances || m_form != 0 && (spellInfo->Stances & (1<<(m_form-1))); break; + } + + //Check CasterAuraStates + return need_cast && (!spellInfo->CasterAuraState || HasAuraState(AuraState(spellInfo->CasterAuraState))); +} + +void Player::learnSpell(uint32 spell_id, bool dependent) { PlayerSpellMap::iterator itr = m_spells.find(spell_id); bool disabled = (itr != m_spells.end()) ? itr->second->disabled : false; bool active = disabled ? itr->second->active : true; - bool learning = addSpell(spell_id,active); + bool learning = addSpell(spell_id,active,true,dependent,false); // learn all disabled higher ranks (recursive) - SpellChainNode const* node = spellmgr.GetSpellChainNode(spell_id); - if (node) + if(disabled) { - PlayerSpellMap::iterator iter = m_spells.find(node->next); - if (disabled && iter != m_spells.end() && iter->second->disabled ) - learnSpell(node->next); + SpellChainNode const* node = spellmgr.GetSpellChainNode(spell_id); + if(node) + { + PlayerSpellMap::iterator iter = m_spells.find(node->next); + if (iter != m_spells.end() && iter->second->disabled ) + learnSpell(node->next,false); + } } - // prevent duplicated entires in spell book - if(!learning) + // prevent duplicated entires in spell book, also not send if not in world (loading) + if(!learning || !IsInWorld ()) return; WorldPacket data(SMSG_LEARNED_SPELL, 4); @@ -2935,7 +3068,7 @@ void Player::learnSpell(uint32 spell_id) GetSession()->SendPacket(&data); } -void Player::removeSpell(uint32 spell_id, bool disabled) +void Player::removeSpell(uint32 spell_id, bool disabled, bool update_action_bar_for_low_rank) { PlayerSpellMap::iterator itr = m_spells.find(spell_id); if (itr == m_spells.end()) @@ -2957,10 +3090,8 @@ void Player::removeSpell(uint32 spell_id, bool disabled) for (uint32 i=reqMap.count(spell_id);i>0;i--,itr2++) removeSpell(itr2->second,disabled); - // removing - WorldPacket data(SMSG_REMOVED_SPELL, 4); - data << uint16(spell_id); - GetSession()->SendPacket(&data); + bool cur_active = itr->second->active; + bool cur_dependent = itr->second->dependent; if (disabled) { @@ -3053,10 +3184,8 @@ void Player::removeSpell(uint32 spell_id, bool disabled) continue; if(_spell_idx->second->learnOnGetSkill == ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL || - // poison special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_POISONS && _spell_idx->second->max_value==0 || - // lockpicking special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_LOCKPICKING && _spell_idx->second->max_value==0 ) + // lockpicking/runeforging special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL + (pSkill->id==SKILL_LOCKPICKING || pSkill->id==SKILL_RUNEFORGING) && _spell_idx->second->max_value==0 ) { // not reset skills for professions and racial abilities if( (pSkill->categoryId==SKILL_CATEGORY_SECONDARY || pSkill->categoryId==SKILL_CATEGORY_PROFESSION) && @@ -3074,6 +3203,60 @@ void Player::removeSpell(uint32 spell_id, bool disabled) for(SpellLearnSpellMap::const_iterator itr2 = spell_begin; itr2 != spell_end; ++itr2) removeSpell(itr2->second.spell, disabled); + + // activate lesser rank in spellbook/action bar, and cast it if need + bool prev_activate = false; + + if(uint32 prev_id = spellmgr.GetPrevSpellInChain (spell_id)) + { + SpellEntry const *spellInfo = sSpellStore.LookupEntry(spell_id); + + // if talent then lesser rank also talent and need learn + if(talentCosts) + { + //learnSpell (prev_id,false); + } + // if ranked non-stackable spell: need activate lesser rank and update dendence state + else if(cur_active && !SpellMgr::canStackSpellRanks(spellInfo) && spellmgr.GetSpellRank(spellInfo->Id) != 0) + { + // need manually update dependence state (learn spell ignore like attempts) + PlayerSpellMap::iterator prev_itr = m_spells.find(prev_id); + if (prev_itr != m_spells.end()) + { + if(prev_itr->second->dependent != cur_dependent) + { + prev_itr->second->dependent = cur_dependent; + if(prev_itr->second->state != PLAYERSPELL_NEW) + prev_itr->second->state = PLAYERSPELL_CHANGED; + } + + // now re-learn if need re-activate + if(cur_active && !prev_itr->second->active) + { + if(addSpell(prev_id,true,false,prev_itr->second->dependent,prev_itr->second->disabled)) + { + if(update_action_bar_for_low_rank) + { + // downgrade spell ranks in spellbook and action bar + WorldPacket data(SMSG_SUPERCEDED_SPELL, (4)); + data << uint16(spell_id); + data << uint16(prev_id); + GetSession()->SendPacket( &data ); + prev_activate = true; + } + } + } + } + } + } + + // remove from spell book if not replaced by lesser rank + if(!prev_activate) + { + WorldPacket data(SMSG_REMOVED_SPELL, 4); + data << uint16(spell_id); + GetSession()->SendPacket(&data); + } } void Player::RemoveArenaSpellCooldowns() @@ -3088,13 +3271,13 @@ void Player::RemoveArenaSpellCooldowns() SpellEntry const * entry = sSpellStore.LookupEntry(itr->first); // check if spellentry is present and if the cooldown is less than 15 mins if( entry && - entry->RecoveryTime <= 15 * MINUTE * 1000 && - entry->CategoryRecoveryTime <= 15 * MINUTE * 1000 ) + entry->RecoveryTime <= 15 * MINUTE * IN_MILISECONDS && + entry->CategoryRecoveryTime <= 15 * MINUTE * IN_MILISECONDS ) { // notify player WorldPacket data(SMSG_CLEAR_COOLDOWN, (4+8)); data << uint32(itr->first); - data << GetGUID(); + data << uint64(GetGUID()); GetSession()->SendPacket(&data); // remove cooldown m_spellCooldowns.erase(itr); @@ -3119,7 +3302,7 @@ void Player::RemoveAllSpellCooldown() void Player::_LoadSpellCooldowns(QueryResult *result) { - m_spellCooldowns.clear(); + // some cooldowns can be already set at aura loading... //QueryResult *result = CharacterDatabase.PQuery("SELECT spell,item,time FROM character_spell_cooldown WHERE guid = '%u'",GetGUIDLow()); @@ -3160,17 +3343,20 @@ void Player::_SaveSpellCooldowns() CharacterDatabase.PExecute("DELETE FROM character_spell_cooldown WHERE guid = '%u'", GetGUIDLow()); time_t curTime = time(NULL); + time_t infTime = curTime + MONTH/2; // remove outdated and save active for(SpellCooldowns::iterator itr = m_spellCooldowns.begin();itr != m_spellCooldowns.end();) { if(itr->second.end <= curTime) m_spellCooldowns.erase(itr++); - else + else if(itr->second.end <= infTime) // not save locked cooldowns, it will be reset or set at reload { CharacterDatabase.PExecute("INSERT INTO character_spell_cooldown (guid,spell,item,time) VALUES ('%u', '%u', '%u', '" I64FMTD "')", GetGUIDLow(), itr->first, itr->second.itemid, uint64(itr->second.end)); ++itr; } + else + ++itr; } } @@ -3216,8 +3402,7 @@ bool Player::resetTalents(bool no_cost) CharacterDatabase.PExecute("UPDATE characters set at_login = at_login & ~ %u WHERE guid ='%u'", uint32(AT_LOGIN_RESET_TALENTS), GetGUIDLow()); } - uint32 level = getLevel(); - uint32 talentPointsForLevel = level < 10 ? 0 : uint32((level-9)*sWorld.getRate(RATE_TALENT)); + uint32 talentPointsForLevel = CalculateTalentsPoints(); if (m_usedTalentCount == 0) { @@ -3255,7 +3440,7 @@ bool Player::resetTalents(bool no_cost) if( (getClassMask() & talentTabInfo->ClassMask) == 0 ) continue; - for (int j = 0; j < 5; j++) + for (int j = 0; j < MAX_TALENT_RANK; j++) { for(PlayerSpellMap::iterator itr = GetSpellMap().begin(); itr != GetSpellMap().end();) { @@ -3286,6 +3471,7 @@ bool Player::resetTalents(bool no_cost) if(!no_cost) { ModifyMoney(-(int32)cost); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GOLD_SPENT_FOR_TALENTS, cost); m_resetTalentsCost = cost; m_resetTalentsTime = time(NULL); @@ -3294,19 +3480,14 @@ bool Player::resetTalents(bool no_cost) //FIXME: remove pet before or after unlearn spells? for now after unlearn to allow removing of talent related, pet affecting auras RemovePet(NULL,PET_SAVE_NOT_IN_SLOT, true); - return true; -} - -bool Player::_removeSpell(uint16 spell_id) -{ - PlayerSpellMap::iterator itr = m_spells.find(spell_id); - if (itr != m_spells.end()) + if(m_canTitanGrip) { - delete itr->second; - m_spells.erase(itr); - return true; + m_canTitanGrip = false; + if(sWorld.getConfig(CONFIG_OFFHAND_CHECK_AT_TALENTS_RESET)) + AutoUnequipOffhandIfNeed(); } - return false; + + return true; } Mail* Player::GetMail(uint32 id) @@ -3354,50 +3535,46 @@ void Player::InitVisibleBits() { updateVisualBits.SetCount(PLAYER_END); - // TODO: really implement OWNER_ONLY and GROUP_ONLY. Flags can be found in UpdateFields.h - updateVisualBits.SetBit(OBJECT_FIELD_GUID); updateVisualBits.SetBit(OBJECT_FIELD_TYPE); + updateVisualBits.SetBit(OBJECT_FIELD_ENTRY); updateVisualBits.SetBit(OBJECT_FIELD_SCALE_X); - - updateVisualBits.SetBit(UNIT_FIELD_CHARM); - updateVisualBits.SetBit(UNIT_FIELD_CHARM+1); - - updateVisualBits.SetBit(UNIT_FIELD_SUMMON); - updateVisualBits.SetBit(UNIT_FIELD_SUMMON+1); - - updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY); - updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY+1); - - updateVisualBits.SetBit(UNIT_FIELD_TARGET); - updateVisualBits.SetBit(UNIT_FIELD_TARGET+1); - - updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT); - updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT+1); - + updateVisualBits.SetBit(UNIT_FIELD_CHARM + 0); + updateVisualBits.SetBit(UNIT_FIELD_CHARM + 1); + updateVisualBits.SetBit(UNIT_FIELD_SUMMON + 0); + updateVisualBits.SetBit(UNIT_FIELD_SUMMON + 1); + updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY + 0); + updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY + 1); + updateVisualBits.SetBit(UNIT_FIELD_TARGET + 0); + updateVisualBits.SetBit(UNIT_FIELD_TARGET + 1); + updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT + 0); + updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT + 1); + updateVisualBits.SetBit(UNIT_FIELD_BYTES_0); updateVisualBits.SetBit(UNIT_FIELD_HEALTH); updateVisualBits.SetBit(UNIT_FIELD_POWER1); updateVisualBits.SetBit(UNIT_FIELD_POWER2); updateVisualBits.SetBit(UNIT_FIELD_POWER3); updateVisualBits.SetBit(UNIT_FIELD_POWER4); updateVisualBits.SetBit(UNIT_FIELD_POWER5); - + updateVisualBits.SetBit(UNIT_FIELD_POWER6); + updateVisualBits.SetBit(UNIT_FIELD_POWER7); updateVisualBits.SetBit(UNIT_FIELD_MAXHEALTH); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER1); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER2); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER3); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER4); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER5); - + updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER6); + updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER7); updateVisualBits.SetBit(UNIT_FIELD_LEVEL); updateVisualBits.SetBit(UNIT_FIELD_FACTIONTEMPLATE); - updateVisualBits.SetBit(UNIT_FIELD_BYTES_0); + updateVisualBits.SetBit(UNIT_VIRTUAL_ITEM_SLOT_ID + 0); + updateVisualBits.SetBit(UNIT_VIRTUAL_ITEM_SLOT_ID + 1); + updateVisualBits.SetBit(UNIT_VIRTUAL_ITEM_SLOT_ID + 2); updateVisualBits.SetBit(UNIT_FIELD_FLAGS); updateVisualBits.SetBit(UNIT_FIELD_FLAGS_2); - for(uint16 i = UNIT_FIELD_AURA; i < UNIT_FIELD_AURASTATE; ++i) - updateVisualBits.SetBit(i); updateVisualBits.SetBit(UNIT_FIELD_AURASTATE); - updateVisualBits.SetBit(UNIT_FIELD_BASEATTACKTIME); + updateVisualBits.SetBit(UNIT_FIELD_BASEATTACKTIME + 0); updateVisualBits.SetBit(UNIT_FIELD_BASEATTACKTIME + 1); updateVisualBits.SetBit(UNIT_FIELD_BOUNDINGRADIUS); updateVisualBits.SetBit(UNIT_FIELD_COMBATREACH); @@ -3410,10 +3587,12 @@ void Player::InitVisibleBits() updateVisualBits.SetBit(UNIT_DYNAMIC_FLAGS); updateVisualBits.SetBit(UNIT_CHANNEL_SPELL); updateVisualBits.SetBit(UNIT_MOD_CAST_SPEED); + updateVisualBits.SetBit(UNIT_FIELD_BASE_MANA); updateVisualBits.SetBit(UNIT_FIELD_BYTES_2); + updateVisualBits.SetBit(UNIT_FIELD_HOVERHEIGHT); - updateVisualBits.SetBit(PLAYER_DUEL_ARBITER); - updateVisualBits.SetBit(PLAYER_DUEL_ARBITER+1); + updateVisualBits.SetBit(PLAYER_DUEL_ARBITER + 0); + updateVisualBits.SetBit(PLAYER_DUEL_ARBITER + 1); updateVisualBits.SetBit(PLAYER_FLAGS); updateVisualBits.SetBit(PLAYER_GUILDID); updateVisualBits.SetBit(PLAYER_GUILDRANK); @@ -3424,29 +3603,29 @@ void Player::InitVisibleBits() updateVisualBits.SetBit(PLAYER_GUILD_TIMESTAMP); // PLAYER_QUEST_LOG_x also visible bit on official (but only on party/raid)... - for(uint16 i = PLAYER_QUEST_LOG_1_1; i < PLAYER_QUEST_LOG_25_2; i+=4) + for(uint16 i = PLAYER_QUEST_LOG_1_1; i < PLAYER_QUEST_LOG_25_2; i += 4) updateVisualBits.SetBit(i); - //Players visible items are not inventory stuff - //431) = 884 (0x374) = main weapon - for(uint16 i = 0; i < EQUIPMENT_SLOT_END; i++) + // Players visible items are not inventory stuff + for(uint16 i = 0; i < EQUIPMENT_SLOT_END; ++i) { - // item creator - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_CREATOR + (i*MAX_VISIBLE_ITEM_OFFSET) + 0); - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_CREATOR + (i*MAX_VISIBLE_ITEM_OFFSET) + 1); + uint32 offset = i * MAX_VISIBLE_ITEM_OFFSET; - uint16 visual_base = PLAYER_VISIBLE_ITEM_1_0 + (i*MAX_VISIBLE_ITEM_OFFSET); + // item creator + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_CREATOR + 0 + offset); + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_CREATOR + 1 + offset); // item entry - updateVisualBits.SetBit(visual_base + 0); + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_0 + 0 + offset); - // item enchantment IDs - for(uint8 j = 0; j < MAX_INSPECTED_ENCHANTMENT_SLOT; ++j) - updateVisualBits.SetBit(visual_base + 1 + j); + // item enchantments + for(uint8 j = 0; j < MAX_ENCHANTMENT_SLOT; ++j) + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_0 + 1 + j + offset); // random properties - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 0 + (i*MAX_VISIBLE_ITEM_OFFSET)); - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 1 + (i*MAX_VISIBLE_ITEM_OFFSET)); + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_PROPERTIES + offset); + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_SEED + offset); + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_PAD + offset); } updateVisualBits.SetBit(PLAYER_CHOSEN_TITLE); @@ -3464,7 +3643,6 @@ void Player::BuildCreateUpdateBlockForPlayer( UpdateData *data, Player *target ) if(target == this) { - for(int i = INVENTORY_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { if(m_items[i] == NULL) @@ -3472,7 +3650,7 @@ void Player::BuildCreateUpdateBlockForPlayer( UpdateData *data, Player *target ) m_items[i]->BuildCreateUpdateBlockForPlayer( data, target ); } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { if(m_items[i] == NULL) continue; @@ -3505,7 +3683,7 @@ void Player::DestroyForPlayer( Player *target ) const m_items[i]->DestroyForPlayer( target ); } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { if(m_items[i] == NULL) continue; @@ -3517,8 +3695,16 @@ void Player::DestroyForPlayer( Player *target ) const bool Player::HasSpell(uint32 spell) const { - PlayerSpellMap::const_iterator itr = m_spells.find((uint16)spell); - return (itr != m_spells.end() && itr->second->state != PLAYERSPELL_REMOVED && !itr->second->disabled); + PlayerSpellMap::const_iterator itr = m_spells.find(spell); + return (itr != m_spells.end() && itr->second->state != PLAYERSPELL_REMOVED && + !itr->second->disabled); +} + +bool Player::HasActiveSpell(uint32 spell) const +{ + PlayerSpellMap::const_iterator itr = m_spells.find(spell); + return (itr != m_spells.end() && itr->second->state != PLAYERSPELL_REMOVED && + itr->second->active && !itr->second->disabled); } TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell) const @@ -3526,22 +3712,22 @@ TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell if (!trainer_spell) return TRAINER_SPELL_RED; - if (!trainer_spell->spell) + if (!trainer_spell->learnedSpell) return TRAINER_SPELL_RED; // known spell - if(HasSpell(trainer_spell->spell)) + if(HasSpell(trainer_spell->learnedSpell)) return TRAINER_SPELL_GRAY; // check race/class requirement - if(!IsSpellFitByClassAndRace(trainer_spell->spell)) + if(!IsSpellFitByClassAndRace(trainer_spell->learnedSpell)) return TRAINER_SPELL_RED; // check level requirement - if(getLevel() < trainer_spell->reqlevel) + if(getLevel() < trainer_spell->reqLevel) return TRAINER_SPELL_RED; - if(SpellChainNode const* spell_chain = spellmgr.GetSpellChainNode(trainer_spell->spell)) + if(SpellChainNode const* spell_chain = spellmgr.GetSpellChainNode(trainer_spell->learnedSpell)) { // check prev.rank requirement if(spell_chain->prev && !HasSpell(spell_chain->prev)) @@ -3556,11 +3742,11 @@ TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell } // check skill requirement - if(trainer_spell->reqskill && GetBaseSkillValue(trainer_spell->reqskill) < trainer_spell->reqskillvalue) + if(trainer_spell->reqSkill && GetBaseSkillValue(trainer_spell->reqSkill) < trainer_spell->reqSkillValue) return TRAINER_SPELL_RED; // exist, already checked at loading - SpellEntry const* spell = sSpellStore.LookupEntry(trainer_spell->spell); + SpellEntry const* spell = sSpellStore.LookupEntry(trainer_spell->learnedSpell); // secondary prof. or not prof. spell uint32 skill = spell->EffectMiscValue[1]; @@ -3593,27 +3779,7 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC } // remove from arena teams - uint32 at_id = GetArenaTeamIdFromDB(playerguid,ARENA_TEAM_2v2); - if(at_id != 0) - { - ArenaTeam * at = objmgr.GetArenaTeamById(at_id); - if(at) - at->DelMember(playerguid); - } - at_id = GetArenaTeamIdFromDB(playerguid,ARENA_TEAM_3v3); - if(at_id != 0) - { - ArenaTeam * at = objmgr.GetArenaTeamById(at_id); - if(at) - at->DelMember(playerguid); - } - at_id = GetArenaTeamIdFromDB(playerguid,ARENA_TEAM_5v5); - if(at_id != 0) - { - ArenaTeam * at = objmgr.GetArenaTeamById(at_id); - if(at) - at->DelMember(playerguid); - } + LeaveAllArenaTeams(playerguid); // the player was uninvited already on logout so just remove from group QueryResult *resultGroup = CharacterDatabase.PQuery("SELECT leaderGuid FROM group_member WHERE memberGuid='%u'", guid); @@ -3654,15 +3820,16 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC MailItemsInfo mi; if(has_items) { - QueryResult *resultItems = CharacterDatabase.PQuery("SELECT item_guid,item_template FROM mail_items WHERE mail_id='%u'", mail_id); + // data needs to be at first place for Item::LoadFromDB + QueryResult *resultItems = CharacterDatabase.PQuery("SELECT data,item_guid,item_template FROM mail_items JOIN item_instance ON item_guid = guid WHERE mail_id='%u'", mail_id); if(resultItems) { do { Field *fields2 = resultItems->Fetch(); - uint32 item_guidlow = fields2[0].GetUInt32(); - uint32 item_template = fields2[1].GetUInt32(); + uint32 item_guidlow = fields2[1].GetUInt32(); + uint32 item_template = fields2[2].GetUInt32(); ItemPrototype const* itemProto = objmgr.GetItemPrototype(item_template); if(!itemProto) @@ -3672,7 +3839,7 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC } Item *pItem = NewItemOrBag(itemProto); - if(!pItem->LoadFromDB(item_guidlow, MAKE_NEW_GUID(guid, 0, HIGHGUID_PLAYER))) + if(!pItem->LoadFromDB(item_guidlow, MAKE_NEW_GUID(guid, 0, HIGHGUID_PLAYER),resultItems)) { pItem->FSetState(ITEM_REMOVED); pItem->SaveToDB(); // it also deletes item object ! @@ -3735,6 +3902,8 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC CharacterDatabase.PExecute("DELETE FROM mail_items WHERE receiver = '%u'",guid); CharacterDatabase.PExecute("DELETE FROM character_pet WHERE owner = '%u'",guid); CharacterDatabase.PExecute("DELETE FROM character_pet_declinedname WHERE owner = '%u'",guid); + CharacterDatabase.PExecute("DELETE FROM character_achievement WHERE guid = '%u'",guid); + CharacterDatabase.PExecute("DELETE FROM character_achievement_progress WHERE guid = '%u'",guid); CharacterDatabase.CommitTransaction(); //LoginDatabase.PExecute("UPDATE realmcharacters SET numchars = numchars - 1 WHERE acctid = %d AND realmid = %d", accountId, realmID); @@ -3765,6 +3934,10 @@ void Player::SetMovement(PlayerMovementType pType) */ void Player::BuildPlayerRepop() { + WorldPacket data(SMSG_PRE_RESURRECT, GetPackGUID().size()); + data.append(GetPackGUID()); + GetSession()->SendPacket(&data); + if(getRace() == RACE_NIGHTELF) CastSpell(this, 20584, true); // auras SPELL_AURA_INCREASE_SPEED(+speed in wisp form), SPELL_AURA_INCREASE_SWIM_SPEED(+swim speed in wisp form), SPELL_AURA_TRANSFORM (to wisp form) CastSpell(this, 8326, true); // auras SPELL_AURA_GHOST, SPELL_AURA_INCREASE_SPEED(why?), SPELL_AURA_INCREASE_SWIM_SPEED(why?) @@ -3809,7 +3982,8 @@ void Player::BuildPlayerRepop() SetFloatValue(UNIT_FIELD_BOUNDINGRADIUS, (float)1.0); //see radius of death player? - SetByteValue(UNIT_FIELD_BYTES_1, 3, PLAYER_STATE_FLAG_ALWAYS_STAND); + // set and clear other + SetByteValue(UNIT_FIELD_BYTES_1, 3, UNIT_BYTE1_FLAG_ALWAYS_STAND); } void Player::SendDelayResponse(const uint32 ml_seconds) @@ -3854,13 +4028,15 @@ void Player::ResurrectPlayer(float restore_percent, bool applySickness) SetPower(POWER_ENERGY, uint32(GetMaxPower(POWER_ENERGY)*restore_percent)); } + // trigger update zone for alive state zone updates + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + UpdateZone(newzone,newarea); + // update visibility //ObjectAccessor::UpdateVisibilityForPlayer(this); SetToNotify(); - // some items limited to specific map - DestroyZoneLimitedItem( true, GetZoneId()); - if(!applySickness) return; @@ -3884,8 +4060,7 @@ void Player::ResurrectPlayer(float restore_percent, bool applySickness) { if(Aura* Aur = GetAura(SPELL_ID_PASSIVE_RESURRECTION_SICKNESS,i)) { - Aur->SetAuraDuration(delta*1000); - Aur->UpdateAuraDuration(); + Aur->SetAuraDurationAndUpdate(delta*IN_MILISECONDS); } } } @@ -3905,7 +4080,7 @@ void Player::KillPlayer() ApplyModFlag(PLAYER_FIELD_BYTES, PLAYER_FIELD_BYTE_RELEASE_TIMER, !sMapStore.LookupEntry(GetMapId())->Instanceable()); // 6 minutes until repop at graveyard - m_deathTimer = 6*MINUTE*1000; + m_deathTimer = 6*MINUTE*IN_MILISECONDS; UpdateCorpseReclaimDelay(); // dependent at use SetDeathPvP() call before kill SendCorpseReclaimDelay(); @@ -3926,8 +4101,7 @@ void Player::CreateCorpse() Corpse *corpse = new Corpse( (m_ExtraFlags & PLAYER_EXTRA_PVP_DEATH) ? CORPSE_RESURRECTABLE_PVP : CORPSE_RESURRECTABLE_PVE ); SetPvPDeath(false); - if(!corpse->Create(objmgr.GenerateLowGuid(HIGHGUID_CORPSE), this, GetMapId(), GetPositionX(), - GetPositionY(), GetPositionZ(), GetOrientation())) + if(!corpse->Create(objmgr.GenerateLowGuid(HIGHGUID_CORPSE), this)) { delete corpse; return; @@ -3955,7 +4129,7 @@ void Player::CreateCorpse() flags |= CORPSE_FLAG_HIDE_HELM; if(HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_HIDE_CLOAK)) flags |= CORPSE_FLAG_HIDE_CLOAK; - if(InBattleGround()) + if(InBattleGround() && !InArena()) flags |= CORPSE_FLAG_LOOTABLE; // to be able to remove insignia corpse->SetUInt32Value( CORPSE_FIELD_FLAGS, flags ); @@ -4142,7 +4316,7 @@ uint32 Player::DurabilityRepair(uint16 pos, bool cost, float discountMod, bool g DurabilityCostsEntry const *dcost = sDurabilityCostsStore.LookupEntry(ditemProto->ItemLevel); if(!dcost) { - sLog.outError("ERROR: RepairDurability: Wrong item lvl %u", ditemProto->ItemLevel); + sLog.outError("RepairDurability: Wrong item lvl %u", ditemProto->ItemLevel); return TotalCost; } @@ -4150,7 +4324,7 @@ uint32 Player::DurabilityRepair(uint16 pos, bool cost, float discountMod, bool g DurabilityQualityEntry const *dQualitymodEntry = sDurabilityQualityStore.LookupEntry(dQualitymodEntryId); if(!dQualitymodEntry) { - sLog.outError("ERROR: RepairDurability: Wrong dQualityModEntry %u", dQualitymodEntryId); + sLog.outError("RepairDurability: Wrong dQualityModEntry %u", dQualitymodEntryId); return TotalCost; } @@ -4231,10 +4405,8 @@ void Player::RepopAtGraveyard() WorldSafeLocsEntry const *ClosestGrave = NULL; // Special handle for battleground maps - BattleGround *bg = sBattleGroundMgr.GetBattleGround(GetBattleGroundId()); - - if(bg && (bg->GetTypeID() == BATTLEGROUND_AB || bg->GetTypeID() == BATTLEGROUND_EY || bg->GetTypeID() == BATTLEGROUND_AV)) - ClosestGrave = bg->GetClosestGraveYard(GetPositionX(), GetPositionY(), GetPositionZ(), GetTeam()); + if( BattleGround *bg = GetBattleGround() ) + ClosestGrave = bg->GetClosestGraveYard(this); else ClosestGrave = objmgr.GetClosestGraveYard( GetPositionX(), GetPositionY(), GetPositionZ(), GetMapId(), GetTeam() ); @@ -4395,7 +4567,7 @@ float Player::GetBaseModValue(BaseModGroup modGroup, BaseModType modType) const { if(modGroup >= BASEMOD_END || modType > MOD_END) { - sLog.outError("ERROR: trial to access non existed BaseModGroup or wrong BaseModType!"); + sLog.outError("trial to access non existed BaseModGroup or wrong BaseModType!"); return 0.0f; } @@ -4409,7 +4581,7 @@ float Player::GetTotalBaseModValue(BaseModGroup modGroup) const { if(modGroup >= BASEMOD_END) { - sLog.outError("ERROR: wrong BaseModGroup in GetTotalBaseModValue()!"); + sLog.outError("wrong BaseModGroup in GetTotalBaseModValue()!"); return 0.0f; } @@ -4423,7 +4595,7 @@ uint32 Player::GetShieldBlockValue() const { BaseModGroup modGroup = SHIELD_BLOCK_VALUE; - float value = GetTotalBaseModValue(modGroup) + GetStat(STAT_STRENGTH)/20 - 1; + float value = GetTotalBaseModValue(modGroup) + GetStat(STAT_STRENGTH) * 0.5f - 10; value = (value < 0) ? 0 : value; @@ -4612,7 +4784,18 @@ float Player::OCTRegenMPPerSpirit() void Player::ApplyRatingMod(CombatRating cr, int32 value, bool apply) { - ApplyModUInt32Value(PLAYER_FIELD_COMBAT_RATING_1 + cr, value, apply); + m_baseRatingValue[cr]+=(apply ? value : -value); + + int32 amount = uint32(m_baseRatingValue[cr]); + // Apply bonus from SPELL_AURA_MOD_RATING_FROM_STAT + // stat used stored in miscValueB for this aura + AuraList const& modRatingFromStat = GetAurasByType(SPELL_AURA_MOD_RATING_FROM_STAT); + for(AuraList::const_iterator i = modRatingFromStat.begin();i != modRatingFromStat.end(); ++i) + if ((*i)->GetMiscValue() & (1<<cr)) + amount += int32(GetStat(Stats((*i)->GetMiscBValue())) * (*i)->GetModifier()->m_amount / 100.0f); + if (amount < 0) + amount = 0; + SetUInt32Value(PLAYER_FIELD_COMBAT_RATING_1 + cr, uint32(amount)); float RatingCoeffecient = GetRatingCoefficient(cr); float RatingChange = 0.0f; @@ -4635,16 +4818,13 @@ void Player::ApplyRatingMod(CombatRating cr, int32 value, bool apply) UpdateBlockPercentage(); break; case CR_HIT_MELEE: - RatingChange = value / RatingCoeffecient; - m_modMeleeHitChance += apply ? RatingChange : -RatingChange; + UpdateMeleeHitChances(); break; case CR_HIT_RANGED: - RatingChange = value / RatingCoeffecient; - m_modRangedHitChance += apply ? RatingChange : -RatingChange; + UpdateRangedHitChances(); break; case CR_HIT_SPELL: - RatingChange = value / RatingCoeffecient; - m_modSpellHitChance += apply ? RatingChange : -RatingChange; + UpdateSpellHitChances(); break; case CR_CRIT_MELEE: if(affectStats) @@ -4742,6 +4922,7 @@ bool Player::UpdateSkill(uint32 skill_id, uint32 step) new_value = max; SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(new_value,max)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL); return true; } @@ -4777,7 +4958,7 @@ bool Player::UpdateCraftSkill(uint32 spellid) if(spellEntry && spellEntry->Mechanic==MECHANIC_DISCOVERY) { if(uint32 discoveredSpell = GetSkillDiscoverySpell(_spell_idx->second->skillId, spellid, this)) - learnSpell(discoveredSpell); + learnSpell(discoveredSpell,false); } uint32 craft_skill_gain = sWorld.getConfig(CONFIG_SKILL_GAIN_CRAFTING); @@ -4804,6 +4985,7 @@ bool Player::UpdateGatherSkill(uint32 SkillId, uint32 SkillValue, uint32 RedLeve case SKILL_HERBALISM: case SKILL_LOCKPICKING: case SKILL_JEWELCRAFTING: + case SKILL_INSCRIPTION: return UpdateSkillPro(SkillId, SkillGainChance(SkillValue, RedLevel+100, RedLevel+50, RedLevel+25)*Multiplicator,gathering_skill_gain); case SKILL_SKINNING: if( sWorld.getConfig(CONFIG_SKILL_CHANCE_SKINNING_STEPS)==0) @@ -4832,6 +5014,11 @@ bool Player::UpdateFishingSkill() return UpdateSkillPro(SKILL_FISHING,chance*10,gathering_skill_gain); } +// levels sync. with spell requirement for skill levels to learn +// bonus abilities in sSkillLineAbilityStore +// Used only to avoid scan DBC at each skill grow +static uint32 bonusSkillLevels[] = {75,150,225,300,375,450}; + bool Player::UpdateSkillPro(uint16 SkillId, int32 Chance, uint32 step) { sLog.outDebug("UpdateSkillPro(SkillId %d, Chance %3.1f%%)", SkillId, Chance/10.0); @@ -4866,6 +5053,15 @@ bool Player::UpdateSkillPro(uint16 SkillId, int32 Chance, uint32 step) new_value = MaxValue; SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(new_value,MaxValue)); + for(uint32* bsl = &bonusSkillLevels[0]; *bsl; ++bsl) + { + if((SkillValue < *bsl && new_value >= *bsl)) + { + learnSkillRewardedSpells( SkillId, new_value); + break; + } + } + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL); sLog.outDebug("Player::UpdateSkillPro Chance=%3.1f%% taken", Chance/10.0); return true; } @@ -4913,22 +5109,8 @@ void Player::UpdateWeaponSkill (WeaponAttackType attType) UpdateAllCritPercentages(); } -void Player::UpdateCombatSkills(Unit *pVictim, WeaponAttackType attType, MeleeHitOutcome outcome, bool defence) +void Player::UpdateCombatSkills(Unit *pVictim, WeaponAttackType attType, bool defence) { -/* Not need, this checked on call this func from trigger system - switch(outcome) - { - case MELEE_HIT_CRIT: - case MELEE_HIT_DODGE: - case MELEE_HIT_PARRY: - case MELEE_HIT_BLOCK: - case MELEE_HIT_BLOCK_CRIT: - return; - - default: - break; - } -*/ uint32 plevel = getLevel(); // if defense than pVictim == attacker uint32 greylevel = Trinity::XP::GetGrayLevel(plevel); uint32 moblevel = pVictim->getLevelForTarget(this); @@ -5025,7 +5207,7 @@ void Player::UpdateSkillsToMaxSkillsForLevel() if (GetUInt32Value(PLAYER_SKILL_INDEX(i))) { uint32 pskill = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; - if( IsProfessionSkill(pskill) || pskill == SKILL_RIDING ) + if( IsProfessionOrRidingSkill(pskill)) continue; uint32 data = GetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i)); @@ -5053,7 +5235,11 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) if(i<PLAYER_MAX_SKILLS) //has skill { if(currVal) + { SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(currVal,maxVal)); + learnSkillRewardedSpells(id, currVal); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL); + } else //remove { // clear skill fields @@ -5061,27 +5247,11 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),0); SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); - // remove spells that depend on this skill when removing the skill - for (PlayerSpellMap::const_iterator itr = m_spells.begin(), next = m_spells.begin(); itr != m_spells.end(); itr = next) - { - ++next; - if(itr->second->state == PLAYERSPELL_REMOVED) - continue; - - SkillLineAbilityMap::const_iterator lower = spellmgr.GetBeginSkillLineAbilityMap(itr->first); - SkillLineAbilityMap::const_iterator upper = spellmgr.GetEndSkillLineAbilityMap(itr->first); - - for(SkillLineAbilityMap::const_iterator _spell_idx = lower; _spell_idx != upper; ++_spell_idx) - { - if (_spell_idx->second->skillId == id) - { - // this may remove more than one spell (dependents) - removeSpell(itr->first); - next = m_spells.begin(); - break; - } - } - } + // remove all spells that related to this skill + for (uint32 j=0; j<sSkillLineAbilityStore.GetNumRows(); ++j) + if(SkillLineAbilityEntry const *pAbility = sSkillLineAbilityStore.LookupEntry(j)) + if (pAbility->skillId==id) + removeSpell(spellmgr.GetFirstSpellInChain(pAbility->spellId)); } } else if(currVal) //add @@ -5101,6 +5271,7 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) else SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,0)); SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(currVal,maxVal)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL); // apply skill bonuses SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); @@ -5118,7 +5289,7 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) (*i)->ApplyModifier(true); // Learn all spells for skill - learnSkillRewardedSpells(id); + learnSkillRewardedSpells(id, currVal); return; } } @@ -5216,6 +5387,22 @@ uint16 Player::GetPureSkillValue(uint32 skill) const return 0; } +int16 Player::GetSkillPermBonusValue(uint32 skill) const +{ + if(!skill) + return 0; + + for (int i = 0; i < PLAYER_MAX_SKILLS; i++) + { + if ((GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF) == skill) + { + return SKILL_PERM_BONUS(GetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i))); + } + } + + return 0; +} + int16 Player::GetSkillTempBonusValue(uint32 skill) const { if(!skill) @@ -5256,12 +5443,12 @@ void Player::SendInitialActionButtons() sLog.outDetail( "Action Buttons for '%u' Initialized", GetGUIDLow() ); } -void Player::addActionButton(const uint8 button, const uint16 action, const uint8 type, const uint8 misc) +bool Player::addActionButton(const uint8 button, const uint16 action, const uint8 type, const uint8 misc) { if(button >= MAX_ACTION_BUTTONS) { sLog.outError( "Action %u not added into button %u for player %s: button must be < 132", action, button, GetName() ); - return; + return false; } // check cheating with adding non-known spells to action bar @@ -5270,13 +5457,13 @@ void Player::addActionButton(const uint8 button, const uint16 action, const uint if(!sSpellStore.LookupEntry(action)) { sLog.outError( "Action %u not added into button %u for player %s: spell not exist", action, button, GetName() ); - return; + return false; } if(!HasSpell(action)) { sLog.outError( "Action %u not added into button %u for player %s: player don't known this spell", action, button, GetName() ); - return; + return false; } } @@ -5294,6 +5481,7 @@ void Player::addActionButton(const uint8 button, const uint16 action, const uint }; sLog.outDetail( "Player '%u' Added Action '%u' to Button '%u'", GetGUIDLow(), action, button ); + return true; } void Player::removeActionButton(uint8 button) @@ -5371,17 +5559,17 @@ void Player::SaveRecallPosition() void Player::SendMessageToSet(WorldPacket *data, bool self, bool to_possessor) { - MapManager::Instance().GetMap(GetMapId(), this)->MessageBroadcast(this, data, self, to_possessor); + GetMap()->MessageBroadcast(this, data, self, to_possessor); } void Player::SendMessageToSetInRange(WorldPacket *data, float dist, bool self, bool to_possessor) { - MapManager::Instance().GetMap(GetMapId(), this)->MessageDistBroadcast(this, data, dist, self, to_possessor); + GetMap()->MessageDistBroadcast(this, data, dist, self, to_possessor); } void Player::SendMessageToSetInRange(WorldPacket *data, float dist, bool self, bool to_possessor, bool own_team_only) { - MapManager::Instance().GetMap(GetMapId(), this)->MessageDistBroadcast(this, data, dist, self, to_possessor, own_team_only); + GetMap()->MessageDistBroadcast(this, data, dist, self, to_possessor, own_team_only); } void Player::SendDirectMessage(WorldPacket *data) @@ -5397,14 +5585,14 @@ void Player::CheckExploreSystem() if (isInFlight()) return; - uint16 areaFlag=MapManager::Instance().GetBaseMap(GetMapId())->GetAreaFlag(GetPositionX(),GetPositionY()); + uint16 areaFlag=MapManager::Instance().GetBaseMap(GetMapId())->GetAreaFlag(GetPositionX(),GetPositionY(),GetPositionZ()); if(areaFlag==0xffff) return; int offset = areaFlag / 32; if(offset >= 128) { - sLog.outError("ERROR: Wrong area flag %u in map data for (X: %f Y: %f) point to field PLAYER_EXPLORED_ZONES_1 + %u ( %u must be < 64 ).",areaFlag,GetPositionX(),GetPositionY(),offset,offset); + sLog.outError("Wrong area flag %u in map data for (X: %f Y: %f) point to field PLAYER_EXPLORED_ZONES_1 + %u ( %u must be < 128 ).",areaFlag,GetPositionX(),GetPositionY(),offset,offset); return; } @@ -5415,6 +5603,8 @@ void Player::CheckExploreSystem() { SetUInt32Value(PLAYER_EXPLORED_ZONES_1 + offset, (uint32)(currFields | val)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_EXPLORE_AREA); + AreaTableEntry const *p = GetAreaEntryByAreaFlagAndMap(areaFlag,GetMapId()); if(!p) { @@ -5511,6 +5701,7 @@ void Player::SendFactionState(FactionState const* faction) const { WorldPacket data(SMSG_SET_FACTION_STANDING, (16)); // last check 2.4.0 data << (float) 0; // unk 2.4.0 + data << (uint8) 0; // wotlk 8634 data << (uint32) 1; // count // for data << (uint32) faction->ReputationListID; @@ -5605,7 +5796,8 @@ void Player::SetFactionVisibleForFactionTemplateId(uint32 FactionTemplateId) if(!factionTemplateEntry) return; - SetFactionVisibleForFactionId(factionTemplateEntry->faction); + if(factionTemplateEntry->faction) + SetFactionVisibleForFactionId(factionTemplateEntry->faction); } void Player::SetFactionVisibleForFactionId(uint32 FactionId) @@ -5820,7 +6012,7 @@ bool Player::ModifyOneFactionReputation(FactionEntry const* factionEntry, int32 SetFactionVisible(&itr->second); - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { if(uint32 questid = GetQuestSlotQuestId(i)) { @@ -5842,7 +6034,8 @@ bool Player::ModifyOneFactionReputation(FactionEntry const* factionEntry, int32 } } } - + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GAIN_REPUTATION,factionEntry->ID); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GAIN_EXALTED_REPUTATION,factionEntry->ID); SendFactionState(&(itr->second)); return true; @@ -5908,6 +6101,8 @@ bool Player::SetOneFactionReputation(FactionEntry const* factionEntry, int32 sta SetFactionAtWar(&itr->second,true); SendFactionState(&(itr->second)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GAIN_REPUTATION,factionEntry->ID); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GAIN_EXALTED_REPUTATION,factionEntry->ID); return true; } return false; @@ -5916,12 +6111,9 @@ bool Player::SetOneFactionReputation(FactionEntry const* factionEntry, int32 sta //Calculate total reputation percent player gain with quest/creature level int32 Player::CalculateReputationGain(uint32 creatureOrQuestLevel, int32 rep, bool for_quest) { - // for grey creature kill received 20%, in other case 100. - int32 percent = (!for_quest && (creatureOrQuestLevel <= Trinity::XP::GetGrayLevel(getLevel()))) ? 20 : 100; - int32 repMod = GetTotalAuraModifier(SPELL_AURA_MOD_REPUTATION_GAIN); - percent += rep > 0 ? repMod : -repMod; + int32 percent = rep > 0 ? repMod : -repMod; if(percent <=0) return 0; @@ -5985,7 +6177,7 @@ void Player::RewardReputation(Quest const *pQuest) { if(pQuest->RewRepFaction[i] && pQuest->RewRepValue[i] ) { - int32 rep = CalculateReputationGain(pQuest->GetQuestLevel(),pQuest->RewRepValue[i],true); + int32 rep = CalculateReputationGain(GetQuestLevel(pQuest),pQuest->RewRepValue[i],true); FactionEntry const* factionEntry = sFactionStore.LookupEntry(pQuest->RewRepFaction[i]); if(factionEntry) ModifyFactionReputation(factionEntry, rep); @@ -6106,12 +6298,7 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt victim_guid = 0; // Don't show HK: <rank> message, only log. } - if(k_level <= 5) - k_grey = 0; - else if( k_level <= 39 ) - k_grey = k_level - 5 - k_level/10; - else - k_grey = k_level - 1 - k_level/5; + k_grey = Trinity::XP::GetGrayLevel(k_level); if(v_level<=k_grey) return false; @@ -6147,6 +6334,8 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt if(groupsize > 1) honor /= groupsize; + // apply honor multiplier from aura (not stacking-get highest) + honor = int32(float(honor) * (float(GetMaxPositiveAuraModifier(SPELL_AURA_MOD_HONOR_GAIN_PCT))+100.0f)/100.0f); honor *= (((float)urand(8,12))/10); // approx honor: 80% - 120% of real honor } @@ -6176,8 +6365,8 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt { // Check if allowed to receive it in current map uint8 MapType = sWorld.getConfig(CONFIG_PVP_TOKEN_MAP_TYPE); - if( (MapType == 1 && !InBattleGround() && !HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP)) - || (MapType == 2 && !HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP)) + if( (MapType == 1 && !InBattleGround() && !HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP)) + || (MapType == 2 && !HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP)) || (MapType == 3 && !InBattleGround()) ) return true; @@ -6235,24 +6424,18 @@ void Player::ModifyArenaPoints( int32 value ) uint32 Player::GetGuildIdFromDB(uint64 guid) { - std::ostringstream ss; - ss<<"SELECT guildid FROM guild_member WHERE guid='"<<guid<<"'"; - QueryResult *result = CharacterDatabase.Query( ss.str().c_str() ); - if( result ) - { - uint32 v = result->Fetch()[0].GetUInt32(); - delete result; - return v; - } - else + QueryResult* result = CharacterDatabase.PQuery("SELECT guildid FROM guild_member WHERE guid='%u'", GUID_LOPART(guid)); + if(!result) return 0; + + uint32 id = result->Fetch()[0].GetUInt32(); + delete result; + return id; } uint32 Player::GetRankFromDB(uint64 guid) { - std::ostringstream ss; - ss<<"SELECT rank FROM guild_member WHERE guid='"<<guid<<"'"; - QueryResult *result = CharacterDatabase.Query( ss.str().c_str() ); + QueryResult *result = CharacterDatabase.PQuery( "SELECT rank FROM guild_member WHERE guid='%u'", GUID_LOPART(guid) ); if( result ) { uint32 v = result->Fetch()[0].GetUInt32(); @@ -6276,10 +6459,8 @@ uint32 Player::GetArenaTeamIdFromDB(uint64 guid, uint8 type) uint32 Player::GetZoneIdFromDB(uint64 guid) { - std::ostringstream ss; - - ss<<"SELECT zone FROM characters WHERE guid='"<<GUID_LOPART(guid)<<"'"; - QueryResult *result = CharacterDatabase.Query( ss.str().c_str() ); + uint32 guidLow = GUID_LOPART(guid); + QueryResult *result = CharacterDatabase.PQuery( "SELECT zone FROM characters WHERE guid='%u'", guidLow ); if (!result) return 0; Field* fields = result->Fetch(); @@ -6289,22 +6470,19 @@ uint32 Player::GetZoneIdFromDB(uint64 guid) if (!zone) { // stored zone is zero, use generic and slow zone detection - ss.str(""); - ss<<"SELECT map,position_x,position_y FROM characters WHERE guid='"<<GUID_LOPART(guid)<<"'"; - result = CharacterDatabase.Query(ss.str().c_str()); + result = CharacterDatabase.PQuery("SELECT map,position_x,position_y,position_z FROM characters WHERE guid='%u'", guidLow); if( !result ) return 0; fields = result->Fetch(); - uint32 map = fields[0].GetUInt32(); + uint32 map = fields[0].GetUInt32(); float posx = fields[1].GetFloat(); float posy = fields[2].GetFloat(); + float posz = fields[3].GetFloat(); delete result; - zone = MapManager::Instance().GetZoneId(map,posx,posy); + zone = MapManager::Instance().GetZoneId(map,posx,posy,posz); - ss.str(""); - ss << "UPDATE characters SET zone='"<<zone<<"' WHERE guid='"<<GUID_LOPART(guid)<<"'"; - CharacterDatabase.Execute(ss.str().c_str()); + CharacterDatabase.PExecute("UPDATE characters SET zone='%u' WHERE guid='%u'", zone, guidLow); } return zone; @@ -6321,39 +6499,38 @@ void Player::UpdateArea(uint32 newArea) if(area && (area->flags & AREA_FLAG_ARENA)) { if(!isGameMaster()) - SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); } else { // remove ffa flag only if not ffapvp realm // removal in sanctuaries and capitals is handled in zone update - if(HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP) && !sWorld.IsFFAPvPRealm()) - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP); + if(HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP) && !sWorld.IsFFAPvPRealm()) + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); } UpdateAreaDependentAuras(newArea); } -void Player::UpdateZone(uint32 newZone) +void Player::UpdateZone(uint32 newZone, uint32 newArea) { - uint32 oldZoneId = m_zoneUpdateId; + if(m_zoneUpdateId != newZone) + { + sOutdoorPvPMgr.HandlePlayerLeaveZone(this, m_zoneUpdateId); + sOutdoorPvPMgr.HandlePlayerEnterZone(this, newZone); + SendInitWorldStates(newZone, newArea); // only if really enters to new zone, not just area change, works strange... + } + m_zoneUpdateId = newZone; m_zoneUpdateTimer = ZONE_UPDATE_INTERVAL; // zone changed, so area changed as well, update it - UpdateArea(GetAreaId()); + UpdateArea(newArea); AreaTableEntry const* zone = GetAreaEntryByAreaID(newZone); if(!zone) return; - // inform outdoor pvp - if(oldZoneId != m_zoneUpdateId) - { - sOutdoorPvPMgr.HandlePlayerLeaveZone(this, oldZoneId); - sOutdoorPvPMgr.HandlePlayerEnterZone(this, m_zoneUpdateId); - } - if (sWorld.getConfig(CONFIG_WEATHER)) { Weather *wth = sWorld.FindWeather(zone->ID); @@ -6388,15 +6565,15 @@ void Player::UpdateZone(uint32 newZone) pvpInfo.endTimer = time(0); // start toggle-off } - if(zone->flags & AREA_FLAG_SANCTUARY) // in sanctuary + if((zone->flags & AREA_FLAG_SANCTUARY) || zone->mapid == 609) // in sanctuary { - SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_SANCTUARY); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_SANCTUARY); if(sWorld.IsFFAPvPRealm()) - RemoveFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); } else { - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_SANCTUARY); + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_SANCTUARY); } if(zone->flags & AREA_FLAG_CAPITAL) // in capital city @@ -6406,7 +6583,7 @@ void Player::UpdateZone(uint32 newZone) InnEnter(time(0),GetMapId(),0,0,0); if(sWorld.IsFFAPvPRealm()) - RemoveFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); } else // anywhere else { @@ -6420,7 +6597,7 @@ void Player::UpdateZone(uint32 newZone) SetRestType(REST_TYPE_NO); if(sWorld.IsFFAPvPRealm()) - SetFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); } } else // not in tavern (leave city then) @@ -6430,7 +6607,7 @@ void Player::UpdateZone(uint32 newZone) // Set player to FFA PVP when not in rested environment. if(sWorld.IsFFAPvPRealm()) - SetFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); } } } @@ -6440,6 +6617,9 @@ void Player::UpdateZone(uint32 newZone) if(isAlive()) DestroyZoneLimitedItem( true, newZone ); + // check some item equip limitations (in result lost CanTitanGrip at talent reset, for example) + AutoUnequipOffhandIfNeed(); + // recent client version not send leave/join channel packets for built-in local channels UpdateLocalChannels( newZone ); @@ -6600,7 +6780,12 @@ void Player::_ApplyItemMods(Item *item, uint8 slot,bool apply) sLog.outDetail("applying mods for item %u ",item->GetGUIDLow()); - uint32 attacktype = Player::GetAttackBySlot(slot); + uint8 attacktype = Player::GetAttackBySlot(slot); + + //check disarm only on mod apply to allow remove item mods + if (apply && !CanUseAttackType(attacktype) ) + return; + if(attacktype < MAX_ATTACK) _ApplyWeaponDependentAuraMods(item,WeaponAttackType(attacktype),apply); @@ -6618,19 +6803,43 @@ void Player::_ApplyItemMods(Item *item, uint8 slot,bool apply) sLog.outDebug("_ApplyItemMods complete."); } -void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) +void Player::_ApplyItemBonuses(ItemPrototype const *proto, uint8 slot, bool apply) { if(slot >= INVENTORY_SLOT_BAG_END || !proto) return; - for (int i = 0; i < 10; i++) + for (int i = 0; i < MAX_ITEM_PROTO_STATS; ++i) { - float val = float (proto->ItemStat[i].ItemStatValue); + uint32 statType = 0; + int32 val = 0; + + if(proto->ScalingStatDistribution) + { + if(ScalingStatDistributionEntry const *ssd = sScalingStatDistributionStore.LookupEntry(proto->ScalingStatDistribution)) + { + statType = ssd->StatMod[i]; + + if(uint32 modifier = ssd->Modifier[i]) + { + uint32 level = ((getLevel() > ssd->MaxLevel) ? ssd->MaxLevel : getLevel()); + if(ScalingStatValuesEntry const *ssv = sScalingStatValuesStore.LookupEntry(level)) + { + uint32 multiplier = ssv->Multiplier[proto->GetScalingStatValuesColumn()]; + val = (multiplier * modifier) / 10000; + } + } + } + } + else + { + statType = proto->ItemStat[i].ItemStatType; + val = proto->ItemStat[i].ItemStatValue; + } - if(val==0) + if(val == 0) continue; - switch (proto->ItemStat[i].ItemStatType) + switch (statType) { case ITEM_MOD_MANA: HandleStatModifier(UNIT_MOD_MANA, BASE_VALUE, float(val), apply); @@ -6748,6 +6957,32 @@ void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) case ITEM_MOD_EXPERTISE_RATING: ApplyRatingMod(CR_EXPERTISE, int32(val), apply); break; + case ITEM_MOD_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER, TOTAL_VALUE, float(val), apply); + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(val), apply); + break; + case ITEM_MOD_RANGED_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(val), apply); + break; + case ITEM_MOD_FERAL_ATTACK_POWER: + ApplyFeralAPBonus(int32(val), apply); + break; + case ITEM_MOD_SPELL_HEALING_DONE: + ApplySpellHealingBonus(int32(val), apply); + break; + case ITEM_MOD_SPELL_DAMAGE_DONE: + ApplySpellDamageBonus(int32(val), apply); + break; + case ITEM_MOD_MANA_REGENERATION: + ApplyManaRegenBonus(int32(val), apply); + break; + case ITEM_MOD_ARMOR_PENETRATION_RATING: + ApplyRatingMod(CR_ARMOR_PENETRATION, int32(val), apply); + break; + case ITEM_MOD_SPELL_POWER: + ApplySpellHealingBonus(int32(val), apply); + ApplySpellDamageBonus(int32(val), apply); + break; } } @@ -6802,7 +7037,15 @@ void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) SetBaseWeaponDamage(attType, MAXDAMAGE, damage); } - if(!IsUseEquipedWeapon(slot==EQUIPMENT_SLOT_MAINHAND)) + // Druids get feral AP bonus from weapon dps + if(getClass() == CLASS_DRUID) + { + int32 feral_bonus = proto->getFeralBonus(); + if (feral_bonus > 0) + ApplyFeralAPBonus(feral_bonus, apply); + } + + if(IsInFeralForm() || !CanUseAttackType(attType)) return; if (proto->Delay) @@ -6851,7 +7094,7 @@ void Player::_ApplyWeaponDependentAuraCritMod(Item *item, WeaponAttackType attac if (item->IsFitToSpellRequirements(aura->GetSpellProto())) { - HandleBaseModValue(mod, FLAT_MOD, float (aura->GetModifierValue()), apply); + HandleBaseModValue(mod, FLAT_MOD, float (aura->GetModifier()->m_amount), apply); } } @@ -6885,7 +7128,7 @@ void Player::_ApplyWeaponDependentAuraDamageMod(Item *item, WeaponAttackType att if (item->IsFitToSpellRequirements(aura->GetSpellProto())) { - HandleStatModifier(unitMod, unitModType, float(aura->GetModifierValue()),apply); + HandleStatModifier(unitMod, unitModType, float(aura->GetModifier()->m_amount),apply); } } @@ -6898,7 +7141,7 @@ void Player::ApplyItemEquipSpell(Item *item, bool apply, bool form_change) if(!proto) return; - for (int i = 0; i < 5; i++) + for (int i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) { _Spell const& spellData = proto->Spells[i]; @@ -6924,7 +7167,7 @@ void Player::ApplyEquipSpell(SpellEntry const* spellInfo, Item* item, bool apply if(apply) { // Cannot be used in this stance/form - if(GetErrorAtShapeshiftedCast(spellInfo, m_form)!=0) + if(GetErrorAtShapeshiftedCast(spellInfo, m_form) != SPELL_CAST_OK) return; if(form_change) // check aura active state from other form @@ -6958,7 +7201,7 @@ void Player::ApplyEquipSpell(SpellEntry const* spellInfo, Item* item, bool apply if(form_change) // check aura compatibility { // Cannot be used in this stance/form - if(GetErrorAtShapeshiftedCast(spellInfo, m_form)==0) + if(GetErrorAtShapeshiftedCast(spellInfo, m_form)==SPELL_CAST_OK) return; // and remove only not compatible at form change } @@ -7011,7 +7254,7 @@ void Player::CastItemCombatSpell(Item *item,Unit* Target, WeaponAttackType attTy if (!Target || Target == this ) return; - for (int i = 0; i < 5; i++) + for (int i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) { _Spell const& spellData = proto->Spells[i]; @@ -7039,7 +7282,7 @@ void Player::CastItemCombatSpell(Item *item,Unit* Target, WeaponAttackType attTy if(spellData.SpellPPMRate) { uint32 WeaponSpeed = GetAttackTime(attType); - chance = GetPPMProcChance(WeaponSpeed, spellData.SpellPPMRate); + chance = GetPPMProcChance(WeaponSpeed, spellData.SpellPPMRate, spellInfo); } else if(chance > 100.0f) { @@ -7080,6 +7323,92 @@ void Player::CastItemCombatSpell(Item *item,Unit* Target, WeaponAttackType attTy } } +void Player::CastItemUseSpell(Item *item,SpellCastTargets const& targets,uint8 cast_count, uint32 glyphIndex) +{ + ItemPrototype const* proto = item->GetProto(); + // special learning case + if(proto->Spells[0].SpellId==SPELL_ID_GENERIC_LEARN || proto->Spells[0].SpellId==SPELL_ID_GENERIC_LEARN_PET) + { + uint32 learn_spell_id = proto->Spells[0].SpellId; + uint32 learning_spell_id = proto->Spells[1].SpellId; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(learn_spell_id); + if(!spellInfo) + { + sLog.outError("Player::CastItemUseSpell: Item (Entry: %u) in have wrong spell id %u, ignoring ",proto->ItemId, learn_spell_id); + SendEquipError(EQUIP_ERR_NONE,item,NULL); + return; + } + + Spell *spell = new Spell(this, spellInfo, false); + spell->m_CastItem = item; + spell->m_cast_count = cast_count; //set count of casts + spell->m_currentBasePoints[0] = learning_spell_id; + spell->prepare(&targets); + return; + } + + // use triggered flag only for items with many spell casts and for not first cast + int count = 0; + + // item spells casted at use + for(int i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) + { + _Spell const& spellData = proto->Spells[i]; + + // no spell + if(!spellData.SpellId) + continue; + + // wrong triggering type + if( spellData.SpellTrigger != ITEM_SPELLTRIGGER_ON_USE && spellData.SpellTrigger != ITEM_SPELLTRIGGER_ON_NO_DELAY_USE) + continue; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellData.SpellId); + if(!spellInfo) + { + sLog.outError("Player::CastItemUseSpell: Item (Entry: %u) in have wrong spell id %u, ignoring",proto->ItemId, spellData.SpellId); + continue; + } + + Spell *spell = new Spell(this, spellInfo, (count > 0)); + spell->m_CastItem = item; + spell->m_cast_count = cast_count; // set count of casts + spell->m_glyphIndex = glyphIndex; // glyph index + spell->prepare(&targets); + + ++count; + } + + // Item enchantments spells casted at use + for(int e_slot = 0; e_slot < MAX_ENCHANTMENT_SLOT; ++e_slot) + { + uint32 enchant_id = item->GetEnchantmentId(EnchantmentSlot(e_slot)); + SpellItemEnchantmentEntry const *pEnchant = sSpellItemEnchantmentStore.LookupEntry(enchant_id); + if(!pEnchant) continue; + for (int s=0;s<3;s++) + { + if(pEnchant->type[s]!=ITEM_ENCHANTMENT_TYPE_USE_SPELL) + continue; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(pEnchant->spellid[s]); + if (!spellInfo) + { + sLog.outError("Player::CastItemUseSpell Enchant %i, cast unknown spell %i", pEnchant->ID, pEnchant->spellid[s]); + continue; + } + + Spell *spell = new Spell(this, spellInfo, (count > 0)); + spell->m_CastItem = item; + spell->m_cast_count = cast_count; // set count of casts + spell->m_glyphIndex = glyphIndex; // glyph index + spell->prepare(&targets); + + ++count; + } + } +} + void Player::_RemoveAllItemMods() { sLog.outDebug("_RemoveAllItemMods start."); @@ -7255,7 +7584,7 @@ void Player::RemovedInsignia(Player* looterPlr) // We have to convert player corpse to bones, not to be able to resurrect there // SpawnCorpseBones isn't handy, 'cos it saves player while he in BG - Corpse *bones = ObjectAccessor::Instance().ConvertCorpseForPlayer(GetGUID()); + Corpse *bones = ObjectAccessor::Instance().ConvertCorpseForPlayer(GetGUID(),true); if (!bones) return; @@ -7284,6 +7613,9 @@ void Player::SendLootRelease( uint64 guid ) void Player::SendLoot(uint64 guid, LootType loot_type) { + if (uint64 lguid = GetLootGUID()) + m_session->DoLootRelease(lguid); + Loot *loot = 0; PermissionTypes permission = ALL_PERMISSION; @@ -7322,11 +7654,11 @@ void Player::SendLoot(uint64 guid, LootType loot_type) { sLog.outDebug(" if(lootid)"); loot->clear(); - loot->FillLoot(lootid, LootTemplates_Gameobject, this); + loot->FillLoot(lootid, LootTemplates_Gameobject, this, false); } if(loot_type == LOOT_FISHING) - go->getFishLoot(loot); + go->getFishLoot(loot,this); go->SetLootState(GO_ACTIVATED); } @@ -7349,7 +7681,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) { item->m_lootGenerated = true; loot->clear(); - loot->FillLoot(item->GetProto()->DisenchantID, LootTemplates_Disenchant, this); + loot->FillLoot(item->GetProto()->DisenchantID, LootTemplates_Disenchant, this,true); } } else if(loot_type == LOOT_PROSPECTING) @@ -7360,7 +7692,18 @@ void Player::SendLoot(uint64 guid, LootType loot_type) { item->m_lootGenerated = true; loot->clear(); - loot->FillLoot(item->GetEntry(), LootTemplates_Prospecting, this); + loot->FillLoot(item->GetEntry(), LootTemplates_Prospecting, this,true); + } + } + else if(loot_type == LOOT_MILLING) + { + loot = &item->loot; + + if(!item->m_lootGenerated) + { + item->m_lootGenerated = true; + loot->clear(); + loot->FillLoot(item->GetEntry(), LootTemplates_Milling, this,true); } } else @@ -7371,7 +7714,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) { item->m_lootGenerated = true; loot->clear(); - loot->FillLoot(item->GetEntry(), LootTemplates_Item, this); + loot->FillLoot(item->GetEntry(), LootTemplates_Item, this,true); loot->generateMoneyLoot(item->GetProto()->MinMoneyLoot,item->GetProto()->MaxMoneyLoot); } @@ -7395,7 +7738,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) uint32 pLevel = bones->loot.gold; bones->loot.clear(); if(GetBattleGround()->GetTypeID() == BATTLEGROUND_AV) - loot->FillLoot(1, LootTemplates_Creature, this); + loot->FillLoot(1, LootTemplates_Creature, this, true); // It may need a better formula // Now it works like this: lvl10: ~6copper, lvl70: ~9silver bones->loot.gold = (uint32)( urand(50, 150) * 0.016f * pow( ((float)pLevel)/5.76f, 2.5f) * sWorld.getRate(RATE_DROP_MONEY) ); @@ -7431,7 +7774,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) loot->clear(); if (uint32 lootid = creature->GetCreatureInfo()->pickpocketLootId) - loot->FillLoot(lootid, LootTemplates_Pickpocketing, this); + loot->FillLoot(lootid, LootTemplates_Pickpocketing, this, false); // Generate extra money for pick pocket loot const uint32 a = urand(0, creature->getLevel()/2); @@ -7461,7 +7804,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) loot->clear(); if (uint32 lootid = creature->GetCreatureInfo()->lootid) - loot->FillLoot(lootid, LootTemplates_Creature, recipient); + loot->FillLoot(lootid, LootTemplates_Creature, recipient, false); loot->generateMoneyLoot(creature->GetCreatureInfo()->mingold,creature->GetCreatureInfo()->maxgold); @@ -7491,7 +7834,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) if (loot_type == LOOT_SKINNING) { loot->clear(); - loot->FillLoot(creature->GetCreatureInfo()->SkinLootId, LootTemplates_Skinning, this); + loot->FillLoot(creature->GetCreatureInfo()->SkinLootId, LootTemplates_Skinning, this, false); } // set group rights only for loot_type != LOOT_SKINNING else @@ -7525,41 +7868,8 @@ void Player::SendLoot(uint64 guid, LootType loot_type) SetLootGUID(guid); - QuestItemList *q_list = 0; - if (permission != NONE_PERMISSION) - { - QuestItemMap const& lootPlayerQuestItems = loot->GetPlayerQuestItems(); - QuestItemMap::const_iterator itr = lootPlayerQuestItems.find(GetGUIDLow()); - if (itr == lootPlayerQuestItems.end()) - q_list = loot->FillQuestLoot(this); - else - q_list = itr->second; - } - - QuestItemList *ffa_list = 0; - if (permission != NONE_PERMISSION) - { - QuestItemMap const& lootPlayerFFAItems = loot->GetPlayerFFAItems(); - QuestItemMap::const_iterator itr = lootPlayerFFAItems.find(GetGUIDLow()); - if (itr == lootPlayerFFAItems.end()) - ffa_list = loot->FillFFALoot(this); - else - ffa_list = itr->second; - } - - QuestItemList *conditional_list = 0; - if (permission != NONE_PERMISSION) - { - QuestItemMap const& lootPlayerNonQuestNonFFAConditionalItems = loot->GetPlayerNonQuestNonFFAConditionalItems(); - QuestItemMap::const_iterator itr = lootPlayerNonQuestNonFFAConditionalItems.find(GetGUIDLow()); - if (itr == lootPlayerNonQuestNonFFAConditionalItems.end()) - conditional_list = loot->FillNonQuestNonFFAConditionalLoot(this); - else - conditional_list = itr->second; - } - - // LOOT_PICKPOCKETING, LOOT_PROSPECTING, LOOT_DISENCHANTING and LOOT_INSIGNIA unsupported by client, sending LOOT_SKINNING instead - if(loot_type == LOOT_PICKPOCKETING || loot_type == LOOT_DISENCHANTING || loot_type == LOOT_PROSPECTING || loot_type == LOOT_INSIGNIA) + // LOOT_PICKPOCKETING, LOOT_PROSPECTING, LOOT_DISENCHANTING, LOOT_INSIGNIA and LOOT_MILLING unsupported by client, sending LOOT_SKINNING instead + if(loot_type == LOOT_PICKPOCKETING || loot_type == LOOT_DISENCHANTING || loot_type == LOOT_PROSPECTING || loot_type == LOOT_INSIGNIA || loot_type == LOOT_MILLING) loot_type = LOOT_SKINNING; if(loot_type == LOOT_FISHINGHOLE) @@ -7569,7 +7879,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) data << uint64(guid); data << uint8(loot_type); - data << LootView(*loot, q_list, ffa_list, conditional_list, this, permission); + data << LootView(*loot, this, permission); SendDirectMessage(&data); @@ -7602,20 +7912,16 @@ void Player::SendUpdateWorldState(uint32 Field, uint32 Value) GetSession()->SendPacket(&data); } -void Player::SendInitWorldStates(bool forceZone, uint32 forceZoneId) +void Player::SendInitWorldStates(uint32 zoneid, uint32 areaid) { // data depends on zoneid/mapid... BattleGround* bg = GetBattleGround(); uint16 NumberOfFields = 0; uint32 mapid = GetMapId(); - uint32 zoneid; - if(forceZone) - zoneid = forceZoneId; - else - zoneid = GetZoneId(); OutdoorPvP * pvp = sOutdoorPvPMgr.GetOutdoorPvPToZoneId(zoneid); - uint32 areaid = GetAreaId(); + sLog.outDebug("Sending SMSG_INIT_WORLD_STATES to Map:%u, Zone: %u", mapid, zoneid); + // may be exist better way to do this... switch(zoneid) { @@ -7636,46 +7942,46 @@ void Player::SendInitWorldStates(bool forceZone, uint32 forceZoneId) case 1537: case 2257: case 2918: - NumberOfFields = 6; + NumberOfFields = 8; break; case 139: - NumberOfFields = 39; + NumberOfFields = 41; break; case 1377: - NumberOfFields = 13; + NumberOfFields = 15; break; case 2597: - NumberOfFields = 81; + NumberOfFields = 83; break; case 3277: - NumberOfFields = 14; + NumberOfFields = 16; break; case 3358: case 3820: - NumberOfFields = 38; + NumberOfFields = 40; break; case 3483: - NumberOfFields = 25; + NumberOfFields = 27; break; case 3518: - NumberOfFields = 37; + NumberOfFields = 39; break; case 3519: - NumberOfFields = 36; + NumberOfFields = 38; break; case 3521: - NumberOfFields = 35; + NumberOfFields = 37; break; case 3698: case 3702: case 3968: - NumberOfFields = 9; + NumberOfFields = 11; break; case 3703: - NumberOfFields = 9; + NumberOfFields = 11; break; default: - NumberOfFields = 10; + NumberOfFields = 12; break; } @@ -7690,6 +7996,10 @@ void Player::SendInitWorldStates(bool forceZone, uint32 forceZoneId) data << uint32(0x8d5) << uint32(0x0); // 4 data << uint32(0x8d4) << uint32(0x0); // 5 data << uint32(0x8d3) << uint32(0x0); // 6 + // 7 1 - Arena season in progress, 0 - end of season + data << uint32(0xC77) << uint32(sWorld.getConfig(CONFIG_ARENA_SEASON_IN_PROGRESS)); + // 8 Arena season id + data << uint32(0xF3D) << uint32(sWorld.getConfig(CONFIG_ARENA_SEASON_ID)); if(mapid == 530) // Outland { data << uint32(0x9bf) << uint32(0x0); // 7 @@ -8283,7 +8593,8 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap // (this will be replace mainhand weapon at auto equip instead unwonted "you don't known dual wielding" ... if(CanDualWield()) slots[1] = EQUIPMENT_SLOT_OFFHAND; - };break; + break; + }; case INVTYPE_SHIELD: slots[0] = EQUIPMENT_SLOT_OFFHAND; break; @@ -8292,6 +8603,8 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap break; case INVTYPE_2HWEAPON: slots[0] = EQUIPMENT_SLOT_MAINHAND; + if (CanDualWield() && CanTitanGrip()) + slots[1] = EQUIPMENT_SLOT_OFFHAND; break; case INVTYPE_TABARD: slots[0] = EQUIPMENT_SLOT_TABARD; @@ -8312,10 +8625,10 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap slots[0] = EQUIPMENT_SLOT_RANGED; break; case INVTYPE_BAG: - slots[0] = INVENTORY_SLOT_BAG_1; - slots[1] = INVENTORY_SLOT_BAG_2; - slots[2] = INVENTORY_SLOT_BAG_3; - slots[3] = INVENTORY_SLOT_BAG_4; + slots[0] = INVENTORY_SLOT_BAG_START + 0; + slots[1] = INVENTORY_SLOT_BAG_START + 1; + slots[2] = INVENTORY_SLOT_BAG_START + 2; + slots[3] = INVENTORY_SLOT_BAG_START + 3; break; case INVTYPE_RELIC: { @@ -8337,6 +8650,10 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap if (pClass == CLASS_WARLOCK) slots[0] = EQUIPMENT_SLOT_RANGED; break; + case ITEM_SUBCLASS_ARMOR_SIGIL: + if (pClass == CLASS_DEATH_KNIGHT) + slots[0] = EQUIPMENT_SLOT_RANGED; + break; } break; } @@ -8362,14 +8679,8 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap { if ( slots[i] != NULL_SLOT && !GetItemByPos( INVENTORY_SLOT_BAG_0, slots[i] ) ) { - // in case 2hand equipped weapon offhand slot empty but not free - if(slots[i]==EQUIPMENT_SLOT_OFFHAND) - { - Item* mainItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_MAINHAND ); - if(!mainItem || mainItem->GetProto()->InventoryType != INVTYPE_2HWEAPON) - return slots[i]; - } - else + // in case 2hand equipped weapon (without titan grip) offhand slot empty but not free + if(slots[i]!=EQUIPMENT_SLOT_OFFHAND || !IsTwoHandUsed()) return slots[i]; } } @@ -8419,7 +8730,7 @@ uint8 Player::CanUnequipItems( uint32 item, uint32 count ) const return EQUIP_ERR_OK; } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8461,7 +8772,7 @@ uint32 Player::GetItemCount( uint32 item, bool inBankAlso, Item* skipItem ) cons if( pItem && pItem != skipItem && pItem->GetEntry() == item ) count += pItem->GetCount(); } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem != skipItem && pItem->GetEntry() == item ) @@ -8521,7 +8832,7 @@ Item* Player::GetItemByGuid( uint64 guid ) const if( pItem && pItem->GetGUID() == guid ) return pItem; } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetGUID() == guid ) @@ -8567,7 +8878,7 @@ Item* Player::GetItemByPos( uint16 pos ) const Item* Player::GetItemByPos( uint8 bag, uint8 slot ) const { - if( bag == INVENTORY_SLOT_BAG_0 && ( slot < BANK_SLOT_BAG_END || slot >= KEYRING_SLOT_START && slot < KEYRING_SLOT_END ) ) + if( bag == INVENTORY_SLOT_BAG_0 && ( slot < BANK_SLOT_BAG_END || slot >= KEYRING_SLOT_START && slot < QUESTBAG_SLOT_END ) ) return m_items[slot]; else if(bag >= INVENTORY_SLOT_BAG_START && bag < INVENTORY_SLOT_BAG_END || bag >= BANK_SLOT_BAG_START && bag < BANK_SLOT_BAG_END ) @@ -8590,14 +8901,14 @@ Item* Player::GetWeaponForAttack(WeaponAttackType attackType, bool useable) cons default: return NULL; } - Item* item = GetItemByPos(INVENTORY_SLOT_BAG_0, slot); + Item* item = GetUseableItemByPos(INVENTORY_SLOT_BAG_0, slot); if (!item || item->GetProto()->Class != ITEM_CLASS_WEAPON) return NULL; if(!useable) return item; - if( item->IsBroken() || !IsUseEquipedWeapon(attackType==BASE_ATTACK) ) + if( item->IsBroken() || IsInFeralForm()) return NULL; return item; @@ -8605,7 +8916,7 @@ Item* Player::GetWeaponForAttack(WeaponAttackType attackType, bool useable) cons Item* Player::GetShield(bool useable) const { - Item* item = GetItemByPos(INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND); + Item* item = GetUseableItemByPos(INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND); if (!item || item->GetProto()->Class != ITEM_CLASS_ARMOR) return NULL; @@ -8618,7 +8929,7 @@ Item* Player::GetShield(bool useable) const return item; } -uint32 Player::GetAttackBySlot( uint8 slot ) +uint8 Player::GetAttackBySlot( uint8 slot ) { switch(slot) { @@ -8645,7 +8956,7 @@ bool Player::IsInventoryPos( uint8 bag, uint8 slot ) return true; if( bag >= INVENTORY_SLOT_BAG_START && bag < INVENTORY_SLOT_BAG_END ) return true; - if( bag == INVENTORY_SLOT_BAG_0 && ( slot >= KEYRING_SLOT_START && slot < KEYRING_SLOT_END ) ) + if( bag == INVENTORY_SLOT_BAG_0 && ( slot >= KEYRING_SLOT_START && slot < QUESTBAG_SLOT_END ) ) return true; return false; } @@ -8766,7 +9077,7 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const return true; } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8826,31 +9137,76 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const return false; } -Item* Player::GetItemOrItemWithGemEquipped( uint32 item ) const +bool Player::HasItemOrGemWithIdEquipped( uint32 item, uint32 count, uint8 except_slot ) const { - Item *pItem; - for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) + uint32 tempcount = 0; + for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) - return pItem; + if(i==int(except_slot)) + continue; + + Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + if( pItem && pItem->GetEntry() == item) + { + tempcount += pItem->GetCount(); + if( tempcount >= count ) + return true; + } } ItemPrototype const *pProto = objmgr.GetItemPrototype(item); if (pProto && pProto->GemProperties) { - for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) + for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetProto()->Socket[0].Color ) + if(i==int(except_slot)) + continue; + + Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + if( pItem && pItem->GetProto()->Socket[0].Color) { - if (pItem->GetGemCountWithID(item) > 0 ) - return pItem; + tempcount += pItem->GetGemCountWithID(item); + if( tempcount >= count ) + return true; } } } - return NULL; + return false; +} + +bool Player::HasItemOrGemWithLimitCategoryEquipped( uint32 limitCategory, uint32 count, uint8 except_slot ) const +{ + uint32 tempcount = 0; + for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; ++i) + { + if(i==int(except_slot)) + continue; + + Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + if (!pItem) + continue; + + ItemPrototype const *pProto = pItem->GetProto(); + if (!pProto) + continue; + + if (pProto->ItemLimitCategory == limitCategory) + { + tempcount += pItem->GetCount(); + if( tempcount >= count ) + return true; + } + + if( pProto->Socket[0].Color) + { + tempcount += pItem->GetGemCountWithLimitCategory(limitCategory); + if( tempcount >= count ) + return true; + } + } + + return false; } uint8 Player::_CanTakeMoreSimilarItems(uint32 entry, uint32 count, Item* pItem, uint32* no_space_count ) const @@ -8864,12 +9220,12 @@ uint8 Player::_CanTakeMoreSimilarItems(uint32 entry, uint32 count, Item* pItem, } // no maximum - if(pProto->MaxCount == 0) + if(pProto->MaxCount <= 0) return EQUIP_ERR_OK; uint32 curcount = GetItemCount(pProto->ItemId,true,pItem); - if( curcount + count > pProto->MaxCount ) + if (curcount + count > uint32(pProto->MaxCount)) { if(no_space_count) *no_space_count = count +curcount - pProto->MaxCount; @@ -8884,13 +9240,13 @@ bool Player::HasItemTotemCategory( uint32 TotemCategory ) const Item *pItem; for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + pItem = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && IsTotemCategoryCompatiableWith(pItem->GetProto()->TotemCategory,TotemCategory )) return true; } - for(uint8 i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; ++i) + for(uint8 i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + pItem = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && IsTotemCategoryCompatiableWith(pItem->GetProto()->TotemCategory,TotemCategory )) return true; } @@ -8900,7 +9256,7 @@ bool Player::HasItemTotemCategory( uint32 TotemCategory ) const { for(uint32 j = 0; j < pBag->GetBagSize(); ++j) { - pItem = GetItemByPos( i, j ); + pItem = GetUseableItemByPos( i, j ); if( pItem && IsTotemCategoryCompatiableWith(pItem->GetProto()->TotemCategory,TotemCategory )) return true; } @@ -8928,6 +9284,18 @@ uint8 Player::_CanStoreItem_InSpecificSlot( uint8 bag, uint8 slot, ItemPosCountV if(slot >= KEYRING_SLOT_START && slot < KEYRING_SLOT_START+GetMaxKeyringSize() && !(pProto->BagFamily & BAG_FAMILY_MASK_KEYS)) return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; + // vanitypet case (not use, vanity pets stored as spells) + if(slot >= VANITYPET_SLOT_START && slot < VANITYPET_SLOT_END) + return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; + + // currencytoken case (disabled until proper implement) + if(slot >= CURRENCYTOKEN_SLOT_START && slot < CURRENCYTOKEN_SLOT_END && !(false /*pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS*/)) + return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; + + // guestbag case (not use) + if(slot >= QUESTBAG_SLOT_START && slot < QUESTBAG_SLOT_END) + return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; + // prevent cheating if(slot >= BUYBACK_SLOT_START && slot < BUYBACK_SLOT_END || slot >= PLAYER_SLOT_END) return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; @@ -8947,7 +9315,7 @@ uint8 Player::_CanStoreItem_InSpecificSlot( uint8 bag, uint8 slot, ItemPosCountV } // non empty stack with space - need_space = pProto->Stackable; + need_space = pProto->GetMaxStackSize(); } // non empty slot, check item type else @@ -8957,10 +9325,11 @@ uint8 Player::_CanStoreItem_InSpecificSlot( uint8 bag, uint8 slot, ItemPosCountV return EQUIP_ERR_ITEM_CANT_STACK; // check free space - if(pItem2->GetCount() >= pProto->Stackable) + if(pItem2->GetCount() >= pProto->GetMaxStackSize()) return EQUIP_ERR_ITEM_CANT_STACK; - need_space = pProto->Stackable - pItem2->GetCount(); + // free stack space or infinity + need_space = pProto->GetMaxStackSize() - pItem2->GetCount(); } if(need_space > count) @@ -9014,9 +9383,9 @@ uint8 Player::_CanStoreItem_InBag( uint8 bag, ItemPosCountVec &dest, ItemPrototy if( pItem2 ) { - if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->Stackable ) + if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->GetMaxStackSize()) { - uint32 need_space = pProto->Stackable - pItem2->GetCount(); + uint32 need_space = pProto->GetMaxStackSize() - pItem2->GetCount(); if(need_space > count) need_space = count; @@ -9033,7 +9402,7 @@ uint8 Player::_CanStoreItem_InBag( uint8 bag, ItemPosCountVec &dest, ItemPrototy } else { - uint32 need_space = pProto->Stackable; + uint32 need_space = pProto->GetMaxStackSize(); if(need_space > count) need_space = count; @@ -9071,9 +9440,9 @@ uint8 Player::_CanStoreItem_InInventorySlots( uint8 slot_begin, uint8 slot_end, if( pItem2 ) { - if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->Stackable ) + if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->GetMaxStackSize()) { - uint32 need_space = pProto->Stackable - pItem2->GetCount(); + uint32 need_space = pProto->GetMaxStackSize() - pItem2->GetCount(); if(need_space > count) need_space = count; ItemPosCount newPosition = ItemPosCount((INVENTORY_SLOT_BAG_0 << 8) | j, need_space); @@ -9089,7 +9458,7 @@ uint8 Player::_CanStoreItem_InInventorySlots( uint8 slot_begin, uint8 slot_end, } else { - uint32 need_space = pProto->Stackable; + uint32 need_space = pProto->GetMaxStackSize(); if(need_space > count) need_space = count; @@ -9168,11 +9537,11 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 if( bag != NULL_BAG ) { // search stack in bag for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { if( bag == INVENTORY_SLOT_BAG_0 ) // inventory { - res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,KEYRING_SLOT_END,dest,pProto,count,true,pItem,bag,slot); + res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,QUESTBAG_SLOT_END,dest,pProto,count,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) { if(no_space_count) @@ -9260,6 +9629,29 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 } } + /* until proper implementation + else if(pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS) + { + res = _CanStoreItem_InInventorySlots(CURRENCYTOKEN_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,false,pItem,bag,slot); + if(res!=EQUIP_ERR_OK) + { + if(no_space_count) + *no_space_count = count + no_similar_count; + return res; + } + + if(count==0) + { + if(no_similar_count==0) + return EQUIP_ERR_OK; + + if(no_space_count) + *no_space_count = count + no_similar_count; + return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; + } + } + */ + res = _CanStoreItem_InInventorySlots(INVENTORY_SLOT_ITEM_START,INVENTORY_SLOT_ITEM_END,dest,pProto,count,false,pItem,bag,slot); if(res!=EQUIP_ERR_OK) { @@ -9306,9 +9698,9 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 // not specific bag or have space for partly store only in specific bag // search stack for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { - res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,KEYRING_SLOT_END,dest,pProto,count,true,pItem,bag,slot); + res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,QUESTBAG_SLOT_END,dest,pProto,count,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) { if(no_space_count) @@ -9407,6 +9799,29 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 } } + /* until proper implementation + else if(false pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS) + { + res = _CanStoreItem_InInventorySlots(CURRENCYTOKEN_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,false,pItem,bag,slot); + if(res!=EQUIP_ERR_OK) + { + if(no_space_count) + *no_space_count = count + no_similar_count; + return res; + } + + if(count==0) + { + if(no_similar_count==0) + return EQUIP_ERR_OK; + + if(no_space_count) + *no_space_count = count + no_similar_count; + return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; + } + } + */ + for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,false,false,pItem,bag,slot); @@ -9476,10 +9891,12 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const int inv_slot_items[INVENTORY_SLOT_ITEM_END-INVENTORY_SLOT_ITEM_START]; int inv_bags[INVENTORY_SLOT_BAG_END-INVENTORY_SLOT_BAG_START][MAX_BAG_SIZE]; int inv_keys[KEYRING_SLOT_END-KEYRING_SLOT_START]; + int inv_tokens[CURRENCYTOKEN_SLOT_END-CURRENCYTOKEN_SLOT_START]; memset(inv_slot_items,0,sizeof(int)*(INVENTORY_SLOT_ITEM_END-INVENTORY_SLOT_ITEM_START)); memset(inv_bags,0,sizeof(int)*(INVENTORY_SLOT_BAG_END-INVENTORY_SLOT_BAG_START)*MAX_BAG_SIZE); memset(inv_keys,0,sizeof(int)*(KEYRING_SLOT_END-KEYRING_SLOT_START)); + memset(inv_tokens,0,sizeof(int)*(CURRENCYTOKEN_SLOT_END-CURRENCYTOKEN_SLOT_START)); for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { @@ -9501,6 +9918,16 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } } + for(int i = CURRENCYTOKEN_SLOT_START; i < CURRENCYTOKEN_SLOT_END; i++) + { + pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + + if (pItem2 && !pItem2->IsInTrade()) + { + inv_tokens[i-CURRENCYTOKEN_SLOT_START] = pItem2->GetCount(); + } + } + for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { if(Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) @@ -9544,14 +9971,14 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const return res; // search stack for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { bool b_found = false; for(int t = KEYRING_SLOT_START; t < KEYRING_SLOT_END; t++) { pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, t ); - if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_keys[t-KEYRING_SLOT_START] + pItem->GetCount() <= pProto->Stackable ) + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_keys[t-KEYRING_SLOT_START] + pItem->GetCount() <= pProto->GetMaxStackSize()) { inv_keys[t-KEYRING_SLOT_START] += pItem->GetCount(); b_found = true; @@ -9560,10 +9987,22 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } if (b_found) continue; + for(int t = CURRENCYTOKEN_SLOT_START; t < CURRENCYTOKEN_SLOT_END; t++) + { + pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, t ); + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_tokens[t-CURRENCYTOKEN_SLOT_START] + pItem->GetCount() <= pProto->GetMaxStackSize()) + { + inv_tokens[t-CURRENCYTOKEN_SLOT_START] += pItem->GetCount(); + b_found = true; + break; + } + } + if (b_found) continue; + for(int t = INVENTORY_SLOT_ITEM_START; t < INVENTORY_SLOT_ITEM_END; t++) { pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, t ); - if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_slot_items[t-INVENTORY_SLOT_ITEM_START] + pItem->GetCount() <= pProto->Stackable ) + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_slot_items[t-INVENTORY_SLOT_ITEM_START] + pItem->GetCount() <= pProto->GetMaxStackSize()) { inv_slot_items[t-INVENTORY_SLOT_ITEM_START] += pItem->GetCount(); b_found = true; @@ -9580,7 +10019,7 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const for(uint32 j = 0; j < pBag->GetBagSize(); j++) { pItem2 = GetItemByPos( t, j ); - if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_bags[t-INVENTORY_SLOT_BAG_START][j] + pItem->GetCount() <= pProto->Stackable ) + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_bags[t-INVENTORY_SLOT_BAG_START][j] + pItem->GetCount() <= pProto->GetMaxStackSize()) { inv_bags[t-INVENTORY_SLOT_BAG_START][j] += pItem->GetCount(); b_found = true; @@ -9612,6 +10051,23 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const if (b_found) continue; + /* until proper implementation + if(pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS) + { + for(uint32 t = CURRENCYTOKEN_SLOT_START; t < CURRENCYTOKEN_SLOT_END; ++t) + { + if( inv_tokens[t-CURRENCYTOKEN_SLOT_START] == 0 ) + { + inv_tokens[t-CURRENCYTOKEN_SLOT_START] = 1; + b_found = true; + break; + } + } + } + + if (b_found) continue; + */ + for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; t++) { pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, t ); @@ -9707,11 +10163,6 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo ItemPrototype const *pProto = pItem->GetProto(); if( pProto ) { - // May be here should be more stronger checks; STUNNED checked - // ROOT, CONFUSED, DISTRACTED, FLEEING this needs to be checked. - if (not_loading && hasUnitState(UNIT_STAT_STUNNED)) - return EQUIP_ERR_YOU_ARE_STUNNED; - if(pItem->IsBindedNotWith(GetGUID())) return EQUIP_ERR_DONT_OWN_THAT_ITEM; @@ -9720,24 +10171,33 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo if(res != EQUIP_ERR_OK) return res; - // do not allow equipping gear except weapons, offhands, projectiles, relics in - // - combat - // - in-progress arenas - if( !pProto->CanChangeEquipStateInCombat() ) + // check this only in game + if(not_loading) { - if( isInCombat() ) - return EQUIP_ERR_NOT_IN_COMBAT; + // May be here should be more stronger checks; STUNNED checked + // ROOT, CONFUSED, DISTRACTED, FLEEING this needs to be checked. + if (hasUnitState(UNIT_STAT_STUNNED)) + return EQUIP_ERR_YOU_ARE_STUNNED; + + // do not allow equipping gear except weapons, offhands, projectiles, relics in + // - combat + // - in-progress arenas + if( !pProto->CanChangeEquipStateInCombat() ) + { + if( isInCombat() ) + return EQUIP_ERR_NOT_IN_COMBAT; - if(BattleGround* bg = GetBattleGround()) - if( bg->isArena() && bg->GetStatus() == STATUS_IN_PROGRESS ) - return EQUIP_ERR_NOT_DURING_ARENA_MATCH; - } + if(BattleGround* bg = GetBattleGround()) + if( bg->isArena() && bg->GetStatus() == STATUS_IN_PROGRESS ) + return EQUIP_ERR_NOT_DURING_ARENA_MATCH; + } - if(isInCombat()&& pProto->Class == ITEM_CLASS_WEAPON && m_weaponChangeTimer != 0) - return EQUIP_ERR_CANT_DO_RIGHT_NOW; // maybe exist better err + if(isInCombat()&& pProto->Class == ITEM_CLASS_WEAPON && m_weaponChangeTimer != 0) + return EQUIP_ERR_CANT_DO_RIGHT_NOW; // maybe exist better err - if(IsNonMeleeSpellCasted(false)) - return EQUIP_ERR_CANT_DO_RIGHT_NOW; + if(IsNonMeleeSpellCasted(false)) + return EQUIP_ERR_CANT_DO_RIGHT_NOW; + } uint8 eslot = FindEquipSlot( pProto, slot, swap ); if( eslot == NULL_SLOT ) @@ -9749,33 +10209,9 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo if( !swap && GetItemByPos( INVENTORY_SLOT_BAG_0, eslot ) ) return EQUIP_ERR_NO_EQUIPMENT_SLOT_AVAILABLE; - // check unique-equipped on item - if (pProto->Flags & ITEM_FLAGS_UNIQUE_EQUIPPED) - { - // there is an equip limit on this item - Item* tItem = GetItemOrItemWithGemEquipped(pProto->ItemId); - if (tItem && (!swap || tItem->GetSlot() != eslot ) ) - return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; - } - - // check unique-equipped on gems - for(uint32 enchant_slot = SOCK_ENCHANTMENT_SLOT; enchant_slot < SOCK_ENCHANTMENT_SLOT+3; ++enchant_slot) - { - uint32 enchant_id = pItem->GetEnchantmentId(EnchantmentSlot(enchant_slot)); - if(!enchant_id) - continue; - SpellItemEnchantmentEntry const* enchantEntry = sSpellItemEnchantmentStore.LookupEntry(enchant_id); - if(!enchantEntry) - continue; - - ItemPrototype const* pGem = objmgr.GetItemPrototype(enchantEntry->GemID); - if(pGem && (pGem->Flags & ITEM_FLAGS_UNIQUE_EQUIPPED)) - { - Item* tItem = GetItemOrItemWithGemEquipped(enchantEntry->GemID); - if(tItem && (!swap || tItem->GetSlot() != eslot )) - return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; - } - } + // if swap ignore item (equipped also) + if(uint8 res = CanEquipUniqueItem(pItem, swap ? eslot : NULL_SLOT)) + return res; // check unique-equipped special item classes if (pProto->Class == ITEM_CLASS_QUIVER) @@ -9802,33 +10238,42 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo if(eslot == EQUIPMENT_SLOT_OFFHAND) { - if( type == INVTYPE_WEAPON || type == INVTYPE_WEAPONOFFHAND ) + if (type == INVTYPE_WEAPON || type == INVTYPE_WEAPONOFFHAND) { if(!CanDualWield()) return EQUIP_ERR_CANT_DUAL_WIELD; } - - Item *mainItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_MAINHAND ); - if(mainItem) + else if (type == INVTYPE_2HWEAPON) { - if(mainItem->GetProto()->InventoryType == INVTYPE_2HWEAPON) - return EQUIP_ERR_CANT_EQUIP_WITH_TWOHANDED; + if(!CanDualWield() || !CanTitanGrip()) + return EQUIP_ERR_CANT_DUAL_WIELD; } + + if(IsTwoHandUsed()) + return EQUIP_ERR_CANT_EQUIP_WITH_TWOHANDED; } // equip two-hand weapon case (with possible unequip 2 items) if( type == INVTYPE_2HWEAPON ) { - if(eslot != EQUIPMENT_SLOT_MAINHAND) + if (eslot == EQUIPMENT_SLOT_OFFHAND) + { + if (!CanTitanGrip()) + return EQUIP_ERR_ITEM_CANT_BE_EQUIPPED; + } + else if (eslot != EQUIPMENT_SLOT_MAINHAND) return EQUIP_ERR_ITEM_CANT_BE_EQUIPPED; - // offhand item must can be stored in inventory for offhand item and it also must be unequipped - Item *offItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND ); - ItemPosCountVec off_dest; - if( offItem && (!not_loading || - CanUnequipItem(uint16(INVENTORY_SLOT_BAG_0) << 8 | EQUIPMENT_SLOT_OFFHAND,false) != EQUIP_ERR_OK || - CanStoreItem( NULL_BAG, NULL_SLOT, off_dest, offItem, false ) != EQUIP_ERR_OK ) ) - return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED : EQUIP_ERR_INVENTORY_FULL; + if (!CanTitanGrip()) + { + // offhand item must can be stored in inventory for offhand item and it also must be unequipped + Item *offItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND ); + ItemPosCountVec off_dest; + if( offItem && (!not_loading || + CanUnequipItem(uint16(INVENTORY_SLOT_BAG_0) << 8 | EQUIPMENT_SLOT_OFFHAND,false) != EQUIP_ERR_OK || + CanStoreItem( NULL_BAG, NULL_SLOT, off_dest, offItem, false ) != EQUIP_ERR_OK ) ) + return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED : EQUIP_ERR_INVENTORY_FULL; + } } dest = ((INVENTORY_SLOT_BAG_0 << 8) | eslot); return EQUIP_ERR_OK; @@ -9900,29 +10345,17 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p // in specific slot if( bag != NULL_BAG && slot != NULL_SLOT ) { - if( pProto->InventoryType == INVTYPE_BAG ) + if( slot >= BANK_SLOT_BAG_START && slot < BANK_SLOT_BAG_END ) { - Bag *pBag = (Bag*)pItem; - if( pBag ) - { - if( slot >= BANK_SLOT_BAG_START && slot < BANK_SLOT_BAG_END ) - { - if( !HasBankBagSlot( slot ) ) - return EQUIP_ERR_MUST_PURCHASE_THAT_BAG_SLOT; - if( uint8 cantuse = CanUseItem( pItem, not_loading ) != EQUIP_ERR_OK ) - return cantuse; - } - else - { - if( !pBag->IsEmpty() ) - return EQUIP_ERR_NONEMPTY_BAG_OVER_OTHER_BAG; - } - } - } - else - { - if( slot >= BANK_SLOT_BAG_START && slot < BANK_SLOT_BAG_END ) + if (!pItem->IsBag()) return EQUIP_ERR_ITEM_DOESNT_GO_TO_SLOT; + + Bag *pBag = (Bag*)pItem; + if( !HasBankBagSlot( slot ) ) + return EQUIP_ERR_MUST_PURCHASE_THAT_BAG_SLOT; + + if( uint8 cantuse = CanUseItem( pItem, not_loading ) != EQUIP_ERR_OK ) + return cantuse; } res = _CanStoreItem_InSpecificSlot(bag,slot,dest,pProto,count,swap,pItem); @@ -9946,7 +10379,7 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p } // search stack in bag for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { if( bag == INVENTORY_SLOT_BAG_0 ) { @@ -9998,7 +10431,7 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p // not specific bag or have space for partly store only in specific bag // search stack for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { // in slots res = _CanStoreItem_InInventorySlots(BANK_SLOT_ITEM_START,BANK_SLOT_ITEM_END,dest,pProto,count,true,pItem,bag,slot); @@ -10454,6 +10887,8 @@ Item* Player::EquipItem( uint16 pos, Item *pItem, bool update ) } } + // only for full equip instead adding to stack + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_EQUIP_ITEM, pItem->GetEntry()); return pItem; } @@ -10717,60 +11152,61 @@ void Player::DestroyItem( uint8 bag, uint8 slot, bool update ) void Player::DestroyItemCount( uint32 item, uint32 count, bool update, bool unequip_check) { sLog.outDebug( "STORAGE: DestroyItemCount item = %u, count = %u", item, count); - Item *pItem; - ItemPrototype const *pProto; uint32 remcount = 0; // in inventory for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { - if( pItem->GetCount() + remcount <= count ) + if (pItem->GetEntry() == item) { - // all items in inventory can unequipped - remcount += pItem->GetCount(); - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + if (pItem->GetCount() + remcount <= count) + { + // all items in inventory can unequipped + remcount += pItem->GetCount(); + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - if(remcount >=count) + if (remcount >=count) + return; + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() & update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); return; - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() & update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; + } } } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { - if( pItem->GetCount() + remcount <= count ) + if (pItem->GetEntry() == item) { - // all keys can be unequipped - remcount += pItem->GetCount(); - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + if (pItem->GetCount() + remcount <= count) + { + // all keys can be unequipped + remcount += pItem->GetCount(); + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - if(remcount >=count) + if (remcount >=count) + return; + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() & update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); return; - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() & update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; + } } } } @@ -10782,27 +11218,28 @@ void Player::DestroyItemCount( uint32 item, uint32 count, bool update, bool uneq { for(uint32 j = 0; j < pBag->GetBagSize(); j++) { - pItem = pBag->GetItemByPos(j); - if( pItem && pItem->GetEntry() == item ) + if(Item* pItem = pBag->GetItemByPos(j)) { - // all items in bags can be unequipped - if( pItem->GetCount() + remcount <= count ) + if (pItem->GetEntry() == item) { - remcount += pItem->GetCount(); - DestroyItem( i, j, update ); + // all items in bags can be unequipped + if (pItem->GetCount() + remcount <= count) + { + remcount += pItem->GetCount(); + DestroyItem( i, j, update ); - if(remcount >=count) + if (remcount >=count) + return; + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() && update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); return; - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() && update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; + } } } } @@ -10812,29 +11249,30 @@ void Player::DestroyItemCount( uint32 item, uint32 count, bool update, bool uneq // in equipment and bag list for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { - if( pItem->GetCount() + remcount <= count ) + if (pItem && pItem->GetEntry() == item) { - if(!unequip_check || CanUnequipItem(INVENTORY_SLOT_BAG_0 << 8 | i,false) == EQUIP_ERR_OK ) + if (pItem->GetCount() + remcount <= count) { - remcount += pItem->GetCount(); - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + if (!unequip_check || CanUnequipItem(INVENTORY_SLOT_BAG_0 << 8 | i,false) == EQUIP_ERR_OK ) + { + remcount += pItem->GetCount(); + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - if(remcount >=count) - return; + if (remcount >=count) + return; + } + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() & update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); + return; } - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() & update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; } } } @@ -10846,40 +11284,28 @@ void Player::DestroyZoneLimitedItem( bool update, uint32 new_zone ) // in inventory for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone)) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + + for(int i = KEYRING_SLOT_START; i < QUESTBAG_SLOT_END; i++) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone)) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); // in inventory bags for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pBag ) - { + if (Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) for(uint32 j = 0; j < pBag->GetBagSize(); j++) - { - Item* pItem = pBag->GetItemByPos(j); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( i, j, update); - } - } - } + if (Item* pItem = pBag->GetItemByPos(j)) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone)) + DestroyItem( i, j, update); // in equipment and bag list for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone)) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); } void Player::DestroyConjuredItems( bool update ) @@ -10890,40 +11316,23 @@ void Player::DestroyConjuredItems( bool update ) // in inventory for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetProto() && - (pItem->GetProto()->Class == ITEM_CLASS_CONSUMABLE) && - (pItem->GetProto()->Flags & ITEM_FLAGS_CONJURED) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsConjuredConsumable()) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); // in inventory bags for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pBag ) - { + if (Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) for(uint32 j = 0; j < pBag->GetBagSize(); j++) - { - Item* pItem = pBag->GetItemByPos(j); - if( pItem && pItem->GetProto() && - (pItem->GetProto()->Class == ITEM_CLASS_CONSUMABLE) && - (pItem->GetProto()->Flags & ITEM_FLAGS_CONJURED) ) - DestroyItem( i, j, update); - } - } - } + if (Item* pItem = pBag->GetItemByPos(j)) + if (pItem->IsConjuredConsumable()) + DestroyItem( i, j, update); // in equipment and bag list for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetProto() && - (pItem->GetProto()->Class == ITEM_CLASS_CONSUMABLE) && - (pItem->GetProto()->Flags & ITEM_FLAGS_CONJURED) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsConjuredConsumable()) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); } void Player::DestroyItemCount( Item* pItem, uint32 &count, bool update ) @@ -11079,6 +11488,8 @@ void Player::SwapItem( uint16 src, uint16 dst ) return; } + // SRC checks + if(pSrcItem->m_lootGenerated) // prevent swap looting item { //best error message found for attempting to swap while looting @@ -11089,8 +11500,8 @@ void Player::SwapItem( uint16 src, uint16 dst ) // check unequip potability for equipped items and bank bags if(IsEquipmentPos ( src ) || IsBagPos ( src )) { - // bags can be swapped with empty bag slots - uint8 msg = CanUnequipItem( src, !IsBagPos ( src ) || IsBagPos ( dst )); + // bags can be swapped with empty bag slots, or with empty bag (items move possibility checked later) + uint8 msg = CanUnequipItem( src, !IsBagPos ( src ) || IsBagPos ( dst ) || pDstItem && pDstItem->IsBag() && ((Bag*)pDstItem)->IsEmpty()); if(msg != EQUIP_ERR_OK) { SendEquipError( msg, pSrcItem, pDstItem ); @@ -11105,6 +11516,34 @@ void Player::SwapItem( uint16 src, uint16 dst ) return; } + // DST checks + + if (pDstItem) + { + if(pDstItem->m_lootGenerated) // prevent swap looting item + { + //best error message found for attempting to swap while looting + SendEquipError( EQUIP_ERR_CANT_DO_RIGHT_NOW, pDstItem, NULL ); + return; + } + + // check unequip potability for equipped items and bank bags + if(IsEquipmentPos ( dst ) || IsBagPos ( dst )) + { + // bags can be swapped with empty bag slots, or with empty bag (items move possibility checked later) + uint8 msg = CanUnequipItem( dst, !IsBagPos ( dst ) || IsBagPos ( src ) || pSrcItem->IsBag() && ((Bag*)pSrcItem)->IsEmpty()); + if(msg != EQUIP_ERR_OK) + { + SendEquipError( msg, pSrcItem, pDstItem ); + return; + } + } + } + + // NOW this is or item move (swap with empty), or swap with another item (including bags in bag possitions) + // or swap empty bag with another empty or not empty bag (with items exchange) + + // Move case if( !pDstItem ) { if( IsInventoryPos( dst ) ) @@ -11147,140 +11586,187 @@ void Player::SwapItem( uint16 src, uint16 dst ) EquipItem( dest, pSrcItem, true); AutoUnequipOffhandIfNeed(); } + + return; } - else // if (!pDstItem) + + // attempt merge to / fill target item + if(!pSrcItem->IsBag() && !pDstItem->IsBag()) { - if(pDstItem->m_lootGenerated) // prevent swap looting item - { - //best error message found for attempting to swap while looting - SendEquipError( EQUIP_ERR_CANT_DO_RIGHT_NOW, pDstItem, NULL ); + uint8 msg; + ItemPosCountVec sDest; + uint16 eDest; + if( IsInventoryPos( dst ) ) + msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, false ); + else if( IsBankPos ( dst ) ) + msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, false ); + else if( IsEquipmentPos ( dst ) ) + msg = CanEquipItem( dstslot, eDest, pSrcItem, false ); + else return; - } - // check unequip potability for equipped items and bank bags - if(IsEquipmentPos ( dst ) || IsBagPos ( dst )) + // can be merge/fill + if(msg == EQUIP_ERR_OK) { - // bags can be swapped with empty bag slots - uint8 msg = CanUnequipItem( dst, !IsBagPos ( dst ) || IsBagPos ( src ) ); - if(msg != EQUIP_ERR_OK) + if( pSrcItem->GetCount() + pDstItem->GetCount() <= pSrcItem->GetProto()->GetMaxStackSize()) { - SendEquipError( msg, pSrcItem, pDstItem ); - return; - } - } + RemoveItem(srcbag, srcslot, true); - // attempt merge to / fill target item - { - uint8 msg; - ItemPosCountVec sDest; - uint16 eDest; - if( IsInventoryPos( dst ) ) - msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, false ); - else if( IsBankPos ( dst ) ) - msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, false ); - else if( IsEquipmentPos ( dst ) ) - msg = CanEquipItem( dstslot, eDest, pSrcItem, false ); - else - return; - - // can be merge/fill - if(msg == EQUIP_ERR_OK) - { - if( pSrcItem->GetCount() + pDstItem->GetCount() <= pSrcItem->GetProto()->Stackable ) + if( IsInventoryPos( dst ) ) + StoreItem( sDest, pSrcItem, true); + else if( IsBankPos ( dst ) ) + BankItem( sDest, pSrcItem, true); + else if( IsEquipmentPos ( dst ) ) { - RemoveItem(srcbag, srcslot, true); - - if( IsInventoryPos( dst ) ) - StoreItem( sDest, pSrcItem, true); - else if( IsBankPos ( dst ) ) - BankItem( sDest, pSrcItem, true); - else if( IsEquipmentPos ( dst ) ) - { - EquipItem( eDest, pSrcItem, true); - AutoUnequipOffhandIfNeed(); - } + EquipItem( eDest, pSrcItem, true); + AutoUnequipOffhandIfNeed(); } - else + } + else + { + pSrcItem->SetCount( pSrcItem->GetCount() + pDstItem->GetCount() - pSrcItem->GetProto()->GetMaxStackSize()); + pDstItem->SetCount( pSrcItem->GetProto()->GetMaxStackSize()); + pSrcItem->SetState(ITEM_CHANGED, this); + pDstItem->SetState(ITEM_CHANGED, this); + if( IsInWorld() ) { - pSrcItem->SetCount( pSrcItem->GetCount() + pDstItem->GetCount() - pSrcItem->GetProto()->Stackable ); - pDstItem->SetCount( pSrcItem->GetProto()->Stackable ); - pSrcItem->SetState(ITEM_CHANGED, this); - pDstItem->SetState(ITEM_CHANGED, this); - if( IsInWorld() ) - { - pSrcItem->SendUpdateToPlayer( this ); - pDstItem->SendUpdateToPlayer( this ); - } + pSrcItem->SendUpdateToPlayer( this ); + pDstItem->SendUpdateToPlayer( this ); } - return; } + return; } + } - // impossible merge/fill, do real swap - uint8 msg; + // impossible merge/fill, do real swap + uint8 msg; - // check src->dest move possibility - ItemPosCountVec sDest; - uint16 eDest; - if( IsInventoryPos( dst ) ) - msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, true ); - else if( IsBankPos( dst ) ) - msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, true ); - else if( IsEquipmentPos( dst ) ) - { - msg = CanEquipItem( dstslot, eDest, pSrcItem, true ); - if( msg == EQUIP_ERR_OK ) - msg = CanUnequipItem( eDest, true ); - } + // check src->dest move possibility + ItemPosCountVec sDest; + uint16 eDest; + if( IsInventoryPos( dst ) ) + msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, true ); + else if( IsBankPos( dst ) ) + msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, true ); + else if( IsEquipmentPos( dst ) ) + { + msg = CanEquipItem( dstslot, eDest, pSrcItem, true ); + if( msg == EQUIP_ERR_OK ) + msg = CanUnequipItem( eDest, true ); + } - if( msg != EQUIP_ERR_OK ) + if( msg != EQUIP_ERR_OK ) + { + SendEquipError( msg, pSrcItem, pDstItem ); + return; + } + + // check dest->src move possibility + ItemPosCountVec sDest2; + uint16 eDest2; + if( IsInventoryPos( src ) ) + msg = CanStoreItem( srcbag, srcslot, sDest2, pDstItem, true ); + else if( IsBankPos( src ) ) + msg = CanBankItem( srcbag, srcslot, sDest2, pDstItem, true ); + else if( IsEquipmentPos( src ) ) + { + msg = CanEquipItem( srcslot, eDest2, pDstItem, true); + if( msg == EQUIP_ERR_OK ) + msg = CanUnequipItem( eDest2, true); + } + + if( msg != EQUIP_ERR_OK ) + { + SendEquipError( msg, pDstItem, pSrcItem ); + return; + } + + // Check bag swap with item exchange (one from empty in not bag possition (equipped (not possible in fact) or store) + if(pSrcItem->IsBag() && pDstItem->IsBag()) + { + Bag* emptyBag = NULL; + Bag* fullBag = NULL; + if(((Bag*)pSrcItem)->IsEmpty() && !IsBagPos(src)) { - SendEquipError( msg, pSrcItem, pDstItem ); - return; + emptyBag = (Bag*)pSrcItem; + fullBag = (Bag*)pDstItem; } - - // check dest->src move possibility - ItemPosCountVec sDest2; - uint16 eDest2; - if( IsInventoryPos( src ) ) - msg = CanStoreItem( srcbag, srcslot, sDest2, pDstItem, true ); - else if( IsBankPos( src ) ) - msg = CanBankItem( srcbag, srcslot, sDest2, pDstItem, true ); - else if( IsEquipmentPos( src ) ) + else if(((Bag*)pDstItem)->IsEmpty() && !IsBagPos(dst)) { - msg = CanEquipItem( srcslot, eDest2, pDstItem, true); - if( msg == EQUIP_ERR_OK ) - msg = CanUnequipItem( eDest2, true); + emptyBag = (Bag*)pDstItem; + fullBag = (Bag*)pSrcItem; } - if( msg != EQUIP_ERR_OK ) + // bag swap (with items exchange) case + if(emptyBag && fullBag) { - SendEquipError( msg, pDstItem, pSrcItem ); - return; - } + ItemPrototype const* emotyProto = emptyBag->GetProto(); - // now do moves, remove... - RemoveItem(dstbag, dstslot, false); - RemoveItem(srcbag, srcslot, false); + uint32 count = 0; - // add to dest - if( IsInventoryPos( dst ) ) - StoreItem(sDest, pSrcItem, true); - else if( IsBankPos( dst ) ) - BankItem(sDest, pSrcItem, true); - else if( IsEquipmentPos( dst ) ) - EquipItem(eDest, pSrcItem, true); - - // add to src - if( IsInventoryPos( src ) ) - StoreItem(sDest2, pDstItem, true); - else if( IsBankPos( src ) ) - BankItem(sDest2, pDstItem, true); - else if( IsEquipmentPos( src ) ) - EquipItem(eDest2, pDstItem, true); + for(int i=0; i < fullBag->GetBagSize(); ++i) + { + Item *bagItem = fullBag->GetItemByPos(i); + if (!bagItem) + continue; - AutoUnequipOffhandIfNeed(); + ItemPrototype const* bagItemProto = bagItem->GetProto(); + if (!bagItemProto || !ItemCanGoIntoBag(bagItemProto, emotyProto)) + { + // one from items not go to empry target bag + SendEquipError( EQUIP_ERR_NONEMPTY_BAG_OVER_OTHER_BAG, pSrcItem, pDstItem ); + return; + } + + ++count; + } + + + if (count > emptyBag->GetBagSize()) + { + // too small targeted bag + SendEquipError( EQUIP_ERR_ITEMS_CANT_BE_SWAPPED, pSrcItem, pDstItem ); + return; + } + + // Items swap + count = 0; // will pos in new bag + for(int i=0; i< fullBag->GetBagSize(); ++i) + { + Item *bagItem = fullBag->GetItemByPos(i); + if (!bagItem) + continue; + + fullBag->RemoveItem(i, true); + emptyBag->StoreItem(count, bagItem, true); + bagItem->SetState(ITEM_CHANGED, this); + + ++count; + } + } } + + // now do moves, remove... + RemoveItem(dstbag, dstslot, false); + RemoveItem(srcbag, srcslot, false); + + // add to dest + if( IsInventoryPos( dst ) ) + StoreItem(sDest, pSrcItem, true); + else if( IsBankPos( dst ) ) + BankItem(sDest, pSrcItem, true); + else if( IsEquipmentPos( dst ) ) + EquipItem(eDest, pSrcItem, true); + + // add to src + if( IsInventoryPos( src ) ) + StoreItem(sDest2, pDstItem, true); + else if( IsBankPos( src ) ) + BankItem(sDest2, pDstItem, true); + else if( IsEquipmentPos( src ) ) + EquipItem(eDest2, pDstItem, true); + + AutoUnequipOffhandIfNeed(); } void Player::AddItemToBuyBackSlot( Item *pItem ) @@ -11848,6 +12334,40 @@ void Player::ApplyEnchantment(Item *item,EnchantmentSlot slot,bool apply, bool a ((Player*)this)->ApplyRatingMod(CR_EXPERTISE, enchant_amount, apply); sLog.outDebug("+ %u EXPERTISE", enchant_amount); break; + case ITEM_MOD_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER, TOTAL_VALUE, float(enchant_amount), apply); + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(enchant_amount), apply); + sLog.outDebug("+ %u ATTACK_POWER", enchant_amount); + break; + case ITEM_MOD_RANGED_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(enchant_amount), apply); + sLog.outDebug("+ %u RANGED_ATTACK_POWER", enchant_amount); + break; + case ITEM_MOD_FERAL_ATTACK_POWER: + ((Player*)this)->ApplyFeralAPBonus(enchant_amount, apply); + sLog.outDebug("+ %u FERAL_ATTACK_POWER", enchant_amount); + break; + case ITEM_MOD_SPELL_HEALING_DONE: + ((Player*)this)->ApplySpellHealingBonus(enchant_amount, apply); + sLog.outDebug("+ %u SPELL_HEALING_DONE", enchant_amount); + break; + case ITEM_MOD_SPELL_DAMAGE_DONE: + ((Player*)this)->ApplySpellDamageBonus(enchant_amount, apply); + sLog.outDebug("+ %u SPELL_DAMAGE_DONE", enchant_amount); + break; + case ITEM_MOD_MANA_REGENERATION: + ((Player*)this)->ApplyManaRegenBonus(enchant_amount, apply); + sLog.outDebug("+ %u MANA_REGENERATION", enchant_amount); + break; + case ITEM_MOD_ARMOR_PENETRATION_RATING: + ((Player*)this)->ApplyRatingMod(CR_ARMOR_PENETRATION, enchant_amount, apply); + sLog.outDebug("+ %u ARMOR PENETRATION", enchant_amount); + break; + case ITEM_MOD_SPELL_POWER: + ((Player*)this)->ApplySpellHealingBonus(enchant_amount, apply); + ((Player*)this)->ApplySpellDamageBonus(enchant_amount, apply); + sLog.outDebug("+ %u SPELL_POWER", enchant_amount); + break; default: break; } @@ -11871,8 +12391,14 @@ void Player::ApplyEnchantment(Item *item,EnchantmentSlot slot,bool apply, bool a } break; } + case ITEM_ENCHANTMENT_TYPE_USE_SPELL: + // processed in Player::CastItemUseSpell + break; + case ITEM_ENCHANTMENT_TYPE_PRISMATIC_SOCKET: + // nothing do.. + break; default: - sLog.outError("Unknown item enchantment display type: %d",enchant_display_type); + sLog.outError("Unknown item enchantment (id = %d) display type: %d", enchant_id, enchant_display_type); break; } /*switch(enchant_display_type)*/ } /*for*/ @@ -11938,7 +12464,7 @@ void Player::SendNewItem(Item *item, uint32 count, bool received, bool created, data << GetItemCount(item->GetEntry()); // count of items in inventory if (broadcast && GetGroup()) - GetGroup()->BroadcastPacket(&data); + GetGroup()->BroadcastPacket(&data, true); else GetSession()->SendPacket(&data); } @@ -12042,7 +12568,7 @@ void Player::SendPreparedQuest( uint64 guid ) if( pCreature ) { uint32 textid = pCreature->GetNpcTextId(); - GossipText * gossiptext = objmgr.GetGossipText(textid); + GossipText const* gossiptext = objmgr.GetGossipText(textid); if( !gossiptext ) { qe._Delay = 0; //TEXTEMOTE_MESSAGE; //zyg: player emote @@ -12346,8 +12872,6 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) // if not exist then created with set uState==NEW and rewarded=false QuestStatusData& questStatusData = mQuestStatus[quest_id]; - if (questStatusData.uState != QUEST_NEW) - questStatusData.uState = QUEST_CHANGED; // check for repeatable quests status reset questStatusData.m_status = QUEST_STATUS_INCOMPLETE; @@ -12355,18 +12879,18 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) if ( pQuest->HasFlag( QUEST_TRINITY_FLAGS_DELIVER ) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(int i = 0; i < QUEST_OBJECTIVES_COUNT; ++i) questStatusData.m_itemcount[i] = 0; } if ( pQuest->HasFlag(QUEST_TRINITY_FLAGS_KILL_OR_CAST | QUEST_TRINITY_FLAGS_SPEAKTO) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(int i = 0; i < QUEST_OBJECTIVES_COUNT; ++i) questStatusData.m_creatureOrGOcount[i] = 0; } GiveQuestSourceItem( pQuest ); - AdjustQuestReqItemCount( pQuest ); + AdjustQuestReqItemCount( pQuest, questStatusData ); if( pQuest->GetRepObjectiveFaction() ) SetFactionVisibleForFactionId(pQuest->GetRepObjectiveFaction()); @@ -12378,10 +12902,10 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) // shared timed quest if(questGiver && questGiver->GetTypeId()==TYPEID_PLAYER) - limittime = ((Player*)questGiver)->getQuestStatusMap()[quest_id].m_timer / 1000; + limittime = ((Player*)questGiver)->getQuestStatusMap()[quest_id].m_timer / IN_MILISECONDS; AddTimedQuest( quest_id ); - questStatusData.m_timer = limittime * 1000; + questStatusData.m_timer = limittime * IN_MILISECONDS; qtime = static_cast<uint32>(time(NULL)) + limittime; } else @@ -12389,10 +12913,26 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) SetQuestSlot(log_slot, quest_id, qtime); + if (questStatusData.uState != QUEST_NEW) + questStatusData.uState = QUEST_CHANGED; + //starting initial quest script if(questGiver && pQuest->GetQuestStartScript()!=0) sWorld.ScriptsStart(sQuestStartScripts, pQuest->GetQuestStartScript(), questGiver, this); + // Some spells applied at quest activation + SpellAreaForQuestMapBounds saBounds = spellmgr.GetSpellAreaForQuestMapBounds(quest_id,true); + if(saBounds.first != saBounds.second) + { + uint32 zone, area; + GetZoneAndAreaId(zone,area); + + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,zone,area)) + if( !HasAura(itr->second->spellId,0) ) + CastSpell(this,itr->second->spellId,true); + } + UpdateForQuestsGO(); } @@ -12490,10 +13030,20 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver if ( getLevel() < sWorld.getConfig(CONFIG_MAX_PLAYER_LEVEL) ) GiveXP( XP , NULL ); else - ModifyMoney( int32(pQuest->GetRewMoneyMaxLevel() * sWorld.getRate(RATE_DROP_MONEY)) ); + { + uint32 money = uint32(pQuest->GetRewMoneyMaxLevel() * sWorld.getRate(RATE_DROP_MONEY)); + ModifyMoney( money ); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_MONEY_FROM_QUEST_REWARD, money); + } // Give player extra money if GetRewOrReqMoney > 0 and get ReqMoney if negative - ModifyMoney( pQuest->GetRewOrReqMoney() ); + if(pQuest->GetRewOrReqMoney()) + { + ModifyMoney( pQuest->GetRewOrReqMoney() ); + + if(pQuest->GetRewOrReqMoney() > 0) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_MONEY_FROM_QUEST_REWARD, pQuest->GetRewOrReqMoney()); + } // honor reward if(pQuest->GetRewHonorableKills()) @@ -12506,6 +13056,12 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver SetTitle(titleEntry); } + if(pQuest->GetBonusTalents()) + { + m_questRewardTalentCount+=pQuest->GetBonusTalents(); + InitTalentForLevel(); + } + // Send reward mail if(pQuest->GetRewMailTemplateId()) { @@ -12537,12 +13093,13 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver Loot questMailLoot; - questMailLoot.FillLoot(pQuest->GetQuestId(), LootTemplates_QuestMail, this); + questMailLoot.FillLoot(pQuest->GetQuestId(), LootTemplates_QuestMail, this,true); // fill mail MailItemsInfo mi; // item list preparing - for(size_t i = 0; mi.size() < MAX_MAIL_ITEMS && i < questMailLoot.items.size(); ++i) + uint32 max_slot = questMailLoot.GetMaxSlotInLootFor(this); + for(uint32 i = 0; mi.size() < MAX_MAIL_ITEMS && i < max_slot; ++i) { if(LootItem* lootitem = questMailLoot.LootItemInSlot(i,this)) { @@ -12554,23 +13111,14 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver } } - for(size_t i = 0; mi.size() < MAX_MAIL_ITEMS && i < questMailLoot.quest_items.size(); ++i) - { - if(LootItem* lootitem = questMailLoot.LootItemInSlot(i+questMailLoot.items.size(),this)) - { - if(Item* item = Item::CreateItem(lootitem->itemid,lootitem->count,this)) - { - item->SaveToDB(); // save for prevent lost at next mail load, if send fail then item will deleted - mi.AddItem(item->GetGUIDLow(), item->GetEntry(), item); - } - } - } - WorldSession::SendMailTo(this, mailType, MAIL_STATIONERY_NORMAL, senderGuidOrEntry, GetGUIDLow(), "", 0, &mi, 0, 0, MAIL_CHECK_MASK_NONE,pQuest->GetRewMailDelaySecs(),pQuest->GetRewMailTemplateId()); } if(pQuest->IsDaily()) + { SetDailyQuestStatus(quest_id); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_DAILY_QUEST, 1); + } if ( !pQuest->IsRepeatable() ) SetQuestStatus(quest_id, QUEST_STATUS_COMPLETE); @@ -12583,6 +13131,35 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver SendQuestReward( pQuest, XP, questGiver ); if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_QUEST_COUNT); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_QUEST); + + uint32 zone = 0; + uint32 area = 0; + + // remove auras from spells with quest reward state limitations + SpellAreaForQuestMapBounds saEndBounds = spellmgr.GetSpellAreaForQuestEndMapBounds(quest_id); + if(saEndBounds.first != saEndBounds.second) + { + GetZoneAndAreaId(zone,area); + + for(SpellAreaForAreaMap::const_iterator itr = saEndBounds.first; itr != saEndBounds.second; ++itr) + if(!itr->second->IsFitToRequirements(this,zone,area)) + RemoveAurasDueToSpell(itr->second->spellId); + } + + // Some spells applied at quest reward + SpellAreaForQuestMapBounds saBounds = spellmgr.GetSpellAreaForQuestMapBounds(quest_id,false); + if(saBounds.first != saBounds.second) + { + if(!zone || !area) + GetZoneAndAreaId(zone,area); + + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,zone,area)) + if( !HasAura(itr->second->spellId,0) ) + CastSpell(this,itr->second->spellId,true); + } } void Player::FailQuest( uint32 quest_id ) @@ -12607,8 +13184,9 @@ void Player::FailTimedQuest( uint32 quest_id ) { QuestStatusData& q_status = mQuestStatus[quest_id]; - if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; q_status.m_timer = 0; + if (q_status.uState != QUEST_NEW) + q_status.uState = QUEST_CHANGED; IncompleteQuest( quest_id ); @@ -13094,18 +13672,18 @@ uint32 Player::GetReqKillOrCastCurrentCount(uint32 quest_id, int32 entry) if( !qInfo ) return 0; - for (int j = 0; j < QUEST_OBJECTIVES_COUNT; j++) + for (int j = 0; j < QUEST_OBJECTIVES_COUNT; ++j) if ( qInfo->ReqCreatureOrGOId[j] == entry ) return mQuestStatus[quest_id].m_creatureOrGOcount[j]; return 0; } -void Player::AdjustQuestReqItemCount( Quest const* pQuest ) +void Player::AdjustQuestReqItemCount( Quest const* pQuest, QuestStatusData& questStatusData ) { if ( pQuest->HasFlag( QUEST_TRINITY_FLAGS_DELIVER ) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(int i = 0; i < QUEST_OBJECTIVES_COUNT; ++i) { uint32 reqitemcount = pQuest->ReqItemCount[i]; if( reqitemcount != 0 ) @@ -13113,9 +13691,8 @@ void Player::AdjustQuestReqItemCount( Quest const* pQuest ) uint32 quest_id = pQuest->GetQuestId(); uint32 curitemcount = GetItemCount(pQuest->ReqItemId[i],true); - QuestStatusData& q_status = mQuestStatus[quest_id]; - q_status.m_itemcount[i] = std::min(curitemcount, reqitemcount); - if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; + questStatusData.m_itemcount[i] = std::min(curitemcount, reqitemcount); + if (questStatusData.uState != QUEST_NEW) questStatusData.uState = QUEST_CHANGED; } } } @@ -13123,7 +13700,7 @@ void Player::AdjustQuestReqItemCount( Quest const* pQuest ) uint16 Player::FindQuestSlot( uint32 quest_id ) const { - for ( uint16 i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for ( uint16 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) if ( GetQuestSlotQuestId(i) == quest_id ) return i; @@ -13171,7 +13748,7 @@ void Player::GroupEventHappens( uint32 questId, WorldObject const* pEventObject void Player::ItemAddedQuestCheck( uint32 entry, uint32 count ) { - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if ( questid == 0 ) @@ -13208,11 +13785,12 @@ void Player::ItemAddedQuestCheck( uint32 entry, uint32 count ) } } UpdateForQuestsGO(); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_OWN_ITEM, entry); } void Player::ItemRemovedQuestCheck( uint32 entry, uint32 count ) { - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13254,7 +13832,8 @@ void Player::ItemRemovedQuestCheck( uint32 entry, uint32 count ) void Player::KilledMonster( uint32 entry, uint64 guid ) { uint32 addkillcount = 1; - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_KILL_CREATURE, entry, addkillcount); + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13309,7 +13888,7 @@ void Player::CastedCreatureOrGO( uint32 entry, uint64 guid, uint32 spell_id ) bool isCreature = IS_CREATURE_GUID(guid); uint32 addCastCount = 1; - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13376,7 +13955,7 @@ void Player::CastedCreatureOrGO( uint32 entry, uint64 guid, uint32 spell_id ) void Player::TalkedToCreature( uint32 entry, uint64 guid ) { uint32 addTalkCount = 1; - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13431,7 +14010,7 @@ void Player::TalkedToCreature( uint32 entry, uint64 guid ) void Player::MoneyChanged( uint32 count ) { - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if (!questid) @@ -13461,13 +14040,21 @@ void Player::MoneyChanged( uint32 count ) bool Player::HasQuestForItem( uint32 itemid ) const { - for( QuestStatusMap::const_iterator i = mQuestStatus.begin( ); i != mQuestStatus.end( ); ++i ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { - QuestStatusData const& q_status = i->second; + uint32 questid = GetQuestSlotQuestId(i); + if ( questid == 0 ) + continue; + + QuestStatusMap::const_iterator qs_itr = mQuestStatus.find(questid); + if(qs_itr == mQuestStatus.end()) + continue; + + QuestStatusData const& q_status = qs_itr->second; if (q_status.m_status == QUEST_STATUS_INCOMPLETE) { - Quest const* qinfo = objmgr.GetQuestTemplate(i->first); + Quest const* qinfo = objmgr.GetQuestTemplate(questid); if(!qinfo) continue; @@ -13487,28 +14074,21 @@ bool Player::HasQuestForItem( uint32 itemid ) const for (int j = 0; j < QUEST_SOURCE_ITEM_IDS_COUNT; j++) { // examined item is a source item - if (qinfo->ReqSourceId[j] == itemid && qinfo->ReqSourceRef[j] > 0 && qinfo->ReqSourceRef[j] <= QUEST_OBJECTIVES_COUNT) + if (qinfo->ReqSourceId[j] == itemid) { - uint32 idx = qinfo->ReqSourceRef[j]-1; + ItemPrototype const *pProto = objmgr.GetItemPrototype(itemid); - // total count of created ReqItems and SourceItems is less than ReqItemCount - if(qinfo->ReqItemId[idx] != 0 && - q_status.m_itemcount[idx] * qinfo->ReqSourceCount[j] + GetItemCount(itemid,true) < qinfo->ReqItemCount[idx] * qinfo->ReqSourceCount[j]) + // 'unique' item + if (pProto->MaxCount && GetItemCount(itemid,true) < pProto->MaxCount) return true; - // total count of casted ReqCreatureOrGOs and SourceItems is less than ReqCreatureOrGOCount - if (qinfo->ReqCreatureOrGOId[idx] != 0) + // allows custom amount drop when not 0 + if (qinfo->ReqSourceCount[j]) { - if(q_status.m_creatureOrGOcount[idx] * qinfo->ReqSourceCount[j] + GetItemCount(itemid,true) < qinfo->ReqCreatureOrGOCount[idx] * qinfo->ReqSourceCount[j]) + if (GetItemCount(itemid,true) < qinfo->ReqSourceCount[j]) return true; - } - // spell with SPELL_EFFECT_QUEST_COMPLETE or SPELL_EFFECT_SEND_EVENT (with script) case - else if(qinfo->ReqSpell[idx] != 0) - { - // not casted and need more reagents/item for use. - if(!q_status.m_explored && GetItemCount(itemid,true) < qinfo->ReqSourceCount[j]) - return true; - } + } else if (GetItemCount(itemid,true) < pProto->Stackable) + return true; } } } @@ -13532,13 +14112,12 @@ void Player::SendQuestReward( Quest const *pQuest, uint32 XP, Object * questGive uint32 questid = pQuest->GetQuestId(); sLog.outDebug( "WORLD: Sent SMSG_QUESTGIVER_QUEST_COMPLETE quest = %u", questid ); gameeventmgr.HandleQuestComplete(questid); - WorldPacket data( SMSG_QUESTGIVER_QUEST_COMPLETE, (4+4+4+4+4+4+pQuest->GetRewItemsCount()*8) ); - data << questid; - data << uint32(0x03); + WorldPacket data( SMSG_QUESTGIVER_QUEST_COMPLETE, (4+4+4+4+4) ); + data << uint32(questid); if ( getLevel() < sWorld.getConfig(CONFIG_MAX_PLAYER_LEVEL) ) { - data << XP; + data << uint32(XP); data << uint32(pQuest->GetRewOrReqMoney()); } else @@ -13546,16 +14125,9 @@ void Player::SendQuestReward( Quest const *pQuest, uint32 XP, Object * questGive data << uint32(0); data << uint32(pQuest->GetRewOrReqMoney() + int32(pQuest->GetRewMoneyMaxLevel() * sWorld.getRate(RATE_DROP_MONEY))); } - data << uint32(0); // new 2.3.0, HonorPoints? - data << uint32( pQuest->GetRewItemsCount() ); // max is 5 - for (uint32 i = 0; i < pQuest->GetRewItemsCount(); ++i) - { - if ( pQuest->RewItemId[i] > 0 ) - data << pQuest->RewItemId[i] << pQuest->RewItemCount[i]; - else - data << uint32(0) << uint32(0); - } + data << uint32(10*Trinity::Honor::hk_honor_at_level(getLevel(), pQuest->GetRewHonorableKills())); + data << uint32(pQuest->GetBonusTalents()); // bonus talents GetSession()->SendPacket( &data ); if (pQuest->GetQuestCompleteScript() != 0) @@ -13566,8 +14138,9 @@ void Player::SendQuestFailed( uint32 quest_id ) { if( quest_id ) { - WorldPacket data( SMSG_QUESTGIVER_QUEST_FAILED, 4 ); + WorldPacket data( SMSG_QUESTGIVER_QUEST_FAILED, 4+4 ); data << quest_id; + data << uint32(0); // failed reason (4 for inventory is full) GetSession()->SendPacket( &data ); sLog.outDebug("WORLD: Sent SMSG_QUESTGIVER_QUEST_FAILED"); } @@ -13606,10 +14179,10 @@ void Player::SendPushToPartyResponse( Player *pPlayer, uint32 msg ) void Player::SendQuestUpdateAddItem( Quest const* pQuest, uint32 item_idx, uint32 count ) { - WorldPacket data( SMSG_QUESTUPDATE_ADD_ITEM, (4+4) ); + WorldPacket data( SMSG_QUESTUPDATE_ADD_ITEM, 0 ); sLog.outDebug( "WORLD: Sent SMSG_QUESTUPDATE_ADD_ITEM" ); - data << pQuest->ReqItemId[item_idx]; - data << count; + //data << pQuest->ReqItemId[item_idx]; + //data << count; GetSession()->SendPacket( &data ); } @@ -13655,7 +14228,7 @@ bool Player::MinimalLoadFromDB( QueryResult *result, uint32 guid ) if(!LoadValues( fields[1].GetString())) { - sLog.outError("ERROR: Player #%d have broken data in `data` field. Can't be loaded.",GUID_LOPART(guid)); + sLog.outError("Player #%d have broken data in `data` field. Can't be loaded for character list.",GUID_LOPART(guid)); if(delete_result) delete result; return false; } @@ -13725,7 +14298,7 @@ void Player::_LoadArenaTeamInfo(QueryResult *result) ArenaTeam* aTeam = objmgr.GetArenaTeamById(arenateamid); if(!aTeam) { - sLog.outError("FATAL: couldn't load arenateam %u", arenateamid); + sLog.outError("Player::_LoadArenaTeamInfo: couldn't load arenateam %u, week %u, season %u, rating %u", arenateamid, played_week, played_season, personal_rating); continue; } uint8 arenaSlot = aTeam->GetSlot(); @@ -13843,13 +14416,13 @@ float Player::GetFloatValueFromDB(uint16 index, uint64 guid) bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) { - //// 0 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 [28] [29] 30 31 32 33 - //QueryResult *result = CharacterDatabase.PQuery("SELECT guid, account, data, name, race, class, position_x, position_y, position_z, map, orientation, taximask, cinematic, totaltime, leveltime, rest_bonus, logout_time, is_logout_resting, resettalents_cost, resettalents_time, trans_x, trans_y, trans_z, trans_o, transguid, extra_flags, stable_slots, at_login, zone, online, death_expire_time, taxi_path, dungeon_difficulty, arena_pending_points FROM characters WHERE guid = '%u'", guid); + //// 0 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 [28] [29] 30 31 32 33 34 35 36 37 38 39 40 + //QueryResult *result = CharacterDatabase.PQuery("SELECT guid, account, data, name, race, class, position_x, position_y, position_z, map, orientation, taximask, cinematic, totaltime, leveltime, rest_bonus, logout_time, is_logout_resting, resettalents_cost, resettalents_time, trans_x, trans_y, trans_z, trans_o, transguid, extra_flags, stable_slots, at_login, zone, online, death_expire_time, taxi_path, dungeon_difficulty, arena_pending_points,bgid,bgteam,bgmap,bgx,bgy,bgz,bgo FROM characters WHERE guid = '%u'", guid); QueryResult *result = holder->GetResult(PLAYER_LOGIN_QUERY_LOADFROM); if(!result) { - sLog.outError("ERROR: Player (GUID: %u) not found in table `characters`, can't load. ",guid); + sLog.outError("Player (GUID: %u) not found in table `characters`, can't load. ",guid); return false; } @@ -13861,7 +14434,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // player should be able to load/delete character only with correct account! if( dbAccountId != GetSession()->GetAccountId() ) { - sLog.outError("ERROR: Player (GUID: %u) loading from wrong account (is: %u, should be: %u)",guid,GetSession()->GetAccountId(),dbAccountId); + sLog.outError("Player (GUID: %u) loading from wrong account (is: %u, should be: %u)",guid,GetSession()->GetAccountId(),dbAccountId); delete result; return false; } @@ -13880,7 +14453,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!LoadValues( fields[2].GetString())) { - sLog.outError("ERROR: Player #%d have broken data in `data` field. Can't be loaded.",GUID_LOPART(guid)); + sLog.outError("Player #%d have broken data in `data` field. Can't be loaded.",GUID_LOPART(guid)); delete result; return false; } @@ -13912,23 +14485,19 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) //Need to call it to initialize m_team (m_team can be calculated from m_race) //Other way is to saves m_team into characters table. setFactionForRace(m_race); - SetCharm(0); + SetMover(this); m_class = fields[5].GetUInt8(); - PlayerInfo const *info = objmgr.GetPlayerInfo(m_race, m_class); - if(!info) - { - sLog.outError("Player have incorrect race/class pair. Can't be loaded."); - delete result; + // load home bind and check in same time class/race pair, it used later for restore broken positions + if(!_LoadHomeBind(holder->GetResult(PLAYER_LOGIN_QUERY_LOADHOMEBIND))) return false; - } InitPrimaryProffesions(); // to max set before any spell loaded + // init saved position, and fix it later if problematic uint32 transGUID = fields[24].GetUInt32(); Relocate(fields[6].GetFloat(),fields[7].GetFloat(),fields[8].GetFloat(),fields[10].GetFloat()); - SetFallInformation(0, fields[8].GetFloat()); SetMapId(fields[9].GetUInt32()); SetDifficulty(fields[32].GetUInt32()); // may be changed in _LoadGroup @@ -13962,10 +14531,8 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!IsPositionValid()) { - sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); - - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + sLog.outError("Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + RelocateToHomebind(); transGUID = 0; @@ -13975,49 +14542,57 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) m_movementInfo.t_o = 0.0f; } - if(!_LoadHomeBind(holder->GetResult(PLAYER_LOGIN_QUERY_LOADHOMEBIND))) - return false; + uint32 bgid = fields[34].GetUInt32(); + uint32 bgteam = fields[35].GetUInt32(); - // load the player's map here if it's not already loaded - Map *map = GetMap(); - if (!map) + if(bgid) //saved in BattleGround { - AreaTrigger const* at = objmgr.GetGoBackTrigger(GetMapId()); - if(at) + SetBattleGroundEntryPoint(fields[36].GetUInt32(),fields[37].GetFloat(),fields[38].GetFloat(),fields[39].GetFloat(),fields[40].GetFloat()); + + // check entry point and fix to homebind if need + MapEntry const* mapEntry = sMapStore.LookupEntry(m_bgEntryPoint.mapid); + if(!mapEntry || mapEntry->Instanceable() || !MapManager::IsValidMapCoord(m_bgEntryPoint)) + SetBattleGroundEntryPoint(m_homebindMapId,m_homebindX,m_homebindY,m_homebindZ,0.0f); + + BattleGround *currentBg = sBattleGroundMgr.GetBattleGround(bgid, BATTLEGROUND_TYPE_NONE); + + if(currentBg && currentBg->IsPlayerInBattleGround(GetGUID())) { - SetMapId(at->target_mapId); - Relocate(at->target_X, at->target_Y, at->target_Z, GetOrientation()); - sLog.outError("Player (guidlow %d) is teleported to gobacktrigger (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + BattleGroundQueueTypeId bgQueueTypeId = sBattleGroundMgr.BGQueueTypeId(currentBg->GetTypeID(), currentBg->GetArenaType()); + uint32 queueSlot = AddBattleGroundQueueId(bgQueueTypeId); + + SetBattleGroundId(currentBg->GetInstanceID(), currentBg->GetTypeID()); + SetBGTeam(bgteam); + + //join player to battleground group + currentBg->EventPlayerLoggedIn(this, GetGUID()); + currentBg->AddOrSetPlayerToCorrectBgGroup(this, GetGUID(), bgteam); + + SetInviteForBattleGroundQueueType(bgQueueTypeId,currentBg->GetInstanceID()); } else { - SetMapId(m_homebindMapId); - Relocate(m_homebindX, m_homebindY, m_homebindZ, GetOrientation()); - sLog.outError("Player (guidlow %d) is teleported to home (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + Relocate(GetBattleGroundEntryPoint()); + //RemoveArenaAuras(true); } - - map = GetMap(); - if(!map) + } + else + { + MapEntry const* mapEntry = sMapStore.LookupEntry(GetMapId()); + // if server restart after player save in BG or area + // player can have current coordinates in to BG/Arean map, fix this + if(!mapEntry || mapEntry->IsBattleGroundOrArena()) { - sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); - - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + // return to BG master + SetMapId(fields[36].GetUInt32()); + Relocate(fields[37].GetFloat(),fields[38].GetFloat(),fields[39].GetFloat(),fields[40].GetFloat()); - map = GetMap(); - if(!map) - { - sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); - sLog.outError("CRASH."); - assert(false); - } + // check entry point and fix to homebind if need + mapEntry = sMapStore.LookupEntry(GetMapId()); + if(!mapEntry || mapEntry->IsBattleGroundOrArena() || !IsPositionValid()) + RelocateToHomebind(); } } - // since the player may not be bound to the map yet, make sure subsequent - // getmap calls won't create new maps - SetInstanceId(map->GetInstanceId()); - - SaveRecallPosition(); if (transGUID != 0) { @@ -14032,12 +14607,11 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // transport size limited m_movementInfo.t_x > 50 || m_movementInfo.t_y > 50 || m_movementInfo.t_z > 50 ) { - sLog.outError("ERROR: Player (guidlow %d) have invalid transport coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.", + sLog.outError("Player (guidlow %d) have invalid transport coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.", guid,GetPositionX()+m_movementInfo.t_x,GetPositionY()+m_movementInfo.t_y, GetPositionZ()+m_movementInfo.t_z,GetOrientation()+m_movementInfo.t_o); - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + RelocateToHomebind(); m_movementInfo.t_x = 0.0f; m_movementInfo.t_y = 0.0f; @@ -14054,6 +14628,14 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) { if( (*iter)->GetGUIDLow() == transGUID) { + MapEntry const* transMapEntry = sMapStore.LookupEntry((*iter)->GetMapId()); + // client without expansion support + if(GetSession()->Expansion() < transMapEntry->Expansion()) + { + sLog.outDebug("Player %s using client without required expansion tried login at transport at non accessible map %u", GetName(), (*iter)->GetMapId()); + break; + } + m_transport = *iter; m_transport->AddPassenger(this); SetMapId(m_transport->GetMapId()); @@ -14063,11 +14645,10 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!m_transport) { - sLog.outError("ERROR: Player (guidlow %d) have invalid transport guid (%u). Teleport to default race/class locations.", + sLog.outError("Player (guidlow %d) have problems with transport guid (%u). Teleport to default race/class locations.", guid,transGUID); - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + RelocateToHomebind(); m_movementInfo.t_x = 0.0f; m_movementInfo.t_y = 0.0f; @@ -14077,6 +14658,71 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) transGUID = 0; } } + else // not transport case + { + MapEntry const* mapEntry = sMapStore.LookupEntry(GetMapId()); + // client without expansion support + if(GetSession()->Expansion() < mapEntry->Expansion()) + { + sLog.outDebug("Player %s using client without required expansion tried login at non accessible map %u", GetName(), GetMapId()); + RelocateToHomebind(); + } + } + + // NOW player must have valid map + // load the player's map here if it's not already loaded + Map *map = GetMap(); + + if (!map) + { + AreaTrigger const* at = objmgr.GetGoBackTrigger(GetMapId()); + if(at) + { + SetMapId(at->target_mapId); + Relocate(at->target_X, at->target_Y, at->target_Z, GetOrientation()); + sLog.outError("Player (guidlow %d) is teleported to gobacktrigger (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + } + else + { + RelocateToHomebind(); + sLog.outError("Player (guidlow %d) is teleported to home (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + } + + map = GetMap(); + if(!map) + { + sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + delete result; + return false; + + /*SetMapId(info->mapId); + Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + + map = GetMap(); + if(!map) + { + sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + sLog.outError("CRASH."); + assert(false); + }*/ + } + } + + // since the player may not be bound to the map yet, make sure subsequent + // getmap calls won't create new maps + SetInstanceId(map->GetInstanceId()); + + // if the player is in an instance and it has been reset in the meantime teleport him to the entrance + if(GetInstanceId() && !sInstanceSaveManager.GetInstanceSave(GetInstanceId())) + { + AreaTrigger const* at = objmgr.GetMapEntranceTrigger(GetMapId()); + if(at) + Relocate(at->target_X, at->target_Y, at->target_Z, at->target_Orientation); + else + sLog.outError("Player %s(GUID: %u) logged in to a reset instance (map: %u) and there is no aretrigger leading to this map. Thus he can't be ported back to the entrance. This _might_ be an exploit attempt.", GetName(), GetGUIDLow(), GetMapId()); + } + + SaveRecallPosition(); time_t now = time(NULL); time_t logoutTime = time_t(fields[16].GetUInt64()); @@ -14127,10 +14773,10 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) uint32 extraflags = fields[25].GetUInt32(); m_stableSlots = fields[26].GetUInt32(); - if(m_stableSlots > 2) + if(m_stableSlots > 4) { - sLog.outError("Player can have not more 2 stable slots, but have in DB %u",uint32(m_stableSlots)); - m_stableSlots = 2; + sLog.outError("Player can have not more 4 stable slots, but have in DB %u",uint32(m_stableSlots)); + m_stableSlots = 4; } m_atLoginFlags = fields[27].GetUInt32(); @@ -14153,35 +14799,17 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) SetUInt32Value(UNIT_CHANNEL_SPELL,0); // clear charm/summon related fields - SetCharm(NULL); - SetPet(NULL); - SetCharmerGUID(NULL); - SetOwnerGUID(NULL); - SetCreatorGUID(NULL); + SetUInt64Value(UNIT_FIELD_CHARM, 0); + SetUInt64Value(UNIT_FIELD_SUMMON, 0); + SetCharmerGUID(0); + SetOwnerGUID(0); + SetCreatorGUID(0); // reset some aura modifiers before aura apply - SetFarSight(NULL); SetUInt32Value(PLAYER_TRACK_CREATURES, 0 ); SetUInt32Value(PLAYER_TRACK_RESOURCES, 0 ); - // reset skill modifiers and set correct unlearn flags - for (uint32 i = 0; i < PLAYER_MAX_SKILLS; i++) - { - SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); - - // set correct unlearn bit - uint32 id = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; - if(!id) continue; - - SkillLineEntry const *pSkill = sSkillLineStore.LookupEntry(id); - if(!pSkill) continue; - - // enable unlearn button for primary professions only - if (pSkill->categoryId == SKILL_CATEGORY_PROFESSION) - SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,1)); - else - SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,0)); - } + _LoadSkills(); // make sure the unit is considered out of combat for proper loading ClearInCombat(); @@ -14199,6 +14827,8 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // reset stats before loading any modifiers InitStatsForLevel(); InitTaxiNodesForLevel(); + InitGlyphsForLevel(); + InitRunes(); // apply original stats mods before spell loading or item equipment that call before equip _RemoveStatsMods() @@ -14206,6 +14836,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) //_LoadMail(); _LoadAuras(holder->GetResult(PLAYER_LOGIN_QUERY_LOADAURAS), time_diff); + _LoadGlyphAuras(); // add ghost flag (must be after aura load: PLAYER_FLAGS_GHOST set in aura) if( HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_GHOST) ) @@ -14213,14 +14844,14 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) _LoadSpells(holder->GetResult(PLAYER_LOGIN_QUERY_LOADSPELLS)); - // after spell load - InitTalentForLevel(); - learnSkillRewardedSpells(); - // after spell load, learn rewarded spell if need also _LoadQuestStatus(holder->GetResult(PLAYER_LOGIN_QUERY_LOADQUESTSTATUS)); _LoadDailyQuestStatus(holder->GetResult(PLAYER_LOGIN_QUERY_LOADDAILYQUESTSTATUS)); + // after spell and quest load + InitTalentForLevel(); + learnDefaultSpells(); + _LoadTutorials(holder->GetResult(PLAYER_LOGIN_QUERY_LOADTUTORIALS)); // must be before inventory (some items required reputation check) @@ -14238,9 +14869,6 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) m_social = sSocialMgr.LoadFromDB(holder->GetResult(PLAYER_LOGIN_QUERY_LOADSOCIALLIST), GetGUIDLow()); - //if(!_LoadHomeBind(holder->GetResult(PLAYER_LOGIN_QUERY_LOADHOMEBIND))) - // return false; - // check PLAYER_CHOSEN_TITLE compatibility with PLAYER__FIELD_KNOWN_TITLES // note: PLAYER__FIELD_KNOWN_TITLES updated at quest status loaded if(uint32 curTitle = GetUInt32Value(PLAYER_CHOSEN_TITLE)) @@ -14250,7 +14878,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) } // Not finish taxi flight path - if(!m_taxi.LoadTaxiDestinationsFromString(taxi_nodes)) + if(!m_taxi.LoadTaxiDestinationsFromString(taxi_nodes,GetTeam())) { // problems with taxi path loading TaxiNodesEntry const* nodeEntry = NULL; @@ -14260,8 +14888,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!nodeEntry) // don't know taxi start node, to homebind { sLog.outError("Character %u have wrong data in taxi destination list, teleport to homebind.",GetGUIDLow()); - SetMapId(m_homebindMapId); - Relocate( m_homebindX, m_homebindY, m_homebindZ,0.0f); + RelocateToHomebind(); SaveRecallPosition(); // save as recall also to prevent recall and fall from sky } else // have start node, to it @@ -14286,6 +14913,9 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // flight will started later } + // has to be called after last Relocate() in Player::LoadFromDB + SetFallInformation(0, GetPositionZ()); + _LoadSpellCooldowns(holder->GetResult(PLAYER_LOGIN_QUERY_LOADSPELLCOOLDOWNS)); // Spell code allow apply any auras to dead character in load time in aura/spell/item loading @@ -14319,6 +14949,28 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) break; } + switch(sWorld.getConfig(CONFIG_GM_VISIBLE_STATE)) + { + default: + case 0: SetGMVisible(false); break; // invisible + case 1: break; // visible + case 2: // save state + if(extraflags & PLAYER_EXTRA_GM_INVISIBLE) + SetGMVisible(false); + break; + } + + /*switch(sWorld.getConfig(CONFIG_GM_ACCEPT_TICKETS)) + { + default: + case 0: break; // disable + case 1: SetAcceptTicket(true); break; // enable + case 2: // save state + if(extraflags & PLAYER_EXTRA_GM_ACCEPT_TICKETS) + SetAcceptTicket(true); + break; + }*/ + switch(sWorld.getConfig(CONFIG_GM_CHAT)) { default: @@ -14344,6 +14996,8 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) _LoadDeclinedNames(holder->GetResult(PLAYER_LOGIN_QUERY_LOADDECLINEDNAMES)); + m_achievementMgr.LoadFromDB(holder->GetResult(PLAYER_LOGIN_QUERY_LOADACHIEVEMENTS), holder->GetResult(PLAYER_LOGIN_QUERY_LOADCRITERIAPROGRESS)); + m_achievementMgr.CheckAllAchievementCriteria(); return true; } @@ -14381,9 +15035,15 @@ void Player::_LoadActions(QueryResult *result) uint8 button = fields[0].GetUInt8(); - addActionButton(button, fields[1].GetUInt16(), fields[2].GetUInt8(), fields[3].GetUInt8()); + if(addActionButton(button, fields[1].GetUInt16(), fields[2].GetUInt8(), fields[3].GetUInt8())) + m_actionButtons[button].uState = ACTIONBUTTON_UNCHANGED; + else + { + sLog.outError( " ...at loading, and will deleted in DB also"); - m_actionButtons[button].uState = ACTIONBUTTON_UNCHANGED; + // Will deleted in DB at next save (it can create data until save but marked as deleted) + m_actionButtons[button].uState = ACTIONBUTTON_DELETED; + } } while( result->NextRow() ); @@ -14397,10 +15057,6 @@ void Player::_LoadAuras(QueryResult *result, uint32 timediff) for (int i = 0; i < TOTAL_AURAS; i++) m_modAuras[i].clear(); - // all aura related fields - for(int i = UNIT_FIELD_AURA; i <= UNIT_FIELD_AURASTATE; ++i) - SetUInt32Value(i, 0); - //QueryResult *result = CharacterDatabase.PQuery("SELECT caster_guid,spell,effect_index,stackcount,amount,maxduration,remaintime,remaincharges FROM character_aura WHERE guid = '%u'",GetGUIDLow()); if(result) @@ -14446,7 +15102,7 @@ void Player::_LoadAuras(QueryResult *result, uint32 timediff) remaincharges = spellproto->procCharges; } else - remaincharges = -1; + remaincharges = 0; //do not load single target auras (unless they were cast by the player) if (caster_guid != GetGUID() && IsSingleTargetSpell(spellproto)) @@ -14471,6 +15127,36 @@ void Player::_LoadAuras(QueryResult *result, uint32 timediff) CastSpell(this,SPELL_ID_PASSIVE_BATTLE_STANCE,true); } +void Player::_LoadGlyphAuras() +{ + for (uint8 i = 0; i < MAX_GLYPH_SLOT_INDEX; ++i) + { + if (uint32 glyph = GetGlyph(i)) + { + if (GlyphPropertiesEntry const *gp = sGlyphPropertiesStore.LookupEntry(glyph)) + { + if (GlyphSlotEntry const *gs = sGlyphSlotStore.LookupEntry(GetGlyphSlot(i))) + { + if(gp->TypeFlags == gs->TypeFlags) + { + CastSpell(this, gp->SpellId, true); + continue; + } + else + sLog.outError("Player %s has glyph with typeflags %u in slot with typeflags %u, removing.", m_name.c_str(), gp->TypeFlags, gs->TypeFlags); + } + else + sLog.outError("Player %s has not existing glyph slot entry %u on index %u", m_name.c_str(), GetGlyphSlot(i), i); + } + else + sLog.outError("Player %s has not existing glyph entry %u on index %u", m_name.c_str(), glyph, i); + + // On any error remove glyph + SetGlyph(i, 0); + } + } +} + void Player::LoadCorpse() { if( isAlive() ) @@ -14646,15 +15332,16 @@ void Player::_LoadInventory(QueryResult *result, uint32 timediff) // load mailed item which should receive current player void Player::_LoadMailedItems(Mail *mail) { - QueryResult* result = CharacterDatabase.PQuery("SELECT item_guid, item_template FROM mail_items WHERE mail_id='%u'", mail->messageID); + // data needs to be at first place for Item::LoadFromDB + QueryResult* result = CharacterDatabase.PQuery("SELECT data, item_guid, item_template FROM mail_items JOIN item_instance ON item_guid = guid WHERE mail_id='%u'", mail->messageID); if(!result) return; do { Field *fields = result->Fetch(); - uint32 item_guid_low = fields[0].GetUInt32(); - uint32 item_template = fields[1].GetUInt32(); + uint32 item_guid_low = fields[1].GetUInt32(); + uint32 item_template = fields[2].GetUInt32(); mail->AddItem(item_guid_low, item_template); @@ -14670,7 +15357,7 @@ void Player::_LoadMailedItems(Mail *mail) Item *item = NewItemOrBag(proto); - if(!item->LoadFromDB(item_guid_low, 0)) + if(!item->LoadFromDB(item_guid_low, 0, result)) { sLog.outError( "Player::_LoadMailedItems - Item in mail (%u) doesn't exist !!!! - item guid: %u, deleted from mail", mail->messageID, item_guid_low); CharacterDatabase.PExecute("DELETE FROM mail_items WHERE item_guid = '%u'", item_guid_low); @@ -14806,7 +15493,7 @@ void Player::_LoadQuestStatus(QueryResult *result) if (quest_time <= sWorld.GetGameTime()) questStatusData.m_timer = 1; else - questStatusData.m_timer = (quest_time - sWorld.GetGameTime()) * 1000; + questStatusData.m_timer = (quest_time - sWorld.GetGameTime()) * IN_MILISECONDS; } else quest_time = 0; @@ -14851,6 +15538,9 @@ void Player::_LoadQuestStatus(QueryResult *result) if(CharTitlesEntry const* titleEntry = sCharTitlesStore.LookupEntry(pQuest->GetCharTitleId())) SetTitle(titleEntry); } + + if(pQuest->GetBonusTalents()) + m_questRewardTalentCount+=pQuest->GetBonusTalents(); } sLog.outDebug("Quest status is {%u} for quest {%u} for player (GUID: %u)", questStatusData.m_status, quest_id, GetGUIDLow()); @@ -14966,11 +15656,7 @@ void Player::_LoadReputation(QueryResult *result) void Player::_LoadSpells(QueryResult *result) { - for (PlayerSpellMap::iterator itr = m_spells.begin(); itr != m_spells.end(); ++itr) - delete itr->second; - m_spells.clear(); - - //QueryResult *result = CharacterDatabase.PQuery("SELECT spell,slot,active FROM character_spell WHERE guid = '%u'",GetGUIDLow()); + //QueryResult *result = CharacterDatabase.PQuery("SELECT spell,active,disabled FROM character_spell WHERE guid = '%u'",GetGUIDLow()); if(result) { @@ -14978,7 +15664,7 @@ void Player::_LoadSpells(QueryResult *result) { Field *fields = result->Fetch(); - addSpell(fields[0].GetUInt16(), fields[2].GetBool(), false, true, fields[1].GetUInt16(), fields[3].GetBool()); + addSpell(fields[0].GetUInt16(), fields[1].GetBool(), false, false, fields[2].GetBool()); } while( result->NextRow() ); @@ -15050,6 +15736,14 @@ void Player::_LoadBoundInstances(QueryResult *result) // so the value read from the DB may be wrong here but only if the InstanceSave is loaded // and in that case it is not used + MapEntry const* mapEntry = sMapStore.LookupEntry(mapId); + if(!mapEntry || !mapEntry->IsDungeon()) + { + sLog.outError("_LoadBoundInstances: player %s(%d) has bind to not existed or not dungeon map %d", GetName(), GetGUIDLow(), mapId); + CharacterDatabase.PExecute("DELETE FROM character_instance WHERE guid = '%d' AND instance = '%d'", GetGUIDLow(), instanceId); + continue; + } + if(!perm && group) { sLog.outError("_LoadBoundInstances: player %s(%d) is in group %d but has a non-permanent character bind to map %d,%d,%d", GetName(), GetGUIDLow(), GUID_LOPART(group->GetLeaderGUID()), mapId, instanceId, difficulty); @@ -15127,29 +15821,29 @@ InstancePlayerBind* Player::BindToInstance(InstanceSave *save, bool permanent, b void Player::SendRaidInfo() { + uint32 counter = 0; + WorldPacket data(SMSG_RAID_INSTANCE_INFO, 4); - uint32 counter = 0, i; - for(i = 0; i < TOTAL_DIFFICULTIES; i++) - for (BoundInstancesMap::iterator itr = m_boundInstances[i].begin(); itr != m_boundInstances[i].end(); ++itr) - if(itr->second.perm) counter++; + size_t p_counter = data.wpos(); + data << uint32(counter); // placeholder - data << counter; - for(i = 0; i < TOTAL_DIFFICULTIES; i++) + for(int i = 0; i < TOTAL_DIFFICULTIES; ++i) { for (BoundInstancesMap::iterator itr = m_boundInstances[i].begin(); itr != m_boundInstances[i].end(); ++itr) { if(itr->second.perm) { InstanceSave *save = itr->second.save; - data << (save->GetMapId()); - data << (uint32)(save->GetResetTime() - time(NULL)); - data << save->GetInstanceId(); - data << uint32(counter); - counter--; + data << uint32(save->GetMapId()); + data << uint32(save->GetResetTime() - time(NULL)); + data << uint32(save->GetInstanceId()); + data << uint32(save->GetDifficulty()); + ++counter; } } } + data.put<uint32>(p_counter,counter); GetSession()->SendPacket(&data); } @@ -15283,8 +15977,8 @@ bool Player::Satisfy(AccessRequirement const *ar, uint32 target_map, bool report if(missingItem) GetSession()->SendAreaTriggerMessage(GetSession()->GetTrinityString(LANG_LEVEL_MINREQUIRED_AND_ITEM), ar->levelMin, objmgr.GetItemPrototype(missingItem)->Name1); else if(missingKey) - SendTransferAborted(target_map, TRANSFER_ABORT_DIFFICULTY2); - else if(missingHeroicQuest) + SendTransferAborted(target_map, TRANSFER_ABORT_DIFFICULTY); + else if(missingHeroicQuest) GetSession()->SendAreaTriggerMessage(ar->heroicQuestFailedText.c_str()); else if(missingQuest) GetSession()->SendAreaTriggerMessage(ar->questFailedText.c_str()); @@ -15299,6 +15993,13 @@ bool Player::Satisfy(AccessRequirement const *ar, uint32 target_map, bool report bool Player::_LoadHomeBind(QueryResult *result) { + PlayerInfo const *info = objmgr.GetPlayerInfo(getRace(), getClass()); + if(!info) + { + sLog.outError("Player have incorrect race/class pair. Can't be loaded."); + return false; + } + bool ok = false; //QueryResult *result = CharacterDatabase.PQuery("SELECT map,zone,position_x,position_y,position_z FROM character_homebind WHERE guid = '%u'", GUID_LOPART(playerGuid)); if (result) @@ -15311,9 +16012,11 @@ bool Player::_LoadHomeBind(QueryResult *result) m_homebindZ = fields[4].GetFloat(); delete result; - // accept saved data only for valid position (and non instanceable) + MapEntry const* bindMapEntry = sMapStore.LookupEntry(m_homebindMapId); + + // accept saved data only for valid position (and non instanceable), and accessable if( MapManager::IsValidMapCoord(m_homebindMapId,m_homebindX,m_homebindY,m_homebindZ) && - !sMapStore.LookupEntry(m_homebindMapId)->Instanceable() ) + !bindMapEntry->Instanceable() && GetSession()->Expansion() >= bindMapEntry->Expansion()) { ok = true; } @@ -15323,9 +16026,6 @@ bool Player::_LoadHomeBind(QueryResult *result) if(!ok) { - PlayerInfo const *info = objmgr.GetPlayerInfo(getRace(), getClass()); - if(!info) return false; - m_homebindMapId = info->mapId; m_homebindZoneId = info->zoneId; m_homebindX = info->positionX; @@ -15335,7 +16035,7 @@ bool Player::_LoadHomeBind(QueryResult *result) CharacterDatabase.PExecute("INSERT INTO character_homebind (guid,map,zone,position_x,position_y,position_z) VALUES ('%u', '%u', '%u', '%f', '%f', '%f')", GetGUIDLow(), m_homebindMapId, (uint32)m_homebindZoneId, m_homebindX, m_homebindY, m_homebindZ); } - DEBUG_LOG("Setting player home position: mapid is: %u, zoneid is %u, X is %f, Y is %f, Z is %f\n", + DEBUG_LOG("Setting player home position: mapid is: %u, zoneid is %u, X is %f, Y is %f, Z is %f", m_homebindMapId, m_homebindZoneId, m_homebindX, m_homebindY, m_homebindZ); return true; @@ -15353,12 +16053,6 @@ void Player::SaveToDB() // first save/honor gain after midnight will also update the player's honor fields UpdateHonorFields(); - // players aren't saved on battleground maps - uint32 mapid = IsBeingTeleported() ? GetTeleportDest().mapid : GetMapId(); - const MapEntry * me = sMapStore.LookupEntry(mapid); - if(!me || me->IsBattleGroundOrArena()) - return; - int is_save_resting = HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_RESTING) ? 1 : 0; //save, far from tavern/city //save, but in tavern/city @@ -15373,10 +16067,9 @@ void Player::SaveToDB() uint32 tmp_displayid = GetDisplayId(); // Set player sit state to standing on save, also stealth and shifted form - SetByteValue(UNIT_FIELD_BYTES_1, 0, 0); // stand state + SetByteValue(UNIT_FIELD_BYTES_1, 0, UNIT_STAND_STATE_STAND); SetByteValue(UNIT_FIELD_BYTES_2, 3, 0); // shapeshift - SetByteValue(UNIT_FIELD_BYTES_1, 3, 0); // stand flags? - RemoveFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_DISABLE_ROTATE); + RemoveFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_STUNNED); SetDisplayId(GetNativeDisplayId()); bool inworld = IsInWorld(); @@ -15394,23 +16087,14 @@ void Player::SaveToDB() "taximask, online, cinematic, " "totaltime, leveltime, rest_bonus, logout_time, is_logout_resting, resettalents_cost, resettalents_time, " "trans_x, trans_y, trans_z, trans_o, transguid, extra_flags, stable_slots, at_login, zone, " - "death_expire_time, taxi_path, arena_pending_points, latency) VALUES (" + "death_expire_time, taxi_path, arena_pending_points, latency, bgid, bgteam, bgmap, bgx, bgy, bgz, bgo) VALUES (" << GetGUIDLow() << ", " << GetSession()->GetAccountId() << ", '" << sql_name << "', " << m_race << ", " << m_class << ", "; - bool save_to_dest = false; - if(IsBeingTeleported()) - { - // don't save to battlegrounds or arenas - const MapEntry *entry = sMapStore.LookupEntry(GetTeleportDest().mapid); - if(entry && entry->map_type != MAP_BATTLEGROUND && entry->map_type != MAP_ARENA) - save_to_dest = true; - } - - if(!save_to_dest) + if(!IsBeingTeleported()) { ss << GetMapId() << ", " << (uint32)GetDifficulty() << ", " @@ -15435,12 +16119,11 @@ void Player::SaveToDB() ss << GetUInt32Value(i) << " "; } - ss << "', '"; + ss << "', "; - for( i = 0; i < 8; i++ ) - ss << m_taxi.GetTaximask(i) << " "; + ss << m_taxi; // string with TaxiMaskSize numbers - ss << "', "; + ss << ", "; ss << (inworld ? 1 : 0); ss << ", "; @@ -15494,9 +16177,19 @@ void Player::SaveToDB() ss << ", '"; ss << m_taxi.SaveTaxiDestinationsToString(); - ss << "', '0', '"; + ss << "', '0', "; ss << GetSession()->GetLatency(); - ss << "' )"; + ss << ", "; + ss << GetBattleGroundId(); + ss << ", "; + ss << GetBGTeam(); + ss << ", "; + ss << m_bgEntryPoint.mapid << ", " + << finiteAlways(m_bgEntryPoint.x) << ", " + << finiteAlways(m_bgEntryPoint.y) << ", " + << finiteAlways(m_bgEntryPoint.z) << ", " + << finiteAlways(m_bgEntryPoint.o); + ss << ")"; CharacterDatabase.Execute( ss.str().c_str() ); @@ -15525,23 +16218,7 @@ void Player::SaveToDB() // save pet (hunter pet level and experience and all type pets health/mana). if(Pet* pet = GetPet()) pet->SavePetToDB(PET_SAVE_AS_CURRENT); - - //to prevent access to DB we should cache some data, which is used very often - CachePlayerInfoMap::iterator _iter = objmgr.m_mPlayerInfoMap.find(GetGUIDLow()); - if(_iter != objmgr.m_mPlayerInfoMap.end())//skip new players - { - _iter->second->unLevel = getLevel(); - - _iter->second->unArenaInfoSlot0 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + 0 * 6 + 5); - _iter->second->unArenaInfoSlot1 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + 1 * 6 + 5); - _iter->second->unArenaInfoSlot2 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + 2 * 6 + 5); - - _iter->second->unfield = GetUInt32Value(UNIT_FIELD_BYTES_0); - - _iter->second->unArenaInfoId0 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + (0 * 6)); - _iter->second->unArenaInfoId1 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + (1 * 6)); - _iter->second->unArenaInfoId2 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + (2 * 6)); - } + m_achievementMgr.SaveToDB(); } // fast save function for item/money cheating preventing - save only inventory and money state @@ -15600,6 +16277,7 @@ void Player::_SaveAuras() AuraMap::const_iterator itr2 = itr; // save previous spellEffectPair to db itr2--; + SpellEntry const *spellInfo = itr2->second->GetSpellProto(); //skip all auras from spells that are passive or need a shapeshift @@ -15619,7 +16297,7 @@ void Player::_SaveAuras() { CharacterDatabase.PExecute("INSERT INTO character_aura (guid,caster_guid,spell,effect_index,stackcount,amount,maxduration,remaintime,remaincharges) " "VALUES ('%u', '" I64FMTD "' ,'%u', '%u', '%u', '%d', '%d', '%d', '%d')", - GetGUIDLow(), itr2->second->GetCasterGUID(), (uint32)itr2->second->GetId(), (uint32)itr2->second->GetEffIndex(), (uint32)itr2->second->GetStackAmount(), itr2->second->GetModifier()->m_amount,int(itr2->second->GetAuraMaxDuration()),int(itr2->second->GetAuraDuration()),int(itr2->second->m_procCharges)); + GetGUIDLow(), itr2->second->GetCasterGUID(), (uint32)itr2->second->GetId(), (uint32)itr2->second->GetEffIndex(), (uint32)itr2->second->GetStackAmount(), itr2->second->GetModifier()->m_amount ,int(itr2->second->GetAuraMaxDuration()),int(itr2->second->GetAuraDuration()),int(itr2->second->GetAuraCharges())); } } } @@ -15775,11 +16453,11 @@ void Player::_SaveQuestStatus() case QUEST_NEW : CharacterDatabase.PExecute("INSERT INTO character_queststatus (guid,quest,status,rewarded,explored,timer,mobcount1,mobcount2,mobcount3,mobcount4,itemcount1,itemcount2,itemcount3,itemcount4) " "VALUES ('%u', '%u', '%u', '%u', '%u', '" I64FMTD "', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u')", - GetGUIDLow(), i->first, i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / 1000 + sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3]); + GetGUIDLow(), i->first, i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / IN_MILISECONDS+ sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3]); break; case QUEST_CHANGED : CharacterDatabase.PExecute("UPDATE character_queststatus SET status = '%u',rewarded = '%u',explored = '%u',timer = '" I64FMTD "',mobcount1 = '%u',mobcount2 = '%u',mobcount3 = '%u',mobcount4 = '%u',itemcount1 = '%u',itemcount2 = '%u',itemcount3 = '%u',itemcount4 = '%u' WHERE guid = '%u' AND quest = '%u' ", - i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / 1000 + sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3], GetGUIDLow(), i->first ); + i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / IN_MILISECONDS + sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3], GetGUIDLow(), i->first ); break; case QUEST_UNCHANGED: break; @@ -15820,18 +16498,26 @@ void Player::_SaveReputation() void Player::_SaveSpells() { - for (PlayerSpellMap::const_iterator itr = m_spells.begin(), next = m_spells.begin(); itr != m_spells.end(); itr = next) + for (PlayerSpellMap::iterator itr = m_spells.begin(), next = m_spells.begin(); itr != m_spells.end();) { - ++next; if (itr->second->state == PLAYERSPELL_REMOVED || itr->second->state == PLAYERSPELL_CHANGED) CharacterDatabase.PExecute("DELETE FROM character_spell WHERE guid = '%u' and spell = '%u'", GetGUIDLow(), itr->first); - if (itr->second->state == PLAYERSPELL_NEW || itr->second->state == PLAYERSPELL_CHANGED) - CharacterDatabase.PExecute("INSERT INTO character_spell (guid,spell,slot,active,disabled) VALUES ('%u', '%u', '%u','%u','%u')", GetGUIDLow(), itr->first, itr->second->slotId,itr->second->active ? 1 : 0,itr->second->disabled ? 1 : 0); + + // add only changed/new not dependent spells + if (!itr->second->dependent && (itr->second->state == PLAYERSPELL_NEW || itr->second->state == PLAYERSPELL_CHANGED)) + CharacterDatabase.PExecute("INSERT INTO character_spell (guid,spell,active,disabled) VALUES ('%u', '%u', '%u', '%u')", GetGUIDLow(), itr->first, itr->second->active ? 1 : 0,itr->second->disabled ? 1 : 0); if (itr->second->state == PLAYERSPELL_REMOVED) - _removeSpell(itr->first); + { + delete itr->second; + m_spells.erase(itr++); + } else + { itr->second->state = PLAYERSPELL_UNCHANGED; + ++itr; + } + } } @@ -16003,6 +16689,42 @@ void Player::SetFloatValueInDB(uint16 index, float value, uint64 guid) Player::SetUInt32ValueInDB(index, temp, guid); } +void Player::Customize(uint64 guid, uint8 gender, uint8 skin, uint8 face, uint8 hairStyle, uint8 hairColor, uint8 facialHair) +{ + Tokens tokens; + if(!LoadValuesArrayFromDB(tokens, guid)) + return; + + uint32 unit_bytes0 = GetUInt32ValueFromArray(tokens, UNIT_FIELD_BYTES_0); + uint8 race = unit_bytes0 & 0xFF; + uint8 class_ = (unit_bytes0 >> 8) & 0xFF; + + PlayerInfo const* info = objmgr.GetPlayerInfo(race, class_); + if(!info) + return; + + unit_bytes0 &= ~(0xFF << 16); + unit_bytes0 |= (gender << 16); + SetUInt32ValueInArray(tokens, UNIT_FIELD_BYTES_0, unit_bytes0); + + SetUInt32ValueInArray(tokens, UNIT_FIELD_DISPLAYID, gender ? info->displayId_f : info->displayId_m); + SetUInt32ValueInArray(tokens, UNIT_FIELD_NATIVEDISPLAYID, gender ? info->displayId_f : info->displayId_m); + + SetUInt32ValueInArray(tokens, PLAYER_BYTES, (skin | (face << 8) | (hairStyle << 16) | (hairColor << 24))); + + uint32 player_bytes2 = GetUInt32ValueFromArray(tokens, PLAYER_BYTES_2); + player_bytes2 &= ~0xFF; + player_bytes2 |= facialHair; + SetUInt32ValueInArray(tokens, PLAYER_BYTES_2, player_bytes2); + + uint32 player_bytes3 = GetUInt32ValueFromArray(tokens, PLAYER_BYTES_3); + player_bytes3 &= ~0xFF; + player_bytes3 |= gender; + SetUInt32ValueInArray(tokens, PLAYER_BYTES_3, player_bytes3); + + SaveValuesArrayInDB(tokens, guid); +} + void Player::SendAttackSwingNotStanding() { WorldPacket data(SMSG_ATTACKSWING_NOTSTANDING, 0); @@ -16035,7 +16757,8 @@ void Player::SendAttackSwingBadFacingAttack() void Player::SendAutoRepeatCancel() { - WorldPacket data(SMSG_CANCEL_AUTO_REPEAT, 0); + WorldPacket data(SMSG_CANCEL_AUTO_REPEAT, GetPackGUID().size()); + data.append(GetPackGUID()); // may be it's target guid GetSession()->SendPacket( &data ); } @@ -16226,19 +16949,10 @@ void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) // only if current pet in slot switch(pet->getPetType()) { - case MINI_PET: - m_miniPet = 0; - break; - case GUARDIAN_PET: - m_guardianPets.erase(pet->GetGUID()); - break; case POSSESSED_PET: - m_guardianPets.erase(pet->GetGUID()); pet->RemoveCharmedOrPossessedBy(NULL); - break; default: - if(GetPetGUID() == pet->GetGUID()) - SetPet(NULL); + SetPet(pet, false); break; } @@ -16266,8 +16980,9 @@ void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) if(pet->isControlled()) { - WorldPacket data(SMSG_PET_SPELLS, 8); + WorldPacket data(SMSG_PET_SPELLS, 8+4); data << uint64(0); + data << uint32(0); GetSession()->SendPacket(&data); if(GetGroup()) @@ -16275,57 +16990,20 @@ void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) } } -void Player::RemoveMiniPet() -{ - if(Pet* pet = GetMiniPet()) - { - pet->Remove(PET_SAVE_AS_DELETED); - m_miniPet = 0; - } -} - -Pet* Player::GetMiniPet() -{ - if(!m_miniPet) - return NULL; - return ObjectAccessor::GetPet(m_miniPet); -} - -void Player::RemoveGuardians() -{ - while(!m_guardianPets.empty()) - { - uint64 guid = *m_guardianPets.begin(); - if(Pet* pet = ObjectAccessor::GetPet(guid)) - pet->Remove(PET_SAVE_AS_DELETED); - - m_guardianPets.erase(guid); - } -} - -bool Player::HasGuardianWithEntry(uint32 entry) -{ - // pet guid middle part is entry (and creature also) - // and in guardian list must be guardians with same entry _always_ - for(GuardianPetList::const_iterator itr = m_guardianPets.begin(); itr != m_guardianPets.end(); ++itr) - if(GUID_ENPART(*itr)==entry) - return true; - - return false; -} - -void Player::Uncharm() +void Player::StopCastingCharm() { Unit* charm = GetCharm(); if(!charm) return; - if(charm->GetTypeId() == TYPEID_UNIT && ((Creature*)charm)->isPet() - && ((Pet*)charm)->getPetType() == POSSESSED_PET) + if(charm->GetTypeId() == TYPEID_UNIT) { - ((Pet*)charm)->Remove(PET_SAVE_AS_DELETED); + if(((Creature*)charm)->isPet() && ((Pet*)charm)->getPetType() == POSSESSED_PET) + ((Pet*)charm)->Remove(PET_SAVE_AS_DELETED); + else if(((Creature*)charm)->isVehicle()) + ExitVehicle((Vehicle*)charm); } - else + if(GetCharmGUID()) { charm->RemoveSpellsCausingAura(SPELL_AURA_MOD_CHARM); charm->RemoveSpellsCausingAura(SPELL_AURA_MOD_POSSESS_PET); @@ -16414,71 +17092,86 @@ void Player::PetSpellInitialize() { Pet* pet = GetPet(); - if(pet) - { - uint8 addlist = 0; + if(!pet) + return; - sLog.outDebug("Pet Spells Groups"); + sLog.outDebug("Pet Spells Groups"); - CreatureInfo const *cinfo = pet->GetCreatureInfo(); + CharmInfo *charmInfo = pet->GetCharmInfo(); - if(pet->isControlled() && (pet->getPetType() == HUNTER_PET || cinfo && cinfo->type == CREATURE_TYPE_DEMON && getClass() == CLASS_WARLOCK)) - { - for(PetSpellMap::iterator itr = pet->m_spells.begin();itr != pet->m_spells.end();++itr) - { - if(itr->second->state == PETSPELL_REMOVED) - continue; - ++addlist; - } - } + WorldPacket data(SMSG_PET_SPELLS, 8+4+4+4+10*4); + data << uint64(pet->GetGUID()); + data << uint32(pet->GetCreatureInfo()->family); // creature family (required for pet talents) + data << uint32(0); + data << uint8(pet->GetReactState()) << uint8(charmInfo->GetCommandState()) << uint16(0); - // first line + actionbar + spellcount + spells + last adds - WorldPacket data(SMSG_PET_SPELLS, 16+40+1+4*addlist+25); + // action bar loop + for(uint32 i = 0; i < MAX_SPELL_CONTROL_BAR; ++i) + { + data << uint32(charmInfo->GetActionBarEntry(i)->Raw); + } - CharmInfo *charmInfo = pet->GetCharmInfo(); + size_t spellsCountPos = data.wpos(); - //16 - data << (uint64)pet->GetGUID() << uint32(0x00000000) << uint8(pet->GetReactState()) << uint8(charmInfo->GetCommandState()) << uint16(0); + // spells count + uint8 addlist = 0; + data << uint8(addlist); // placeholder - for(uint32 i = 0; i < 10; i++) //40 + if(pet->isControlled() && ((pet->getPetType() == HUNTER_PET) || ((pet->GetCreatureInfo()->type == CREATURE_TYPE_DEMON) && (getClass() == CLASS_WARLOCK)))) + { + // spells loop + for (PetSpellMap::iterator itr = pet->m_spells.begin(); itr != pet->m_spells.end(); ++itr) { - data << uint16(charmInfo->GetActionBarEntry(i)->SpellOrAction) << uint16(charmInfo->GetActionBarEntry(i)->Type); + if(itr->second->state == PETSPELL_REMOVED) + continue; + + data << uint16(itr->first); + data << uint16(itr->second->active); // pet spell active state isn't boolean + ++addlist; } + } - data << uint8(addlist); //1 + data.put<uint8>(spellsCountPos, addlist); - if(addlist && pet->isControlled()) - { - for (PetSpellMap::iterator itr = pet->m_spells.begin(); itr != pet->m_spells.end(); ++itr) - { - if(itr->second->state == PETSPELL_REMOVED) - continue; + uint8 cooldownsCount = pet->m_CreatureSpellCooldowns.size() + pet->m_CreatureCategoryCooldowns.size(); + data << uint8(cooldownsCount); - data << uint16(itr->first); - data << uint16(itr->second->active); // pet spell active state isn't boolean - } - } + time_t curTime = time(NULL); - //data << uint8(0x01) << uint32(0x6010) << uint32(0x01) << uint32(0x05) << uint16(0x00); //15 - uint8 count = 3; //1+8+8+8=25 + for(CreatureSpellCooldowns::const_iterator itr = pet->m_CreatureSpellCooldowns.begin(); itr != pet->m_CreatureSpellCooldowns.end(); ++itr) + { + time_t cooldown = 0; - // if count = 0, then end of packet... - data << count; - // uint32 value is spell id... - // uint64 value is constant 0, unknown... - data << uint32(0x6010) << uint64(0); // if count = 1, 2 or 3 - //data << uint32(0x5fd1) << uint64(0); // if count = 2 - data << uint32(0x8e8c) << uint64(0); // if count = 3 - data << uint32(0x8e8b) << uint64(0); // if count = 3 + if(itr->second > curTime) + cooldown = (itr->second - curTime) * IN_MILISECONDS; - GetSession()->SendPacket(&data); + data << uint16(itr->first); // spellid + data << uint16(0); // spell category? + data << uint32(itr->second); // cooldown + data << uint32(0); // category cooldown } + + for(CreatureSpellCooldowns::const_iterator itr = pet->m_CreatureCategoryCooldowns.begin(); itr != pet->m_CreatureCategoryCooldowns.end(); ++itr) + { + time_t cooldown = 0; + + if(itr->second > curTime) + cooldown = (itr->second - curTime) * IN_MILISECONDS; + + data << uint16(itr->first); // spellid + data << uint16(0); // spell category? + data << uint32(0); // cooldown + data << uint32(itr->second); // category cooldown + } + + data.hexlike(); + + GetSession()->SendPacket(&data); } void Player::PossessSpellInitialize() { Unit* charm = GetCharm(); - if(!charm) return; @@ -16490,32 +17183,69 @@ void Player::PossessSpellInitialize() return; } - uint8 addlist = 0; - WorldPacket data(SMSG_PET_SPELLS, 16+40+1+4*addlist+25);// first line + actionbar + spellcount + spells + last adds + WorldPacket data(SMSG_PET_SPELLS, 20+40+1+1); - //16 - data << (uint64)charm->GetGUID() << uint32(0x00000000) << uint8(0) << uint8(0) << uint16(0); + //basic info 20 + data << uint64(charm->GetGUID()); + data << uint32(0x00000000); + data << uint32(0); + data << uint32(0); - for(uint32 i = 0; i < 10; i++) //40 - { + //action bar 40 + for(uint32 i = 0; i < 10; i++) data << uint16(charmInfo->GetActionBarEntry(i)->SpellOrAction) << uint16(charmInfo->GetActionBarEntry(i)->Type); - } - data << uint8(addlist); //1 + //addlist 1 + data << uint8(0); - uint8 count = 3; - data << count; - data << uint32(0x6010) << uint64(0); // if count = 1, 2 or 3 - data << uint32(0x8e8c) << uint64(0); // if count = 3 - data << uint32(0x8e8b) << uint64(0); // if count = 3 + //cooldown 1 + data << uint8(0); GetSession()->SendPacket(&data); } -void Player::CharmSpellInitialize() +void Player::VehicleSpellInitialize() { Unit* charm = GetCharm(); + if(!charm || charm->GetTypeId() != TYPEID_UNIT) + return; + + WorldPacket data(SMSG_PET_SPELLS, 8+4+4+4+4*10+1+1); + data << uint64(charm->GetGUID()); + data << uint32(0x00000000); + data << uint32(0x00000000); + data << uint32(0x00000101); + + for(uint32 i = 0; i < CREATURE_MAX_SPELLS; ++i) + { + uint32 spellId = ((Creature*)charm)->m_spells[i]; + if(!spellId) + continue; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellId); + if(!spellInfo) + continue; + + if(IsPassiveSpell(spellId) || spellInfo->activeIconID == 2158) //flight + { + charm->CastSpell(charm, spellId, true); + data << uint16(0) << uint8(0) << uint8(i+8); + } + else + data << uint16(spellId) << uint8(0) << uint8(i+8); + } + + for(uint32 i = CREATURE_MAX_SPELLS; i < MAX_SPELL_CONTROL_BAR; ++i) + data << uint16(0) << uint8(0) << uint8(i+8); + + data << uint8(0); + data << uint8(0); + GetSession()->SendPacket(&data); +} +void Player::CharmSpellInitialize() +{ + Unit* charm = GetFirstControlled(); if(!charm) return; @@ -16527,14 +17257,12 @@ void Player::CharmSpellInitialize() } uint8 addlist = 0; - if(charm->GetTypeId() != TYPEID_PLAYER) { CreatureInfo const *cinfo = ((Creature*)charm)->GetCreatureInfo(); - - if(cinfo && cinfo->type == CREATURE_TYPE_DEMON && getClass() == CLASS_WARLOCK) + //if(cinfo && cinfo->type == CREATURE_TYPE_DEMON && getClass() == CLASS_WARLOCK) { - for(uint32 i = 0; i < CREATURE_MAX_SPELLS; ++i) + for(uint32 i = 0; i < MAX_SPELL_CHARM; ++i) { if(charmInfo->GetCharmSpell(i)->spellId) ++addlist; @@ -16542,27 +17270,29 @@ void Player::CharmSpellInitialize() } } - WorldPacket data(SMSG_PET_SPELLS, 16+40+1+4*addlist+25);// first line + actionbar + spellcount + spells + last adds - - data << (uint64)charm->GetGUID() << uint32(0x00000000); + WorldPacket data(SMSG_PET_SPELLS, 20+40+1+4*addlist+1);// first line + actionbar + spellcount + spells + last adds + //basic info 20 + data << uint64(charm->GetGUID()); + data << uint32(0); + data << uint32(0); if(charm->GetTypeId() != TYPEID_PLAYER) data << uint8(((Creature*)charm)->GetReactState()) << uint8(charmInfo->GetCommandState()); else data << uint8(0) << uint8(0); - data << uint16(0); - for(uint32 i = 0; i < 10; i++) //40 + //action bar 40 + for(uint32 i = 0; i < MAX_SPELL_CONTROL_BAR; ++i) //40 { data << uint16(charmInfo->GetActionBarEntry(i)->SpellOrAction) << uint16(charmInfo->GetActionBarEntry(i)->Type); } + //add list data << uint8(addlist); //1 - if(addlist) { - for(uint32 i = 0; i < CREATURE_MAX_SPELLS; ++i) + for(uint32 i = 0; i < MAX_SPELL_CHARM; ++i) { CharmSpellEntry *cspell = charmInfo->GetCharmSpell(i); if(cspell->spellId) @@ -16573,49 +17303,14 @@ void Player::CharmSpellInitialize() } } - uint8 count = 3; - data << count; - data << uint32(0x6010) << uint64(0); // if count = 1, 2 or 3 - data << uint32(0x8e8c) << uint64(0); // if count = 3 - data << uint32(0x8e8b) << uint64(0); // if count = 3 - - GetSession()->SendPacket(&data); -} - -int32 Player::GetTotalFlatMods(uint32 spellId, SpellModOp op) -{ - SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellId); - if (!spellInfo) return 0; - int32 total = 0; - for (SpellModList::iterator itr = m_spellMods[op].begin(); itr != m_spellMods[op].end(); ++itr) - { - SpellModifier *mod = *itr; - - if(!IsAffectedBySpellmod(spellInfo,mod)) - continue; - - if (mod->type == SPELLMOD_FLAT) - total += mod->value; - } - return total; -} - -int32 Player::GetTotalPctMods(uint32 spellId, SpellModOp op) -{ - SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellId); - if (!spellInfo) return 0; - int32 total = 0; - for (SpellModList::iterator itr = m_spellMods[op].begin(); itr != m_spellMods[op].end(); ++itr) - { - SpellModifier *mod = *itr; + //cooldown + uint8 count = 0; + data << uint8(count); // cooldowns count - if(!IsAffectedBySpellmod(spellInfo,mod)) - continue; + data.hexlike(); + - if (mod->type == SPELLMOD_PCT) - total += mod->value; - } - return total; + GetSession()->SendPacket(&data); } bool Player::IsAffectedBySpellmod(SpellEntry const *spellInfo, SpellModifier *mod, Spell const* spell) @@ -16635,22 +17330,27 @@ bool Player::IsAffectedBySpellmod(SpellEntry const *spellInfo, SpellModifier *mo return false; } - return spellmgr.IsAffectedBySpell(spellInfo,mod->spellId,mod->effectId,mod->mask); + return spellmgr.IsAffectedByMod(spellInfo, mod); } void Player::AddSpellMod(SpellModifier* mod, bool apply) { uint16 Opcode= (mod->type == SPELLMOD_FLAT) ? SMSG_SET_FLAT_SPELL_MODIFIER : SMSG_SET_PCT_SPELL_MODIFIER; - for(int eff=0;eff<64;++eff) + uint8 i=0; + flag96 _mask; + for(int eff=0;eff<96;++eff) { - uint64 _mask = uint64(1) << eff; + if ((eff!=0) && (eff%32==0)) + i++; + + _mask[i] = uint32(1) << (eff-(32*i)); if ( mod->mask & _mask) { int32 val = 0; for (SpellModList::iterator itr = m_spellMods[mod->op].begin(); itr != m_spellMods[mod->op].end(); ++itr) { - if ((*itr)->type == mod->type && (*itr)->mask & _mask) + if ((*itr)->type == mod->type && (*itr)->mask & _mask ) val += (*itr)->value; } val += apply ? mod->value : -(mod->value); @@ -16749,6 +17449,27 @@ void Player::RemovePetitionsAndSigns(uint64 guid, uint32 type) CharacterDatabase.CommitTransaction(); } +void Player::LeaveAllArenaTeams(uint64 guid) +{ + QueryResult *result = CharacterDatabase.PQuery("SELECT arena_team_member.arenateamid FROM arena_team_member JOIN arena_team ON arena_team_member.arenateamid = arena_team.arenateamid WHERE guid='%u'", GUID_LOPART(guid)); + if(!result) + return; + + do + { + Field *fields = result->Fetch(); + uint32 at_id = fields[0].GetUInt32(); + if(at_id != 0) + { + ArenaTeam * at = objmgr.GetArenaTeamById(at_id); + if(at) + at->DelMember(guid); + } + } while (result->NextRow()); + + delete result; +} + void Player::SetRestBonus (float rest_bonus_new) { // Prevent resting on max level @@ -16779,7 +17500,7 @@ void Player::HandleStealthedUnitsDetection() { std::list<Unit*> stealthedUnits; Trinity::AnyStealthedCheck u_check; - Trinity::UnitListSearcher<Trinity::AnyStealthedCheck > searcher(stealthedUnits, u_check); + Trinity::UnitListSearcher<Trinity::AnyStealthedCheck > searcher(this, stealthedUnits, u_check); VisitNearbyObject(World::GetMaxVisibleDistance(), searcher); for (std::list<Unit*>::iterator i = stealthedUnits.begin(); i != stealthedUnits.end(); ++i) @@ -16927,6 +17648,7 @@ bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_i //Checks and preparations done, DO FLIGHT ModifyMoney(-(int32)totalcost); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GOLD_SPENT_FOR_TRAVELLING, totalcost); // prevent stealth flight //RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_TALK); @@ -16969,7 +17691,7 @@ void Player::ProhibitSpellScholl(SpellSchoolMask idSchoolMask, uint32 unTimeMs ) { data << unSpellId; data << unTimeMs; // in m.secs - AddSpellCooldown(unSpellId, 0, curTime + unTimeMs/1000); + AddSpellCooldown(unSpellId, 0, curTime + unTimeMs/IN_MILISECONDS); } } GetSession()->SendPacket(&data); @@ -17336,6 +18058,102 @@ void Player::UpdatePvP(bool state, bool ovrride) } } +void Player::AddSpellAndCategoryCooldowns(SpellEntry const* spellInfo, uint32 itemId, Spell* spell, bool infinityCooldown) +{ + // init cooldown values + uint32 cat = 0; + int32 rec = -1; + int32 catrec = -1; + + // some special item spells without correct cooldown in SpellInfo + // cooldown information stored in item prototype + // This used in same way in WorldSession::HandleItemQuerySingleOpcode data sending to client. + + if(itemId) + { + if(ItemPrototype const* proto = ObjectMgr::GetItemPrototype(itemId)) + { + for(int idx = 0; idx < 5; ++idx) + { + if(proto->Spells[idx].SpellId == spellInfo->Id) + { + cat = proto->Spells[idx].SpellCategory; + rec = proto->Spells[idx].SpellCooldown; + catrec = proto->Spells[idx].SpellCategoryCooldown; + break; + } + } + } + } + + // if no cooldown found above then base at DBC data + if(rec < 0 && catrec < 0) + { + cat = spellInfo->Category; + rec = spellInfo->RecoveryTime; + catrec = spellInfo->CategoryRecoveryTime; + } + + time_t curTime = time(NULL); + + time_t catrecTime; + time_t recTime; + + // overwrite time for selected category + if(infinityCooldown) + { + // use +MONTH as infinity mark for spell cooldown (will checked as MONTH/2 at save ans skipped) + // but not allow ignore until reset or re-login + catrecTime = catrec > 0 ? curTime+MONTH : 0; + recTime = rec > 0 ? curTime+MONTH : catrecTime; + } + else + { + // shoot spells used equipped item cooldown values already assigned in GetAttackTime(RANGED_ATTACK) + // prevent 0 cooldowns set by another way + if (rec <= 0 && catrec <= 0 && (cat == 76 || IsAutoRepeatRangedSpell(spellInfo) && spellInfo->Id != SPELL_ID_AUTOSHOT)) + rec = GetAttackTime(RANGED_ATTACK); + + // Now we have cooldown data (if found any), time to apply mods + if(rec > 0) + ApplySpellMod(spellInfo->Id, SPELLMOD_COOLDOWN, rec, spell); + + if(catrec > 0) + ApplySpellMod(spellInfo->Id, SPELLMOD_COOLDOWN, catrec, spell); + + // replace negative cooldowns by 0 + if (rec < 0) rec = 0; + if (catrec < 0) catrec = 0; + + // no cooldown after applying spell mods + if( rec == 0 && catrec == 0) + return; + + catrecTime = catrec ? curTime+catrec/IN_MILISECONDS : 0; + recTime = rec ? curTime+rec/IN_MILISECONDS : catrecTime; + } + + // self spell cooldown + if(recTime > 0) + AddSpellCooldown(spellInfo->Id, itemId, recTime); + + // category spells + if (cat && catrec > 0) + { + SpellCategoryStore::const_iterator i_scstore = sSpellCategoryStore.find(cat); + if(i_scstore != sSpellCategoryStore.end()) + { + for(SpellCategorySet::const_iterator i_scset = i_scstore->second.begin(); i_scset != i_scstore->second.end(); ++i_scset) + { + if(*i_scset == spellInfo->Id) // skip main spell, already handled above + continue; + + AddSpellCooldown(*i_scset, itemId, catrecTime); + } + } + } +} + void Player::AddSpellCooldown(uint32 spellid, uint32 itemid, time_t end_time) { SpellCooldown sc; @@ -17344,25 +18162,41 @@ void Player::AddSpellCooldown(uint32 spellid, uint32 itemid, time_t end_time) m_spellCooldowns[spellid] = sc; } -void Player::SendCooldownEvent(SpellEntry const *spellInfo) +void Player::SendCooldownEvent(SpellEntry const *spellInfo, uint32 itemId, Spell* spell) { - if ( !(spellInfo->Attributes & SPELL_ATTR_DISABLED_WHILE_ACTIVE) ) - return; + // start cooldowns at server side, if any + AddSpellAndCategoryCooldowns(spellInfo,itemId,spell); - // Get spell cooldown - int32 cooldown = GetSpellRecoveryTime(spellInfo); - // Apply spellmods - ApplySpellMod(spellInfo->Id, SPELLMOD_COOLDOWN, cooldown); - if (cooldown < 0) - cooldown = 0; - // Add cooldown - AddSpellCooldown(spellInfo->Id, 0, time(NULL) + cooldown / 1000); - // Send activate + // Send activate cooldown timer (possible 0) at client side WorldPacket data(SMSG_COOLDOWN_EVENT, (4+8)); data << spellInfo->Id; data << GetGUID(); SendDirectMessage(&data); } + +void Player::UpdatePotionCooldown(Spell* spell) +{ + // no potion used i combat or still in combat + if(!m_lastPotionId || isInCombat()) + return; + + // Call not from spell cast, send cooldown event for item spells if no in combat + if(!spell) + { + // spell/item pair let set proper cooldown (except not existed charged spell cooldown spellmods for potions) + if(ItemPrototype const* proto = ObjectMgr::GetItemPrototype(m_lastPotionId)) + for(int idx = 0; idx < 5; ++idx) + if(proto->Spells[idx].SpellId && proto->Spells[idx].SpellTrigger == ITEM_SPELLTRIGGER_ON_USE) + if(SpellEntry const* spellInfo = sSpellStore.LookupEntry(proto->Spells[idx].SpellId)) + SendCooldownEvent(spellInfo,m_lastPotionId); + } + // from spell cases (m_lastPotionId set in Spell::SendSpellCooldown) + else + SendCooldownEvent(spell->m_spellInfo,m_lastPotionId,spell); + + m_lastPotionId = 0; +} + //slot to be excluded while counting bool Player::EnchantmentFitsRequirements(uint32 enchantmentcondition, int8 slot) { @@ -17579,9 +18413,13 @@ void Player::ReportedAfkBy(Player* reporter) bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool is3dDistance) const { // Always can see self - if (u == this) + if (m_mover == u) return true; + // phased visibility (both must phased in same way) + if(!InSamePhase(u)) + return false; + // player visible for other player if not logout and at same transport // including case when player is out of world bool at_same_transport = @@ -17607,38 +18445,33 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool if(!u->IsVisibleInGridForPlayer(this)) return false; - // If the player is currently channeling vision, update visibility from the target unit's location - const WorldObject* target = GetFarsightTarget(); - if (!target || !HasFarsightVision()) // Vision needs to be on the farsight target - target = this; - // different visible distance checks if(isInFlight()) // what see player in flight { - if (!target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceInFlight()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) + if (!m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceInFlight()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) return false; } else if(!u->isAlive()) // distance for show body { - if (!target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForObject()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) + if (!m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForObject()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) return false; } else if(u->GetTypeId()==TYPEID_PLAYER) // distance for show player { // Players far than max visible distance for player or not in our map are not visible too - if (!at_same_transport && !target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) + if (!at_same_transport && !m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) return false; } else if(u->GetCharmerOrOwnerGUID()) // distance for show pet/charmed { // Pet/charmed far than max visible distance for player or not in our map are not visible too - if (!target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) + if (!m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) return false; } else // distance for show creature { // Units far than max visible distance for creature or not in our map are not visible too - if (!target->IsWithinDistInMap(u + if (!m_seer->IsWithinDistInMap(u , u->isActiveObject() ? (MAX_VISIBILITY_DISTANCE - (inVisibleList ? 0.0f : World::GetVisibleUnitGreyDistance())) : (World::GetMaxVisibleDistanceForCreature() + (inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f)) , is3dDistance)) @@ -17659,7 +18492,7 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool } // player see other player with stealth/invisibility only if he in same group or raid or same team (raid/team case dependent from conf setting) - if((m_invisibilityMask || u->m_invisibilityMask) && !canDetectInvisibilityOf(u)) + if((m_mover->m_invisibilityMask || u->m_invisibilityMask) && !m_mover->canDetectInvisibilityOf(u)) if(!(u->GetTypeId()==TYPEID_PLAYER && !IsHostileTo(u) && IsGroupVisibleFor(((Player*)u)))) return false; @@ -17673,7 +18506,7 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool detect = false; if(m_DetectInvTimer < 300 || !HaveAtClient(u)) if(!(u->GetTypeId()==TYPEID_PLAYER && !IsHostileTo(u) && IsGroupVisibleFor(((Player*)u)))) - if(!detect || !canDetectStealthOf(u, GetDistance(u))) + if(!detect || !m_mover->canDetectStealthOf(u, GetDistance(u))) return false; } @@ -17786,7 +18619,7 @@ void Player::UpdateVisibilityOf(WorldObject* target) void Player::SendInitialVisiblePackets(Unit* target) { - SendAuraDurationsForTarget(target); + SendAurasForTarget(target); if(target->isAlive()) { if(target->GetMotionMaster()->GetCurrentMovementGeneratorType() != IDLE_MOTION_TYPE) @@ -17949,7 +18782,8 @@ void Player::ClearComboPoints() void Player::SetGroup(Group *group, int8 subgroup) { - if(group == NULL) m_group.unlink(); + if(group == NULL) + m_group.unlink(); else { // never use SetGroup without a subgroup unless you specify NULL for group @@ -17961,7 +18795,7 @@ void Player::SetGroup(Group *group, int8 subgroup) void Player::SendInitialPacketsBeforeAddToMap() { - WorldPacket data(SMSG_SET_REST_START, 4); + WorldPacket data(SMSG_SET_REST_START_OBSOLETE, 4); data << uint32(0); // unknown, may be rest state time or experience GetSession()->SendPacket(&data); @@ -17989,8 +18823,12 @@ void Player::SendInitialPacketsBeforeAddToMap() SendInitialActionButtons(); SendInitialReputations(); - UpdateZone(GetZoneId()); - SendInitWorldStates(); + m_achievementMgr.SendAllAchievementData(); + + // update zone + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + UpdateZone(newzone,newarea); // also call SendInitWorldStates(); // SMSG_SET_AURA_SINGLE @@ -18002,10 +18840,17 @@ void Player::SendInitialPacketsBeforeAddToMap() // set fly flag if in fly form or taxi flight to prevent visually drop at ground in showup moment if(HasAuraType(SPELL_AURA_MOD_INCREASE_FLIGHT_SPEED) || isInFlight()) AddUnitMovementFlag(MOVEMENTFLAG_FLYING2); + + m_mover = this; + m_seer = this; } void Player::SendInitialPacketsAfterAddToMap() { + WorldPacket data(SMSG_TIME_SYNC_REQ, 4); // new 2.0.x, enable movement + data << uint32(0x00000000); // on blizz it increments periodically + GetSession()->SendPacket(&data); + CastSpell(this, 836, true); // LOGINEFFECT // set some aura effects that send packet to player client after add player to map @@ -18036,6 +18881,7 @@ void Player::SendInitialPacketsAfterAddToMap() SendMessageToSet(&data,true); } + SendAurasForTarget(this); SendEnchantmentDurations(); // must be after add to map SendItemDurations(); // must be after add to map } @@ -18048,16 +18894,24 @@ void Player::SendUpdateToOutOfRangeGroupMembers() group->UpdatePlayerOutOfRange(this); m_groupUpdateMask = GROUP_UPDATE_FLAG_NONE; - m_auraUpdateMask = 0; + m_auraRaidUpdateMask = 0; if(Pet *pet = GetPet()) - pet->ResetAuraUpdateMask(); + pet->ResetAuraUpdateMaskForRaid(); } -void Player::SendTransferAborted(uint32 mapid, uint16 reason) +void Player::SendTransferAborted(uint32 mapid, uint8 reason, uint8 arg) { WorldPacket data(SMSG_TRANSFER_ABORTED, 4+2); data << uint32(mapid); - data << uint16(reason); // transfer abort reason + data << uint8(reason); // transfer abort reason + switch(reason) + { + case TRANSFER_ABORT_INSUF_EXPAN_LVL: + case TRANSFER_ABORT_DIFFICULTY: + case TRANSFER_ABORT_UNIQUE_MESSAGE: + data << uint8(arg); + break; + } GetSession()->SendPacket(&data); } @@ -18082,7 +18936,7 @@ void Player::SendInstanceResetWarning(uint32 mapid, uint32 time) void Player::ApplyEquipCooldown( Item * pItem ) { - for(int i = 0; i <5; ++i) + for(int i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) { _Spell const& spellData = pItem->GetProto()->Spells[i]; @@ -18123,22 +18977,18 @@ void Player::resetSpells() learnQuestRewardedSpells(); } -void Player::learnDefaultSpells(bool loading) +void Player::learnDefaultSpells() { // learn default race/class spells PlayerInfo const *info = objmgr.GetPlayerInfo(getRace(),getClass()); - std::list<CreateSpellPair>::const_iterator spell_itr; - for (spell_itr = info->spell.begin(); spell_itr!=info->spell.end(); ++spell_itr) + for (PlayerCreateInfoSpells::const_iterator itr = info->spell.begin(); itr!=info->spell.end(); ++itr) { - uint16 tspell = spell_itr->first; - if (tspell) - { - sLog.outDebug("PLAYER: Adding initial spell, id = %u",tspell); - if(loading || !spell_itr->second) // not care about passive spells or loading case - addSpell(tspell,spell_itr->second); - else // but send in normal spell in game learn case - learnSpell(tspell); - } + uint32 tspell = *itr; + sLog.outDebug("PLAYER (Class: %u Race: %u): Adding initial spell, id = %u",uint32(getClass()),uint32(getRace()), tspell); + if(!IsInWorld()) // will send in INITIAL_SPELLS in list anyway at map add + addSpell(tspell,true,true,true,false); + else // but send in normal spell in game learn case + learnSpell(tspell,true); } } @@ -18230,7 +19080,7 @@ void Player::learnQuestRewardedSpells() } } -void Player::learnSkillRewardedSpells(uint32 skill_id ) +void Player::learnSkillRewardedSpells(uint32 skill_id, uint32 skill_value ) { uint32 raceMask = getRaceMask(); uint32 classMask = getClassMask(); @@ -18248,35 +19098,70 @@ void Player::learnSkillRewardedSpells(uint32 skill_id ) if (sSpellStore.LookupEntry(pAbility->spellId)) { - // Ok need learn spell - learnSpell(pAbility->spellId); + // need unlearn spell + if (skill_value < pAbility->req_skill_value) + removeSpell(pAbility->spellId); + // need learn + else if (!IsInWorld()) + addSpell(pAbility->spellId,true,true,true,false); + else + learnSpell(pAbility->spellId,true); } } } -void Player::learnSkillRewardedSpells() +void Player::SendAurasForTarget(Unit *target) { - for (uint16 i=0; i < PLAYER_MAX_SKILLS; i++) - { - if(!GetUInt32Value(PLAYER_SKILL_INDEX(i))) - continue; - - uint32 pskill = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; + if(!target || target->GetVisibleAuras()->empty()) // speedup things + return; - learnSkillRewardedSpells(pskill); - } -} + WorldPacket data(SMSG_AURA_UPDATE_ALL); + data.append(target->GetPackGUID()); -void Player::SendAuraDurationsForTarget(Unit* target) -{ - for(Unit::AuraMap::const_iterator itr = target->GetAuras().begin(); itr != target->GetAuras().end(); ++itr) + Unit::VisibleAuraMap const *visibleAuras = target->GetVisibleAuras(); + for(Unit::VisibleAuraMap::const_iterator itr = visibleAuras->begin(); itr != visibleAuras->end(); ++itr) { - Aura* aura = itr->second; - if(aura->GetAuraSlot() >= MAX_AURAS || aura->IsPassive() || aura->GetCasterGUID()!=GetGUID()) - continue; + Aura * aura=NULL; + for (uint8 i=0 ; i<3; i++) + { + if (itr->second.m_slotAuras[i]) + { + aura=itr->second.m_slotAuras[i]; + break; + } + } + if(aura) + { + data << uint8(aura->GetAuraSlot()); + data << uint32(aura->GetId()); - aura->SendAuraDurationForCaster(this); + if(aura->GetId()) + { + // flags + data << itr->second.m_Flags; + // level + data << itr->second.m_Level; + // charges + data << uint8(aura->GetAuraCharges()); + + if(!(itr->second.m_Flags & AFLAG_CASTER)) + { + if (Unit * caster = aura->GetCaster()) + data.append(caster->GetPackGUID()); + else + data << uint8(0); + } + + if(itr->second.m_Flags & AFLAG_DURATION) // include aura duration + { + data << uint32(aura->GetAuraMaxDuration()); + data << uint32(aura->GetAuraDuration()); + } + } + } } + + GetSession()->SendPacket(&data); } void Player::SetDailyQuestStatus( uint32 quest_id ) @@ -18308,7 +19193,7 @@ BattleGround* Player::GetBattleGround() const if(GetBattleGroundId()==0) return NULL; - return sBattleGroundMgr.GetBattleGround(GetBattleGroundId()); + return sBattleGroundMgr.GetBattleGround(GetBattleGroundId(), m_bgTypeID); } bool Player::InArena() const @@ -18320,7 +19205,7 @@ bool Player::InArena() const return true; } -bool Player::GetBGAccessByLevel(uint32 bgTypeId) const +bool Player::GetBGAccessByLevel(BattleGroundTypeId bgTypeId) const { // get a template bg instead of running one BattleGround *bg = sBattleGroundMgr.GetBattleGroundTemplate(bgTypeId); @@ -18333,46 +19218,26 @@ bool Player::GetBGAccessByLevel(uint32 bgTypeId) const return true; } -uint32 Player::GetMinLevelForBattleGroundQueueId(uint32 queue_id) -{ - if(queue_id < 1) - return 0; - - if(queue_id >=6) - queue_id = 6; - - return 10*(queue_id+1); -} - -uint32 Player::GetMaxLevelForBattleGroundQueueId(uint32 queue_id) -{ - if(queue_id >=6) - return 255; // hardcoded max level - - return 10*(queue_id+2)-1; -} - -//TODO make this more generic - current implementation is wrong -uint32 Player::GetBattleGroundQueueIdFromLevel() const +BGQueueIdBasedOnLevel Player::GetBattleGroundQueueIdFromLevel(BattleGroundTypeId bgTypeId) const { + //returned to hardcoded version of this function, because there is no way to code it dynamic uint32 level = getLevel(); - if(level <= 19) - return 0; - else if (level > 69) - return 6; - else - return level/10 - 1; // 20..29 -> 1, 30-39 -> 2, ... - /* - assert(bgTypeId < MAX_BATTLEGROUND_TYPES); - BattleGround *bg = sBattleGroundMgr.GetBattleGroundTemplate(bgTypeId); - assert(bg); - return (getLevel() - bg->GetMinLevel()) / 10;*/ + if( bgTypeId == BATTLEGROUND_AV ) + level--; + + uint32 queue_id = (level / 10) - 1; // for ranges 0 - 19, 20 - 29, 30 - 39, 40 - 49, 50 - 59, 60 - 69, 70 -79, 80 + if( queue_id >= MAX_BATTLEGROUND_QUEUES ) + { + sLog.outError("BattleGround: too high queue_id %u this shouldn't happen", queue_id); + return QUEUE_ID_MAX_LEVEL_80; + } + return BGQueueIdBasedOnLevel(queue_id); } float Player::GetReputationPriceDiscount( Creature const* pCreature ) const { FactionTemplateEntry const* vendor_faction = pCreature->getFactionTemplateEntry(); - if(!vendor_faction) + if(!vendor_faction || !vendor_faction->faction) return 1.0f; ReputationRank rank = GetReputationRank(vendor_faction->faction); @@ -18389,28 +19254,42 @@ bool Player::IsSpellFitByClassAndRace( uint32 spell_id ) const SkillLineAbilityMap::const_iterator lower = spellmgr.GetBeginSkillLineAbilityMap(spell_id); SkillLineAbilityMap::const_iterator upper = spellmgr.GetEndSkillLineAbilityMap(spell_id); + if(lower==upper) + return true; for(SkillLineAbilityMap::const_iterator _spell_idx = lower; _spell_idx != upper; ++_spell_idx) { // skip wrong race skills if( _spell_idx->second->racemask && (_spell_idx->second->racemask & racemask) == 0) - return false; + continue; // skip wrong class skills if( _spell_idx->second->classmask && (_spell_idx->second->classmask & classmask) == 0) - return false; + continue; + + return true; } - return true; + + return false; } -bool Player::HasQuestForGO(int32 GOId) +bool Player::HasQuestForGO(int32 GOId) const { - for( QuestStatusMap::iterator i = mQuestStatus.begin( ); i != mQuestStatus.end( ); ++i ) + for( int i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { - QuestStatusData qs=i->second; + uint32 questid = GetQuestSlotQuestId(i); + if ( questid == 0 ) + continue; + + QuestStatusMap::const_iterator qs_itr = mQuestStatus.find(questid); + if(qs_itr == mQuestStatus.end()) + continue; + + QuestStatusData const& qs = qs_itr->second; + if (qs.m_status == QUEST_STATUS_INCOMPLETE) { - Quest const* qinfo = objmgr.GetQuestTemplate(i->first); + Quest const* qinfo = objmgr.GetQuestTemplate(questid); if(!qinfo) continue; @@ -18505,9 +19384,8 @@ void Player::AutoUnequipOffhandIfNeed() if(!offItem) return; - Item *mainItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_MAINHAND ); - - if(!mainItem || mainItem->GetProto()->InventoryType != INVTYPE_2HWEAPON) + // need unequip offhand for 2h-weapon without TitanGrip (in any from hands) + if (CanTitanGrip() || (offItem->GetProto()->InventoryType != INVTYPE_2HWEAPON && !IsTwoHandUsed())) return; ItemPosCountVec off_dest; @@ -18519,7 +19397,16 @@ void Player::AutoUnequipOffhandIfNeed() } else { - sLog.outError("Player::EquipItem: Can's store offhand item at 2hand item equip for player (GUID: %u).",GetGUIDLow()); + MailItemsInfo mi; + mi.AddItem(offItem->GetGUIDLow(), offItem->GetEntry(), offItem); + MoveItemFromInventory(INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND, true); + CharacterDatabase.BeginTransaction(); + offItem->DeleteFromInventoryDB(); // deletes item from character's inventory + offItem->SaveToDB(); // recursive and not have transaction guard into self, item not in inventory and can be save standalone + CharacterDatabase.CommitTransaction(); + + std::string subject = GetSession()->GetMangosString(LANG_NOT_EQUIPPED_ITEM); + WorldSession::SendMailTo(this, MAIL_NORMAL, MAIL_STATIONERY_GM, GetGUIDLow(), GetGUIDLow(), subject, 0, &mi, 0, 0, MAIL_CHECK_MASK_NONE); } } @@ -18540,7 +19427,7 @@ bool Player::HasItemFitToSpellReqirements(SpellEntry const* spellInfo, Item cons case ITEM_CLASS_WEAPON: { for(int i= EQUIPMENT_SLOT_MAINHAND; i < EQUIPMENT_SLOT_TABARD; ++i) - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i )) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; break; @@ -18549,17 +19436,17 @@ bool Player::HasItemFitToSpellReqirements(SpellEntry const* spellInfo, Item cons { // tabard not have dependent spells for(int i= EQUIPMENT_SLOT_START; i< EQUIPMENT_SLOT_MAINHAND; ++i) - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i )) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; // shields can be equipped to offhand slot - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND)) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND)) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; // ranged slot can have some armor subclasses - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_RANGED)) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_RANGED)) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; @@ -18573,6 +19460,24 @@ bool Player::HasItemFitToSpellReqirements(SpellEntry const* spellInfo, Item cons return false; } +bool Player::CanNoReagentCast(SpellEntry const* spellInfo) const +{ + // don't take reagents for spells with SPELL_ATTR_EX5_NO_REAGENT_WHILE_PREP + if (spellInfo->AttributesEx5 & SPELL_ATTR_EX5_NO_REAGENT_WHILE_PREP && + HasFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_PREPARATION)) + return true; + + // Check no reagent use mask + flag96 noReagentMask; + noReagentMask[0] = GetUInt32Value(PLAYER_NO_REAGENT_COST_1); + noReagentMask[1] = GetUInt32Value(PLAYER_NO_REAGENT_COST_1+1); + noReagentMask[2] = GetUInt32Value(PLAYER_NO_REAGENT_COST_1+2); + if (spellInfo->SpellFamilyFlags & noReagentMask) + return true; + + return false; +} + void Player::RemoveItemDependentAurasAndCasts( Item * pItem ) { AuraMap& auras = GetAuras(); @@ -18618,7 +19523,7 @@ uint32 Player::GetResurrectionSpellId() for(AuraList::const_iterator itr = dummyAuras.begin(); itr != dummyAuras.end(); ++itr) { // Soulstone Resurrection // prio: 3 (max, non death persistent) - if( prio < 2 && (*itr)->GetSpellProto()->SpellVisual == 99 && (*itr)->GetSpellProto()->SpellIconID == 92 ) + if( prio < 2 && (*itr)->GetSpellProto()->SpellVisual[0] == 99 && (*itr)->GetSpellProto()->SpellIconID == 92 ) { switch((*itr)->GetId()) { @@ -18628,6 +19533,7 @@ uint32 Player::GetResurrectionSpellId() case 20764: spell_id = 20760; break; // rank 4 case 20765: spell_id = 20761; break; // rank 5 case 27239: spell_id = 27240; break; // rank 6 + case 47883: spell_id = 47882; break; // rank 7 default: sLog.outError("Unhandled spell %%u: S.Resurrection",(*itr)->GetId()); continue; @@ -18650,6 +19556,26 @@ uint32 Player::GetResurrectionSpellId() return spell_id; } +// Used in triggers for check "Only to targets that grant experience or honor" req +bool Player::isHonorOrXPTarget(Unit* pVictim) +{ + uint32 v_level = pVictim->getLevel(); + uint32 k_grey = Trinity::XP::GetGrayLevel(getLevel()); + + // Victim level less gray level + if(v_level<=k_grey) + return false; + + if(pVictim->GetTypeId() == TYPEID_UNIT) + { + if (((Creature*)pVictim)->isTotem() || + ((Creature*)pVictim)->isPet() || + ((Creature*)pVictim)->GetCreatureInfo()->flags_extra & CREATURE_FLAG_EXTRA_NO_XP_AT_KILL) + return false; + } + return true; +} + bool Player::RewardPlayerAndGroupAtKill(Unit* pVictim) { bool PvP = pVictim->isCharmedOwnedByPlayerOrPlayer(); @@ -18777,6 +19703,9 @@ uint32 Player::GetBaseWeaponSkillValue (WeaponAttackType attType) const void Player::ResurectUsingRequestData() { + /// Teleport before resurrecting, otherwise the player might get attacked from creatures near his corpse + TeleportTo(m_resurrectMap, m_resurrectX, m_resurrectY, m_resurrectZ, GetOrientation()); + ResurrectPlayer(0.0f,false); if(GetMaxHealth() > m_resurrectHealth) @@ -18794,8 +19723,6 @@ void Player::ResurectUsingRequestData() SetPower(POWER_ENERGY, GetMaxPower(POWER_ENERGY) ); SpawnCorpseBones(); - - TeleportTo(m_resurrectMap, m_resurrectX, m_resurrectY, m_resurrectZ, GetOrientation()); } void Player::SetClientControl(Unit* target, uint8 allowMove) @@ -18809,29 +19736,18 @@ void Player::SetClientControl(Unit* target, uint8 allowMove) void Player::UpdateZoneDependentAuras( uint32 newZone ) { // remove new continent flight forms - if( !isGameMaster() && - GetVirtualMapForMapAndZone(GetMapId(),newZone) != 530) + if( !IsAllowUseFlyMountsHere() ) { RemoveSpellsCausingAura(SPELL_AURA_MOD_INCREASE_FLIGHT_SPEED); RemoveSpellsCausingAura(SPELL_AURA_FLY); } - // Some spells applied at enter into zone (with subzones) - // Human Illusion - // NOTE: these are removed by RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_CHANGE_MAP); - if ( newZone == 2367 ) // Old Hillsbrad Foothills - { - uint32 spellid = 0; - // all horde races - if( GetTeam() == HORDE ) - spellid = getGender() == GENDER_FEMALE ? 35481 : 35480; - // and some alliance races - else if( getRace() == RACE_NIGHTELF || getRace() == RACE_DRAENEI ) - spellid = getGender() == GENDER_FEMALE ? 35483 : 35482; - - if(spellid && !HasAura(spellid,0) ) - CastSpell(this,spellid,true); - } + // Some spells applied at enter into zone (with subzones), aura removed in UpdateAreaDependentAuras that called always at zone->area update + SpellAreaForAreaMapBounds saBounds = spellmgr.GetSpellAreaForAreaMapBounds(newZone); + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,newZone,0)) + if( !HasAura(itr->second->spellId,0) ) + CastSpell(this,itr->second->spellId,true); } void Player::UpdateAreaDependentAuras( uint32 newArea ) @@ -18840,26 +19756,18 @@ void Player::UpdateAreaDependentAuras( uint32 newArea ) for(AuraMap::iterator iter = m_Auras.begin(); iter != m_Auras.end();) { // use m_zoneUpdateId for speed: UpdateArea called from UpdateZone or instead UpdateZone in both cases m_zoneUpdateId up-to-date - if(!IsSpellAllowedInLocation(iter->second->GetSpellProto(),GetMapId(),m_zoneUpdateId,newArea)) + if(spellmgr.GetSpellAllowedInLocationError(iter->second->GetSpellProto(),GetMapId(),m_zoneUpdateId,newArea,this) != SPELL_CAST_OK) RemoveAura(iter); else ++iter; } - // unmount if enter in this subzone - if( newArea == 35) - RemoveSpellsCausingAura(SPELL_AURA_MOUNTED); - // Dragonmaw Illusion - else if( newArea == 3759 || newArea == 3966 || newArea == 3939 ) - { - if( GetDummyAura(40214) ) - { - if( !HasAura(40216,0) ) - CastSpell(this,40216,true); - if( !HasAura(42016,0) ) - CastSpell(this,42016,true); - } - } + // some auras applied at subzone enter + SpellAreaForAreaMapBounds saBounds = spellmgr.GetSpellAreaForAreaMapBounds(newArea); + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,m_zoneUpdateId,newArea)) + if( !HasAura(itr->second->spellId,0) ) + CastSpell(this,itr->second->spellId,true); } uint32 Player::GetCorpseReclaimDelay(bool pvp) const @@ -18945,7 +19853,7 @@ void Player::SendCorpseReclaimDelay(bool load) //! corpse reclaim delay 30 * 1000ms or longer at often deaths WorldPacket data(SMSG_CORPSE_RECLAIM_DELAY, 4); - data << uint32(delay*1000); + data << uint32(delay*IN_MILISECONDS); GetSession()->SendPacket( &data ); } @@ -18990,21 +19898,85 @@ PartyResult Player::CanUninviteFromGroup() const return PARTY_RESULT_OK; } +void Player::SetBattleGroundRaid(Group* group, int8 subgroup) +{ + //we must move references from m_group to m_originalGroup + SetOriginalGroup(GetGroup(), GetSubGroup()); + + m_group.unlink(); + m_group.link(group, this); + m_group.setSubGroup((uint8)subgroup); +} + +void Player::RemoveFromBattleGroundRaid() +{ + //remove existing reference + m_group.unlink(); + if( Group* group = GetOriginalGroup() ) + { + m_group.link(group, this); + m_group.setSubGroup(GetOriginalSubGroup()); + } + SetOriginalGroup(NULL); +} + +void Player::SetOriginalGroup(Group *group, int8 subgroup) +{ + if( group == NULL ) + m_originalGroup.unlink(); + else + { + // never use SetOriginalGroup without a subgroup unless you specify NULL for group + assert(subgroup >= 0); + m_originalGroup.link(group, this); + m_originalGroup.setSubGroup((uint8)subgroup); + } +} + void Player::UpdateUnderwaterState( Map* m, float x, float y, float z ) { - float water_z = m->GetWaterLevel(x,y); - float height_z = m->GetHeight(x,y,z, false); // use .map base surface height - uint8 flag1 = m->GetTerrainType(x,y); + LiquidData liquid_status; + ZLiquidStatus res = m->getLiquidStatus(x, y, z, MAP_ALL_LIQUIDS, &liquid_status); + if (!res) + { + m_MirrorTimerFlags &= ~(UNDERWATER_INWATER|UNDERWATER_INLAVA|UNDERWATER_INSLIME|UNDERWARER_INDARKWATER); + // Small hack for enable breath in WMO + if (IsInWater()) + m_MirrorTimerFlags|=UNDERWATER_INWATER; + return; + } + + // All liquids type - check under water position + if (liquid_status.type&(MAP_LIQUID_TYPE_WATER|MAP_LIQUID_TYPE_OCEAN|MAP_LIQUID_TYPE_MAGMA|MAP_LIQUID_TYPE_SLIME)) + { + if ( res & LIQUID_MAP_UNDER_WATER) + m_MirrorTimerFlags |= UNDERWATER_INWATER; + else + m_MirrorTimerFlags &= ~UNDERWATER_INWATER; + } - //!Underwater check, not in water if underground or above water level - if (height_z <= INVALID_HEIGHT || z < (height_z-2) || z > (water_z - 2) ) - m_isunderwater &= 0x7A; - else if ((z < (water_z - 2)) && (flag1 & 0x01)) - m_isunderwater |= 0x01; + // Allow travel in dark water on taxi or transport + if (liquid_status.type & MAP_LIQUID_TYPE_DARK_WATER && !isInFlight() && !(GetUnitMovementFlags()&MOVEMENTFLAG_ONTRANSPORT)) + m_MirrorTimerFlags |= UNDERWARER_INDARKWATER; + else + m_MirrorTimerFlags &= ~UNDERWARER_INDARKWATER; - //!in lava check, anywhere under lava level - if ((height_z <= INVALID_HEIGHT || z < (height_z - 0)) && (flag1 == 0x00) && IsInWater()) - m_isunderwater |= 0x80; + // in lava check, anywhere in lava level + if (liquid_status.type&MAP_LIQUID_TYPE_MAGMA) + { + if (res & (LIQUID_MAP_UNDER_WATER|LIQUID_MAP_IN_WATER|LIQUID_MAP_WATER_WALK)) + m_MirrorTimerFlags |= UNDERWATER_INLAVA; + else + m_MirrorTimerFlags &= ~UNDERWATER_INLAVA; + } + // in slime check, anywhere in slime level + if (liquid_status.type&MAP_LIQUID_TYPE_SLIME) + { + if (res & (LIQUID_MAP_UNDER_WATER|LIQUID_MAP_IN_WATER|LIQUID_MAP_WATER_WALK)) + m_MirrorTimerFlags |= UNDERWATER_INSLIME; + else + m_MirrorTimerFlags &= ~UNDERWATER_INSLIME; + } } void Player::SetCanParry( bool value ) @@ -19037,52 +20009,6 @@ bool ItemPosCount::isContainedIn(ItemPosCountVec const& vec) const //-------------TRINITY--------------- //*********************************** -void Player::HandleFallDamage(MovementInfo& movementInfo) -{ - if(movementInfo.fallTime < 1500) - return; - - // calculate total z distance of the fall - float z_diff = m_lastFallZ - movementInfo.z; - sLog.outDebug("zDiff = %f", z_diff); - - //Players with low fall distance, Feather Fall or physical immunity (charges used) are ignored - // 14.57 can be calculated by resolving damageperc formular below to 0 - if (z_diff >= 14.57f && !isDead() && !isGameMaster() && - !HasAuraType(SPELL_AURA_HOVER) && !HasAuraType(SPELL_AURA_FEATHER_FALL) && - !HasAuraType(SPELL_AURA_FLY) && !IsImmunedToDamage(SPELL_SCHOOL_MASK_NORMAL,true) ) - { - //Safe fall, fall height reduction - int32 safe_fall = GetTotalAuraModifier(SPELL_AURA_SAFE_FALL); - - float damageperc = 0.018f*(z_diff-safe_fall)-0.2426f; - - if(damageperc >0 ) - { - uint32 damage = (uint32)(damageperc * GetMaxHealth()*sWorld.getRate(RATE_DAMAGE_FALL)); - - float height = movementInfo.z; - UpdateGroundPositionZ(movementInfo.x,movementInfo.y,height); - - if (damage > 0) - { - //Prevent fall damage from being more than the player maximum health - if (damage > GetMaxHealth()) - damage = GetMaxHealth(); - - // Gust of Wind - if (GetDummyAura(43621)) - damage = GetMaxHealth()/2; - - EnvironmentalDamage(GetGUID(), DAMAGE_FALL, damage); - } - - //Z given by moveinfo, LastZ, FallTime, WaterZ, MapZ, Damage, Safefall reduction - DEBUG_LOG("FALLDAMAGE z=%f sz=%f pZ=%f FallTime=%d mZ=%f damage=%d SF=%d" , movementInfo.z, height, GetPositionZ(), movementInfo.fallTime, height, damage, safe_fall); - } - } -} - void Player::HandleFallUnderMap() { if(InBattleGround() @@ -19110,63 +20036,204 @@ void Player::HandleFallUnderMap() } } -void Player::SetViewport(uint64 guid, bool moveable) +void Player::StopCastingBindSight() { - WorldPacket data(SMSG_CLIENT_CONTROL_UPDATE, 8+1); - data.appendPackGUID(guid); // Packed guid of object to set client's view to - data << (moveable ? uint8(0x01) : uint8(0x00)); // 0 - can't move; 1 - can move - m_session->SendPacket(&data); - sLog.outDetail("Viewport for "I64FMT" (%s) changed to "I64FMT, GetGUID(), GetName(), guid); + if(WorldObject* target = GetViewpoint()) + { + if(target->isType(TYPEMASK_UNIT)) + ((Unit*)target)->RemoveAuraTypeByCaster(SPELL_AURA_BIND_SIGHT, GetGUID()); + } } -WorldObject* Player::GetFarsightTarget() const +void Player::CreateViewpoint(WorldObject* target) { - // Players can have in farsight field another player's guid, a creature's guid, or a dynamic object's guid - if (uint64 guid = GetUInt64Value(PLAYER_FARSIGHT)) - return (WorldObject*)ObjectAccessor::GetObjectByTypeMask(*this, guid, TYPEMASK_PLAYER | TYPEMASK_UNIT | TYPEMASK_DYNAMICOBJECT); + if(!target || target == this) // remove seer + { + sLog.outDebug("Player::CreateViewpoint: Player %s remove seer", GetName()); + SetUInt64Value(PLAYER_FARSIGHT, 0); + //WorldPacket data(SMSG_CLEAR_FAR_SIGHT_IMMEDIATE, 0); + //GetSession()->SendPacket(&data); + if(m_seer != this && m_seer->isType(TYPEMASK_UNIT)) + ((Unit*)m_seer)->RemovePlayerFromVision(this); + //must immediately set seer back otherwise may crash + m_seer = this; + } + else + { + sLog.outDebug("Player::CreateViewpoint: Player %s create seer %u (TypeId: %u).", GetName(), target->GetEntry(), target->GetTypeId()); + StopCastingBindSight(); + SetUInt64Value(PLAYER_FARSIGHT, target->GetGUID()); + if(target->isType(TYPEMASK_UNIT)) + ((Unit*)target)->AddPlayerToVision(this); + } +} + +WorldObject* Player::GetViewpoint() const +{ + if(uint64 guid = GetUInt64Value(PLAYER_FARSIGHT)) + return (WorldObject*)ObjectAccessor::GetObjectByTypeMask(*this, guid, TYPEMASK_SEER); return NULL; } -void Player::StopCastingBindSight() +bool Player::CanUseBattleGroundObject() { - if (WorldObject* fTarget = GetFarsightTarget()) - { - if (fTarget->isType(TYPEMASK_UNIT)) - ((Unit*)fTarget)->RemoveAuraTypeByCaster(SPELL_AURA_BIND_SIGHT, GetGUID()); - } + return ( //InBattleGround() && // in battleground - not need, check in other cases + //!IsMounted() && - not correct, player is dismounted when he clicks on flag + //i'm not sure if these two are correct, because invisible players should get visible when they click on flag + !HasStealthAura() && // not stealthed + !HasInvisibilityAura() && // not invisible + !HasAura(SPELL_RECENTLY_DROPPED_FLAG, 0) && // can't pickup + //TODO player cannot use object when he is invulnerable (immune) - (ice block, divine shield, divine protection, divine intervention ...) + isAlive() // live player + ); } -void Player::ClearFarsight() +bool Player::CanCaptureTowerPoint() { - if (GetUInt64Value(PLAYER_FARSIGHT)) - { - SetUInt64Value(PLAYER_FARSIGHT, 0); - WorldPacket data(SMSG_CLEAR_FAR_SIGHT_IMMEDIATE, 0); - GetSession()->SendPacket(&data); - } + return ( !HasStealthAura() && // not stealthed + !HasInvisibilityAura() && // not invisible + isAlive() // live player + ); +} + +uint32 Player::GetBarberShopCost(uint8 newhairstyle, uint8 newhaircolor, uint8 newfacialhair) +{ + uint32 level = getLevel(); + + if(level > GT_MAX_LEVEL) + level = GT_MAX_LEVEL; // max level in this dbc + + uint8 hairstyle = GetByteValue(PLAYER_BYTES, 2); + uint8 haircolor = GetByteValue(PLAYER_BYTES, 3); + uint8 facialhair = GetByteValue(PLAYER_BYTES_2, 0); + + if((hairstyle == newhairstyle) && (haircolor == newhaircolor) && (facialhair == newfacialhair)) + return 0; + + GtBarberShopCostBaseEntry const *bsc = sGtBarberShopCostBaseStore.LookupEntry(level - 1); + + if(!bsc) // shouldn't happen + return 0xFFFFFFFF; + + float cost = 0; + + if(hairstyle != newhairstyle) + cost += bsc->cost; // full price + + if((haircolor != newhaircolor) && (hairstyle == newhairstyle)) + cost += bsc->cost * 0.5f; // +1/2 of price + + if(facialhair != newfacialhair) + cost += bsc->cost * 0.75f; // +3/4 of price + + return uint32(cost); +} + +void Player::InitGlyphsForLevel() +{ + for(uint32 i = 0; i < sGlyphSlotStore.GetNumRows(); ++i) + if(GlyphSlotEntry const * gs = sGlyphSlotStore.LookupEntry(i)) + if(gs->Order) + SetGlyphSlot(gs->Order - 1, gs->Id); + + uint32 level = getLevel(); + uint32 value = 0; + + // 0x3F = 0x01 | 0x02 | 0x04 | 0x08 | 0x10 | 0x20 for 80 level + if(level >= 15) + value |= (0x01 | 0x02); + if(level >= 30) + value |= 0x08; + if(level >= 50) + value |= 0x04; + if(level >= 70) + value |= 0x10; + if(level >= 80) + value |= 0x20; + + SetUInt32Value(PLAYER_GLYPHS_ENABLED, value); } -void Player::SetFarsightTarget(WorldObject* obj) +void Player::EnterVehicle(Vehicle *vehicle) { - if (!obj || !obj->isType(TYPEMASK_PLAYER | TYPEMASK_UNIT | TYPEMASK_DYNAMICOBJECT)) + VehicleEntry const *ve = sVehicleStore.LookupEntry(vehicle->GetVehicleId()); + if(!ve) + return; + + VehicleSeatEntry const *veSeat = sVehicleSeatStore.LookupEntry(ve->m_seatID[0]); + if(!veSeat) return; - // Remove the current target if there is one - StopCastingBindSight(); + vehicle->SetCharmerGUID(GetGUID()); + vehicle->RemoveFlag(UNIT_NPC_FLAGS, UNIT_NPC_FLAG_SPELLCLICK); + vehicle->SetFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_UNK_24); + vehicle->setFaction(getFaction()); + + SetCharm(vehicle, true); // charm + SetMover(vehicle); + + SetClientControl(vehicle, 1); // redirect controls to vehicle + + WorldPacket data(SMSG_ON_CANCEL_EXPECTED_RIDE_VEHICLE_AURA, 0); + GetSession()->SendPacket(&data); + + data.Initialize(MSG_MOVE_TELEPORT_ACK, 30); + data.append(GetPackGUID()); + data << uint32(0); // counter? + data << uint32(MOVEMENTFLAG_ONTRANSPORT); // transport + data << uint16(0); // special flags + data << uint32(getMSTime()); // time + data << vehicle->GetPositionX(); // x + data << vehicle->GetPositionY(); // y + data << vehicle->GetPositionZ(); // z + data << vehicle->GetOrientation(); // o + // transport part, TODO: load/calculate seat offsets + data << uint64(vehicle->GetGUID()); // transport guid + data << float(veSeat->m_attachmentOffsetX); // transport offsetX + data << float(veSeat->m_attachmentOffsetY); // transport offsetY + data << float(veSeat->m_attachmentOffsetZ); // transport offsetZ + data << float(0); // transport orientation + data << uint32(getMSTime()); // transport time + data << uint8(0); // seat + // end of transport part + data << uint32(0); // fall time + GetSession()->SendPacket(&data); - SetUInt64Value(PLAYER_FARSIGHT, obj->GetGUID()); + VehicleSpellInitialize(); } -bool Player::isAllowUseBattleGroundObject() +void Player::ExitVehicle(Vehicle *vehicle) { - return ( //InBattleGround() && // in battleground - not need, check in other cases - !IsMounted() && // not mounted - !isTotalImmunity() && // not totally immuned - !HasStealthAura() && // not stealthed - !HasInvisibilityAura() && // not invisible - !HasAura(SPELL_RECENTLY_DROPPED_FLAG, 0) && // can't pickup - isAlive() // live player - ); + vehicle->SetCharmerGUID(0); + vehicle->SetFlag(UNIT_NPC_FLAGS, UNIT_NPC_FLAG_SPELLCLICK); + vehicle->RemoveFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_UNK_24); + vehicle->setFaction((GetTeam() == ALLIANCE) ? vehicle->GetCreatureInfo()->faction_A : vehicle->GetCreatureInfo()->faction_H); + + SetCharm(vehicle, false); + SetMover(this); + + SetClientControl(vehicle, 0); + + WorldPacket data(MSG_MOVE_TELEPORT_ACK, 30); + data.append(GetPackGUID()); + data << uint32(0); // counter? + data << uint32(MOVEMENTFLAG_FLY_UNK1); // fly unk + data << uint16(0x40); // special flags + data << uint32(getMSTime()); // time + data << vehicle->GetPositionX(); // x + data << vehicle->GetPositionY(); // y + data << vehicle->GetPositionZ(); // z + data << vehicle->GetOrientation(); // o + data << uint32(0); // fall time + GetSession()->SendPacket(&data); + + data.Initialize(SMSG_PET_SPELLS, 8+4); + data << uint64(0); + data << uint32(0); + GetSession()->SendPacket(&data); + + // only for flyable vehicles? + CastSpell(this, 45472, true); // Parachute } bool Player::HasTitle(uint32 bitIndex) @@ -19186,7 +20253,6 @@ void Player::SetTitle(CharTitlesEntry const* title) SetFlag(PLAYER__FIELD_KNOWN_TITLES+fieldIndexOffset, flag); } - /*-----------------------TRINITY--------------------------*/ bool Player::isTotalImmunity() { @@ -19244,3 +20310,561 @@ void Player::UpdateCharmedAI() } } +void Player::ConvertRune(uint8 index, uint8 newType) +{ + SetCurrentRune(index, newType); + + WorldPacket data(SMSG_CONVERT_RUNE, 2); + data << uint8(index); + data << uint8(newType); + GetSession()->SendPacket(&data); +} + +void Player::ResyncRunes(uint8 count) +{ + WorldPacket data(SMSG_RESYNC_RUNES, count * 2); + for(uint32 i = 0; i < count; ++i) + { + data << uint8(GetCurrentRune(i)); // rune type + data << uint8(255 - (GetRuneCooldown(i) * 51)); // passed cooldown time (0-255) + } + GetSession()->SendPacket(&data); +} + +void Player::AddRunePower(uint8 index) +{ + WorldPacket data(SMSG_ADD_RUNE_POWER, 4); + data << uint32(1 << index); // mask (0x00-0x3F probably) + GetSession()->SendPacket(&data); +} + +void Player::InitRunes() +{ + if(getClass() != CLASS_DEATH_KNIGHT) + return; + + m_runes = new Runes; + + m_runes->runeState = 0; + + for(uint32 i = 0; i < MAX_RUNES; ++i) + { + SetBaseRune(i, i / 2); // init base types + SetCurrentRune(i, i / 2); // init current types + SetRuneCooldown(i, 0); // reset cooldowns + m_runes->SetRuneState(i); + } + + for(uint32 i = 0; i < NUM_RUNE_TYPES; ++i) + SetFloatValue(PLAYER_RUNE_REGEN_1 + i, 0.1f); +} + +void Player::AutoStoreLoot(uint8 bag, uint8 slot, uint32 loot_id, LootStore const& store, bool broadcast) +{ + Loot loot; + loot.FillLoot (loot_id,store,this,true); + + uint32 max_slot = loot.GetMaxSlotInLootFor(this); + for(uint32 i = 0; i < max_slot; ++i) + { + LootItem* lootItem = loot.LootItemInSlot(i,this); + + ItemPosCountVec dest; + uint8 msg = CanStoreNewItem (bag,slot,dest,lootItem->itemid,lootItem->count); + if(msg != EQUIP_ERR_OK && slot != NULL_SLOT) + msg = CanStoreNewItem( bag, NULL_SLOT,dest,lootItem->itemid,lootItem->count); + if( msg != EQUIP_ERR_OK && bag != NULL_BAG) + msg = CanStoreNewItem( NULL_BAG, NULL_SLOT,dest,lootItem->itemid,lootItem->count); + if(msg != EQUIP_ERR_OK) + { + SendEquipError( msg, NULL, NULL ); + continue; + } + + Item* pItem = StoreNewItem (dest,lootItem->itemid,true,lootItem->randomPropertyId); + SendNewItem(pItem, lootItem->count, false, false, broadcast); + } +} + +uint32 Player::CalculateTalentsPoints() const +{ + uint32 base_talent = getLevel() < 10 ? 0 : uint32((getLevel()-9)*sWorld.getRate(RATE_TALENT)); + + if(getClass() != CLASS_DEATH_KNIGHT) + return base_talent; + + uint32 talentPointsForLevel = + (getLevel() < 56 ? 0 : uint32((getLevel()-55)*sWorld.getRate(RATE_TALENT))) + + m_questRewardTalentCount; + + if(talentPointsForLevel > base_talent) + talentPointsForLevel = base_talent; + + return talentPointsForLevel; +} + +bool Player::IsAllowUseFlyMountsHere() const +{ + if (isGameMaster()) + return true; + + uint32 v_map = GetVirtualMapForMapAndZone(GetMapId(), GetZoneId()); + return v_map == 530 || v_map == 571 && HasSpell(54197); +} + +void Player::learnSpellHighRank(uint32 spellid) +{ + learnSpell(spellid,false); + + if(uint32 next = spellmgr.GetNextSpellInChain(spellid)) + learnSpellHighRank(next); +} + +void Player::_LoadSkills() +{ + // Note: skill data itself loaded from `data` field. This is only cleanup part of load + + // reset skill modifiers and set correct unlearn flags + for (uint32 i = 0; i < PLAYER_MAX_SKILLS; i++) + { + SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); + + // set correct unlearn bit + uint32 id = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; + if(!id) continue; + + SkillLineEntry const *pSkill = sSkillLineStore.LookupEntry(id); + if(!pSkill) continue; + + // enable unlearn button for primary professions only + if (pSkill->categoryId == SKILL_CATEGORY_PROFESSION) + SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,1)); + else + SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,0)); + + // set fixed skill ranges + switch(GetSkillRangeType(pSkill,false)) + { + case SKILL_RANGE_LANGUAGE: // 300..300 + SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(300,300)); + break; + case SKILL_RANGE_MONO: // 1..1, grey monolite bar + SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(1,1)); + break; + default: + break; + } + + uint32 vskill = SKILL_VALUE(GetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i))); + learnSkillRewardedSpells(id, vskill); + } + + // special settings + if(getClass()==CLASS_DEATH_KNIGHT) + { + uint32 base_level = std::min(getLevel(),sWorld.getConfig (CONFIG_START_HEROIC_PLAYER_LEVEL)); + if(base_level < 1) + base_level = 1; + uint32 base_skill = (base_level-1)*5; // 270 at starting level 55 + if(base_skill < 1) + base_skill = 1; // skill mast be known and then > 0 in any case + + if(GetPureSkillValue (SKILL_FIRST_AID) < base_skill) + SetSkill(SKILL_FIRST_AID,base_skill, base_skill); + if(GetPureSkillValue (SKILL_AXES) < base_skill) + SetSkill(SKILL_AXES, base_skill,base_skill); + if(GetPureSkillValue (SKILL_DEFENSE) < base_skill) + SetSkill(SKILL_DEFENSE, base_skill,base_skill); + if(GetPureSkillValue (SKILL_POLEARMS) < base_skill) + SetSkill(SKILL_POLEARMS, base_skill,base_skill); + if(GetPureSkillValue (SKILL_SWORDS) < base_skill) + SetSkill(SKILL_SWORDS, base_skill,base_skill); + if(GetPureSkillValue (SKILL_2H_AXES) < base_skill) + SetSkill(SKILL_2H_AXES, base_skill,base_skill); + if(GetPureSkillValue (SKILL_2H_SWORDS) < base_skill) + SetSkill(SKILL_2H_SWORDS, base_skill,base_skill); + if(GetPureSkillValue (SKILL_UNARMED) < base_skill) + SetSkill(SKILL_UNARMED, base_skill,base_skill); + } +} + +uint32 Player::GetPhaseMaskForSpawn() const +{ + uint32 phase = PHASEMASK_NORMAL; + if(!isGameMaster()) + phase = GetPhaseMask(); + else + { + AuraList const& phases = GetAurasByType(SPELL_AURA_PHASE); + if(!phases.empty()) + phase = phases.front()->GetMiscValue(); + } + + // some aura phases include 1 normal map in addition to phase itself + if(uint32 n_phase = phase & ~PHASEMASK_NORMAL) + return n_phase; + + return PHASEMASK_NORMAL; +} + +uint8 Player::CanEquipUniqueItem(Item* pItem, uint8 eslot, uint32 limit_count) const +{ + ItemPrototype const* pProto = pItem->GetProto(); + + // proto based limitations + if(uint8 res = CanEquipUniqueItem(pProto,eslot,limit_count)) + return res; + + // check unique-equipped on gems + for(uint32 enchant_slot = SOCK_ENCHANTMENT_SLOT; enchant_slot < SOCK_ENCHANTMENT_SLOT+3; ++enchant_slot) + { + uint32 enchant_id = pItem->GetEnchantmentId(EnchantmentSlot(enchant_slot)); + if(!enchant_id) + continue; + SpellItemEnchantmentEntry const* enchantEntry = sSpellItemEnchantmentStore.LookupEntry(enchant_id); + if(!enchantEntry) + continue; + + ItemPrototype const* pGem = objmgr.GetItemPrototype(enchantEntry->GemID); + if(!pGem) + continue; + + // include for check equip another gems with same limit category for not equipped item (and then not counted) + uint32 gem_limit_count = !pItem->IsEquipped() && pGem->ItemLimitCategory + ? pItem->GetGemCountWithLimitCategory(pGem->ItemLimitCategory) : 1; + + if(uint8 res = CanEquipUniqueItem(pGem, eslot,gem_limit_count)) + return res; + } + + return EQUIP_ERR_OK; +} + +uint8 Player::CanEquipUniqueItem( ItemPrototype const* itemProto, uint8 except_slot, uint32 limit_count) const +{ + // check unique-equipped on item + if (itemProto->Flags & ITEM_FLAGS_UNIQUE_EQUIPPED) + { + // there is an equip limit on this item + if(HasItemOrGemWithIdEquipped(itemProto->ItemId,1,except_slot)) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; + } + + // check unique-equipped limit + if (itemProto->ItemLimitCategory) + { + ItemLimitCategoryEntry const* limitEntry = sItemLimitCategoryStore.LookupEntry(itemProto->ItemLimitCategory); + if(!limitEntry) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; + + if(limit_count > limitEntry->maxCount) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; // attempt add too many limit category items (gems) + + // there is an equip limit on this item + if(HasItemOrGemWithLimitCategoryEquipped(itemProto->ItemLimitCategory,limitEntry->maxCount-limit_count+1,except_slot)) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; + } + + return EQUIP_ERR_OK; +} + +void Player::HandleFall(MovementInfo const& movementInfo) +{ + // calculate total z distance of the fall + float z_diff = m_lastFallZ - movementInfo.z; + sLog.outDebug("zDiff = %f", z_diff); + + //Players with low fall distance, Feather Fall or physical immunity (charges used) are ignored + // 14.57 can be calculated by resolving damageperc formular below to 0 + if (z_diff >= 14.57f && !isDead() && !isGameMaster() && + !HasAuraType(SPELL_AURA_HOVER) && !HasAuraType(SPELL_AURA_FEATHER_FALL) && + !HasAuraType(SPELL_AURA_FLY) && !IsImmunedToDamage(SPELL_SCHOOL_MASK_NORMAL) ) + { + //Safe fall, fall height reduction + int32 safe_fall = GetTotalAuraModifier(SPELL_AURA_SAFE_FALL); + + float damageperc = 0.018f*(z_diff-safe_fall)-0.2426f; + + if(damageperc >0 ) + { + uint32 damage = (uint32)(damageperc * GetMaxHealth()*sWorld.getRate(RATE_DAMAGE_FALL)); + + float height = movementInfo.z; + UpdateGroundPositionZ(movementInfo.x,movementInfo.y,height); + + if (damage > 0) + { + //Prevent fall damage from being more than the player maximum health + if (damage > GetMaxHealth()) + damage = GetMaxHealth(); + + // Gust of Wind + if (GetDummyAura(43621)) + damage = GetMaxHealth()/2; + + EnvironmentalDamage(GetGUID(), DAMAGE_FALL, damage); + + // recheck alive, might have died of EnvironmentalDamage + if (isAlive()) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_FALL_WITHOUT_DYING, uint32(z_diff*100)); + } + + //Z given by moveinfo, LastZ, FallTime, WaterZ, MapZ, Damage, Safefall reduction + DEBUG_LOG("FALLDAMAGE z=%f sz=%f pZ=%f FallTime=%d mZ=%f damage=%d SF=%d" , movementInfo.z, height, GetPositionZ(), movementInfo.fallTime, height, damage, safe_fall); + } + } +} + +void Player::UpdateAchievementCriteria( AchievementCriteriaTypes type, uint32 miscvalue1/*=0*/, uint32 miscvalue2/*=0*/, Unit *unit/*=NULL*/, uint32 time/*=0*/ ) +{ + GetAchievementMgr().UpdateAchievementCriteria(type, miscvalue1,miscvalue2,unit,time); +} + +void Player::LearnTalent(uint32 talentId, uint32 talentRank) +{ + uint32 CurTalentPoints = GetFreeTalentPoints(); + + if(CurTalentPoints == 0) + return; + + if (talentRank >= MAX_TALENT_RANK) + return; + + TalentEntry const *talentInfo = sTalentStore.LookupEntry( talentId ); + + if(!talentInfo) + return; + + TalentTabEntry const *talentTabInfo = sTalentTabStore.LookupEntry( talentInfo->TalentTab ); + + if(!talentTabInfo) + return; + + // prevent learn talent for different class (cheating) + if( (getClassMask() & talentTabInfo->ClassMask) == 0 ) + return; + + // find current max talent rank + int32 curtalent_maxrank = 0; + for(int32 k = MAX_TALENT_RANK-1; k > -1; --k) + { + if(talentInfo->RankID[k] && HasSpell(talentInfo->RankID[k])) + { + curtalent_maxrank = k + 1; + break; + } + } + + // we already have same or higher talent rank learned + if(curtalent_maxrank >= (talentRank + 1)) + return; + + // check if we have enough talent points + if(CurTalentPoints < (talentRank - curtalent_maxrank + 1)) + return; + + // Check if it requires another talent + if (talentInfo->DependsOn > 0) + { + if(TalentEntry const *depTalentInfo = sTalentStore.LookupEntry(talentInfo->DependsOn)) + { + bool hasEnoughRank = false; + for (int i = talentInfo->DependsOnRank; i < MAX_TALENT_RANK; i++) + { + if (depTalentInfo->RankID[i] != 0) + if (HasSpell(depTalentInfo->RankID[i])) + hasEnoughRank = true; + } + if (!hasEnoughRank) + return; + } + } + + // Find out how many points we have in this field + uint32 spentPoints = 0; + + uint32 tTab = talentInfo->TalentTab; + if (talentInfo->Row > 0) + { + unsigned int numRows = sTalentStore.GetNumRows(); + for (unsigned int i = 0; i < numRows; i++) // Loop through all talents. + { + // Someday, someone needs to revamp + const TalentEntry *tmpTalent = sTalentStore.LookupEntry(i); + if (tmpTalent) // the way talents are tracked + { + if (tmpTalent->TalentTab == tTab) + { + for (int j = 0; j < MAX_TALENT_RANK; j++) + { + if (tmpTalent->RankID[j] != 0) + { + if (HasSpell(tmpTalent->RankID[j])) + { + spentPoints += j + 1; + } + } + } + } + } + } + } + + // not have required min points spent in talent tree + if(spentPoints < (talentInfo->Row * MAX_TALENT_RANK)) + return; + + // spell not set in talent.dbc + uint32 spellid = talentInfo->RankID[talentRank]; + if( spellid == 0 ) + { + sLog.outError("Talent.dbc have for talent: %u Rank: %u spell id = 0", talentId, talentRank); + return; + } + + // already known + if(HasSpell(spellid)) + return; + + // learn! (other talent ranks will unlearned at learning) + learnSpell(spellid, false); + sLog.outDetail("TalentID: %u Rank: %u Spell: %u\n", talentId, talentRank, spellid); + + // update free talent points + SetFreeTalentPoints(CurTalentPoints - (talentRank - curtalent_maxrank + 1)); +} + +void Player::LearnPetTalent(uint64 petGuid, uint32 talentId, uint32 talentRank) +{ + Pet *pet = GetPet(); + + if(!pet) + return; + + if(petGuid != pet->GetGUID()) + return; + + uint32 CurTalentPoints = pet->GetFreeTalentPoints(); + + if(CurTalentPoints == 0) + return; + + if (talentRank >= MAX_PET_TALENT_RANK) + return; + + TalentEntry const *talentInfo = sTalentStore.LookupEntry(talentId); + + if(!talentInfo) + return; + + TalentTabEntry const *talentTabInfo = sTalentTabStore.LookupEntry(talentInfo->TalentTab); + + if(!talentTabInfo) + return; + + CreatureInfo const *ci = pet->GetCreatureInfo(); + + if(!ci) + return; + + CreatureFamilyEntry const *pet_family = sCreatureFamilyStore.LookupEntry(ci->family); + + if(!pet_family) + return; + + if(pet_family->petTalentType < 0) // not hunter pet + return; + + // prevent learn talent for different family (cheating) + if(!((1 << pet_family->petTalentType) & talentTabInfo->petTalentMask)) + return; + + // find current max talent rank + int32 curtalent_maxrank = 0; + for(int32 k = MAX_TALENT_RANK-1; k > -1; --k) + { + if(talentInfo->RankID[k] && pet->HasSpell(talentInfo->RankID[k])) + { + curtalent_maxrank = k + 1; + break; + } + } + + // we already have same or higher talent rank learned + if(curtalent_maxrank >= (talentRank + 1)) + return; + + // check if we have enough talent points + if(CurTalentPoints < (talentRank - curtalent_maxrank + 1)) + return; + + // Check if it requires another talent + if (talentInfo->DependsOn > 0) + { + if(TalentEntry const *depTalentInfo = sTalentStore.LookupEntry(talentInfo->DependsOn)) + { + bool hasEnoughRank = false; + for (int i = talentInfo->DependsOnRank; i < MAX_TALENT_RANK; i++) + { + if (depTalentInfo->RankID[i] != 0) + if (pet->HasSpell(depTalentInfo->RankID[i])) + hasEnoughRank = true; + } + if (!hasEnoughRank) + return; + } + } + + // Find out how many points we have in this field + uint32 spentPoints = 0; + + uint32 tTab = talentInfo->TalentTab; + if (talentInfo->Row > 0) + { + unsigned int numRows = sTalentStore.GetNumRows(); + for (unsigned int i = 0; i < numRows; ++i) // Loop through all talents. + { + // Someday, someone needs to revamp + const TalentEntry *tmpTalent = sTalentStore.LookupEntry(i); + if (tmpTalent) // the way talents are tracked + { + if (tmpTalent->TalentTab == tTab) + { + for (int j = 0; j < MAX_TALENT_RANK; j++) + { + if (tmpTalent->RankID[j] != 0) + { + if (pet->HasSpell(tmpTalent->RankID[j])) + { + spentPoints += j + 1; + } + } + } + } + } + } + } + + // not have required min points spent in talent tree + if(spentPoints < (talentInfo->Row * MAX_PET_TALENT_RANK)) + return; + + // spell not set in talent.dbc + uint32 spellid = talentInfo->RankID[talentRank]; + if( spellid == 0 ) + { + sLog.outError("Talent.dbc have for talent: %u Rank: %u spell id = 0", talentId, talentRank); + return; + } + + // already known + if(pet->HasSpell(spellid)) + return; + + // learn! (other talent ranks will unlearned at learning) + pet->learnSpell(spellid); + sLog.outDetail("PetTalentID: %u Rank: %u Spell: %u\n", talentId, talentRank, spellid); + + // update free talent points + pet->SetFreeTalentPoints(CurTalentPoints - (talentRank - curtalent_maxrank + 1)); +} |
