diff options
Diffstat (limited to 'src/game/Player.cpp')
-rw-r--r-- | src/game/Player.cpp | 9213 |
1 files changed, 5500 insertions, 3713 deletions
diff --git a/src/game/Player.cpp b/src/game/Player.cpp index 4c651ca8e89..9a8345b67e9 100644 --- a/src/game/Player.cpp +++ b/src/game/Player.cpp @@ -1,7 +1,7 @@ /* - * Copyright (C) 2005-2008 MaNGOS <http://www.mangosproject.org/> + * Copyright (C) 2005-2009 MaNGOS <http://getmangos.com/> * - * Copyright (C) 2008 Trinity <http://www.trinitycore.org/> + * Copyright (C) 2008-2009 Trinity <http://www.trinitycore.org/> * * This program is free software; you can redistribute it and/or modify * it under the terms of the GNU General Public License as published by @@ -23,13 +23,13 @@ #include "Database/DatabaseEnv.h" #include "Log.h" #include "Opcodes.h" -#include "ObjectMgr.h" #include "SpellMgr.h" #include "World.h" #include "WorldPacket.h" #include "WorldSession.h" #include "UpdateMask.h" #include "Player.h" +#include "Vehicle.h" #include "SkillDiscovery.h" #include "QuestDef.h" #include "GossipDef.h" @@ -49,7 +49,6 @@ #include "Group.h" #include "Guild.h" #include "Pet.h" -#include "SpellAuras.h" #include "Util.h" #include "Transports.h" #include "Weather.h" @@ -63,11 +62,13 @@ #include "Database/DatabaseImpl.h" #include "Spell.h" #include "SocialMgr.h" -#include "GameEvent.h" +#include "GameEventMgr.h" +#include "AchievementMgr.h" +#include "SpellAuras.h" #include <cmath> -#define ZONE_UPDATE_INTERVAL 1000 +#define ZONE_UPDATE_INTERVAL (1*IN_MILISECONDS) #define PLAYER_SKILL_INDEX(x) (PLAYER_SKILL_INFO_1_1 + ((x)*3)) #define PLAYER_SKILL_VALUE_INDEX(x) (PLAYER_SKILL_INDEX(x)+1) @@ -132,9 +133,20 @@ PlayerTaxi::PlayerTaxi() memset(m_taximask, 0, sizeof(m_taximask)); } -void PlayerTaxi::InitTaxiNodesForLevel(uint32 race, uint32 level) +void PlayerTaxi::InitTaxiNodesForLevel(uint32 race, uint32 chrClass, uint32 level) { - // capital and taxi hub masks + // class specific initial known nodes + switch(chrClass) + { + case CLASS_DEATH_KNIGHT: + { + for(uint8 i = 0; i < TaxiMaskSize; ++i) + m_taximask[i] |= sOldContinentsNodesMask[i]; + break; + } + } + + // race specific initial known nodes: capital and taxi hub masks switch(race) { case RACE_HUMAN: SetTaximaskNode(2); break; // Human @@ -149,6 +161,7 @@ void PlayerTaxi::InitTaxiNodesForLevel(uint32 race, uint32 level) case RACE_BLOODELF: SetTaximaskNode(82); break; // Blood Elf case RACE_DRAENEI: SetTaximaskNode(94); break; // Draenei } + // new continent starting masks (It will be accessible only at new map) switch(Player::TeamForRace(race)) { @@ -164,7 +177,7 @@ void PlayerTaxi::LoadTaxiMask(const char* data) { Tokens tokens = StrSplit(data, " "); - int index; + uint8 index; Tokens::iterator iter; for (iter = tokens.begin(), index = 0; (index < TaxiMaskSize) && (iter != tokens.end()); ++iter, ++index) @@ -188,7 +201,7 @@ void PlayerTaxi::AppendTaximaskTo( ByteBuffer& data, bool all ) } } -bool PlayerTaxi::LoadTaxiDestinationsFromString( const std::string& values ) +bool PlayerTaxi::LoadTaxiDestinationsFromString( const std::string& values, uint32 team ) { ClearTaxiDestinations(); @@ -216,6 +229,10 @@ bool PlayerTaxi::LoadTaxiDestinationsFromString( const std::string& values ) return false; } + // can't load taxi path without mount set (quest taxi path?) + if(!objmgr.GetTaxiMountDisplayId(GetTaxiSource(),team,true)) + return false; + return true; } @@ -245,16 +262,21 @@ uint32 PlayerTaxi::GetCurrentTaxiPath() const return path; } -//== Player ==================================================== +std::ostringstream& operator<< (std::ostringstream& ss, PlayerTaxi const& taxi) +{ + ss << "'"; + for(uint8 i = 0; i < TaxiMaskSize; ++i) + ss << taxi.m_taximask[i] << " "; + ss << "'"; + return ss; +} -const int32 Player::ReputationRank_Length[MAX_REPUTATION_RANK] = {36000, 3000, 3000, 3000, 6000, 12000, 21000, 1000}; +//== Player ==================================================== UpdateMask Player::updateVisualBits; -Player::Player (WorldSession *session): Unit() +Player::Player (WorldSession *session): Unit(), m_achievementMgr(this), m_reputationMgr(this) { - m_transport = 0; - m_speakTime = 0; m_speakCount = 0; @@ -269,6 +291,8 @@ Player::Player (WorldSession *session): Unit() m_ExtraFlags = 0; + m_spellModTakingSpell = NULL; + // players always accept if(GetSession()->GetSecurity() == SEC_PLAYER) SetAcceptWhispers(true); @@ -280,6 +304,7 @@ Player::Player (WorldSession *session): Unit() m_comboPoints = 0; m_usedTalentCount = 0; + m_questRewardTalentCount = 0; m_regenTimer = 0; m_weaponChangeTimer = 0; @@ -293,12 +318,10 @@ Player::Player (WorldSession *session): Unit() // randomize first save time in range [CONFIG_INTERVAL_SAVE] around [CONFIG_INTERVAL_SAVE] // this must help in case next save after mass player load after server startup - m_nextSave = GetMap()->urand(m_nextSave/2,m_nextSave*3/2); + m_nextSave = urand(m_nextSave/2,m_nextSave*3/2); clearResurrectRequestData(); - m_SpellModRemoveCount = 0; - memset(m_items, 0, sizeof(Item*)*PLAYER_SLOTS_COUNT); m_social = NULL; @@ -306,7 +329,7 @@ Player::Player (WorldSession *session): Unit() // group is initialized in the reference constructor SetGroupInvite(NULL); m_groupUpdateMask = 0; - m_auraUpdateMask = 0; + m_auraRaidUpdateMask = 0; duel = NULL; @@ -315,7 +338,8 @@ Player::Player (WorldSession *session): Unit() m_atLoginFlags = AT_LOGIN_NONE; - m_dontMove = false; + mSemaphoreTeleport_Near = false; + mSemaphoreTeleport_Far = false; pTrader = 0; ClearTrade(); @@ -325,17 +349,14 @@ Player::Player (WorldSession *session): Unit() PlayerTalkClass = new PlayerMenu( GetSession() ); m_currentBuybackSlot = BUYBACK_SLOT_START; - for ( int aX = 0 ; aX < 8 ; aX++ ) - m_Tutorials[ aX ] = 0x00; - m_TutorialsChanged = false; - m_DailyQuestChanged = false; m_lastDailyQuestTime = 0; - m_regenTimer = 0; - m_weaponChangeTimer = 0; - m_breathTimer = 0; - m_isunderwater = 0; + for (uint8 i=0; i<MAX_TIMERS; i++) + m_MirrorTimer[i] = DISABLED_MIRROR_TIMER; + + m_MirrorTimerFlags = UNDERWATER_NONE; + m_MirrorTimerFlagsLast = UNDERWATER_NONE; m_isInWater = false; m_drunkTimer = 0; m_drunk = 0; @@ -345,12 +366,13 @@ Player::Player (WorldSession *session): Unit() m_swingErrorMsg = 0; - m_DetectInvTimer = 1000; + m_DetectInvTimer = 1*IN_MILISECONDS; m_bgBattleGroundID = 0; + m_bgTypeID = BATTLEGROUND_TYPE_NONE; for (int j=0; j < PLAYER_MAX_BATTLEGROUND_QUEUES; j++) { - m_bgBattleGroundQueueID[j].bgQueueType = 0; + m_bgBattleGroundQueueID[j].bgQueueTypeId = BATTLEGROUND_QUEUE_NONE; m_bgBattleGroundQueueID[j].invitedToInstance = 0; } m_bgTeam = 0; @@ -362,6 +384,7 @@ Player::Player (WorldSession *session): Unit() m_canParry = false; m_canBlock = false; m_canDualWield = false; + m_canTitanGrip = false; m_ammoDPS = 0.0f; m_temporaryUnsummonedPetNumber = 0; @@ -389,7 +412,7 @@ Player::Player (WorldSession *session): Unit() m_resetTalentsTime = 0; m_itemUpdateQueueBlocked = false; - for (int i = 0; i < MAX_MOVE_TYPE; ++i) + for (uint8 i = 0; i < MAX_MOVE_TYPE; ++i) m_forced_speed_changes[i] = 0; m_stableSlots = 0; @@ -400,12 +423,25 @@ Player::Player (WorldSession *session): Unit() m_InstanceValid = true; m_dungeonDifficulty = DIFFICULTY_NORMAL; - for (int i = 0; i < BASEMOD_END; i++) + m_lastPotionId = 0; + + m_activeSpec = 0; + m_specsCount = 1; + + for (uint8 i = 0; i < BASEMOD_END; ++i) { m_auraBaseMod[i][FLAT_MOD] = 0.0f; m_auraBaseMod[i][PCT_MOD] = 1.0f; } + for (uint8 i = 0; i < MAX_COMBAT_RATING; i++) + m_baseRatingValue[i] = 0; + + m_baseSpellDamage = 0; + m_baseSpellHealing = 0; + m_baseFeralAP = 0; + m_baseManaRegen = 0; + // Honor System m_lastHonorUpdateTime = time(NULL); @@ -417,9 +453,11 @@ Player::Player (WorldSession *session): Unit() m_summon_z = 0.0f; //Default movement to run mode - m_unit_movement_flags = 0; + //m_unit_movement_flags = 0; + + m_mover = this; + m_seer = this; - m_miniPet = 0; m_bgAfkReportedTimer = 0; m_contestedPvPTimer = 0; @@ -427,23 +465,25 @@ Player::Player (WorldSession *session): Unit() m_isActive = true; - m_farsightVision = false; + m_runes = NULL; + + m_lastFallTime = 0; + m_lastFallZ = 0; + + m_ControlledByPlayer = true; } Player::~Player () { - CleanupsBeforeDelete(); - // it must be unloaded already in PlayerLogout and accessed only for loggined player //m_social = NULL; // Note: buy back item already deleted from DB when player was saved - for(int i = 0; i < PLAYER_SLOTS_COUNT; ++i) + for(uint8 i = 0; i < PLAYER_SLOTS_COUNT; ++i) { if(m_items[i]) delete m_items[i]; } - CleanupChannels(); for (PlayerSpellMap::const_iterator itr = m_spells.begin(); itr != m_spells.end(); ++itr) delete itr->second; @@ -457,31 +497,28 @@ Player::~Player () delete PlayerTalkClass; - if (m_transport) - { - m_transport->RemovePassenger(this); - } - for(size_t x = 0; x < ItemSetEff.size(); x++) if(ItemSetEff[x]) delete ItemSetEff[x]; - // clean up player-instance binds, may unload some instance saves - for(uint8 i = 0; i < TOTAL_DIFFICULTIES; i++) - for(BoundInstancesMap::iterator itr = m_boundInstances[i].begin(); itr != m_boundInstances[i].end(); ++itr) - itr->second.save->RemovePlayer(this); - delete m_declinedname; + delete m_runes; } void Player::CleanupsBeforeDelete() { - if(m_uint32Values) // only for fully created Object - { - TradeCancel(false); - DuelComplete(DUEL_INTERUPTED); - } + TradeCancel(false); + DuelComplete(DUEL_INTERUPTED); + Unit::CleanupsBeforeDelete(); + + if (m_transport) + m_transport->RemovePassenger(this); + + // clean up player-instance binds, may unload some instance saves + for(uint8 i = 0; i < TOTAL_DIFFICULTIES; ++i) + for(BoundInstancesMap::iterator itr = m_boundInstances[i].begin(); itr != m_boundInstances[i].end(); ++itr) + itr->second.save->RemovePlayer(this); } bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 class_, uint8 gender, uint8 skin, uint8 face, uint8 hairStyle, uint8 hairColor, uint8 facialHair, uint8 outfitId ) @@ -499,7 +536,7 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 return false; } - for (int i = 0; i < PLAYER_SLOTS_COUNT; i++) + for (uint8 i = 0; i < PLAYER_SLOTS_COUNT; i++) m_items[i] = NULL; m_race = race; @@ -517,24 +554,8 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 uint8 powertype = cEntry->powerType; - uint32 unitfield; - - switch(powertype) - { - case POWER_ENERGY: - case POWER_MANA: - unitfield = 0x00000000; - break; - case POWER_RAGE: - unitfield = 0x00110000; - break; - default: - sLog.outError("Invalid default powertype %u for player (class %u)",powertype,class_); - return false; - } - - SetFloatValue(UNIT_FIELD_BOUNDINGRADIUS, DEFAULT_WORLD_OBJECT_SIZE ); - SetFloatValue(UNIT_FIELD_COMBATREACH, DEFAULT_COMBAT_REACH ); + SetFloatValue(UNIT_FIELD_BOUNDINGRADIUS, DEFAULT_WORLD_OBJECT_SIZE); + SetFloatValue(UNIT_FIELD_COMBATREACH, 1.5f); switch(gender) { @@ -557,12 +578,13 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 uint32 RaceClassGender = ( race ) | ( class_ << 8 ) | ( gender << 16 ); SetUInt32Value(UNIT_FIELD_BYTES_0, ( RaceClassGender | ( powertype << 24 ) ) ); - SetUInt32Value(UNIT_FIELD_BYTES_1, unitfield); - SetByteValue(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_SANCTUARY | UNIT_BYTE2_FLAG_UNK5 ); - SetUInt32Value(UNIT_FIELD_FLAGS, UNIT_FLAG_PVP_ATTACKABLE ); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_PVP ); + SetFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_PVP_ATTACKABLE ); + SetFlag(UNIT_FIELD_FLAGS_2, UNIT_FLAG2_REGENERATE_POWER); SetFloatValue(UNIT_MOD_CAST_SPEED, 1.0f); // fix cast time showed in spell tooltip on client + SetFloatValue(UNIT_FIELD_HOVERHEIGHT, 1.0f); // default for players in 3.0.3 - //-1 is default value + // -1 is default value SetUInt32Value(PLAYER_FIELD_WATCHED_FACTION_INDEX, uint32(-1)); SetUInt32Value(PLAYER_BYTES, (skin | (face << 8) | (hairStyle << 16) | (hairColor << 24))); @@ -574,6 +596,8 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 SetUInt32Value( PLAYER_GUILD_TIMESTAMP, 0 ); SetUInt64Value( PLAYER__FIELD_KNOWN_TITLES, 0 ); // 0=disabled + SetUInt64Value( PLAYER__FIELD_KNOWN_TITLES1, 0 ); // 0=disabled + SetUInt64Value( PLAYER__FIELD_KNOWN_TITLES2, 0 ); // 0=disabled SetUInt32Value( PLAYER_CHOSEN_TITLE, 0 ); SetUInt32Value( PLAYER_FIELD_KILLS, 0 ); SetUInt32Value( PLAYER_FIELD_LIFETIME_HONORBALE_KILLS, 0 ); @@ -581,10 +605,20 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 SetUInt32Value( PLAYER_FIELD_YESTERDAY_CONTRIBUTION, 0 ); // set starting level + uint32 start_level = getClass() != CLASS_DEATH_KNIGHT + ? sWorld.getConfig(CONFIG_START_PLAYER_LEVEL) + : sWorld.getConfig(CONFIG_START_HEROIC_PLAYER_LEVEL); + if (GetSession()->GetSecurity() >= SEC_MODERATOR) - SetUInt32Value (UNIT_FIELD_LEVEL, sWorld.getConfig(CONFIG_START_GM_LEVEL)); - else - SetUInt32Value (UNIT_FIELD_LEVEL, sWorld.getConfig(CONFIG_START_PLAYER_LEVEL)); + { + uint32 gm_level = sWorld.getConfig(CONFIG_START_GM_LEVEL); + if(gm_level > start_level) + start_level = gm_level; + } + + SetUInt32Value(UNIT_FIELD_LEVEL, start_level); + + InitRunes(); SetUInt32Value (PLAYER_FIELD_COINAGE, sWorld.getConfig(CONFIG_START_PLAYER_MONEY)); SetUInt32Value (PLAYER_FIELD_HONOR_CURRENCY, sWorld.getConfig(CONFIG_START_HONOR_POINTS)); @@ -600,40 +634,40 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 //Reputations if "StartAllReputation" is enabled, -- TODO: Fix this in a better way if(sWorld.getConfig(CONFIG_START_ALL_REP)) { - SetFactionReputation(sFactionStore.LookupEntry(942),42999); - SetFactionReputation(sFactionStore.LookupEntry(935),42999); - SetFactionReputation(sFactionStore.LookupEntry(936),42999); - SetFactionReputation(sFactionStore.LookupEntry(1011),42999); - SetFactionReputation(sFactionStore.LookupEntry(970),42999); - SetFactionReputation(sFactionStore.LookupEntry(967),42999); - SetFactionReputation(sFactionStore.LookupEntry(989),42999); - SetFactionReputation(sFactionStore.LookupEntry(932),42999); - SetFactionReputation(sFactionStore.LookupEntry(934),42999); - SetFactionReputation(sFactionStore.LookupEntry(1038),42999); - SetFactionReputation(sFactionStore.LookupEntry(1077),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(942),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(935),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(936),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(1011),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(970),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(967),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(989),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(932),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(934),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(1038),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(1077),42999); // Factions depending on team, like cities and some more stuff switch(GetTeam()) { case ALLIANCE: - SetFactionReputation(sFactionStore.LookupEntry(72),42999); - SetFactionReputation(sFactionStore.LookupEntry(47),42999); - SetFactionReputation(sFactionStore.LookupEntry(69),42999); - SetFactionReputation(sFactionStore.LookupEntry(930),42999); - SetFactionReputation(sFactionStore.LookupEntry(730),42999); - SetFactionReputation(sFactionStore.LookupEntry(978),42999); - SetFactionReputation(sFactionStore.LookupEntry(54),42999); - SetFactionReputation(sFactionStore.LookupEntry(946),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(72),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(47),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(69),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(930),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(730),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(978),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(54),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(946),42999); break; case HORDE: - SetFactionReputation(sFactionStore.LookupEntry(76),42999); - SetFactionReputation(sFactionStore.LookupEntry(68),42999); - SetFactionReputation(sFactionStore.LookupEntry(81),42999); - SetFactionReputation(sFactionStore.LookupEntry(911),42999); - SetFactionReputation(sFactionStore.LookupEntry(729),42999); - SetFactionReputation(sFactionStore.LookupEntry(941),42999); - SetFactionReputation(sFactionStore.LookupEntry(530),42999); - SetFactionReputation(sFactionStore.LookupEntry(947),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(76),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(68),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(81),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(911),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(729),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(941),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(530),42999); + GetReputationMgr().SetReputation(sFactionStore.LookupEntry(947),42999); break; default: break; @@ -648,8 +682,9 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 // base stats and related field values InitStatsForLevel(); InitTaxiNodesForLevel(); + InitGlyphsForLevel(); InitTalentForLevel(); - InitPrimaryProffesions(); // to max set before any spell added + InitPrimaryProfessions(); // to max set before any spell added // apply original stats mods before spell loading or item equipment that call before equip _RemoveStatsMods() UpdateMaxHealth(); // Update max Health (for add bonus from stamina) @@ -660,23 +695,31 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 SetPower(POWER_MANA,GetMaxPower(POWER_MANA)); } + if(getPowerType() == POWER_RUNIC_POWER) + { + SetPower(POWER_RUNE, 8); + SetMaxPower(POWER_RUNE, 8); + SetPower(POWER_RUNIC_POWER, 0); + SetMaxPower(POWER_RUNIC_POWER, 1000); + } + // original spells - learnDefaultSpells(true); + learnDefaultSpells(); // original action bar std::list<uint16>::const_iterator action_itr[4]; - for(int i=0; i<4; i++) + for(uint8 i=0; i<4; i++) action_itr[i] = info->action[i].begin(); for (; action_itr[0]!=info->action[0].end() && action_itr[1]!=info->action[1].end();) { uint16 taction[4]; - for(int i=0; i<4 ;i++) + for(uint8 i=0; i<4 ;i++) taction[i] = (*action_itr[i]); addActionButton((uint8)taction[0], taction[1], (uint8)taction[2], (uint8)taction[3]); - for(int i=0; i<4 ;i++) + for(uint8 i=0; i<4 ;i++) ++action_itr[i]; } @@ -703,6 +746,11 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 uint32 item_id = oEntry->ItemId[j]; + + // Hack for not existed item id in dbc 3.0.3 + if(item_id==40582) + continue; + ItemPrototype const* iProto = objmgr.GetItemPrototype(item_id); if(!iProto) { @@ -710,7 +758,9 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 continue; } - uint32 count = iProto->Stackable; // max stack by default (mostly 1) + // max stack by default (mostly 1), 1 for infinity stackable + uint32 count = iProto->Stackable > 0 ? uint32(iProto->Stackable) : 1; + if(iProto->Class==ITEM_CLASS_CONSUMABLE && iProto->SubClass==ITEM_SUBCLASS_FOOD) { switch(iProto->Spells[0].SpellCategory) @@ -736,7 +786,7 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 // bags and main-hand weapon must equipped at this moment // now second pass for not equipped (offhand weapon/shield if it attempt equipped before main-hand weapon) // or ammo not equipped in special bag - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { if(Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { @@ -760,9 +810,9 @@ bool Player::Create( uint32 guidlow, const std::string& name, uint8 race, uint8 } // if this is ammo then use it - uint8 msg = CanUseAmmo( pItem->GetProto()->ItemId ); + msg = CanUseAmmo( pItem->GetEntry() ); if( msg == EQUIP_ERR_OK ) - SetAmmo( pItem->GetProto()->ItemId ); + SetAmmo( pItem->GetEntry() ); } } } @@ -806,25 +856,14 @@ bool Player::StoreNewItemInBestSlots(uint32 titem_id, uint32 titem_amount) return false; } -void Player::StartMirrorTimer(MirrorTimerType Type, uint32 MaxValue) +void Player::SendMirrorTimer(MirrorTimerType Type, uint32 MaxValue, uint32 CurrentValue, int32 Regen) { - uint32 BreathRegen = (uint32)-1; - - WorldPacket data(SMSG_START_MIRROR_TIMER, (21)); - data << (uint32)Type; - data << MaxValue; - data << MaxValue; - data << BreathRegen; - data << (uint8)0; - data << (uint32)0; // spell id - GetSession()->SendPacket(&data); -} - -void Player::ModifyMirrorTimer(MirrorTimerType Type, uint32 MaxValue, uint32 CurrentValue, uint32 Regen) -{ - if(Type==BREATH_TIMER) - m_breathTimer = ((MaxValue + 1000) - CurrentValue) / Regen; - + if (MaxValue == DISABLED_MIRROR_TIMER) + { + if (CurrentValue!=DISABLED_MIRROR_TIMER) + StopMirrorTimer(Type); + return; + } WorldPacket data(SMSG_START_MIRROR_TIMER, (21)); data << (uint32)Type; data << CurrentValue; @@ -837,150 +876,201 @@ void Player::ModifyMirrorTimer(MirrorTimerType Type, uint32 MaxValue, uint32 Cur void Player::StopMirrorTimer(MirrorTimerType Type) { - if(Type==BREATH_TIMER) - m_breathTimer = 0; - + m_MirrorTimer[Type] = DISABLED_MIRROR_TIMER; WorldPacket data(SMSG_STOP_MIRROR_TIMER, 4); data << (uint32)Type; GetSession()->SendPacket( &data ); } -void Player::EnvironmentalDamage(uint64 guid, EnviromentalDamage type, uint32 damage) +void Player::EnvironmentalDamage(EnviromentalDamage type, uint32 damage) { + if(!isAlive() || isGameMaster()) + return; + + // Absorb, resist some environmental damage type + uint32 absorb = 0; + uint32 resist = 0; + if (type == DAMAGE_LAVA) + CalcAbsorbResist(this, SPELL_SCHOOL_MASK_FIRE, DIRECT_DAMAGE, damage, &absorb, &resist); + else if (type == DAMAGE_SLIME) + CalcAbsorbResist(this, SPELL_SCHOOL_MASK_NATURE, DIRECT_DAMAGE, damage, &absorb, &resist); + + damage-=absorb+resist; + + DealDamageMods(this,damage,&absorb); + WorldPacket data(SMSG_ENVIRONMENTALDAMAGELOG, (21)); - data << (uint64)guid; - data << (uint8)(type!=DAMAGE_FALL_TO_VOID ? type : DAMAGE_FALL); - data << (uint32)damage; - data << (uint32)0; - data << (uint32)0; + data << uint64(GetGUID()); + data << uint8(type!=DAMAGE_FALL_TO_VOID ? type : DAMAGE_FALL); + data << uint32(damage); + data << uint32(absorb); + data << uint32(resist); SendMessageToSet(&data, true); DealDamage(this, damage, NULL, SELF_DAMAGE, SPELL_SCHOOL_MASK_NORMAL, NULL, false); - if(type==DAMAGE_FALL && !isAlive()) // DealDamage not apply item durability loss at self damage + if(!isAlive()) { - DEBUG_LOG("We are fall to death, loosing 10 percents durability"); - DurabilityLossAll(0.10f,false); - // durability lost message - WorldPacket data(SMSG_DURABILITY_DAMAGE_DEATH, 0); - GetSession()->SendPacket(&data); + if(type==DAMAGE_FALL) // DealDamage not apply item durability loss at self damage + { + DEBUG_LOG("We are fall to death, loosing 10 percents durability"); + DurabilityLossAll(0.10f,false); + // durability lost message + WorldPacket data2(SMSG_DURABILITY_DAMAGE_DEATH, 0); + GetSession()->SendPacket(&data2); + } + + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATHS_FROM, 1, type); } } -void Player::HandleDrowning() +int32 Player::getMaxTimer(MirrorTimerType timer) { - if(!m_isunderwater) - return; - - //if player is GM, have waterbreath, is dead or if breathing is disabled then return - if(waterbreath || isGameMaster() || !isAlive() || GetSession()->GetSecurity() >= sWorld.getConfig(CONFIG_DISABLE_BREATHING)) + switch (timer) { - StopMirrorTimer(BREATH_TIMER); - m_isunderwater = 0; - return; + case FATIGUE_TIMER: + return MINUTE*IN_MILISECONDS; + case BREATH_TIMER: + { + if (!isAlive() || HasAuraType(SPELL_AURA_WATER_BREATHING) || GetSession()->GetSecurity() >= sWorld.getConfig(CONFIG_DISABLE_BREATHING)) + return DISABLED_MIRROR_TIMER; + int32 UnderWaterTime = 3*MINUTE*IN_MILISECONDS; + AuraEffectList const& mModWaterBreathing = GetAurasByType(SPELL_AURA_MOD_WATER_BREATHING); + for(AuraEffectList::const_iterator i = mModWaterBreathing.begin(); i != mModWaterBreathing.end(); ++i) + UnderWaterTime = uint32(UnderWaterTime * (100.0f + (*i)->GetAmount()) / 100.0f); + return UnderWaterTime; + } + case FIRE_TIMER: + { + if (!isAlive()) + return DISABLED_MIRROR_TIMER; + return 1*IN_MILISECONDS; + } + default: + return 0; } + return 0; +} - uint32 UnderWaterTime = 1*MINUTE*1000; // default length 1 min +void Player::UpdateMirrorTimers() +{ + // Desync flags for update on next HandleDrowning + if (m_MirrorTimerFlags) + m_MirrorTimerFlagsLast = ~m_MirrorTimerFlags; +} - AuraList const& mModWaterBreathing = GetAurasByType(SPELL_AURA_MOD_WATER_BREATHING); - for(AuraList::const_iterator i = mModWaterBreathing.begin(); i != mModWaterBreathing.end(); ++i) - UnderWaterTime = uint32(UnderWaterTime * (100.0f + (*i)->GetModifierValue()) / 100.0f); +void Player::HandleDrowning(uint32 time_diff) +{ + if (!m_MirrorTimerFlags) + return; - if ((m_isunderwater & 0x01) && !(m_isunderwater & 0x80) && isAlive()) + // In water + if (m_MirrorTimerFlags & UNDERWATER_INWATER) { - //single trigger timer - if (!(m_isunderwater & 0x02)) - { - m_isunderwater|= 0x02; - m_breathTimer = UnderWaterTime + 1000; - } - //single trigger "Breathbar" - if ( m_breathTimer <= UnderWaterTime && !(m_isunderwater & 0x04)) + // Breath timer not activated - activate it + if (m_MirrorTimer[BREATH_TIMER] == DISABLED_MIRROR_TIMER) { - m_isunderwater|= 0x04; - StartMirrorTimer(BREATH_TIMER, UnderWaterTime); + m_MirrorTimer[BREATH_TIMER] = getMaxTimer(BREATH_TIMER); + SendMirrorTimer(BREATH_TIMER, m_MirrorTimer[BREATH_TIMER], m_MirrorTimer[BREATH_TIMER], -1); } - //continuous trigger drowning "Damage" - if ((m_breathTimer == 0) && (m_isunderwater & 0x01)) + else // If activated - do tick { - //TODO: Check this formula - uint64 guid = GetGUID(); - uint32 damage = GetMaxHealth() / 5 + GetMap()->urand(0, getLevel()-1); - - EnvironmentalDamage(guid, DAMAGE_DROWNING,damage); - m_breathTimer = 2000; + m_MirrorTimer[BREATH_TIMER]-=time_diff; + // Timer limit - need deal damage + if (m_MirrorTimer[BREATH_TIMER] < 0) + { + m_MirrorTimer[BREATH_TIMER]+= 1*IN_MILISECONDS; + // Calculate and deal damage + // TODO: Check this formula + uint32 damage = GetMaxHealth() / 5 + urand(0, getLevel()-1); + EnvironmentalDamage(DAMAGE_DROWNING, damage); + } + else if (!(m_MirrorTimerFlagsLast & UNDERWATER_INWATER)) // Update time in client if need + SendMirrorTimer(BREATH_TIMER, getMaxTimer(BREATH_TIMER), m_MirrorTimer[BREATH_TIMER], -1); } } - //single trigger retract bar - else if (!(m_isunderwater & 0x01) && !(m_isunderwater & 0x08) && (m_isunderwater & 0x02) && (m_breathTimer > 0) && isAlive()) + else if (m_MirrorTimer[BREATH_TIMER] != DISABLED_MIRROR_TIMER) // Regen timer { - m_isunderwater = 0x08; - - uint32 BreathRegen = 10; - ModifyMirrorTimer(BREATH_TIMER, UnderWaterTime, m_breathTimer,BreathRegen); - m_isunderwater = 0x10; - } - //remove bar - else if ((m_breathTimer < 50) && !(m_isunderwater & 0x01) && (m_isunderwater == 0x10)) - { - StopMirrorTimer(BREATH_TIMER); - m_isunderwater = 0; + int32 UnderWaterTime = getMaxTimer(BREATH_TIMER); + // Need breath regen + m_MirrorTimer[BREATH_TIMER]+=10*time_diff; + if (m_MirrorTimer[BREATH_TIMER] >= UnderWaterTime || !isAlive()) + StopMirrorTimer(BREATH_TIMER); + else if (m_MirrorTimerFlagsLast & UNDERWATER_INWATER) + SendMirrorTimer(BREATH_TIMER, UnderWaterTime, m_MirrorTimer[BREATH_TIMER], 10); } -} - -void Player::HandleLava() -{ - bool ValidArea = false; - if ((m_isunderwater & 0x80) && isAlive()) + // In dark water + if (m_MirrorTimerFlags & UNDERWARER_INDARKWATER) { - //Single trigger Set BreathTimer - if (!(m_isunderwater & 0x80)) + // Fatigue timer not activated - activate it + if (m_MirrorTimer[FATIGUE_TIMER] == DISABLED_MIRROR_TIMER) { - m_isunderwater|= 0x04; - m_breathTimer = 1000; + m_MirrorTimer[FATIGUE_TIMER] = getMaxTimer(FATIGUE_TIMER); + SendMirrorTimer(FATIGUE_TIMER, m_MirrorTimer[FATIGUE_TIMER], m_MirrorTimer[FATIGUE_TIMER], -1); } - //Reset BreathTimer and still in the lava - if (!m_breathTimer) + else { - uint64 guid = GetGUID(); - uint32 damage = GetMap()->urand(600, 700); // TODO: Get more detailed information about lava damage - uint32 dmgZone = GetZoneId(); // TODO: Find correct "lava dealing zone" flag in Area Table - - // Deal lava damage only in lava zones. - switch(dmgZone) + m_MirrorTimer[FATIGUE_TIMER]-=time_diff; + // Timer limit - need deal damage or teleport ghost to graveyard + if (m_MirrorTimer[FATIGUE_TIMER] < 0) { - case 0x8D: - ValidArea = false; - break; - case 0x94: - ValidArea = false; - break; - case 0x2CE: - ValidArea = false; - break; - case 0x2CF: - ValidArea = false; - break; - default: - if (dmgZone / 5 & 0x408) - ValidArea = true; + m_MirrorTimer[FATIGUE_TIMER]+= 1*IN_MILISECONDS; + if (isAlive()) // Calculate and deal damage + { + uint32 damage = GetMaxHealth() / 5 + urand(0, getLevel()-1); + EnvironmentalDamage(DAMAGE_EXHAUSTED, damage); + } + else if (HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_GHOST)) // Teleport ghost to graveyard + RepopAtGraveyard(); } - - // if is valid area and is not gamemaster then deal damage - if ( ValidArea && !isGameMaster() ) - EnvironmentalDamage(guid, DAMAGE_LAVA, damage); - - m_breathTimer = 1000; + else if (!(m_MirrorTimerFlagsLast & UNDERWARER_INDARKWATER)) + SendMirrorTimer(FATIGUE_TIMER, getMaxTimer(FATIGUE_TIMER), m_MirrorTimer[FATIGUE_TIMER], -1); } - } - //Death timer disabled and WaterFlags reset - else if (m_deathState == DEAD) + else if (m_MirrorTimer[FATIGUE_TIMER] != DISABLED_MIRROR_TIMER) // Regen timer + { + int32 DarkWaterTime = getMaxTimer(FATIGUE_TIMER); + m_MirrorTimer[FATIGUE_TIMER]+=10*time_diff; + if (m_MirrorTimer[FATIGUE_TIMER] >= DarkWaterTime || !isAlive()) + StopMirrorTimer(FATIGUE_TIMER); + else if (m_MirrorTimerFlagsLast & UNDERWARER_INDARKWATER) + SendMirrorTimer(FATIGUE_TIMER, DarkWaterTime, m_MirrorTimer[FATIGUE_TIMER], 10); + } + + if (m_MirrorTimerFlags & (UNDERWATER_INLAVA|UNDERWATER_INSLIME)) { - m_breathTimer = 0; - m_isunderwater = 0; + // Breath timer not activated - activate it + if (m_MirrorTimer[FIRE_TIMER] == DISABLED_MIRROR_TIMER) + m_MirrorTimer[FIRE_TIMER] = getMaxTimer(FIRE_TIMER); + else + { + m_MirrorTimer[FIRE_TIMER]-=time_diff; + if (m_MirrorTimer[FIRE_TIMER] < 0) + { + m_MirrorTimer[FIRE_TIMER]+= 1*IN_MILISECONDS; + // Calculate and deal damage + // TODO: Check this formula + uint32 damage = urand(600, 700); + if (m_MirrorTimerFlags&UNDERWATER_INLAVA) + EnvironmentalDamage(DAMAGE_LAVA, damage); + else + EnvironmentalDamage(DAMAGE_SLIME, damage); + } + } } + else + m_MirrorTimer[FIRE_TIMER] = DISABLED_MIRROR_TIMER; + + // Recheck timers flag + m_MirrorTimerFlags&=~UNDERWATER_EXIST_TIMERS; + for (uint8 i = 0; i< MAX_TIMERS; ++i) + if (m_MirrorTimer[i]!=DISABLED_MIRROR_TIMER) + { + m_MirrorTimerFlags|=UNDERWATER_EXIST_TIMERS; + break; + } + m_MirrorTimerFlagsLast = m_MirrorTimerFlags; } ///The player sobers by 256 every 10 seconds @@ -1044,6 +1134,10 @@ void Player::Update( uint32 p_time ) m_nextMailDelivereTime = 0; } + // If this is set during update SetSpellModTakingSpell call is missing somewhere in the code + // Having this would prevent more aura charges to be dropped, so let's crash + assert (!m_spellModTakingSpell); + Unit::Update( p_time ); time_t now = time (NULL); @@ -1058,8 +1152,6 @@ void Player::Update( uint32 p_time ) UpdateAfkReport(now); - CheckExploreSystem(); - if(isCharmed()) { if(Unit *charmer = GetCharmer()) @@ -1203,14 +1295,15 @@ void Player::Update( uint32 p_time ) { if(p_time >= m_zoneUpdateTimer) { - uint32 newzone = GetZoneId(); + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + if( m_zoneUpdateId != newzone ) - UpdateZone(newzone); // also update area + UpdateZone(newzone,newarea); // also update area else { // use area updates as well // needed for free far all arenas for example - uint32 newarea = GetAreaId(); if( m_areaUpdateId != newarea ) UpdateArea(newarea); @@ -1245,21 +1338,8 @@ void Player::Update( uint32 p_time ) } } - //Breathtimer - if(m_breathTimer > 0) - { - if(p_time >= m_breathTimer) - m_breathTimer = 0; - else - m_breathTimer -= p_time; - - } - //Handle Water/drowning - HandleDrowning(); - - //Handle lava - HandleLava(); + HandleDrowning(p_time); //Handle detect stealth players if (m_DetectInvTimer > 0) @@ -1286,7 +1366,7 @@ void Player::Update( uint32 p_time ) { m_drunkTimer += p_time; - if (m_drunkTimer > 10000) + if (m_drunkTimer > 10*IN_MILISECONDS) HandleSobering(); } @@ -1311,6 +1391,7 @@ void Player::Update( uint32 p_time ) Pet* pet = GetPet(); if(pet && !IsWithinDistInMap(pet, OWNER_MAX_DISTANCE) && !pet->isPossessed()) + //if(pet && !IsWithinDistInMap(pet, OWNER_MAX_DISTANCE) && (GetCharmGUID() && (pet->GetGUID() != GetCharmGUID()))) { RemovePet(pet, PET_SAVE_NOT_IN_SLOT, true); return; @@ -1344,16 +1425,15 @@ void Player::setDeathState(DeathState s) //FIXME: is pet dismissed at dying or releasing spirit? if second, add setDeathState(DEAD) to HandleRepopRequestOpcode and define pet unsummon here with (s == DEAD) RemovePet(NULL, PET_SAVE_NOT_IN_SLOT, true); - // remove uncontrolled pets - RemoveMiniPet(); - RemoveGuardians(); - // save value before aura remove in Unit::setDeathState ressSpellId = GetUInt32Value(PLAYER_SELF_RES_SPELL); // passive spell if(!ressSpellId) ressSpellId = GetResurrectionSpellId(); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATH_AT_MAP, 1); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATH, 1); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_DEATH_IN_DUNGEON, 1); } Unit::setDeathState(s); @@ -1374,13 +1454,15 @@ void Player::setDeathState(DeathState s) void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) { - *p_data << GetGUID(); + Field *fields = result->Fetch(); + + *p_data << uint64(GetGUID()); *p_data << m_name; - *p_data << getRace(); + *p_data << uint8(getRace()); uint8 pClass = getClass(); - *p_data << pClass; - *p_data << getGender(); + *p_data << uint8(pClass); + *p_data << uint8(getGender()); uint32 bytes = GetUInt32Value(PLAYER_BYTES); *p_data << uint8(bytes); @@ -1393,16 +1475,17 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) *p_data << uint8(getLevel()); // player level // do not use GetMap! it will spawn a new instance since the bound instances are not loaded - uint32 zoneId = MapManager::Instance().GetZoneId(GetMapId(), GetPositionX(),GetPositionY()); - sLog.outDebug("Player::BuildEnumData: m:%u, x:%f, y:%f, z:%f zone:%u", GetMapId(), GetPositionX(), GetPositionY(), GetPositionZ(), zoneId); - *p_data << zoneId; - *p_data << GetMapId(); + uint32 zoneId = fields[10].GetUInt32(); + sLog.outDebug("Player::BuildEnumData: map:%u, x:%f, y:%f, z:%f zone:%u", GetMapId(), GetPositionX(), GetPositionY(), GetPositionZ(), zoneId); + *p_data << uint32(zoneId); + *p_data << uint32(GetMapId()); *p_data << GetPositionX(); *p_data << GetPositionY(); *p_data << GetPositionZ(); - *p_data << (result ? result->Fetch()[13].GetUInt32() : 0); + // guild id + *p_data << uint32(fields[14].GetUInt32()); uint32 char_flags = 0; if(HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_HIDE_HELM)) @@ -1413,14 +1496,18 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) char_flags |= CHARACTER_FLAG_GHOST; if(HasAtLoginFlag(AT_LOGIN_RENAME)) char_flags |= CHARACTER_FLAG_RENAME; - // always send the flag if declined names aren't used - // to let the client select a default method of declining the name - if(!sWorld.getConfig(CONFIG_DECLINED_NAMES_USED) || (result && result->Fetch()[14].GetCppString() != "")) + if(sWorld.getConfig(CONFIG_DECLINED_NAMES_USED)) + { + if(!fields[15].GetCppString().empty()) + char_flags |= CHARACTER_FLAG_DECLINED; + } + else char_flags |= CHARACTER_FLAG_DECLINED; - *p_data << (uint32)char_flags; // character flags - - *p_data << (uint8)1; // unknown + *p_data << uint32(char_flags); // character flags + // character customize (flags?) + *p_data << uint32(HasAtLoginFlag(AT_LOGIN_CUSTOMIZE) ? 1 : 0); + *p_data << uint8(1); // unknown // Pets info { @@ -1429,80 +1516,53 @@ void Player::BuildEnumData( QueryResult * result, WorldPacket * p_data ) uint32 petFamily = 0; // show pet at selection character in character list only for non-ghost character - if(result && isAlive() && (pClass == CLASS_WARLOCK || pClass == CLASS_HUNTER)) + if (result && isAlive() && (pClass == CLASS_WARLOCK || pClass == CLASS_HUNTER || pClass == CLASS_DEATH_KNIGHT)) { - Field* fields = result->Fetch(); - - uint32 entry = fields[10].GetUInt32(); + uint32 entry = fields[11].GetUInt32(); CreatureInfo const* cInfo = sCreatureStorage.LookupEntry<CreatureInfo>(entry); if(cInfo) { - petDisplayId = fields[11].GetUInt32(); - petLevel = fields[12].GetUInt32(); + petDisplayId = fields[12].GetUInt32(); + petLevel = fields[13].GetUInt32(); petFamily = cInfo->family; } } - *p_data << (uint32)petDisplayId; - *p_data << (uint32)petLevel; - *p_data << (uint32)petFamily; + *p_data << uint32(petDisplayId); + *p_data << uint32(petLevel); + *p_data << uint32(petFamily); } - /*ItemPrototype const *items[EQUIPMENT_SLOT_END]; - for (int i = 0; i < EQUIPMENT_SLOT_END; i++) - items[i] = NULL; - - QueryResult *result = CharacterDatabase.PQuery("SELECT slot,item_template FROM character_inventory WHERE guid = '%u' AND bag = 0",GetGUIDLow()); - if (result) - { - do - { - Field *fields = result->Fetch(); - uint8 slot = fields[0].GetUInt8() & 255; - uint32 item_id = fields[1].GetUInt32(); - if( slot >= EQUIPMENT_SLOT_END ) - continue; - - items[slot] = objmgr.GetItemPrototype(item_id); - if(!items[slot]) - { - sLog.outError( "Player::BuildEnumData: Player %s have unknown item (id: #%u) in inventory, skipped.", GetName(),item_id ); - continue; - } - } while (result->NextRow()); - delete result; - }*/ - for (uint8 slot = 0; slot < EQUIPMENT_SLOT_END; slot++) { - uint32 visualbase = PLAYER_VISIBLE_ITEM_1_0 + (slot * MAX_VISIBLE_ITEM_OFFSET); + uint32 visualbase = PLAYER_VISIBLE_ITEM_1_ENTRYID + (slot * 2); uint32 item_id = GetUInt32Value(visualbase); const ItemPrototype * proto = objmgr.GetItemPrototype(item_id); SpellItemEnchantmentEntry const *enchant = NULL; - for(uint8 enchantSlot = PERM_ENCHANTMENT_SLOT; enchantSlot<=TEMP_ENCHANTMENT_SLOT; enchantSlot++) + for(uint8 enchantSlot = PERM_ENCHANTMENT_SLOT; enchantSlot <= TEMP_ENCHANTMENT_SLOT; ++enchantSlot) { - uint32 enchantId = GetUInt32Value(visualbase+1+enchantSlot); + uint32 enchantId = GetUInt16Value(visualbase + 1, enchantSlot); if(enchant = sSpellItemEnchantmentStore.LookupEntry(enchantId)) break; } if (proto != NULL) { - *p_data << (uint32)proto->DisplayInfoID; - *p_data << (uint8)proto->InventoryType; - *p_data << (uint32)(enchant?enchant->aura_id:0); + *p_data << uint32(proto->DisplayInfoID); + *p_data << uint8(proto->InventoryType); + *p_data << uint32(enchant ? enchant->aura_id : 0); } else { - *p_data << (uint32)0; - *p_data << (uint8)0; - *p_data << (uint32)0; // enchant? + *p_data << uint32(0); + *p_data << uint8(0); + *p_data << uint32(0); // enchant? } } - *p_data << (uint32)0; // first bag display id - *p_data << (uint8)0; // first bag inventory type - *p_data << (uint32)0; // enchant? + *p_data << uint32(0); // first bag display id + *p_data << uint8(0); // first bag inventory type + *p_data << uint32(0); // enchant? } bool Player::ToggleAFK() @@ -1542,6 +1602,15 @@ uint8 Player::chatTag() const return 0; } +void Player::SendTeleportAckMsg() +{ + WorldPacket data(MSG_MOVE_TELEPORT_ACK, 41); + data.append(GetPackGUID()); + data << uint32(0); // this value increments every time + BuildMovementPacket(&data); + GetSession()->SendPacket(&data); +} + bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientation, uint32 options) { if(!MapManager::IsValidMapCoord(mapid, x, y, z, orientation)) @@ -1566,19 +1635,6 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati if(!InBattleGround() && mEntry->IsBattleGroundOrArena()) return false; - // 449 - Champions' Hall (Alliance) // 450 - Hall of Legends (Horde) - if(mapid == 449 && GetTeam()==HORDE) - { - GetSession()->SendNotification(LANG_NO_ENTER_CHAMPIONS_HALL); - return false; - } - - if(mapid == 450 && GetTeam() == ALLIANCE) - { - GetSession()->SendNotification(LANG_NO_ENTER_HALL_OF_LEGENDS); - return false; - } - // client without expansion support if(GetSession()->Expansion() < mEntry->Expansion()) { @@ -1587,106 +1643,71 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati if(GetTransport()) RepopAtGraveyard(); // teleport to near graveyard if on transport, looks blizz like :) - SendTransferAborted(mapid, TRANSFER_ABORT_INSUF_EXPAN_LVL1); + SendTransferAborted(mapid, TRANSFER_ABORT_INSUF_EXPAN_LVL, mEntry->Expansion()); return false; // normal client can't teleport to this map... } else { - sLog.outDebug("Player %s will teleported to map %u", GetName(), mapid); + sLog.outDebug("Player %s is being teleported to map %u", GetName(), mapid); } - // if we were on a transport, leave - if (!(options & TELE_TO_NOT_LEAVE_TRANSPORT) && m_transport) + // reset movement flags at teleport, because player will continue move with these flags after teleport + SetUnitMovementFlags(0); + + if (m_transport) { - m_transport->RemovePassenger(this); - m_transport = NULL; - m_movementInfo.t_x = 0.0f; - m_movementInfo.t_y = 0.0f; - m_movementInfo.t_z = 0.0f; - m_movementInfo.t_o = 0.0f; - m_movementInfo.t_time = 0; + if (options & TELE_TO_NOT_LEAVE_TRANSPORT) + AddUnitMovementFlag(MOVEMENTFLAG_ONTRANSPORT); + else + { + m_transport->RemovePassenger(this); + m_transport = NULL; + m_movementInfo.t_x = 0.0f; + m_movementInfo.t_y = 0.0f; + m_movementInfo.t_z = 0.0f; + m_movementInfo.t_o = 0.0f; + m_movementInfo.t_time = 0; + } } - SetSemaphoreTeleport(true); - - // The player was ported to another map and looses the duel immediatly. + // The player was ported to another map and looses the duel immediately. // We have to perform this check before the teleport, otherwise the // ObjectAccessor won't find the flag. if (duel && GetMapId()!=mapid) { - GameObject* obj = ObjectAccessor::GetGameObject(*this, GetUInt64Value(PLAYER_DUEL_ARBITER)); + GameObject* obj = GetMap()->GetGameObject(GetUInt64Value(PLAYER_DUEL_ARBITER)); if (obj) DuelComplete(DUEL_FLED); } - // reset movement flags at teleport, because player will continue move with these flags after teleport - SetUnitMovementFlags(0); - if ((GetMapId() == mapid) && (!m_transport)) { - // prepare zone change detect - uint32 old_zone = GetZoneId(); - - // near teleport - if(!GetSession()->PlayerLogout()) - { - WorldPacket data; - BuildTeleportAckMsg(&data, x, y, z, orientation); - GetSession()->SendPacket(&data); - SetPosition( x, y, z, orientation, true); - } - else - // this will be used instead of the current location in SaveToDB - m_teleport_dest = WorldLocation(mapid, x, y, z, orientation); - SetFallInformation(0, z); - - //BuildHeartBeatMsg(&data); - //SendMessageToSet(&data, true); if (!(options & TELE_TO_NOT_UNSUMMON_PET)) { - //same map, only remove pet if out of range - if(pet && !IsWithinDistInMap(pet, OWNER_MAX_DISTANCE)) - { - if(pet->isControlled() && !pet->isTemporarySummoned() ) - m_temporaryUnsummonedPetNumber = pet->GetCharmInfo()->GetPetNumber(); - else - m_temporaryUnsummonedPetNumber = 0; - - RemovePet(pet, PET_SAVE_NOT_IN_SLOT); - } + //same map, only remove pet if out of range for new position + if(pet && !pet->IsWithinDist3d(x,y,z, OWNER_MAX_DISTANCE)) + UnsummonPetTemporaryIfAny(); } if(!(options & TELE_TO_NOT_LEAVE_COMBAT)) CombatStop(); - if (!(options & TELE_TO_NOT_UNSUMMON_PET)) - { - // resummon pet - if(pet && m_temporaryUnsummonedPetNumber) - { - Pet* NewPet = new Pet; - if(!NewPet->LoadPetFromDB(this, 0, m_temporaryUnsummonedPetNumber, true)) - delete NewPet; - - m_temporaryUnsummonedPetNumber = 0; - } - } + // this will be used instead of the current location in SaveToDB + m_teleport_dest = WorldLocation(mapid, x, y, z, orientation); + SetFallInformation(0, z); + // code for finish transfer called in WorldSession::HandleMovementOpcodes() + // at client packet MSG_MOVE_TELEPORT_ACK + SetSemaphoreTeleportNear(true); + // near teleport, triggering send MSG_MOVE_TELEPORT_ACK from client at landing if(!GetSession()->PlayerLogout()) { - // don't reset teleport semaphore while logging out, otherwise m_teleport_dest won't be used in Player::SaveToDB - SetSemaphoreTeleport(false); - - UpdateZone(GetZoneId()); - } - - // new zone - if(old_zone != GetZoneId()) - { - // honorless target - if(pvpInfo.inHostileArea) - CastSpell(this, 2479, true); + Position oldPos; + GetPosition(oldPos); + Relocate(x, y, z, orientation); + SendTeleportAckMsg(); + Relocate(oldPos); } } else @@ -1698,10 +1719,7 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati // Check enter rights before map getting to avoid creating instance copy for player // this check not dependent from map instance copy and same for all instance copies of selected map if (!MapManager::Instance().CanPlayerEnter(mapid, this)) - { - SetSemaphoreTeleport(false); return false; - } // If the map is not created, assume it is possible to enter it. // It will be created in the WorldPortAck. @@ -1726,15 +1744,7 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati // remove pet on map change if (pet) - { - //leaving map -> delete pet right away (doing this later will cause problems) - if(pet->isControlled() && !pet->isTemporarySummoned()) - m_temporaryUnsummonedPetNumber = pet->GetCharmInfo()->GetPetNumber(); - else - m_temporaryUnsummonedPetNumber = 0; - - RemovePet(pet, PET_SAVE_NOT_IN_SLOT); - } + UnsummonPetTemporaryIfAny(); // remove all dyn objects RemoveAllDynObjects(); @@ -1791,13 +1801,11 @@ bool Player::TeleportTo(uint32 mapid, float x, float y, float z, float orientati // if the player is saved before worldportack (at logout for example) // this will be used instead of the current location in SaveToDB - RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_CHANGE_MAP); + RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_CHANGE_MAP | AURA_INTERRUPT_FLAG_MOVE | AURA_INTERRUPT_FLAG_TURNING); // move packet sent by client always after far teleport - // SetPosition(final_x, final_y, final_z, final_o, true); - SetDontMove(true); - // code for finish transfer to new map called in WorldSession::HandleMoveWorldportAckOpcode at client packet + SetSemaphoreTeleportFar(true); } else return false; @@ -1812,7 +1820,7 @@ void Player::AddToWorld() ///- The player should only be added when logging in Unit::AddToWorld(); - for(int i = PLAYER_SLOT_START; i < PLAYER_SLOT_END; i++) + for(uint8 i = PLAYER_SLOT_START; i < PLAYER_SLOT_END; ++i) { if(m_items[i]) m_items[i]->AddToWorld(); @@ -1827,21 +1835,32 @@ void Player::RemoveFromWorld() ///- Release charmed creatures, unsummon totems and remove pets/guardians StopCastingCharm(); StopCastingBindSight(); - UnsummonAllTotems(); - RemoveMiniPet(); - RemoveGuardians(); + UnsummonPetTemporaryIfAny(); + sOutdoorPvPMgr.HandlePlayerLeaveZone(this, m_zoneUpdateId); } - for(int i = PLAYER_SLOT_START; i < PLAYER_SLOT_END; i++) + ///- Do not add/remove the player from the object storage + ///- It will crash when updating the ObjectAccessor + ///- The player should only be removed when logging out + Unit::RemoveFromWorld(); + + for(uint8 i = PLAYER_SLOT_START; i < PLAYER_SLOT_END; ++i) { if(m_items[i]) m_items[i]->RemoveFromWorld(); } - ///- Do not add/remove the player from the object storage - ///- It will crash when updating the ObjectAccessor - ///- The player should only be removed when logging out - Unit::RemoveFromWorld(); + for (ItemMap::iterator iter = mMitems.begin(); iter != mMitems.end(); ++iter) + iter->second->RemoveFromWorld(); + + if(m_uint32Values) + { + if(WorldObject *viewpoint = GetViewpoint()) + { + sLog.outCrash("Player %s has viewpoint %u %u when removed from world", GetName(), viewpoint->GetEntry(), viewpoint->GetTypeId()); + SetViewpoint(viewpoint, false); + } + } } void Player::RewardRage( uint32 damage, uint32 weaponSpeedHitFactor, bool attacker ) @@ -1862,7 +1881,7 @@ void Player::RewardRage( uint32 damage, uint32 weaponSpeedHitFactor, bool attack addRage = damage/rageconversion*2.5; // Berserker Rage effect - if(HasAura(18499,0)) + if(HasAura(18499)) addRage *= 1.3; } @@ -1883,13 +1902,20 @@ void Player::RegenerateAll() { RegenerateHealth(); if (!isInCombat() && !HasAuraType(SPELL_AURA_INTERRUPT_REGEN)) + { Regenerate(POWER_RAGE); + if(getClass() == CLASS_DEATH_KNIGHT) + Regenerate(POWER_RUNIC_POWER); + } } Regenerate( POWER_ENERGY ); Regenerate( POWER_MANA ); + if(getClass() == CLASS_DEATH_KNIGHT) + Regenerate( POWER_RUNE ); + m_regenTimer = regenDelay; } @@ -1909,23 +1935,35 @@ void Player::Regenerate(Powers power) if (recentCast) { // Trinity Updates Mana in intervals of 2s, which is correct - addvalue = GetFloatValue(PLAYER_FIELD_MOD_MANA_REGEN_INTERRUPT) * ManaIncreaseRate * 2.00f; + addvalue = GetFloatValue(UNIT_FIELD_POWER_REGEN_INTERRUPTED_FLAT_MODIFIER) * ManaIncreaseRate * 2.00f; } else { - addvalue = GetFloatValue(PLAYER_FIELD_MOD_MANA_REGEN) * ManaIncreaseRate * 2.00f; + addvalue = GetFloatValue(UNIT_FIELD_POWER_REGEN_FLAT_MODIFIER) * ManaIncreaseRate * 2.00f; } } break; case POWER_RAGE: // Regenerate rage { float RageDecreaseRate = sWorld.getRate(RATE_POWER_RAGE_LOSS); - addvalue = 30 * RageDecreaseRate; // 3 rage by tick + addvalue = 20 * RageDecreaseRate; // 2 rage by tick (= 2 seconds => 1 rage/sec) } break; case POWER_ENERGY: // Regenerate energy (rogue) addvalue = 20; break; + case POWER_RUNIC_POWER: + { + float RunicPowerDecreaseRate = sWorld.getRate(RATE_POWER_RUNICPOWER_LOSS); + addvalue = 30 * RunicPowerDecreaseRate; // 3 RunicPower by tick + } break; + case POWER_RUNE: + { + for(uint32 i = 0; i < MAX_RUNES; ++i) + if(uint8 cd = GetRuneCooldown(i)) // if we have cooldown, reduce it... + SetRuneCooldown(i, cd - 1); // ... by 2 sec (because update is every 2 sec) + } break; case POWER_FOCUS: case POWER_HAPPINESS: + case POWER_HEALTH: break; } @@ -1933,13 +1971,13 @@ void Player::Regenerate(Powers power) // Exist only for POWER_MANA, POWER_ENERGY, POWER_FOCUS auras if(power != POWER_MANA) { - AuraList const& ModPowerRegenPCTAuras = GetAurasByType(SPELL_AURA_MOD_POWER_REGEN_PERCENT); - for(AuraList::const_iterator i = ModPowerRegenPCTAuras.begin(); i != ModPowerRegenPCTAuras.end(); ++i) - if ((*i)->GetModifier()->m_miscvalue == power) - addvalue *= ((*i)->GetModifierValue() + 100) / 100.0f; + AuraEffectList const& ModPowerRegenPCTAuras = GetAurasByType(SPELL_AURA_MOD_POWER_REGEN_PERCENT); + for(AuraEffectList::const_iterator i = ModPowerRegenPCTAuras.begin(); i != ModPowerRegenPCTAuras.end(); ++i) + if ((*i)->GetMiscValue() == power) + addvalue *= ((*i)->GetAmount() + 100) / 100.0f; } - if (power != POWER_RAGE) + if (power != POWER_RAGE && power != POWER_RUNIC_POWER) { curValue += uint32(addvalue); if (curValue > maxValue) @@ -1975,9 +2013,9 @@ void Player::RegenerateHealth() addvalue = OCTRegenHPPerSpirit()* HealthIncreaseRate; if (!isInCombat()) { - AuraList const& mModHealthRegenPct = GetAurasByType(SPELL_AURA_MOD_HEALTH_REGEN_PERCENT); - for(AuraList::const_iterator i = mModHealthRegenPct.begin(); i != mModHealthRegenPct.end(); ++i) - addvalue *= (100.0f + (*i)->GetModifierValue()) / 100.0f; + AuraEffectList const& mModHealthRegenPct = GetAurasByType(SPELL_AURA_MOD_HEALTH_REGEN_PERCENT); + for(AuraEffectList::const_iterator i = mModHealthRegenPct.begin(); i != mModHealthRegenPct.end(); ++i) + addvalue *= (100.0f + (*i)->GetAmount()) / 100.0f; } else if(HasAuraType(SPELL_AURA_MOD_REGEN_DURING_COMBAT)) addvalue *= GetTotalAuraModifier(SPELL_AURA_MOD_REGEN_DURING_COMBAT) / 100.0f; @@ -2005,10 +2043,92 @@ bool Player::CanInteractWithNPCs(bool alive) const return true; } +Creature* +Player::GetNPCIfCanInteractWith(uint64 guid, uint32 npcflagmask) +{ + // unit checks + if (!guid) + return NULL; + + if(!IsInWorld()) + return NULL; + + // exist (we need look pets also for some interaction (quest/etc) + Creature *unit = ObjectAccessor::GetCreatureOrPetOrVehicle(*this,guid); + if (!unit) + return NULL; + + // player check + if(!CanInteractWithNPCs(!unit->isSpiritService())) + return NULL; + + // appropriate npc type + if(npcflagmask && !unit->HasFlag( UNIT_NPC_FLAGS, npcflagmask )) + return NULL; + + // alive or spirit healer + if(!unit->isAlive() && (!unit->isSpiritService() || isAlive() )) + return NULL; + + // not allow interaction under control, but allow with own pets + if(unit->GetCharmerGUID()) + return NULL; + + // not enemy + if( unit->IsHostileTo(this)) + return NULL; + + // not unfriendly + if(FactionTemplateEntry const* factionTemplate = sFactionTemplateStore.LookupEntry(unit->getFaction())) + if(factionTemplate->faction) + if(FactionEntry const* faction = sFactionStore.LookupEntry(factionTemplate->faction)) + if(faction->reputationListID >= 0 && GetReputationMgr().GetRank(faction) <= REP_UNFRIENDLY) + return NULL; + + // not too far + if(!unit->IsWithinDistInMap(this,INTERACTION_DISTANCE)) + return NULL; + + return unit; +} + +GameObject* Player::GetGameObjectIfCanInteractWith(uint64 guid, GameobjectTypes type) const +{ + if(GameObject *go = GetMap()->GetGameObject(guid)) + { + if(go->GetGoType() == type) + { + float maxdist; + switch(type) + { + // TODO: find out how the client calculates the maximal usage distance to spellless working + // gameobjects like guildbanks and mailboxes - 10.0 is a just an abitrary choosen number + case GAMEOBJECT_TYPE_GUILD_BANK: + case GAMEOBJECT_TYPE_MAILBOX: + maxdist = 10.0f; + break; + case GAMEOBJECT_TYPE_FISHINGHOLE: + maxdist = 20.0f+CONTACT_DISTANCE; // max spell range + break; + default: + maxdist = INTERACTION_DISTANCE; + break; + } + + if (go->IsWithinDistInMap(this, maxdist)) + return go; + + sLog.outError("IsGameObjectOfTypeInRange: GameObject '%s' [GUID: %u] is too far away from player %s [GUID: %u] to be used by him (distance=%f, maximal 10 is allowed)", go->GetGOInfo()->name, + go->GetGUIDLow(), GetName(), GetGUIDLow(), go->GetDistance(this)); + } + } + return NULL; +} + bool Player::IsUnderWater() const { return IsInWater() && - GetPositionZ() < (MapManager::Instance().GetBaseMap(GetMapId())->GetWaterLevel(GetPositionX(),GetPositionY())-2); + GetPositionZ() < (GetBaseMap()->GetWaterLevel(GetPositionX(),GetPositionY())-2); } void Player::SetInWater(bool apply) @@ -2037,21 +2157,39 @@ void Player::SetGameMaster(bool on) setFaction(35); SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_GM); - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP); + if (Pet* pet = GetPet()) + { + pet->setFaction(35); + pet->getHostilRefManager().setOnlineOfflineState(false); + } + + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); ResetContestedPvP(); getHostilRefManager().setOnlineOfflineState(false); - CombatStop(); + CombatStopWithPets(); + + SetPhaseMask(PHASEMASK_ANYWHERE,false); // see and visible in all phases } else { + // restore phase + AuraEffectList const& phases = GetAurasByType(SPELL_AURA_PHASE); + SetPhaseMask(!phases.empty() ? phases.front()->GetMiscValue() : PHASEMASK_NORMAL,false); + m_ExtraFlags &= ~ PLAYER_EXTRA_GM_ON; setFactionForRace(getRace()); RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_GM); + if (Pet* pet = GetPet()) + { + pet->setFaction(getFaction()); + pet->getHostilRefManager().setOnlineOfflineState(true); + } + // restore FFA PvP Server state if(sWorld.IsFFAPvPRealm()) - SetFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); // restore FFA PvP area state, remove not allowed for GM mounts UpdateArea(m_areaUpdateId); @@ -2115,7 +2253,7 @@ void Player::UninviteFromGroup() group->RemoveInvite(this); - if(group->GetMembersCount() <= 1) // group has just 1 member => disband + if(group->GetMembersCount() <= 1) // group has just 1 member => disband { if(group->IsCreated()) { @@ -2173,9 +2311,9 @@ void Player::GiveXP(uint32 xp, Unit* victim) return; // handle SPELL_AURA_MOD_XP_PCT auras - Unit::AuraList const& ModXPPctAuras = GetAurasByType(SPELL_AURA_MOD_XP_PCT); - for(Unit::AuraList::const_iterator i = ModXPPctAuras.begin();i != ModXPPctAuras.end(); ++i) - xp = uint32(xp*(1.0f + (*i)->GetModifierValue() / 100.0f)); + Unit::AuraEffectList const& ModXPPctAuras = GetAurasByType(SPELL_AURA_MOD_XP_PCT); + for(Unit::AuraEffectList::const_iterator i = ModXPPctAuras.begin();i != ModXPPctAuras.end(); ++i) + xp = uint32(xp*(1.0f + (*i)->GetAmount() / 100.0f)); // XP resting bonus for kill uint32 rested_bonus_xp = victim ? GetXPRestBonus(xp) : 0; @@ -2223,13 +2361,15 @@ void Player::GiveLevel(uint32 level) data << uint32(0); data << uint32(0); data << uint32(0); + data << uint32(0); + data << uint32(0); // end for - for(int i = STAT_STRENGTH; i < MAX_STATS; ++i) // Stats loop (0-4) + for(uint8 i = STAT_STRENGTH; i < MAX_STATS; ++i) // Stats loop (0-4) data << uint32(int32(info.stats[i]) - GetCreateStat(Stats(i))); GetSession()->SendPacket(&data); - SetUInt32Value(PLAYER_NEXT_LEVEL_XP, Trinity::XP::xp_to_level(level)); + SetUInt32Value(PLAYER_NEXT_LEVEL_XP, objmgr.GetXPForLevel(level)); //update level, max level of skills if(getLevel()!= level) @@ -2238,7 +2378,7 @@ void Player::GiveLevel(uint32 level) UpdateSkillsForLevel (); // save base values (bonuses already included in stored stats - for(int i = STAT_STRENGTH; i < MAX_STATS; ++i) + for(uint8 i = STAT_STRENGTH; i < MAX_STATS; ++i) SetCreateStat(Stats(i), info.stats[i]); SetCreateHealth(classInfo.basehealth); @@ -2246,6 +2386,7 @@ void Player::GiveLevel(uint32 level) InitTalentForLevel(); InitTaxiNodesForLevel(); + InitGlyphsForLevel(); UpdateAllStats(); @@ -2261,10 +2402,11 @@ void Player::GiveLevel(uint32 level) SetPower(POWER_FOCUS, 0); SetPower(POWER_HAPPINESS, 0); - // give level to summoned pet - Pet* pet = GetPet(); - if(pet && pet->getPetType()==SUMMON_PET) - pet->GivePetLevel(level); + // update level to hunter/summon pet + if (Pet* pet = GetPet()) + pet->SynchronizeLevelWithOwner(); + + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_LEVEL); } void Player::InitTalentForLevel() @@ -2282,7 +2424,8 @@ void Player::InitTalentForLevel() } else { - uint32 talentPointsForLevel = uint32((level-9)*sWorld.getRate(RATE_TALENT)); + uint32 talentPointsForLevel = CalculateTalentsPoints(); + // if used more that have then reset if(m_usedTalentCount > talentPointsForLevel) { @@ -2295,6 +2438,9 @@ void Player::InitTalentForLevel() else SetFreeTalentPoints(talentPointsForLevel-m_usedTalentCount); } + + if(!GetSession()->PlayerLoading()) + SendTalentsInfoData(false); // update at client } void Player::InitStatsForLevel(bool reapplyMods) @@ -2309,7 +2455,7 @@ void Player::InitStatsForLevel(bool reapplyMods) objmgr.GetPlayerLevelInfo(getRace(),getClass(),getLevel(),&info); SetUInt32Value(PLAYER_FIELD_MAX_LEVEL, sWorld.getConfig(CONFIG_MAX_PLAYER_LEVEL) ); - SetUInt32Value(PLAYER_NEXT_LEVEL_XP, Trinity::XP::xp_to_level(getLevel())); + SetUInt32Value(PLAYER_NEXT_LEVEL_XP, objmgr.GetXPForLevel(getLevel())); UpdateSkillsForLevel (); @@ -2320,10 +2466,10 @@ void Player::InitStatsForLevel(bool reapplyMods) SetFloatValue(OBJECT_FIELD_SCALE_X,1.0f); // save base values (bonuses already included in stored stats - for(int i = STAT_STRENGTH; i < MAX_STATS; ++i) + for(uint8 i = STAT_STRENGTH; i < MAX_STATS; ++i) SetCreateStat(Stats(i), info.stats[i]); - for(int i = STAT_STRENGTH; i < MAX_STATS; ++i) + for(uint8 i = STAT_STRENGTH; i < MAX_STATS; ++i) SetStat(Stats(i), info.stats[i]); SetCreateHealth(classInfo.basehealth); @@ -2340,7 +2486,7 @@ void Player::InitStatsForLevel(bool reapplyMods) SetUInt32Value(index, 0); SetUInt32Value(PLAYER_FIELD_MOD_HEALING_DONE_POS,0); - for (int i = 0; i < 7; i++) + for (uint8 i = 0; i < 7; i++) { SetUInt32Value(PLAYER_FIELD_MOD_DAMAGE_DONE_NEG+i, 0); SetUInt32Value(PLAYER_FIELD_MOD_DAMAGE_DONE_POS+i, 0); @@ -2359,11 +2505,11 @@ void Player::InitStatsForLevel(bool reapplyMods) SetFloatValue(UNIT_FIELD_MINRANGEDDAMAGE, 0.0f ); SetFloatValue(UNIT_FIELD_MAXRANGEDDAMAGE, 0.0f ); - SetUInt32Value(UNIT_FIELD_ATTACK_POWER, 0 ); - SetUInt32Value(UNIT_FIELD_ATTACK_POWER_MODS, 0 ); + SetInt32Value(UNIT_FIELD_ATTACK_POWER, 0 ); + SetInt32Value(UNIT_FIELD_ATTACK_POWER_MODS, 0 ); SetFloatValue(UNIT_FIELD_ATTACK_POWER_MULTIPLIER,0.0f); - SetUInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER, 0 ); - SetUInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER_MODS,0 ); + SetInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER, 0 ); + SetInt32Value(UNIT_FIELD_RANGED_ATTACK_POWER_MODS,0 ); SetFloatValue(UNIT_FIELD_RANGED_ATTACK_POWER_MULTIPLIER,0.0f); // Base crit values (will be recalculated in UpdateAllStats() at loading and in _ApplyAllStatBonuses() at reset @@ -2387,7 +2533,7 @@ void Player::InitStatsForLevel(bool reapplyMods) SetResistanceBuffMods(SpellSchools(0), true, 0.0f); SetResistanceBuffMods(SpellSchools(0), false, 0.0f); // set other resistance to original value (0) - for (int i = 1; i < MAX_SPELL_SCHOOL; i++) + for (uint8 i = 1; i < MAX_SPELL_SCHOOL; i++) { SetResistance(SpellSchools(i), 0); SetResistanceBuffMods(SpellSchools(i), true, 0.0f); @@ -2396,16 +2542,19 @@ void Player::InitStatsForLevel(bool reapplyMods) SetUInt32Value(PLAYER_FIELD_MOD_TARGET_RESISTANCE,0); SetUInt32Value(PLAYER_FIELD_MOD_TARGET_PHYSICAL_RESISTANCE,0); - for(int i = 0; i < MAX_SPELL_SCHOOL; ++i) + for(uint8 i = 0; i < MAX_SPELL_SCHOOL; ++i) { - SetFloatValue(UNIT_FIELD_POWER_COST_MODIFIER+i,0.0f); + SetUInt32Value(UNIT_FIELD_POWER_COST_MODIFIER+i,0); SetFloatValue(UNIT_FIELD_POWER_COST_MULTIPLIER+i,0.0f); } + // Reset no reagent cost field + for(uint8 i = 0; i < 3; i++) + SetUInt32Value(PLAYER_NO_REAGENT_COST_1 + i, 0); // Init data for form but skip reapply item mods for form InitDataForForm(reapplyMods); // save new stats - for (int i = POWER_MANA; i < MAX_POWERS; i++) + for (uint8 i = POWER_MANA; i < MAX_POWERS; i++) SetMaxPower(Powers(i), uint32(GetCreatePowers(Powers(i)))); SetMaxHealth(classInfo.basehealth); // stamina bonus will applied later @@ -2417,15 +2566,18 @@ void Player::InitStatsForLevel(bool reapplyMods) RemoveFlag( UNIT_FIELD_FLAGS, UNIT_FLAG_NON_ATTACKABLE | UNIT_FLAG_DISABLE_MOVE | UNIT_FLAG_NOT_ATTACKABLE_1 | UNIT_FLAG_PET_IN_COMBAT | UNIT_FLAG_SILENCED | UNIT_FLAG_PACIFIED | - UNIT_FLAG_DISABLE_ROTATE | UNIT_FLAG_IN_COMBAT | UNIT_FLAG_DISARMED | + UNIT_FLAG_STUNNED | UNIT_FLAG_IN_COMBAT | UNIT_FLAG_DISARMED | UNIT_FLAG_CONFUSED | UNIT_FLAG_FLEEING | UNIT_FLAG_NOT_SELECTABLE | UNIT_FLAG_SKINNABLE | UNIT_FLAG_MOUNT | UNIT_FLAG_TAXI_FLIGHT ); SetFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_PVP_ATTACKABLE ); // must be set + SetFlag(UNIT_FIELD_FLAGS_2,UNIT_FLAG2_REGENERATE_POWER);// must be set + // cleanup player flags (will be re-applied if need at aura load), to avoid have ghost flag without ghost aura, for example. - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_AFK | PLAYER_FLAGS_DND | PLAYER_FLAGS_GM | PLAYER_FLAGS_GHOST | PLAYER_FLAGS_FFA_PVP); + RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_AFK | PLAYER_FLAGS_DND | PLAYER_FLAGS_GM | PLAYER_FLAGS_GHOST | PLAYER_ALLOW_ONLY_ABILITY); - SetByteValue(UNIT_FIELD_BYTES_1, 2, 0x00); // one form stealth modified bytes + RemoveStandFlags(UNIT_STAND_FLAGS_ALL); // one form stealth modified bytes + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP | UNIT_BYTE2_FLAG_SANCTUARY); // restore if need some important flags SetUInt32Value(PLAYER_FIELD_BYTES2, 0 ); // flags empty by default @@ -2441,10 +2593,18 @@ void Player::InitStatsForLevel(bool reapplyMods) SetPower(POWER_RAGE, GetMaxPower(POWER_RAGE)); SetPower(POWER_FOCUS, 0); SetPower(POWER_HAPPINESS, 0); + SetPower(POWER_RUNIC_POWER, 0); + + // update level to hunter/summon pet + if (Pet* pet = GetPet()) + pet->SynchronizeLevelWithOwner(); } void Player::SendInitialSpells() { + time_t curTime = time(NULL); + time_t infTime = curTime + MONTH/2; + uint16 spellCount = 0; WorldPacket data(SMSG_INITIAL_SPELLS, (1+2+4*m_spells.size()+2+m_spellCooldowns.size()*(2+2+2+4+4))); @@ -2461,7 +2621,7 @@ void Player::SendInitialSpells() if(!itr->second->active || itr->second->disabled) continue; - data << uint16(itr->first); + data << uint32(itr->first); data << uint16(0); // it's not slot id spellCount +=1; @@ -2477,12 +2637,15 @@ void Player::SendInitialSpells() if(!sEntry) continue; - data << uint16(itr->first); + // not send infinity cooldown + if(itr->second.end > infTime) + continue; + + data << uint32(itr->first); time_t cooldown = 0; - time_t curTime = time(NULL); if(itr->second.end > curTime) - cooldown = (itr->second.end-curTime)*1000; + cooldown = (itr->second.end-curTime)*IN_MILISECONDS; data << uint16(itr->second.itemid); // cast item id data << uint16(sEntry->Category); // spell category @@ -2516,13 +2679,13 @@ void Player::RemoveMail(uint32 id) } } -void Player::SendMailResult(uint32 mailId, uint32 mailAction, uint32 mailError, uint32 equipError, uint32 item_guid, uint32 item_count) +void Player::SendMailResult(uint32 mailId, MailResponseType mailAction, MailResponseResult mailError, uint32 equipError, uint32 item_guid, uint32 item_count) { - WorldPacket data(SMSG_SEND_MAIL_RESULT, (4+4+4+(mailError == MAIL_ERR_BAG_FULL?4:(mailAction == MAIL_ITEM_TAKEN?4+4:0)))); + WorldPacket data(SMSG_SEND_MAIL_RESULT, (4+4+4+(mailError == MAIL_ERR_EQUIP_ERROR?4:(mailAction == MAIL_ITEM_TAKEN?4+4:0)))); data << (uint32) mailId; data << (uint32) mailAction; data << (uint32) mailError; - if ( mailError == MAIL_ERR_BAG_FULL ) + if ( mailError == MAIL_ERR_EQUIP_ERROR ) data << (uint32) equipError; else if( mailAction == MAIL_ITEM_TAKEN ) { @@ -2573,13 +2736,13 @@ void Player::AddNewMailDeliverTime(time_t deliver_time) } } -bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, uint16 slot_id, bool disabled) +bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool dependent, bool disabled) { SpellEntry const *spellInfo = sSpellStore.LookupEntry(spell_id); if (!spellInfo) { // do character spell book cleanup (all characters) - if(loading && !learning) // spell load case + if(!IsInWorld() && !learning) // spell load case { sLog.outError("Player::addSpell: Non-existed in SpellStore spell #%u request, deleting for all characters in `character_spell`.",spell_id); CharacterDatabase.PExecute("DELETE FROM character_spell WHERE spell = '%u'",spell_id); @@ -2593,7 +2756,7 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, if(!SpellMgr::IsSpellValid(spellInfo,this,false)) { // do character spell book cleanup (all characters) - if(loading && !learning) // spell load case + if(!IsInWorld() && !learning) // spell load case { sLog.outError("Player::addSpell: Broken spell #%u learning not allowed, deleting for all characters in `character_spell`.",spell_id); CharacterDatabase.PExecute("DELETE FROM character_spell WHERE spell = '%u'",spell_id); @@ -2606,29 +2769,84 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, PlayerSpellState state = learning ? PLAYERSPELL_NEW : PLAYERSPELL_UNCHANGED; + bool dependent_set = false; bool disabled_case = false; bool superceded_old = false; PlayerSpellMap::iterator itr = m_spells.find(spell_id); - if (itr != m_spells.end()) + + // Remove temporary spell if found to prevent conflicts + if (itr != m_spells.end() && itr->second->state == PLAYERSPELL_TEMPORARY) + RemoveTemporarySpell(spell_id); + else if (itr != m_spells.end()) { + uint32 next_active_spell_id = 0; + // fix activate state for non-stackable low rank (and find next spell for !active case) + if(!SpellMgr::canStackSpellRanks(spellInfo) && spellmgr.GetSpellRank(spellInfo->Id) != 0) + { + if(uint32 next = spellmgr.GetNextSpellInChain(spell_id)) + { + if(HasSpell(next)) + { + // high rank already known so this must !active + active = false; + next_active_spell_id = next; + } + } + } + + // not do anything if already known in expected state + if(itr->second->state != PLAYERSPELL_REMOVED && itr->second->active == active && + itr->second->dependent == dependent && itr->second->disabled == disabled) + { + if(!IsInWorld() && !learning) // explicitly load from DB and then exist in it already and set correctly + itr->second->state = PLAYERSPELL_UNCHANGED; + + return false; + } + + // dependent spell known as not dependent, overwrite state + if (itr->second->state != PLAYERSPELL_REMOVED && !itr->second->dependent && dependent) + { + itr->second->dependent = dependent; + if (itr->second->state != PLAYERSPELL_NEW) + itr->second->state = PLAYERSPELL_CHANGED; + dependent_set = true; + } + // update active state for known spell if(itr->second->active != active && itr->second->state != PLAYERSPELL_REMOVED && !itr->second->disabled) { itr->second->active = active; - // loading && !learning == explicitly load from DB and then exist in it already and set correctly - if(loading && !learning) + if(!IsInWorld() && !learning && !dependent_set) // explicitly load from DB and then exist in it already and set correctly itr->second->state = PLAYERSPELL_UNCHANGED; else if(itr->second->state != PLAYERSPELL_NEW) itr->second->state = PLAYERSPELL_CHANGED; - if(!active) + if(active) { - WorldPacket data(SMSG_REMOVED_SPELL, 4); - data << uint16(spell_id); - GetSession()->SendPacket(&data); + if (IsPassiveSpell(spell_id) && IsNeedCastPassiveSpellAtLearn(spellInfo)) + CastSpell (this,spell_id,true); + } + else if(IsInWorld()) + { + if(next_active_spell_id) + { + // update spell ranks in spellbook and action bar + WorldPacket data(SMSG_SUPERCEDED_SPELL, 4 + 4); + data << uint32(spell_id); + data << uint32(next_active_spell_id); + GetSession()->SendPacket( &data ); + } + else + { + WorldPacket data(SMSG_REMOVED_SPELL, 4); + data << uint32(spell_id); + GetSession()->SendPacket(&data); + } } + return active; // learn (show in spell book if active now) } @@ -2657,7 +2875,7 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, default: // known not saved yet spell (new or modified) { // can be in case spell loading but learned at some previous spell loading - if(loading && !learning) + if(!IsInWorld() && !learning && !dependent_set) itr->second->state = PLAYERSPELL_UNCHANGED; return false; @@ -2672,17 +2890,13 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, { if(TalentEntry const *talentInfo = sTalentStore.LookupEntry( talentPos->talent_id )) { - for(int i=0; i <5; ++i) + for(uint8 i=0; i < MAX_TALENT_RANK; ++i) { // skip learning spell and no rank spell case uint32 rankSpellId = talentInfo->RankID[i]; if(!rankSpellId || rankSpellId==spell_id) continue; - // skip unknown ranks - if(!HasSpell(rankSpellId)) - continue; - removeSpell(rankSpellId); } } @@ -2690,52 +2904,54 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, // non talent spell: learn low ranks (recursive call) else if(uint32 prev_spell = spellmgr.GetPrevSpellInChain(spell_id)) { - if(loading) // at spells loading, no output, but allow save - addSpell(prev_spell,active,true,loading,SPELL_WITHOUT_SLOT_ID,disabled); + if(!IsInWorld() || disabled) // at spells loading, no output, but allow save + addSpell(prev_spell,active,true,true,disabled); else // at normal learning - learnSpell(prev_spell); + learnSpell(prev_spell,true); } PlayerSpell *newspell = new PlayerSpell; - newspell->active = active; - newspell->state = state; - newspell->disabled = disabled; + newspell->state = state; + newspell->active = active; + newspell->dependent = dependent; + newspell->disabled = disabled; // replace spells in action bars and spellbook to bigger rank if only one spell rank must be accessible if(newspell->active && !newspell->disabled && !SpellMgr::canStackSpellRanks(spellInfo) && spellmgr.GetSpellRank(spellInfo->Id) != 0) { - for( PlayerSpellMap::iterator itr = m_spells.begin(); itr != m_spells.end(); ++itr ) + for( PlayerSpellMap::iterator itr2 = m_spells.begin(); itr2 != m_spells.end(); ++itr2 ) { - if(itr->second->state == PLAYERSPELL_REMOVED) continue; - SpellEntry const *i_spellInfo = sSpellStore.LookupEntry(itr->first); + if(itr2->second->state == PLAYERSPELL_REMOVED) continue; + SpellEntry const *i_spellInfo = sSpellStore.LookupEntry(itr2->first); if(!i_spellInfo) continue; - if( spellmgr.IsRankSpellDueToSpell(spellInfo,itr->first) ) + if( spellmgr.IsRankSpellDueToSpell(spellInfo,itr2->first) ) { - if(itr->second->active) + if(itr2->second->active) { - if(spellmgr.IsHighRankOfSpell(spell_id,itr->first)) + if(spellmgr.IsHighRankOfSpell(spell_id,itr2->first)) { - if(!loading) // not send spell (re-/over-)learn packets at loading + if(IsInWorld()) // not send spell (re-/over-)learn packets at loading { - WorldPacket data(SMSG_SUPERCEDED_SPELL, (4)); - data << uint16(itr->first); - data << uint16(spell_id); + WorldPacket data(SMSG_SUPERCEDED_SPELL, 4 + 4); + data << uint32(itr2->first); + data << uint32(spell_id); GetSession()->SendPacket( &data ); } // mark old spell as disable (SMSG_SUPERCEDED_SPELL replace it in client by new) - itr->second->active = false; - itr->second->state = PLAYERSPELL_CHANGED; + itr2->second->active = false; + if(itr2->second->state != PLAYERSPELL_NEW) + itr2->second->state = PLAYERSPELL_CHANGED; superceded_old = true; // new spell replace old in action bars and spell book. } - else if(spellmgr.IsHighRankOfSpell(itr->first,spell_id)) + else if(spellmgr.IsHighRankOfSpell(itr2->first,spell_id)) { - if(!loading) // not send spell (re-/over-)learn packets at loading + if(IsInWorld()) // not send spell (re-/over-)learn packets at loading { - WorldPacket data(SMSG_SUPERCEDED_SPELL, (4)); - data << uint16(spell_id); - data << uint16(itr->first); + WorldPacket data(SMSG_SUPERCEDED_SPELL, 4 + 4); + data << uint32(spell_id); + data << uint32(itr2->first); GetSession()->SendPacket( &data ); } @@ -2749,23 +2965,6 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, } } - uint16 tmpslot=slot_id; - - if (tmpslot == SPELL_WITHOUT_SLOT_ID) - { - uint16 maxid = 0; - PlayerSpellMap::iterator itr; - for (itr = m_spells.begin(); itr != m_spells.end(); ++itr) - { - if(itr->second->state == PLAYERSPELL_REMOVED) - continue; - if (itr->second->slotId > maxid) - maxid = itr->second->slotId; - } - tmpslot = maxid + 1; - } - - newspell->slotId = tmpslot; m_spells[spell_id] = newspell; // return false if spell disabled @@ -2785,23 +2984,8 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, // also cast passive spells (including all talents without SPELL_EFFECT_LEARN_SPELL) with additional checks else if (IsPassiveSpell(spell_id)) { - // if spell doesn't require a stance or the player is in the required stance - if( ( !spellInfo->Stances && - spell_id != 5420 && spell_id != 5419 && spell_id != 7376 && - spell_id != 7381 && spell_id != 21156 && spell_id != 21009 && - spell_id != 21178 && spell_id != 33948 && spell_id != 40121 ) || - m_form != 0 && (spellInfo->Stances & (1<<(m_form-1))) || - (spell_id == 5420 && m_form == FORM_TREE) || - (spell_id == 5419 && m_form == FORM_TRAVEL) || - (spell_id == 7376 && m_form == FORM_DEFENSIVESTANCE) || - (spell_id == 7381 && m_form == FORM_BERSERKERSTANCE) || - (spell_id == 21156 && m_form == FORM_BATTLESTANCE)|| - (spell_id == 21178 && (m_form == FORM_BEAR || m_form == FORM_DIREBEAR) ) || - (spell_id == 33948 && m_form == FORM_FLIGHT) || - (spell_id == 40121 && m_form == FORM_FLIGHT_EPIC) ) - //Check CasterAuraStates - if (!spellInfo->CasterAuraState || HasAuraState(AuraState(spellInfo->CasterAuraState))) - CastSpell(this, spell_id, true); + if(IsNeedCastPassiveSpellAtLearn(spellInfo)) + CastSpell(this, spell_id, true); } else if( IsSpellHaveEffect(spellInfo,SPELL_EFFECT_SKILL_STEP) ) { @@ -2813,10 +2997,10 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, m_usedTalentCount += talentCost; // update free primary prof.points (if any, can be none in case GM .learn prof. learning) - if(uint32 freeProfs = GetFreePrimaryProffesionPoints()) + if(uint32 freeProfs = GetFreePrimaryProfessionPoints()) { if(spellmgr.IsPrimaryProfessionFirstRankSpell(spell_id)) - SetFreePrimaryProffesions(freeProfs-1); + SetFreePrimaryProfessions(freeProfs-1); } // add dependent skills @@ -2824,6 +3008,9 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, SpellLearnSkillNode const* spellLearnSkill = spellmgr.GetSpellLearnSkill(spell_id); + SkillLineAbilityMap::const_iterator lower = spellmgr.GetBeginSkillLineAbilityMap(spell_id); + SkillLineAbilityMap::const_iterator upper = spellmgr.GetEndSkillLineAbilityMap(spell_id); + if(spellLearnSkill) { uint32 skill_value = GetPureSkillValue(spellLearnSkill->skill); @@ -2842,9 +3029,6 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, else { // not ranked skills - SkillLineAbilityMap::const_iterator lower = spellmgr.GetBeginSkillLineAbilityMap(spell_id); - SkillLineAbilityMap::const_iterator upper = spellmgr.GetEndSkillLineAbilityMap(spell_id); - for(SkillLineAbilityMap::const_iterator _spell_idx = lower; _spell_idx != upper; ++_spell_idx) { SkillLineEntry const *pSkill = sSkillLineStore.LookupEntry(_spell_idx->second->skillId); @@ -2855,10 +3039,8 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, continue; if(_spell_idx->second->learnOnGetSkill == ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL || - // poison special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_POISONS && _spell_idx->second->max_value==0 || - // lockpicking special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_LOCKPICKING && _spell_idx->second->max_value==0 ) + // lockpicking/runeforging special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL + (pSkill->id==SKILL_LOCKPICKING || pSkill->id==SKILL_RUNEFORGING) && _spell_idx->second->max_value==0 ) { switch(GetSkillRangeType(pSkill,_spell_idx->second->racemask!=0)) { @@ -2882,41 +3064,108 @@ bool Player::addSpell(uint32 spell_id, bool active, bool learning, bool loading, SpellLearnSpellMap::const_iterator spell_begin = spellmgr.GetBeginSpellLearnSpell(spell_id); SpellLearnSpellMap::const_iterator spell_end = spellmgr.GetEndSpellLearnSpell(spell_id); - for(SpellLearnSpellMap::const_iterator itr = spell_begin; itr != spell_end; ++itr) + for(SpellLearnSpellMap::const_iterator itr2 = spell_begin; itr2 != spell_end; ++itr2) { - if(!itr->second.autoLearned) + if(!itr2->second.autoLearned) { - if(loading) // at spells loading, no output, but allow save - addSpell(itr->second.spell,true,true,loading); + if(!IsInWorld() || !itr2->second.active) // at spells loading, no output, but allow save + addSpell(itr2->second.spell,itr2->second.active,true,true,false); else // at normal learning - learnSpell(itr->second.spell); + learnSpell(itr2->second.spell,true); } } + if(!GetSession()->PlayerLoading()) + { + // not ranked skills + for(SkillLineAbilityMap::const_iterator _spell_idx = lower; _spell_idx != upper; ++_spell_idx) + { + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SKILL_LINE,_spell_idx->second->skillId); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SKILLLINE_SPELLS,_spell_idx->second->skillId); + } + + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SPELL,spell_id); + } + // return true (for send learn packet) only if spell active (in case ranked spells) and not replace old spell return active && !disabled && !superceded_old; } -void Player::learnSpell(uint32 spell_id) +void Player::AddTemporarySpell(uint32 spellId) +{ + PlayerSpellMap::iterator itr = m_spells.find(spellId); + // spell already added - do not do anything + if (itr != m_spells.end()) + return; + PlayerSpell *newspell = new PlayerSpell; + newspell->state = PLAYERSPELL_TEMPORARY; + newspell->active = true; + newspell->dependent = false; + newspell->disabled = false; + m_spells[spellId] = newspell; +} + +void Player::RemoveTemporarySpell(uint32 spellId) +{ + PlayerSpellMap::iterator itr = m_spells.find(spellId); + // spell already not in list - do not do anything + if (itr == m_spells.end()) + return; + // spell has other state than temporary - do not change it + if (itr->second->state != PLAYERSPELL_TEMPORARY) + return; + delete itr->second; + m_spells.erase(itr); +} + +bool Player::IsNeedCastPassiveSpellAtLearn(SpellEntry const* spellInfo) const +{ + bool need_cast = false; + + switch(spellInfo->Id) + { + // some spells not have stance data expected cast at form change or present + case 5420: need_cast = (m_form == FORM_TREE); break; + case 5419: need_cast = (m_form == FORM_TRAVEL); break; + case 7376: need_cast = (m_form == FORM_DEFENSIVESTANCE); break; + case 7381: need_cast = (m_form == FORM_BERSERKERSTANCE); break; + case 21156: need_cast = (m_form == FORM_BATTLESTANCE); break; + case 21178: need_cast = (m_form == FORM_BEAR || m_form == FORM_DIREBEAR); break; + case 33948: need_cast = (m_form == FORM_FLIGHT); break; + case 34764: need_cast = (m_form == FORM_FLIGHT); break; + case 40121: need_cast = (m_form == FORM_FLIGHT_EPIC); break; + case 40122: need_cast = (m_form == FORM_FLIGHT_EPIC); break; + // another spells have proper stance data + default: need_cast = !spellInfo->Stances || m_form != 0 && (spellInfo->Stances & (1<<(m_form-1))); break; + } + + //Check CasterAuraStates + return need_cast && (!spellInfo->CasterAuraState || HasAuraState(AuraState(spellInfo->CasterAuraState))); +} + +void Player::learnSpell(uint32 spell_id, bool dependent) { PlayerSpellMap::iterator itr = m_spells.find(spell_id); bool disabled = (itr != m_spells.end()) ? itr->second->disabled : false; bool active = disabled ? itr->second->active : true; - bool learning = addSpell(spell_id,active); + bool learning = addSpell(spell_id,active,true,dependent,false); // learn all disabled higher ranks (recursive) - SpellChainNode const* node = spellmgr.GetSpellChainNode(spell_id); - if (node) + if(disabled) { - PlayerSpellMap::iterator iter = m_spells.find(node->next); - if (disabled && iter != m_spells.end() && iter->second->disabled ) - learnSpell(node->next); + SpellChainNode const* node = spellmgr.GetSpellChainNode(spell_id); + if(node) + { + PlayerSpellMap::iterator iter = m_spells.find(node->next); + if (iter != m_spells.end() && iter->second->disabled ) + learnSpell(node->next,false); + } } - // prevent duplicated entires in spell book - if(!learning) + // prevent duplicated entires in spell book, also not send if not in world (loading) + if(!learning || !IsInWorld ()) return; WorldPacket data(SMSG_LEARNED_SPELL, 4); @@ -2924,13 +3173,13 @@ void Player::learnSpell(uint32 spell_id) GetSession()->SendPacket(&data); } -void Player::removeSpell(uint32 spell_id, bool disabled) +void Player::removeSpell(uint32 spell_id, bool disabled, bool update_action_bar_for_low_rank) { PlayerSpellMap::iterator itr = m_spells.find(spell_id); if (itr == m_spells.end()) return; - if(itr->second->state == PLAYERSPELL_REMOVED || disabled && itr->second->disabled) + if(itr->second->state == PLAYERSPELL_REMOVED || disabled && itr->second->disabled || itr->second->state == PLAYERSPELL_TEMPORARY) return; // unlearn non talent higher ranks (recursive) @@ -2946,10 +3195,13 @@ void Player::removeSpell(uint32 spell_id, bool disabled) for (uint32 i=reqMap.count(spell_id);i>0;i--,itr2++) removeSpell(itr2->second,disabled); - // removing - WorldPacket data(SMSG_REMOVED_SPELL, 4); - data << uint16(spell_id); - GetSession()->SendPacket(&data); + // re-search, it can be corrupted in prev loop + itr = m_spells.find(spell_id); + if (itr == m_spells.end()) + return; // already unleared + + bool cur_active = itr->second->active; + bool cur_dependent = itr->second->dependent; if (disabled) { @@ -2971,8 +3223,9 @@ void Player::removeSpell(uint32 spell_id, bool disabled) RemoveAurasDueToSpell(spell_id); // remove pet auras - if(PetAura const* petSpell = spellmgr.GetPetAura(spell_id)) - RemovePetAura(petSpell); + for(int i = 0; i < MAX_SPELL_EFFECTS; ++i) + if(PetAura const* petSpell = spellmgr.GetPetAura(spell_id, i)) + RemovePetAura(petSpell); // free talent points uint32 talentCosts = GetTalentSpellCost(spell_id); @@ -2987,9 +3240,9 @@ void Player::removeSpell(uint32 spell_id, bool disabled) // update free primary prof.points (if not overflow setting, can be in case GM use before .learn prof. learning) if(spellmgr.IsPrimaryProfessionFirstRankSpell(spell_id)) { - uint32 freeProfs = GetFreePrimaryProffesionPoints()+1; + uint32 freeProfs = GetFreePrimaryProfessionPoints()+1; if(freeProfs <= sWorld.getConfig(CONFIG_MAX_PRIMARY_TRADE_SKILL)) - SetFreePrimaryProffesions(freeProfs); + SetFreePrimaryProfessions(freeProfs); } // remove dependent skill @@ -3042,10 +3295,8 @@ void Player::removeSpell(uint32 spell_id, bool disabled) continue; if(_spell_idx->second->learnOnGetSkill == ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL || - // poison special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_POISONS && _spell_idx->second->max_value==0 || - // lockpicking special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL - pSkill->id==SKILL_LOCKPICKING && _spell_idx->second->max_value==0 ) + // lockpicking/runeforging special case, not have ABILITY_LEARNED_ON_GET_RACE_OR_CLASS_SKILL + (pSkill->id==SKILL_LOCKPICKING || pSkill->id==SKILL_RUNEFORGING) && _spell_idx->second->max_value==0 ) { // not reset skills for professions and racial abilities if( (pSkill->categoryId==SKILL_CATEGORY_SECONDARY || pSkill->categoryId==SKILL_CATEGORY_PROFESSION) && @@ -3063,6 +3314,76 @@ void Player::removeSpell(uint32 spell_id, bool disabled) for(SpellLearnSpellMap::const_iterator itr2 = spell_begin; itr2 != spell_end; ++itr2) removeSpell(itr2->second.spell, disabled); + + // activate lesser rank in spellbook/action bar, and cast it if need + bool prev_activate = false; + + if(uint32 prev_id = spellmgr.GetPrevSpellInChain (spell_id)) + { + SpellEntry const *spellInfo = sSpellStore.LookupEntry(spell_id); + + // if talent then lesser rank also talent and need learn + if(talentCosts) + { + //learnSpell (prev_id,false); + } + // if ranked non-stackable spell: need activate lesser rank and update dendence state + else if(cur_active && !SpellMgr::canStackSpellRanks(spellInfo) && spellmgr.GetSpellRank(spellInfo->Id) != 0) + { + // need manually update dependence state (learn spell ignore like attempts) + PlayerSpellMap::iterator prev_itr = m_spells.find(prev_id); + if (prev_itr != m_spells.end()) + { + if(prev_itr->second->dependent != cur_dependent) + { + prev_itr->second->dependent = cur_dependent; + if(prev_itr->second->state != PLAYERSPELL_NEW) + prev_itr->second->state = PLAYERSPELL_CHANGED; + } + + // now re-learn if need re-activate + if(cur_active && !prev_itr->second->active) + { + if(addSpell(prev_id,true,false,prev_itr->second->dependent,prev_itr->second->disabled)) + { + if(update_action_bar_for_low_rank) + { + // downgrade spell ranks in spellbook and action bar + WorldPacket data(SMSG_SUPERCEDED_SPELL, 4 + 4); + data << uint32(spell_id); + data << uint32(prev_id); + GetSession()->SendPacket( &data ); + prev_activate = true; + } + } + } + } + } + } + + // remove from spell book if not replaced by lesser rank + if(!prev_activate) + { + WorldPacket data(SMSG_REMOVED_SPELL, 4); + data << uint32(spell_id); + GetSession()->SendPacket(&data); + } +} + +void Player::RemoveSpellCooldown( uint32 spell_id, bool update /* = false */ ) +{ + m_spellCooldowns.erase(spell_id); + + if(update) + SendClearCooldown(spell_id, this); +} + +void Player::RemoveCategoryCooldown( uint32 cat ) +{ + SpellCategoryStore::const_iterator i_scstore = sSpellCategoryStore.find(cat); + if(i_scstore != sSpellCategoryStore.end()) + for(SpellCategorySet::const_iterator i_scset = i_scstore->second.begin(); i_scset != i_scstore->second.end(); ++i_scset) + RemoveSpellCooldown(*i_scset, true); } void Player::RemoveArenaSpellCooldowns() @@ -3077,16 +3398,11 @@ void Player::RemoveArenaSpellCooldowns() SpellEntry const * entry = sSpellStore.LookupEntry(itr->first); // check if spellentry is present and if the cooldown is less than 15 mins if( entry && - entry->RecoveryTime <= 15 * MINUTE * 1000 && - entry->CategoryRecoveryTime <= 15 * MINUTE * 1000 ) + entry->RecoveryTime <= 15 * MINUTE * IN_MILISECONDS && + entry->CategoryRecoveryTime <= 15 * MINUTE * IN_MILISECONDS ) { - // notify player - WorldPacket data(SMSG_CLEAR_COOLDOWN, (4+8)); - data << uint32(itr->first); - data << GetGUID(); - GetSession()->SendPacket(&data); - // remove cooldown - m_spellCooldowns.erase(itr); + // remove & notify + RemoveSpellCooldown(itr->first, true); } } } @@ -3096,19 +3412,15 @@ void Player::RemoveAllSpellCooldown() if(!m_spellCooldowns.empty()) { for(SpellCooldowns::const_iterator itr = m_spellCooldowns.begin();itr != m_spellCooldowns.end(); ++itr) - { - WorldPacket data(SMSG_CLEAR_COOLDOWN, (4+8)); - data << uint32(itr->first); - data << uint64(GetGUID()); - GetSession()->SendPacket(&data); - } + SendClearCooldown(itr->first, this); + m_spellCooldowns.clear(); } } void Player::_LoadSpellCooldowns(QueryResult *result) { - m_spellCooldowns.clear(); + // some cooldowns can be already set at aura loading... //QueryResult *result = CharacterDatabase.PQuery("SELECT spell,item,time FROM character_spell_cooldown WHERE guid = '%u'",GetGUIDLow()); @@ -3149,17 +3461,20 @@ void Player::_SaveSpellCooldowns() CharacterDatabase.PExecute("DELETE FROM character_spell_cooldown WHERE guid = '%u'", GetGUIDLow()); time_t curTime = time(NULL); + time_t infTime = curTime + MONTH/2; // remove outdated and save active for(SpellCooldowns::iterator itr = m_spellCooldowns.begin();itr != m_spellCooldowns.end();) { if(itr->second.end <= curTime) m_spellCooldowns.erase(itr++); - else + else if(itr->second.end <= infTime) // not save locked cooldowns, it will be reset or set at reload { - CharacterDatabase.PExecute("INSERT INTO character_spell_cooldown (guid,spell,item,time) VALUES ('%u', '%u', '%u', '" I64FMTD "')", GetGUIDLow(), itr->first, itr->second.itemid, uint64(itr->second.end)); + CharacterDatabase.PExecute("INSERT INTO character_spell_cooldown (guid,spell,item,time) VALUES ('%u', '%u', '%u', '" UI64FMTD "')", GetGUIDLow(), itr->first, itr->second.itemid, uint64(itr->second.end)); ++itr; } + else + ++itr; } } @@ -3200,13 +3515,9 @@ bool Player::resetTalents(bool no_cost) { // not need after this call if(HasAtLoginFlag(AT_LOGIN_RESET_TALENTS)) - { - m_atLoginFlags = m_atLoginFlags & ~AT_LOGIN_RESET_TALENTS; - CharacterDatabase.PExecute("UPDATE characters set at_login = at_login & ~ %u WHERE guid ='%u'", uint32(AT_LOGIN_RESET_TALENTS), GetGUIDLow()); - } + RemoveAtLoginFlag(AT_LOGIN_RESET_TALENTS,true); - uint32 level = getLevel(); - uint32 talentPointsForLevel = level < 10 ? 0 : uint32((level-9)*sWorld.getRate(RATE_TALENT)); + uint32 talentPointsForLevel = CalculateTalentsPoints(); if (m_usedTalentCount == 0) { @@ -3227,7 +3538,7 @@ bool Player::resetTalents(bool no_cost) } } - for (unsigned int i = 0; i < sTalentStore.GetNumRows(); i++) + for (uint32 i = 0; i < sTalentStore.GetNumRows(); i++) { TalentEntry const *talentInfo = sTalentStore.LookupEntry(i); @@ -3244,7 +3555,7 @@ bool Player::resetTalents(bool no_cost) if( (getClassMask() & talentTabInfo->ClassMask) == 0 ) continue; - for (int j = 0; j < 5; j++) + for (int j = 0; j < MAX_TALENT_RANK; j++) { for(PlayerSpellMap::iterator itr = GetSpellMap().begin(); itr != GetSpellMap().end();) { @@ -3275,6 +3586,8 @@ bool Player::resetTalents(bool no_cost) if(!no_cost) { ModifyMoney(-(int32)cost); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GOLD_SPENT_FOR_TALENTS, cost); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_NUMBER_OF_TALENT_RESETS, 1); m_resetTalentsCost = cost; m_resetTalentsTime = time(NULL); @@ -3282,20 +3595,23 @@ bool Player::resetTalents(bool no_cost) //FIXME: remove pet before or after unlearn spells? for now after unlearn to allow removing of talent related, pet affecting auras RemovePet(NULL,PET_SAVE_NOT_IN_SLOT, true); + /* when prev line will dropped use next line + if(Pet* pet = GetPet()) + { + if(pet->getPetType()==HUNTER_PET && !pet->GetCreatureInfo()->isTameable(CanTameExoticPets())) + RemovePet(NULL,PET_SAVE_NOT_IN_SLOT, true); + } + */ - return true; -} -bool Player::_removeSpell(uint16 spell_id) -{ - PlayerSpellMap::iterator itr = m_spells.find(spell_id); - if (itr != m_spells.end()) + if(m_canTitanGrip) { - delete itr->second; - m_spells.erase(itr); - return true; + m_canTitanGrip = false; + if(sWorld.getConfig(CONFIG_OFFHAND_CHECK_AT_TALENTS_RESET)) + AutoUnequipOffhandIfNeed(); } - return false; + + return true; } Mail* Player::GetMail(uint32 id) @@ -3343,50 +3659,46 @@ void Player::InitVisibleBits() { updateVisualBits.SetCount(PLAYER_END); - // TODO: really implement OWNER_ONLY and GROUP_ONLY. Flags can be found in UpdateFields.h - updateVisualBits.SetBit(OBJECT_FIELD_GUID); updateVisualBits.SetBit(OBJECT_FIELD_TYPE); + updateVisualBits.SetBit(OBJECT_FIELD_ENTRY); updateVisualBits.SetBit(OBJECT_FIELD_SCALE_X); - - updateVisualBits.SetBit(UNIT_FIELD_CHARM); - updateVisualBits.SetBit(UNIT_FIELD_CHARM+1); - - updateVisualBits.SetBit(UNIT_FIELD_SUMMON); - updateVisualBits.SetBit(UNIT_FIELD_SUMMON+1); - - updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY); - updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY+1); - - updateVisualBits.SetBit(UNIT_FIELD_TARGET); - updateVisualBits.SetBit(UNIT_FIELD_TARGET+1); - - updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT); - updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT+1); - + updateVisualBits.SetBit(UNIT_FIELD_CHARM + 0); + updateVisualBits.SetBit(UNIT_FIELD_CHARM + 1); + updateVisualBits.SetBit(UNIT_FIELD_SUMMON + 0); + updateVisualBits.SetBit(UNIT_FIELD_SUMMON + 1); + updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY + 0); + updateVisualBits.SetBit(UNIT_FIELD_CHARMEDBY + 1); + updateVisualBits.SetBit(UNIT_FIELD_TARGET + 0); + updateVisualBits.SetBit(UNIT_FIELD_TARGET + 1); + updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT + 0); + updateVisualBits.SetBit(UNIT_FIELD_CHANNEL_OBJECT + 1); + updateVisualBits.SetBit(UNIT_FIELD_BYTES_0); updateVisualBits.SetBit(UNIT_FIELD_HEALTH); updateVisualBits.SetBit(UNIT_FIELD_POWER1); updateVisualBits.SetBit(UNIT_FIELD_POWER2); updateVisualBits.SetBit(UNIT_FIELD_POWER3); updateVisualBits.SetBit(UNIT_FIELD_POWER4); updateVisualBits.SetBit(UNIT_FIELD_POWER5); - + updateVisualBits.SetBit(UNIT_FIELD_POWER6); + updateVisualBits.SetBit(UNIT_FIELD_POWER7); updateVisualBits.SetBit(UNIT_FIELD_MAXHEALTH); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER1); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER2); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER3); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER4); updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER5); - + updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER6); + updateVisualBits.SetBit(UNIT_FIELD_MAXPOWER7); updateVisualBits.SetBit(UNIT_FIELD_LEVEL); updateVisualBits.SetBit(UNIT_FIELD_FACTIONTEMPLATE); - updateVisualBits.SetBit(UNIT_FIELD_BYTES_0); + updateVisualBits.SetBit(UNIT_VIRTUAL_ITEM_SLOT_ID + 0); + updateVisualBits.SetBit(UNIT_VIRTUAL_ITEM_SLOT_ID + 1); + updateVisualBits.SetBit(UNIT_VIRTUAL_ITEM_SLOT_ID + 2); updateVisualBits.SetBit(UNIT_FIELD_FLAGS); updateVisualBits.SetBit(UNIT_FIELD_FLAGS_2); - for(uint16 i = UNIT_FIELD_AURA; i < UNIT_FIELD_AURASTATE; ++i) - updateVisualBits.SetBit(i); updateVisualBits.SetBit(UNIT_FIELD_AURASTATE); - updateVisualBits.SetBit(UNIT_FIELD_BASEATTACKTIME); + updateVisualBits.SetBit(UNIT_FIELD_BASEATTACKTIME + 0); updateVisualBits.SetBit(UNIT_FIELD_BASEATTACKTIME + 1); updateVisualBits.SetBit(UNIT_FIELD_BOUNDINGRADIUS); updateVisualBits.SetBit(UNIT_FIELD_COMBATREACH); @@ -3399,10 +3711,12 @@ void Player::InitVisibleBits() updateVisualBits.SetBit(UNIT_DYNAMIC_FLAGS); updateVisualBits.SetBit(UNIT_CHANNEL_SPELL); updateVisualBits.SetBit(UNIT_MOD_CAST_SPEED); + updateVisualBits.SetBit(UNIT_FIELD_BASE_MANA); updateVisualBits.SetBit(UNIT_FIELD_BYTES_2); + updateVisualBits.SetBit(UNIT_FIELD_HOVERHEIGHT); - updateVisualBits.SetBit(PLAYER_DUEL_ARBITER); - updateVisualBits.SetBit(PLAYER_DUEL_ARBITER+1); + updateVisualBits.SetBit(PLAYER_DUEL_ARBITER + 0); + updateVisualBits.SetBit(PLAYER_DUEL_ARBITER + 1); updateVisualBits.SetBit(PLAYER_FLAGS); updateVisualBits.SetBit(PLAYER_GUILDID); updateVisualBits.SetBit(PLAYER_GUILDRANK); @@ -3413,29 +3727,18 @@ void Player::InitVisibleBits() updateVisualBits.SetBit(PLAYER_GUILD_TIMESTAMP); // PLAYER_QUEST_LOG_x also visible bit on official (but only on party/raid)... - for(uint16 i = PLAYER_QUEST_LOG_1_1; i < PLAYER_QUEST_LOG_25_2; i+=4) + for(uint16 i = PLAYER_QUEST_LOG_1_1; i < PLAYER_QUEST_LOG_25_2; i += 4) updateVisualBits.SetBit(i); - //Players visible items are not inventory stuff - //431) = 884 (0x374) = main weapon - for(uint16 i = 0; i < EQUIPMENT_SLOT_END; i++) + // Players visible items are not inventory stuff + for(uint8 i = 0; i < EQUIPMENT_SLOT_END; ++i) { - // item creator - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_CREATOR + (i*MAX_VISIBLE_ITEM_OFFSET) + 0); - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_CREATOR + (i*MAX_VISIBLE_ITEM_OFFSET) + 1); - - uint16 visual_base = PLAYER_VISIBLE_ITEM_1_0 + (i*MAX_VISIBLE_ITEM_OFFSET); + uint16 offset = i * 2; // item entry - updateVisualBits.SetBit(visual_base + 0); - - // item enchantment IDs - for(uint8 j = 0; j < MAX_INSPECTED_ENCHANTMENT_SLOT; ++j) - updateVisualBits.SetBit(visual_base + 1 + j); - - // random properties - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 0 + (i*MAX_VISIBLE_ITEM_OFFSET)); - updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 1 + (i*MAX_VISIBLE_ITEM_OFFSET)); + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_ENTRYID + offset); + // enchant + updateVisualBits.SetBit(PLAYER_VISIBLE_ITEM_1_ENCHANTMENT + offset); } updateVisualBits.SetBit(PLAYER_CHOSEN_TITLE); @@ -3443,7 +3746,7 @@ void Player::InitVisibleBits() void Player::BuildCreateUpdateBlockForPlayer( UpdateData *data, Player *target ) const { - for(int i = 0; i < EQUIPMENT_SLOT_END; i++) + for(uint8 i = 0; i < EQUIPMENT_SLOT_END; i++) { if(m_items[i] == NULL) continue; @@ -3453,15 +3756,14 @@ void Player::BuildCreateUpdateBlockForPlayer( UpdateData *data, Player *target ) if(target == this) { - - for(int i = INVENTORY_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { if(m_items[i] == NULL) continue; m_items[i]->BuildCreateUpdateBlockForPlayer( data, target ); } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { if(m_items[i] == NULL) continue; @@ -3477,7 +3779,7 @@ void Player::DestroyForPlayer( Player *target ) const { Unit::DestroyForPlayer( target ); - for(int i = 0; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = 0; i < INVENTORY_SLOT_BAG_END; i++) { if(m_items[i] == NULL) continue; @@ -3487,14 +3789,14 @@ void Player::DestroyForPlayer( Player *target ) const if(target == this) { - for(int i = INVENTORY_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { if(m_items[i] == NULL) continue; m_items[i]->DestroyForPlayer( target ); } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { if(m_items[i] == NULL) continue; @@ -3506,8 +3808,16 @@ void Player::DestroyForPlayer( Player *target ) const bool Player::HasSpell(uint32 spell) const { - PlayerSpellMap::const_iterator itr = m_spells.find((uint16)spell); - return (itr != m_spells.end() && itr->second->state != PLAYERSPELL_REMOVED && !itr->second->disabled); + PlayerSpellMap::const_iterator itr = m_spells.find(spell); + return (itr != m_spells.end() && itr->second->state != PLAYERSPELL_REMOVED && + !itr->second->disabled); +} + +bool Player::HasActiveSpell(uint32 spell) const +{ + PlayerSpellMap::const_iterator itr = m_spells.find(spell); + return (itr != m_spells.end() && itr->second->state != PLAYERSPELL_REMOVED && + itr->second->active && !itr->second->disabled); } TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell) const @@ -3515,22 +3825,22 @@ TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell if (!trainer_spell) return TRAINER_SPELL_RED; - if (!trainer_spell->spell) + if (!trainer_spell->learnedSpell) return TRAINER_SPELL_RED; // known spell - if(HasSpell(trainer_spell->spell)) + if(HasSpell(trainer_spell->learnedSpell)) return TRAINER_SPELL_GRAY; // check race/class requirement - if(!IsSpellFitByClassAndRace(trainer_spell->spell)) + if(!IsSpellFitByClassAndRace(trainer_spell->learnedSpell)) return TRAINER_SPELL_RED; // check level requirement - if(getLevel() < trainer_spell->reqlevel) + if(getLevel() < trainer_spell->reqLevel) return TRAINER_SPELL_RED; - if(SpellChainNode const* spell_chain = spellmgr.GetSpellChainNode(trainer_spell->spell)) + if(SpellChainNode const* spell_chain = spellmgr.GetSpellChainNode(trainer_spell->learnedSpell)) { // check prev.rank requirement if(spell_chain->prev && !HasSpell(spell_chain->prev)) @@ -3545,11 +3855,11 @@ TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell } // check skill requirement - if(trainer_spell->reqskill && GetBaseSkillValue(trainer_spell->reqskill) < trainer_spell->reqskillvalue) + if(trainer_spell->reqSkill && GetBaseSkillValue(trainer_spell->reqSkill) < trainer_spell->reqSkillValue) return TRAINER_SPELL_RED; // exist, already checked at loading - SpellEntry const* spell = sSpellStore.LookupEntry(trainer_spell->spell); + SpellEntry const* spell = sSpellStore.LookupEntry(trainer_spell->learnedSpell); // secondary prof. or not prof. spell uint32 skill = spell->EffectMiscValue[1]; @@ -3558,8 +3868,8 @@ TrainerSpellState Player::GetTrainerSpellState(TrainerSpell const* trainer_spell return TRAINER_SPELL_GREEN; // check primary prof. limit - if(spellmgr.IsPrimaryProfessionFirstRankSpell(spell->Id) && GetFreePrimaryProffesionPoints() == 0) - return TRAINER_SPELL_RED; + if(spellmgr.IsPrimaryProfessionFirstRankSpell(spell->Id) && GetFreePrimaryProfessionPoints() == 0) + return TRAINER_SPELL_GREEN_DISABLED; return TRAINER_SPELL_GREEN; } @@ -3582,27 +3892,7 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC } // remove from arena teams - uint32 at_id = GetArenaTeamIdFromDB(playerguid,ARENA_TEAM_2v2); - if(at_id != 0) - { - ArenaTeam * at = objmgr.GetArenaTeamById(at_id); - if(at) - at->DelMember(playerguid); - } - at_id = GetArenaTeamIdFromDB(playerguid,ARENA_TEAM_3v3); - if(at_id != 0) - { - ArenaTeam * at = objmgr.GetArenaTeamById(at_id); - if(at) - at->DelMember(playerguid); - } - at_id = GetArenaTeamIdFromDB(playerguid,ARENA_TEAM_5v5); - if(at_id != 0) - { - ArenaTeam * at = objmgr.GetArenaTeamById(at_id); - if(at) - at->DelMember(playerguid); - } + LeaveAllArenaTeams(playerguid); // the player was uninvited already on logout so just remove from group QueryResult *resultGroup = CharacterDatabase.PQuery("SELECT leaderGuid FROM group_member WHERE memberGuid='%u'", guid); @@ -3643,15 +3933,16 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC MailItemsInfo mi; if(has_items) { - QueryResult *resultItems = CharacterDatabase.PQuery("SELECT item_guid,item_template FROM mail_items WHERE mail_id='%u'", mail_id); + // data needs to be at first place for Item::LoadFromDB + QueryResult *resultItems = CharacterDatabase.PQuery("SELECT data,item_guid,item_template FROM mail_items JOIN item_instance ON item_guid = guid WHERE mail_id='%u'", mail_id); if(resultItems) { do { Field *fields2 = resultItems->Fetch(); - uint32 item_guidlow = fields2[0].GetUInt32(); - uint32 item_template = fields2[1].GetUInt32(); + uint32 item_guidlow = fields2[1].GetUInt32(); + uint32 item_template = fields2[2].GetUInt32(); ItemPrototype const* itemProto = objmgr.GetItemPrototype(item_template); if(!itemProto) @@ -3661,7 +3952,7 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC } Item *pItem = NewItemOrBag(itemProto); - if(!pItem->LoadFromDB(item_guidlow, MAKE_NEW_GUID(guid, 0, HIGHGUID_PLAYER))) + if(!pItem->LoadFromDB(item_guidlow, MAKE_NEW_GUID(guid, 0, HIGHGUID_PLAYER),resultItems)) { pItem->FSetState(ITEM_REMOVED); pItem->SaveToDB(); // it also deletes item object ! @@ -3724,6 +4015,9 @@ void Player::DeleteFromDB(uint64 playerguid, uint32 accountId, bool updateRealmC CharacterDatabase.PExecute("DELETE FROM mail_items WHERE receiver = '%u'",guid); CharacterDatabase.PExecute("DELETE FROM character_pet WHERE owner = '%u'",guid); CharacterDatabase.PExecute("DELETE FROM character_pet_declinedname WHERE owner = '%u'",guid); + CharacterDatabase.PExecute("DELETE FROM character_achievement WHERE guid = '%u'",guid); + CharacterDatabase.PExecute("DELETE FROM character_achievement_progress WHERE guid = '%u'",guid); + CharacterDatabase.PExecute("DELETE FROM character_equipmentsets WHERE guid = '%u'",guid); CharacterDatabase.CommitTransaction(); //LoginDatabase.PExecute("UPDATE realmcharacters SET numchars = numchars - 1 WHERE acctid = %d AND realmid = %d", accountId, realmID); @@ -3754,6 +4048,10 @@ void Player::SetMovement(PlayerMovementType pType) */ void Player::BuildPlayerRepop() { + WorldPacket data(SMSG_PRE_RESURRECT, GetPackGUID().size()); + data.append(GetPackGUID()); + GetSession()->SendPacket(&data); + if(getRace() == RACE_NIGHTELF) CastSpell(this, 20584, true); // auras SPELL_AURA_INCREASE_SPEED(+speed in wisp form), SPELL_AURA_INCREASE_SWIM_SPEED(+swim speed in wisp form), SPELL_AURA_TRANSFORM (to wisp form) CastSpell(this, 8326, true); // auras SPELL_AURA_GHOST, SPELL_AURA_INCREASE_SPEED(why?), SPELL_AURA_INCREASE_SWIM_SPEED(why?) @@ -3798,7 +4096,8 @@ void Player::BuildPlayerRepop() SetFloatValue(UNIT_FIELD_BOUNDINGRADIUS, (float)1.0); //see radius of death player? - SetByteValue(UNIT_FIELD_BYTES_1, 3, PLAYER_STATE_FLAG_ALWAYS_STAND); + // set and clear other + SetByteValue(UNIT_FIELD_BYTES_1, 3, UNIT_BYTE1_FLAG_ALWAYS_STAND); } void Player::SendDelayResponse(const uint32 ml_seconds) @@ -3843,13 +4142,15 @@ void Player::ResurrectPlayer(float restore_percent, bool applySickness) SetPower(POWER_ENERGY, uint32(GetMaxPower(POWER_ENERGY)*restore_percent)); } + // trigger update zone for alive state zone updates + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + UpdateZone(newzone,newarea); + // update visibility //ObjectAccessor::UpdateVisibilityForPlayer(this); SetToNotify(); - // some items limited to specific map - DestroyZoneLimitedItem( true, GetZoneId()); - if(!applySickness) return; @@ -3869,13 +4170,9 @@ void Player::ResurrectPlayer(float restore_percent, bool applySickness) { int32 delta = (int32(getLevel()) - startLevel + 1)*MINUTE; - for(int i =0; i < 3; ++i) + if(Aura* Aur = GetAura(SPELL_ID_PASSIVE_RESURRECTION_SICKNESS, GetGUID())) { - if(Aura* Aur = GetAura(SPELL_ID_PASSIVE_RESURRECTION_SICKNESS,i)) - { - Aur->SetAuraDuration(delta*1000); - Aur->UpdateAuraDuration(); - } + Aur->SetAuraDuration(delta*IN_MILISECONDS); } } } @@ -3894,7 +4191,7 @@ void Player::KillPlayer() ApplyModFlag(PLAYER_FIELD_BYTES, PLAYER_FIELD_BYTE_RELEASE_TIMER, !sMapStore.LookupEntry(GetMapId())->Instanceable()); // 6 minutes until repop at graveyard - m_deathTimer = 6*MINUTE*1000; + m_deathTimer = 6*MINUTE*IN_MILISECONDS; UpdateCorpseReclaimDelay(); // dependent at use SetDeathPvP() call before kill SendCorpseReclaimDelay(); @@ -3915,8 +4212,7 @@ void Player::CreateCorpse() Corpse *corpse = new Corpse( (m_ExtraFlags & PLAYER_EXTRA_PVP_DEATH) ? CORPSE_RESURRECTABLE_PVP : CORPSE_RESURRECTABLE_PVE ); SetPvPDeath(false); - if(!corpse->Create(objmgr.GenerateLowGuid(HIGHGUID_CORPSE), this, GetMapId(), GetPositionX(), - GetPositionY(), GetPositionZ(), GetOrientation())) + if(!corpse->Create(objmgr.GenerateLowGuid(HIGHGUID_CORPSE), this)) { delete corpse; return; @@ -3944,7 +4240,7 @@ void Player::CreateCorpse() flags |= CORPSE_FLAG_HIDE_HELM; if(HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_HIDE_CLOAK)) flags |= CORPSE_FLAG_HIDE_CLOAK; - if(InBattleGround()) + if(InBattleGround() && !InArena()) flags |= CORPSE_FLAG_LOOTABLE; // to be able to remove insignia corpse->SetUInt32Value( CORPSE_FIELD_FLAGS, flags ); @@ -3955,7 +4251,7 @@ void Player::CreateCorpse() uint32 iDisplayID; uint16 iIventoryType; uint32 _cfi; - for (int i = 0; i < EQUIPMENT_SLOT_END; i++) + for (uint8 i = 0; i < EQUIPMENT_SLOT_END; i++) { if(m_items[i]) { @@ -3990,7 +4286,7 @@ Corpse* Player::GetCorpse() const void Player::DurabilityLossAll(double percent, bool inventory) { - for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) if(Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) DurabilityLoss(pItem,percent); @@ -3999,14 +4295,14 @@ void Player::DurabilityLossAll(double percent, bool inventory) // bags not have durability // for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) if(Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) DurabilityLoss(pItem,percent); // keys not have durability //for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) if(Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) for(uint32 j = 0; j < pBag->GetBagSize(); j++) if(Item* pItem = GetItemByPos( i, j )) @@ -4034,7 +4330,7 @@ void Player::DurabilityLoss(Item* item, double percent) void Player::DurabilityPointsLossAll(int32 points, bool inventory) { - for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) if(Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) DurabilityPointsLoss(pItem,points); @@ -4043,14 +4339,14 @@ void Player::DurabilityPointsLossAll(int32 points, bool inventory) // bags not have durability // for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) if(Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) DurabilityPointsLoss(pItem,points); // keys not have durability //for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) if(Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) for(uint32 j = 0; j < pBag->GetBagSize(); j++) if(Item* pItem = GetItemByPos( i, j )) @@ -4095,14 +4391,14 @@ uint32 Player::DurabilityRepairAll(bool cost, float discountMod, bool guildBank) { uint32 TotalCost = 0; // equipped, backpack, bags itself - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) TotalCost += DurabilityRepair(( (INVENTORY_SLOT_BAG_0 << 8) | i ),cost,discountMod, guildBank); // bank, buyback and keys not repaired // items in inventory bags - for(int j = INVENTORY_SLOT_BAG_START; j < INVENTORY_SLOT_BAG_END; j++) - for(int i = 0; i < MAX_BAG_SIZE; i++) + for(uint8 j = INVENTORY_SLOT_BAG_START; j < INVENTORY_SLOT_BAG_END; j++) + for(uint8 i = 0; i < MAX_BAG_SIZE; i++) TotalCost += DurabilityRepair(( (j << 8) | i ),cost,discountMod, guildBank); return TotalCost; } @@ -4131,7 +4427,7 @@ uint32 Player::DurabilityRepair(uint16 pos, bool cost, float discountMod, bool g DurabilityCostsEntry const *dcost = sDurabilityCostsStore.LookupEntry(ditemProto->ItemLevel); if(!dcost) { - sLog.outError("ERROR: RepairDurability: Wrong item lvl %u", ditemProto->ItemLevel); + sLog.outError("RepairDurability: Wrong item lvl %u", ditemProto->ItemLevel); return TotalCost; } @@ -4139,7 +4435,7 @@ uint32 Player::DurabilityRepair(uint16 pos, bool cost, float discountMod, bool g DurabilityQualityEntry const *dQualitymodEntry = sDurabilityQualityStore.LookupEntry(dQualitymodEntryId); if(!dQualitymodEntry) { - sLog.outError("ERROR: RepairDurability: Wrong dQualityModEntry %u", dQualitymodEntryId); + sLog.outError("RepairDurability: Wrong dQualityModEntry %u", dQualitymodEntryId); return TotalCost; } @@ -4211,7 +4507,7 @@ void Player::RepopAtGraveyard() AreaTableEntry const *zone = GetAreaEntryByAreaID(GetAreaId()); // Such zones are considered unreachable as a ghost and the player must be automatically revived - if(!isAlive() && zone && zone->flags & AREA_FLAG_NEED_FLY || GetTransport()) + if(!isAlive() && zone && zone->flags & AREA_FLAG_NEED_FLY || GetTransport() || GetPositionZ() < -500.0f) { ResurrectPlayer(0.5f); SpawnCorpseBones(); @@ -4220,10 +4516,8 @@ void Player::RepopAtGraveyard() WorldSafeLocsEntry const *ClosestGrave = NULL; // Special handle for battleground maps - BattleGround *bg = sBattleGroundMgr.GetBattleGround(GetBattleGroundId()); - - if(bg && (bg->GetTypeID() == BATTLEGROUND_AB || bg->GetTypeID() == BATTLEGROUND_EY || bg->GetTypeID() == BATTLEGROUND_AV)) - ClosestGrave = bg->GetClosestGraveYard(GetPositionX(), GetPositionY(), GetPositionZ(), GetTeam()); + if( BattleGround *bg = GetBattleGround() ) + ClosestGrave = bg->GetClosestGraveYard(this); else ClosestGrave = objmgr.GetClosestGraveYard( GetPositionX(), GetPositionY(), GetPositionZ(), GetMapId(), GetTeam() ); @@ -4245,6 +4539,8 @@ void Player::RepopAtGraveyard() GetSession()->SendPacket(&data); } } + else if(GetPositionZ() < -500.0f) + TeleportTo(m_homebindMapId, m_homebindX, m_homebindY, m_homebindZ, GetOrientation()); } void Player::JoinedChannel(Channel *c) @@ -4384,7 +4680,7 @@ float Player::GetBaseModValue(BaseModGroup modGroup, BaseModType modType) const { if(modGroup >= BASEMOD_END || modType > MOD_END) { - sLog.outError("ERROR: trial to access non existed BaseModGroup or wrong BaseModType!"); + sLog.outError("trial to access non existed BaseModGroup or wrong BaseModType!"); return 0.0f; } @@ -4398,7 +4694,7 @@ float Player::GetTotalBaseModValue(BaseModGroup modGroup) const { if(modGroup >= BASEMOD_END) { - sLog.outError("ERROR: wrong BaseModGroup in GetTotalBaseModValue()!"); + sLog.outError("wrong BaseModGroup in GetTotalBaseModValue()!"); return 0.0f; } @@ -4410,9 +4706,7 @@ float Player::GetTotalBaseModValue(BaseModGroup modGroup) const uint32 Player::GetShieldBlockValue() const { - BaseModGroup modGroup = SHIELD_BLOCK_VALUE; - - float value = GetTotalBaseModValue(modGroup) + GetStat(STAT_STRENGTH)/20 - 1; + float value = (m_auraBaseMod[SHIELD_BLOCK_VALUE][FLAT_MOD] + GetStat(STAT_STRENGTH) * 0.5f - 10)*m_auraBaseMod[SHIELD_BLOCK_VALUE][PCT_MOD]; value = (value < 0) ? 0 : value; @@ -4516,24 +4810,24 @@ float Player::GetRatingBonusValue(CombatRating cr) const uint32 Player::GetMeleeCritDamageReduction(uint32 damage) const { - float melee = GetRatingBonusValue(CR_CRIT_TAKEN_MELEE)*2.0f; - if (melee>25.0f) melee = 25.0f; + float melee = GetRatingBonusValue(CR_CRIT_TAKEN_MELEE)*2.2f; + if (melee>33.0f) melee = 33.0f; return uint32 (melee * damage /100.0f); } uint32 Player::GetRangedCritDamageReduction(uint32 damage) const { - float ranged = GetRatingBonusValue(CR_CRIT_TAKEN_RANGED)*2.0f; - if (ranged>25.0f) ranged=25.0f; + float ranged = GetRatingBonusValue(CR_CRIT_TAKEN_RANGED)*2.2f; + if (ranged>33.0f) ranged=33.0f; return uint32 (ranged * damage /100.0f); } uint32 Player::GetSpellCritDamageReduction(uint32 damage) const { - float spell = GetRatingBonusValue(CR_CRIT_TAKEN_SPELL)*2.0f; - // In wow script resilience limited to 25% - if (spell>25.0f) - spell = 25.0f; + float spell = GetRatingBonusValue(CR_CRIT_TAKEN_SPELL)*2.2f; + // In wow script resilience limited to 33% + if (spell>33.0f) + spell = 33.0f; return uint32 (spell * damage / 100.0f); } @@ -4601,7 +4895,18 @@ float Player::OCTRegenMPPerSpirit() void Player::ApplyRatingMod(CombatRating cr, int32 value, bool apply) { - ApplyModUInt32Value(PLAYER_FIELD_COMBAT_RATING_1 + cr, value, apply); + m_baseRatingValue[cr]+=(apply ? value : -value); + + int32 amount = uint32(m_baseRatingValue[cr]); + // Apply bonus from SPELL_AURA_MOD_RATING_FROM_STAT + // stat used stored in miscValueB for this aura + AuraEffectList const& modRatingFromStat = GetAurasByType(SPELL_AURA_MOD_RATING_FROM_STAT); + for(AuraEffectList::const_iterator i = modRatingFromStat.begin();i != modRatingFromStat.end(); ++i) + if ((*i)->GetMiscValue() & (1<<cr)) + amount += int32(GetStat(Stats((*i)->GetMiscBValue())) * (*i)->GetAmount() / 100.0f); + if (amount < 0) + amount = 0; + SetUInt32Value(PLAYER_FIELD_COMBAT_RATING_1 + cr, uint32(amount)); float RatingCoeffecient = GetRatingCoefficient(cr); float RatingChange = 0.0f; @@ -4624,16 +4929,13 @@ void Player::ApplyRatingMod(CombatRating cr, int32 value, bool apply) UpdateBlockPercentage(); break; case CR_HIT_MELEE: - RatingChange = value / RatingCoeffecient; - m_modMeleeHitChance += apply ? RatingChange : -RatingChange; + UpdateMeleeHitChances(); break; case CR_HIT_RANGED: - RatingChange = value / RatingCoeffecient; - m_modRangedHitChance += apply ? RatingChange : -RatingChange; + UpdateRangedHitChances(); break; case CR_HIT_SPELL: - RatingChange = value / RatingCoeffecient; - m_modSpellHitChance += apply ? RatingChange : -RatingChange; + UpdateSpellHitChances(); break; case CR_CRIT_MELEE: if(affectStats) @@ -4684,12 +4986,16 @@ void Player::ApplyRatingMod(CombatRating cr, int32 value, bool apply) UpdateExpertise(OFF_ATTACK); } break; + case CR_ARMOR_PENETRATION: + if(affectStats) + UpdateArmorPenetration(amount); + break; } } void Player::SetRegularAttackTime() { - for(int i = 0; i < MAX_ATTACK; ++i) + for(uint8 i = 0; i < MAX_ATTACK; ++i) { Item *tmpitem = GetWeaponForAttack(WeaponAttackType(i)); if(tmpitem && !tmpitem->IsBroken()) @@ -4724,13 +5030,14 @@ bool Player::UpdateSkill(uint32 skill_id, uint32 step) if ((!max) || (!value) || (value >= max)) return false; - if (value*512 < max*GetMap()->urand(0,512)) + if (value*512 < max*urand(0,512)) { uint32 new_value = value+step; if(new_value > max) new_value = max; SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(new_value,max)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL,skill_id); return true; } @@ -4766,7 +5073,7 @@ bool Player::UpdateCraftSkill(uint32 spellid) if(spellEntry && spellEntry->Mechanic==MECHANIC_DISCOVERY) { if(uint32 discoveredSpell = GetSkillDiscoverySpell(_spell_idx->second->skillId, spellid, this)) - learnSpell(discoveredSpell); + learnSpell(discoveredSpell,false); } uint32 craft_skill_gain = sWorld.getConfig(CONFIG_SKILL_GAIN_CRAFTING); @@ -4793,6 +5100,7 @@ bool Player::UpdateGatherSkill(uint32 SkillId, uint32 SkillValue, uint32 RedLeve case SKILL_HERBALISM: case SKILL_LOCKPICKING: case SKILL_JEWELCRAFTING: + case SKILL_INSCRIPTION: return UpdateSkillPro(SkillId, SkillGainChance(SkillValue, RedLevel+100, RedLevel+50, RedLevel+25)*Multiplicator,gathering_skill_gain); case SKILL_SKINNING: if( sWorld.getConfig(CONFIG_SKILL_CHANCE_SKINNING_STEPS)==0) @@ -4821,6 +5129,11 @@ bool Player::UpdateFishingSkill() return UpdateSkillPro(SKILL_FISHING,chance*10,gathering_skill_gain); } +// levels sync. with spell requirement for skill levels to learn +// bonus abilities in sSkillLineAbilityStore +// Used only to avoid scan DBC at each skill grow +static uint32 bonusSkillLevels[] = {75,150,225,300,375,450}; + bool Player::UpdateSkillPro(uint16 SkillId, int32 Chance, uint32 step) { sLog.outDebug("UpdateSkillPro(SkillId %d, Chance %3.1f%%)", SkillId, Chance/10.0); @@ -4846,7 +5159,7 @@ bool Player::UpdateSkillPro(uint16 SkillId, int32 Chance, uint32 step) if ( !MaxValue || !SkillValue || SkillValue >= MaxValue ) return false; - int32 Roll = GetMap()->irand(1,1000); + int32 Roll = irand(1,1000); if ( Roll <= Chance ) { @@ -4855,6 +5168,15 @@ bool Player::UpdateSkillPro(uint16 SkillId, int32 Chance, uint32 step) new_value = MaxValue; SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(new_value,MaxValue)); + for(uint32* bsl = &bonusSkillLevels[0]; *bsl; ++bsl) + { + if((SkillValue < *bsl && new_value >= *bsl)) + { + learnSkillRewardedSpells( SkillId, new_value); + break; + } + } + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL,SkillId); sLog.outDebug("Player::UpdateSkillPro Chance=%3.1f%% taken", Chance/10.0); return true; } @@ -4902,22 +5224,8 @@ void Player::UpdateWeaponSkill (WeaponAttackType attType) UpdateAllCritPercentages(); } -void Player::UpdateCombatSkills(Unit *pVictim, WeaponAttackType attType, MeleeHitOutcome outcome, bool defence) +void Player::UpdateCombatSkills(Unit *pVictim, WeaponAttackType attType, bool defence) { -/* Not need, this checked on call this func from trigger system - switch(outcome) - { - case MELEE_HIT_CRIT: - case MELEE_HIT_DODGE: - case MELEE_HIT_PARRY: - case MELEE_HIT_BLOCK: - case MELEE_HIT_BLOCK_CRIT: - return; - - default: - break; - } -*/ uint32 plevel = getLevel(); // if defense than pVictim == attacker uint32 greylevel = Trinity::XP::GetGrayLevel(plevel); uint32 moblevel = pVictim->getLevelForTarget(this); @@ -5014,7 +5322,7 @@ void Player::UpdateSkillsToMaxSkillsForLevel() if (GetUInt32Value(PLAYER_SKILL_INDEX(i))) { uint32 pskill = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; - if( IsProfessionSkill(pskill) || pskill == SKILL_RIDING ) + if( IsProfessionOrRidingSkill(pskill)) continue; uint32 data = GetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i)); @@ -5042,7 +5350,12 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) if(i<PLAYER_MAX_SKILLS) //has skill { if(currVal) + { SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(currVal,maxVal)); + learnSkillRewardedSpells(id, currVal); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL,id); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SKILL_LEVEL,id); + } else //remove { // clear skill fields @@ -5050,27 +5363,11 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),0); SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); - // remove spells that depend on this skill when removing the skill - for (PlayerSpellMap::const_iterator itr = m_spells.begin(), next = m_spells.begin(); itr != m_spells.end(); itr = next) - { - ++next; - if(itr->second->state == PLAYERSPELL_REMOVED) - continue; - - SkillLineAbilityMap::const_iterator lower = spellmgr.GetBeginSkillLineAbilityMap(itr->first); - SkillLineAbilityMap::const_iterator upper = spellmgr.GetEndSkillLineAbilityMap(itr->first); - - for(SkillLineAbilityMap::const_iterator _spell_idx = lower; _spell_idx != upper; ++_spell_idx) - { - if (_spell_idx->second->skillId == id) - { - // this may remove more than one spell (dependents) - removeSpell(itr->first); - next = m_spells.begin(); - break; - } - } - } + // remove all spells that related to this skill + for (uint32 j=0; j<sSkillLineAbilityStore.GetNumRows(); ++j) + if(SkillLineAbilityEntry const *pAbility = sSkillLineAbilityStore.LookupEntry(j)) + if (pAbility->skillId==id) + removeSpell(spellmgr.GetFirstSpellInChain(pAbility->spellId)); } } else if(currVal) //add @@ -5090,24 +5387,26 @@ void Player::SetSkill(uint32 id, uint16 currVal, uint16 maxVal) else SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,0)); SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(currVal,maxVal)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_REACH_SKILL_LEVEL,id); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LEARN_SKILL_LEVEL,id); // apply skill bonuses SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); // temporary bonuses - AuraList const& mModSkill = GetAurasByType(SPELL_AURA_MOD_SKILL); - for(AuraList::const_iterator i = mModSkill.begin(); i != mModSkill.end(); ++i) - if ((*i)->GetModifier()->m_miscvalue == int32(id)) - (*i)->ApplyModifier(true); + AuraEffectList const& mModSkill = GetAurasByType(SPELL_AURA_MOD_SKILL); + for(AuraEffectList::const_iterator j = mModSkill.begin(); j != mModSkill.end(); ++j) + if ((*j)->GetMiscValue() == int32(id)) + (*j)->ApplyModifier(true); // permanent bonuses - AuraList const& mModSkillTalent = GetAurasByType(SPELL_AURA_MOD_SKILL_TALENT); - for(AuraList::const_iterator i = mModSkillTalent.begin(); i != mModSkillTalent.end(); ++i) - if ((*i)->GetModifier()->m_miscvalue == int32(id)) - (*i)->ApplyModifier(true); + AuraEffectList const& mModSkillTalent = GetAurasByType(SPELL_AURA_MOD_SKILL_TALENT); + for(AuraEffectList::const_iterator j = mModSkillTalent.begin(); j != mModSkillTalent.end(); ++j) + if ((*j)->GetMiscValue() == int32(id)) + (*j)->ApplyModifier(true); // Learn all spells for skill - learnSkillRewardedSpells(id); + learnSkillRewardedSpells(id, currVal); return; } } @@ -5205,12 +5504,28 @@ uint16 Player::GetPureSkillValue(uint32 skill) const return 0; } +int16 Player::GetSkillPermBonusValue(uint32 skill) const +{ + if(!skill) + return 0; + + for (uint8 i = 0; i < PLAYER_MAX_SKILLS; i++) + { + if ((GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF) == skill) + { + return SKILL_PERM_BONUS(GetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i))); + } + } + + return 0; +} + int16 Player::GetSkillTempBonusValue(uint32 skill) const { if(!skill) return 0; - for (int i = 0; i < PLAYER_MAX_SKILLS; i++) + for (uint8 i = 0; i < PLAYER_MAX_SKILLS; i++) { if ((GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF) == skill) { @@ -5221,11 +5536,12 @@ int16 Player::GetSkillTempBonusValue(uint32 skill) const return 0; } -void Player::SendInitialActionButtons() +void Player::SendInitialActionButtons() const { sLog.outDetail( "Initializing Action Buttons for '%u'", GetGUIDLow() ); - WorldPacket data(SMSG_ACTION_BUTTONS, (MAX_ACTION_BUTTONS*4)); + WorldPacket data(SMSG_ACTION_BUTTONS, 1+(MAX_ACTION_BUTTONS*4)); + data << uint8(0); // can be 0, 1, 2 for(int button = 0; button < MAX_ACTION_BUTTONS; ++button) { ActionButtonList::const_iterator itr = m_actionButtons.find(button); @@ -5245,12 +5561,12 @@ void Player::SendInitialActionButtons() sLog.outDetail( "Action Buttons for '%u' Initialized", GetGUIDLow() ); } -void Player::addActionButton(const uint8 button, const uint16 action, const uint8 type, const uint8 misc) +bool Player::addActionButton(const uint8 button, const uint16 action, const uint8 type, const uint8 misc) { if(button >= MAX_ACTION_BUTTONS) { sLog.outError( "Action %u not added into button %u for player %s: button must be < 132", action, button, GetName() ); - return; + return false; } // check cheating with adding non-known spells to action bar @@ -5259,13 +5575,13 @@ void Player::addActionButton(const uint8 button, const uint16 action, const uint if(!sSpellStore.LookupEntry(action)) { sLog.outError( "Action %u not added into button %u for player %s: spell not exist", action, button, GetName() ); - return; + return false; } if(!HasSpell(action)) { sLog.outError( "Action %u not added into button %u for player %s: player don't known this spell", action, button, GetName() ); - return; + return false; } } @@ -5283,6 +5599,7 @@ void Player::addActionButton(const uint8 button, const uint16 action, const uint }; sLog.outDetail( "Player '%u' Added Action '%u' to Button '%u'", GetGUIDLow(), action, button ); + return true; } void Player::removeActionButton(uint8 button) @@ -5299,11 +5616,6 @@ void Player::removeActionButton(uint8 button) sLog.outDetail( "Action Button '%u' Removed from Player '%u'", button, GetGUIDLow() ); } -void Player::SetDontMove(bool dontMove) -{ - m_dontMove = dontMove; -} - bool Player::SetPosition(float x, float y, float z, float orientation, bool teleport) { // prevent crash when a bad coord is sent by the client @@ -5313,38 +5625,41 @@ bool Player::SetPosition(float x, float y, float z, float orientation, bool tele return false; } - Map *m = GetMap(); + //if(movementInfo.flags & MOVEMENTFLAG_MOVING) + // mover->RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_MOVE); + //if(movementInfo.flags & MOVEMENTFLAG_TURNING) + // mover->RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_TURNING); + //AURA_INTERRUPT_FLAG_JUMP not sure - const float old_x = GetPositionX(); - const float old_y = GetPositionY(); - const float old_z = GetPositionZ(); - const float old_r = GetOrientation(); + bool turn = (GetOrientation() != orientation); + bool move2d = (teleport || GetPositionX() != x || GetPositionY() != y); - if( teleport || old_x != x || old_y != y || old_z != z || old_r != orientation ) + if(turn) + RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_TURNING); + + if(move2d || GetPositionZ() != z) { - if (teleport || old_x != x || old_y != y || old_z != z) - RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_MOVE | AURA_INTERRUPT_FLAG_TURNING); - else - RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_TURNING); + RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_MOVE); // move and update visible state if need - m->PlayerRelocation(this, x, y, z, orientation); + GetMap()->PlayerRelocation(this, x, y, z, orientation); // reread after Map::Relocation - m = GetMap(); - x = GetPositionX(); - y = GetPositionY(); - z = GetPositionZ(); + GetPosition(x, y, z); // group update - if(GetGroup() && (old_x != x || old_y != y)) + if(move2d && GetGroup()) SetGroupUpdateFlag(GROUP_UPDATE_FLAG_POSITION); - } - // code block for underwater state update - UpdateUnderwaterState(m, x, y, z); + // code block for underwater state update + UpdateUnderwaterState(GetMap(), x, y, z); - CheckExploreSystem(); + CheckExploreSystem(); + } + else if(turn) + { + SetOrientation(orientation); + } return true; } @@ -5358,19 +5673,45 @@ void Player::SaveRecallPosition() m_recallO = GetOrientation(); } -void Player::SendMessageToSet(WorldPacket *data, bool self, bool to_possessor) +void Player::SendMessageToSet(WorldPacket *data, bool self) { - MapManager::Instance().GetMap(GetMapId(), this)->MessageBroadcast(this, data, self, to_possessor); + Map * _map = IsInWorld() ? GetMap() : MapManager::Instance().FindMap(GetMapId(), GetInstanceId()); + if(_map) + { + _map->MessageBroadcast(this, data, self); + return; + } + + //if player is not in world and map in not created/already destroyed + //no need to create one, just send packet for itself! + if(self) + GetSession()->SendPacket(data); } -void Player::SendMessageToSetInRange(WorldPacket *data, float dist, bool self, bool to_possessor) +void Player::SendMessageToSetInRange(WorldPacket *data, float dist, bool self) { - MapManager::Instance().GetMap(GetMapId(), this)->MessageDistBroadcast(this, data, dist, self, to_possessor); + Map * _map = IsInWorld() ? GetMap() : MapManager::Instance().FindMap(GetMapId(), GetInstanceId()); + if(_map) + { + _map->MessageDistBroadcast(this, data, dist, self); + return; + } + + if(self) + GetSession()->SendPacket(data); } -void Player::SendMessageToSetInRange(WorldPacket *data, float dist, bool self, bool to_possessor, bool own_team_only) +void Player::SendMessageToSetInRange(WorldPacket *data, float dist, bool self, bool own_team_only) { - MapManager::Instance().GetMap(GetMapId(), this)->MessageDistBroadcast(this, data, dist, self, to_possessor, own_team_only); + Map * _map = IsInWorld() ? GetMap() : MapManager::Instance().FindMap(GetMapId(), GetInstanceId()); + if(_map) + { + _map->MessageDistBroadcast(this, data, dist, self, own_team_only); + return; + } + + if(self) + GetSession()->SendPacket(data); } void Player::SendDirectMessage(WorldPacket *data) @@ -5378,6 +5719,20 @@ void Player::SendDirectMessage(WorldPacket *data) GetSession()->SendPacket(data); } +void Player::SendCinematicStart(uint32 CinematicSequenceId) +{ + WorldPacket data(SMSG_TRIGGER_CINEMATIC, 4); + data << uint32(CinematicSequenceId); + SendDirectMessage(&data); +} + +void Player::SendMovieStart(uint32 MovieId) +{ + WorldPacket data(SMSG_TRIGGER_MOVIE, 4); + data << uint32(MovieId); + SendDirectMessage(&data); +} + void Player::CheckExploreSystem() { if (!isAlive()) @@ -5386,14 +5741,14 @@ void Player::CheckExploreSystem() if (isInFlight()) return; - uint16 areaFlag=MapManager::Instance().GetBaseMap(GetMapId())->GetAreaFlag(GetPositionX(),GetPositionY()); + uint16 areaFlag = GetBaseMap()->GetAreaFlag(GetPositionX(),GetPositionY(),GetPositionZ()); if(areaFlag==0xffff) return; int offset = areaFlag / 32; if(offset >= 128) { - sLog.outError("ERROR: Wrong area flag %u in map data for (X: %f Y: %f) point to field PLAYER_EXPLORED_ZONES_1 + %u ( %u must be < 64 ).",areaFlag,GetPositionX(),GetPositionY(),offset,offset); + sLog.outError("Wrong area flag %u in map data for (X: %f Y: %f) point to field PLAYER_EXPLORED_ZONES_1 + %u ( %u must be < 128 ).",areaFlag,GetPositionX(),GetPositionY(),offset,offset); return; } @@ -5404,6 +5759,8 @@ void Player::CheckExploreSystem() { SetUInt32Value(PLAYER_EXPLORED_ZONES_1 + offset, (uint32)(currFields | val)); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_EXPLORE_AREA); + AreaTableEntry const *p = GetAreaEntryByAreaFlagAndMap(areaFlag,GetMapId()); if(!p) { @@ -5462,7 +5819,7 @@ uint32 Player::TeamForRace(uint8 race) case 1: return HORDE; } - sLog.outError("Race %u have wrong team id in DBC: wrong DBC files?",uint32(race),rEntry->TeamID); + sLog.outError("Race %u have wrong teamid %u in DBC: wrong DBC files?",uint32(race),rEntry->TeamID); return ALLIANCE; } @@ -5484,438 +5841,33 @@ void Player::setFactionForRace(uint8 race) setFaction( getFactionForRace(race) ); } -void Player::UpdateReputation() const -{ - sLog.outDetail( "WORLD: Player::UpdateReputation" ); - - for(FactionStateList::const_iterator itr = m_factions.begin(); itr != m_factions.end(); ++itr) - { - SendFactionState(&(itr->second)); - } -} - -void Player::SendFactionState(FactionState const* faction) const -{ - if(faction->Flags & FACTION_FLAG_VISIBLE) //If faction is visible then update it - { - WorldPacket data(SMSG_SET_FACTION_STANDING, (16)); // last check 2.4.0 - data << (float) 0; // unk 2.4.0 - data << (uint32) 1; // count - // for - data << (uint32) faction->ReputationListID; - data << (uint32) faction->Standing; - // end for - GetSession()->SendPacket(&data); - } -} - -void Player::SendInitialReputations() -{ - WorldPacket data(SMSG_INITIALIZE_FACTIONS, (4+128*5)); - data << uint32 (0x00000080); - - RepListID a = 0; - - for (FactionStateList::const_iterator itr = m_factions.begin(); itr != m_factions.end(); ++itr) - { - // fill in absent fields - for (; a != itr->first; a++) - { - data << uint8 (0x00); - data << uint32 (0x00000000); - } - - // fill in encountered data - data << uint8 (itr->second.Flags); - data << uint32 (itr->second.Standing); - - ++a; - } - - // fill in absent fields - for (; a != 128; a++) - { - data << uint8 (0x00); - data << uint32 (0x00000000); - } - - GetSession()->SendPacket(&data); -} - -FactionState const* Player::GetFactionState( FactionEntry const* factionEntry) const -{ - FactionStateList::const_iterator itr = m_factions.find(factionEntry->reputationListID); - if (itr != m_factions.end()) - return &itr->second; - - return NULL; -} - -void Player::SetFactionAtWar(FactionState* faction, bool atWar) -{ - // not allow declare war to own faction - if(atWar && (faction->Flags & FACTION_FLAG_PEACE_FORCED) ) - return; - - // already set - if(((faction->Flags & FACTION_FLAG_AT_WAR) != 0) == atWar) - return; - - if( atWar ) - faction->Flags |= FACTION_FLAG_AT_WAR; - else - faction->Flags &= ~FACTION_FLAG_AT_WAR; - - faction->Changed = true; -} - -void Player::SetFactionInactive(FactionState* faction, bool inactive) -{ - // always invisible or hidden faction can't be inactive - if(inactive && ((faction->Flags & (FACTION_FLAG_INVISIBLE_FORCED|FACTION_FLAG_HIDDEN)) || !(faction->Flags & FACTION_FLAG_VISIBLE) ) ) - return; - - // already set - if(((faction->Flags & FACTION_FLAG_INACTIVE) != 0) == inactive) - return; - - if(inactive) - faction->Flags |= FACTION_FLAG_INACTIVE; - else - faction->Flags &= ~FACTION_FLAG_INACTIVE; - - faction->Changed = true; -} - -void Player::SetFactionVisibleForFactionTemplateId(uint32 FactionTemplateId) -{ - FactionTemplateEntry const*factionTemplateEntry = sFactionTemplateStore.LookupEntry(FactionTemplateId); - - if(!factionTemplateEntry) - return; - - SetFactionVisibleForFactionId(factionTemplateEntry->faction); -} - -void Player::SetFactionVisibleForFactionId(uint32 FactionId) -{ - FactionEntry const *factionEntry = sFactionStore.LookupEntry(FactionId); - if(!factionEntry) - return; - - if(factionEntry->reputationListID < 0) - return; - - FactionStateList::iterator itr = m_factions.find(factionEntry->reputationListID); - if (itr == m_factions.end()) - return; - - SetFactionVisible(&itr->second); -} - -void Player::SetFactionVisible(FactionState* faction) -{ - // always invisible or hidden faction can't be make visible - if(faction->Flags & (FACTION_FLAG_INVISIBLE_FORCED|FACTION_FLAG_HIDDEN)) - return; - - // already set - if(faction->Flags & FACTION_FLAG_VISIBLE) - return; - - faction->Flags |= FACTION_FLAG_VISIBLE; - faction->Changed = true; - - if(!m_session->PlayerLoading()) - { - // make faction visible in reputation list at client - WorldPacket data(SMSG_SET_FACTION_VISIBLE, 4); - data << faction->ReputationListID; - GetSession()->SendPacket(&data); - } -} - -void Player::SetInitialFactions() -{ - for(unsigned int i = 1; i < sFactionStore.GetNumRows(); i++) - { - FactionEntry const *factionEntry = sFactionStore.LookupEntry(i); - - if( factionEntry && (factionEntry->reputationListID >= 0)) - { - FactionState newFaction; - newFaction.ID = factionEntry->ID; - newFaction.ReputationListID = factionEntry->reputationListID; - newFaction.Standing = 0; - newFaction.Flags = GetDefaultReputationFlags(factionEntry); - newFaction.Changed = true; - - m_factions[newFaction.ReputationListID] = newFaction; - } - } -} - -uint32 Player::GetDefaultReputationFlags(const FactionEntry *factionEntry) const -{ - if (!factionEntry) - return 0; - - uint32 raceMask = getRaceMask(); - uint32 classMask = getClassMask(); - for (int i=0; i < 4; i++) - { - if( (factionEntry->BaseRepRaceMask[i] & raceMask) && - (factionEntry->BaseRepClassMask[i]==0 || - (factionEntry->BaseRepClassMask[i] & classMask) ) ) - return factionEntry->ReputationFlags[i]; - } - return 0; -} - -int32 Player::GetBaseReputation(const FactionEntry *factionEntry) const -{ - if (!factionEntry) - return 0; - - uint32 raceMask = getRaceMask(); - uint32 classMask = getClassMask(); - for (int i=0; i < 4; i++) - { - if( (factionEntry->BaseRepRaceMask[i] & raceMask) && - (factionEntry->BaseRepClassMask[i]==0 || - (factionEntry->BaseRepClassMask[i] & classMask) ) ) - return factionEntry->BaseRepValue[i]; - } - - // in faction.dbc exist factions with (RepListId >=0, listed in character reputation list) with all BaseRepRaceMask[i]==0 - return 0; -} - -int32 Player::GetReputation(uint32 faction_id) const -{ - FactionEntry const *factionEntry = sFactionStore.LookupEntry(faction_id); - - if (!factionEntry) - { - sLog.outError("Player::GetReputation: Can't get reputation of %s for unknown faction (faction template id) #%u.",GetName(), faction_id); - return 0; - } - - return GetReputation(factionEntry); -} - -int32 Player::GetReputation(const FactionEntry *factionEntry) const -{ - // Faction without recorded reputation. Just ignore. - if(!factionEntry) - return 0; - - FactionStateList::const_iterator itr = m_factions.find(factionEntry->reputationListID); - if (itr != m_factions.end()) - return GetBaseReputation(factionEntry) + itr->second.Standing; - - return 0; -} - ReputationRank Player::GetReputationRank(uint32 faction) const { - FactionEntry const*factionEntry = sFactionStore.LookupEntry(faction); - if(!factionEntry) - return MIN_REPUTATION_RANK; - - return GetReputationRank(factionEntry); -} - -ReputationRank Player::ReputationToRank(int32 standing) const -{ - int32 Limit = Reputation_Cap + 1; - for (int i = MAX_REPUTATION_RANK-1; i >= MIN_REPUTATION_RANK; --i) - { - Limit -= ReputationRank_Length[i]; - if (standing >= Limit ) - return ReputationRank(i); - } - return MIN_REPUTATION_RANK; -} - -ReputationRank Player::GetReputationRank(const FactionEntry *factionEntry) const -{ - int32 Reputation = GetReputation(factionEntry); - return ReputationToRank(Reputation); + FactionEntry const* factionEntry = sFactionStore.LookupEntry(faction); + return GetReputationMgr().GetRank(factionEntry); } -ReputationRank Player::GetBaseReputationRank(const FactionEntry *factionEntry) const -{ - int32 Reputation = GetBaseReputation(factionEntry); - return ReputationToRank(Reputation); -} - -bool Player::ModifyFactionReputation(uint32 FactionTemplateId, int32 DeltaReputation) -{ - FactionTemplateEntry const* factionTemplateEntry = sFactionTemplateStore.LookupEntry(FactionTemplateId); - - if(!factionTemplateEntry) - { - sLog.outError("Player::ModifyFactionReputation: Can't update reputation of %s for unknown faction (faction template id) #%u.", GetName(), FactionTemplateId); - return false; - } - - FactionEntry const *factionEntry = sFactionStore.LookupEntry(factionTemplateEntry->faction); - - // Faction without recorded reputation. Just ignore. - if(!factionEntry) - return false; - - return ModifyFactionReputation(factionEntry, DeltaReputation); -} - -bool Player::ModifyFactionReputation(FactionEntry const* factionEntry, int32 standing) -{ - SimpleFactionsList const* flist = GetFactionTeamList(factionEntry->ID); - if (flist) - { - bool res = false; - for (SimpleFactionsList::const_iterator itr = flist->begin();itr != flist->end();++itr) - { - FactionEntry const *factionEntryCalc = sFactionStore.LookupEntry(*itr); - if(factionEntryCalc) - res = ModifyOneFactionReputation(factionEntryCalc, standing); - } - return res; - } - else - return ModifyOneFactionReputation(factionEntry, standing); -} - -bool Player::ModifyOneFactionReputation(FactionEntry const* factionEntry, int32 standing) -{ - FactionStateList::iterator itr = m_factions.find(factionEntry->reputationListID); - if (itr != m_factions.end()) - { - int32 BaseRep = GetBaseReputation(factionEntry); - int32 new_rep = BaseRep + itr->second.Standing + standing; - - if (new_rep > Reputation_Cap) - new_rep = Reputation_Cap; - else - if (new_rep < Reputation_Bottom) - new_rep = Reputation_Bottom; - - if(ReputationToRank(new_rep) <= REP_HOSTILE) - SetFactionAtWar(&itr->second,true); - - itr->second.Standing = new_rep - BaseRep; - itr->second.Changed = true; - - SetFactionVisible(&itr->second); - - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) - { - if(uint32 questid = GetQuestSlotQuestId(i)) - { - Quest const* qInfo = objmgr.GetQuestTemplate(questid); - if( qInfo && qInfo->GetRepObjectiveFaction() == factionEntry->ID ) - { - QuestStatusData& q_status = mQuestStatus[questid]; - if( q_status.m_status == QUEST_STATUS_INCOMPLETE ) - { - if(GetReputation(factionEntry) >= qInfo->GetRepObjectiveValue()) - if ( CanCompleteQuest( questid ) ) - CompleteQuest( questid ); - } - else if( q_status.m_status == QUEST_STATUS_COMPLETE ) - { - if(GetReputation(factionEntry) < qInfo->GetRepObjectiveValue()) - IncompleteQuest( questid ); - } - } - } - } - - SendFactionState(&(itr->second)); - - return true; - } - return false; -} - -bool Player::SetFactionReputation(uint32 FactionTemplateId, int32 standing) -{ - FactionTemplateEntry const* factionTemplateEntry = sFactionTemplateStore.LookupEntry(FactionTemplateId); - - if(!factionTemplateEntry) - { - sLog.outError("Player::SetFactionReputation: Can't set reputation of %s for unknown faction (faction template id) #%u.", GetName(), FactionTemplateId); - return false; - } - - FactionEntry const *factionEntry = sFactionStore.LookupEntry(factionTemplateEntry->faction); - - // Faction without recorded reputation. Just ignore. - if(!factionEntry) - return false; - - return SetFactionReputation(factionEntry, standing); -} - -bool Player::SetFactionReputation(FactionEntry const* factionEntry, int32 standing) +//Calculate total reputation percent player gain with quest/creature level +int32 Player::CalculateReputationGain(uint32 creatureOrQuestLevel, int32 rep, int32 faction, bool for_quest) { - SimpleFactionsList const* flist = GetFactionTeamList(factionEntry->ID); - if (flist) - { - bool res = false; - for (SimpleFactionsList::const_iterator itr = flist->begin();itr != flist->end();++itr) - { - FactionEntry const *factionEntryCalc = sFactionStore.LookupEntry(*itr); - if(factionEntryCalc) - res = SetOneFactionReputation(factionEntryCalc, standing); - } - return res; - } - else - return SetOneFactionReputation(factionEntry, standing); -} + float percent = 100.0f; -bool Player::SetOneFactionReputation(FactionEntry const* factionEntry, int32 standing) -{ - FactionStateList::iterator itr = m_factions.find(factionEntry->reputationListID); - if (itr != m_factions.end()) - { - if (standing > Reputation_Cap) - standing = Reputation_Cap; - else - if (standing < Reputation_Bottom) - standing = Reputation_Bottom; + float rate = for_quest ? sWorld.getRate(RATE_REPUTATION_LOWLEVEL_QUEST) : sWorld.getRate(RATE_REPUTATION_LOWLEVEL_KILL); - int32 BaseRep = GetBaseReputation(factionEntry); - itr->second.Standing = standing - BaseRep; - itr->second.Changed = true; + if (rate != 1.0f && creatureOrQuestLevel <= MaNGOS::XP::GetGrayLevel(getLevel())) + percent *= rate; - SetFactionVisible(&itr->second); + float repMod = GetTotalAuraModifier(SPELL_AURA_MOD_REPUTATION_GAIN); - if(ReputationToRank(standing) <= REP_HOSTILE) - SetFactionAtWar(&itr->second,true); - - SendFactionState(&(itr->second)); - return true; - } - return false; -} - -//Calculate total reputation percent player gain with quest/creature level -int32 Player::CalculateReputationGain(uint32 creatureOrQuestLevel, int32 rep, bool for_quest) -{ - // for grey creature kill received 20%, in other case 100. - int32 percent = (!for_quest && (creatureOrQuestLevel <= Trinity::XP::GetGrayLevel(getLevel()))) ? 20 : 100; - - int32 repMod = GetTotalAuraModifier(SPELL_AURA_MOD_REPUTATION_GAIN); + if (!for_quest) + repMod += GetTotalAuraModifierByMiscValue(SPELL_AURA_MOD_FACTION_REPUTATION_GAIN, faction); percent += rep > 0 ? repMod : -repMod; - if(percent <=0) + if (percent <= 0.0f) return 0; - return int32(sWorld.getRate(RATE_REPUTATION_GAIN)*rep*percent/100); + return int32(rep*percent*0.01f); } //Calculates how many reputation points player gains in victim's enemy factions @@ -5934,37 +5886,37 @@ void Player::RewardReputation(Unit *pVictim, float rate) if(Rep->repfaction1 && (!Rep->team_dependent || GetTeam()==ALLIANCE)) { - int32 donerep1 = CalculateReputationGain(pVictim->getLevel(),Rep->repvalue1,false); + int32 donerep1 = CalculateReputationGain(pVictim->getLevel(), Rep->repvalue1, Rep->repfaction1, false); donerep1 = int32(donerep1*rate); FactionEntry const *factionEntry1 = sFactionStore.LookupEntry(Rep->repfaction1); - uint32 current_reputation_rank1 = GetReputationRank(factionEntry1); - if(factionEntry1 && current_reputation_rank1 <= Rep->reputation_max_cap1) - ModifyFactionReputation(factionEntry1, donerep1); + uint32 current_reputation_rank1 = GetReputationMgr().GetRank(factionEntry1); + if (factionEntry1 && current_reputation_rank1 <= Rep->reputation_max_cap1) + GetReputationMgr().ModifyReputation(factionEntry1, donerep1); // Wiki: Team factions value divided by 2 - if(Rep->is_teamaward1) + if (factionEntry1 && Rep->is_teamaward1) { FactionEntry const *team1_factionEntry = sFactionStore.LookupEntry(factionEntry1->team); if(team1_factionEntry) - ModifyFactionReputation(team1_factionEntry, donerep1 / 2); + GetReputationMgr().ModifyReputation(team1_factionEntry, donerep1 / 2); } } if(Rep->repfaction2 && (!Rep->team_dependent || GetTeam()==HORDE)) { - int32 donerep2 = CalculateReputationGain(pVictim->getLevel(),Rep->repvalue2,false); + int32 donerep2 = CalculateReputationGain(pVictim->getLevel(), Rep->repvalue2, Rep->repfaction2, false); donerep2 = int32(donerep2*rate); FactionEntry const *factionEntry2 = sFactionStore.LookupEntry(Rep->repfaction2); - uint32 current_reputation_rank2 = GetReputationRank(factionEntry2); - if(factionEntry2 && current_reputation_rank2 <= Rep->reputation_max_cap2) - ModifyFactionReputation(factionEntry2, donerep2); + uint32 current_reputation_rank2 = GetReputationMgr().GetRank(factionEntry2); + if (factionEntry2 && current_reputation_rank2 <= Rep->reputation_max_cap2) + GetReputationMgr().ModifyReputation(factionEntry2, donerep2); // Wiki: Team factions value divided by 2 - if(Rep->is_teamaward2) + if (factionEntry2 && Rep->is_teamaward2) { FactionEntry const *team2_factionEntry = sFactionStore.LookupEntry(factionEntry2->team); if(team2_factionEntry) - ModifyFactionReputation(team2_factionEntry, donerep2 / 2); + GetReputationMgr().ModifyReputation(team2_factionEntry, donerep2 / 2); } } } @@ -5973,14 +5925,14 @@ void Player::RewardReputation(Unit *pVictim, float rate) void Player::RewardReputation(Quest const *pQuest) { // quest reputation reward/loss - for(int i = 0; i < QUEST_REPUTATIONS_COUNT; ++i) + for(uint8 i = 0; i < QUEST_REPUTATIONS_COUNT; ++i) { if(pQuest->RewRepFaction[i] && pQuest->RewRepValue[i] ) { - int32 rep = CalculateReputationGain(pQuest->GetQuestLevel(),pQuest->RewRepValue[i],true); + int32 rep = CalculateReputationGain(GetQuestLevel(pQuest), pQuest->RewRepValue[i], pQuest->RewRepFaction[i], true); FactionEntry const* factionEntry = sFactionStore.LookupEntry(pQuest->RewRepFaction[i]); if(factionEntry) - ModifyFactionReputation(factionEntry, rep); + GetReputationMgr().ModifyReputation(factionEntry, rep); } } @@ -6098,12 +6050,7 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt victim_guid = 0; // Don't show HK: <rank> message, only log. } - if(k_level <= 5) - k_grey = 0; - else if( k_level <= 39 ) - k_grey = k_level - 5 - k_level/10; - else - k_grey = k_level - 1 - k_level/5; + k_grey = Trinity::XP::GetGrayLevel(k_level); if(v_level<=k_grey) return false; @@ -6119,6 +6066,9 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt ApplyModUInt32Value(PLAYER_FIELD_KILLS, 1, true); // and those in a lifetime ApplyModUInt32Value(PLAYER_FIELD_LIFETIME_HONORBALE_KILLS, 1, true); + UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_EARN_HONORABLE_KILL); + UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_HK_CLASS, pVictim->getClass()); + UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_HK_RACE, pVictim->getRace()); } else { @@ -6139,7 +6089,9 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt if(groupsize > 1) honor /= groupsize; - honor *= (((float)GetMap()->urand(8,12))/10); // approx honor: 80% - 120% of real honor + // apply honor multiplier from aura (not stacking-get highest) + honor = int32(float(honor) * (float(GetMaxPositiveAuraModifier(SPELL_AURA_MOD_HONOR_GAIN_PCT))+100.0f)/100.0f); + honor *= (((float)urand(8,12))/10); // approx honor: 80% - 120% of real honor } // honor - for show honor points in log @@ -6168,8 +6120,8 @@ bool Player::RewardHonor(Unit *uVictim, uint32 groupsize, float honor, bool pvpt { // Check if allowed to receive it in current map uint8 MapType = sWorld.getConfig(CONFIG_PVP_TOKEN_MAP_TYPE); - if( (MapType == 1 && !InBattleGround() && !HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP)) - || (MapType == 2 && !HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP)) + if( (MapType == 1 && !InBattleGround() && !HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP)) + || (MapType == 2 && !HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP)) || (MapType == 3 && !InBattleGround()) ) return true; @@ -6227,24 +6179,18 @@ void Player::ModifyArenaPoints( int32 value ) uint32 Player::GetGuildIdFromDB(uint64 guid) { - std::ostringstream ss; - ss<<"SELECT guildid FROM guild_member WHERE guid='"<<guid<<"'"; - QueryResult *result = CharacterDatabase.Query( ss.str().c_str() ); - if( result ) - { - uint32 v = result->Fetch()[0].GetUInt32(); - delete result; - return v; - } - else + QueryResult* result = CharacterDatabase.PQuery("SELECT guildid FROM guild_member WHERE guid='%u'", GUID_LOPART(guid)); + if(!result) return 0; + + uint32 id = result->Fetch()[0].GetUInt32(); + delete result; + return id; } uint32 Player::GetRankFromDB(uint64 guid) { - std::ostringstream ss; - ss<<"SELECT rank FROM guild_member WHERE guid='"<<guid<<"'"; - QueryResult *result = CharacterDatabase.Query( ss.str().c_str() ); + QueryResult *result = CharacterDatabase.PQuery( "SELECT rank FROM guild_member WHERE guid='%u'", GUID_LOPART(guid) ); if( result ) { uint32 v = result->Fetch()[0].GetUInt32(); @@ -6268,10 +6214,8 @@ uint32 Player::GetArenaTeamIdFromDB(uint64 guid, uint8 type) uint32 Player::GetZoneIdFromDB(uint64 guid) { - std::ostringstream ss; - - ss<<"SELECT zone FROM characters WHERE guid='"<<GUID_LOPART(guid)<<"'"; - QueryResult *result = CharacterDatabase.Query( ss.str().c_str() ); + uint32 guidLow = GUID_LOPART(guid); + QueryResult *result = CharacterDatabase.PQuery( "SELECT zone FROM characters WHERE guid='%u'", guidLow ); if (!result) return 0; Field* fields = result->Fetch(); @@ -6281,22 +6225,19 @@ uint32 Player::GetZoneIdFromDB(uint64 guid) if (!zone) { // stored zone is zero, use generic and slow zone detection - ss.str(""); - ss<<"SELECT map,position_x,position_y FROM characters WHERE guid='"<<GUID_LOPART(guid)<<"'"; - result = CharacterDatabase.Query(ss.str().c_str()); + result = CharacterDatabase.PQuery("SELECT map,position_x,position_y,position_z FROM characters WHERE guid='%u'", guidLow); if( !result ) return 0; fields = result->Fetch(); - uint32 map = fields[0].GetUInt32(); + uint32 map = fields[0].GetUInt32(); float posx = fields[1].GetFloat(); float posy = fields[2].GetFloat(); + float posz = fields[3].GetFloat(); delete result; - zone = MapManager::Instance().GetZoneId(map,posx,posy); + zone = MapManager::Instance().GetZoneId(map,posx,posy,posz); - ss.str(""); - ss << "UPDATE characters SET zone='"<<zone<<"' WHERE guid='"<<GUID_LOPART(guid)<<"'"; - CharacterDatabase.Execute(ss.str().c_str()); + CharacterDatabase.PExecute("UPDATE characters SET zone='%u' WHERE guid='%u'", zone, guidLow); } return zone; @@ -6309,43 +6250,31 @@ void Player::UpdateArea(uint32 newArea) m_areaUpdateId = newArea; AreaTableEntry const* area = GetAreaEntryByAreaID(newArea); - - if(area && (area->flags & AREA_FLAG_ARENA)) - { - if(!isGameMaster()) - SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP); - } - else - { - // remove ffa flag only if not ffapvp realm - // removal in sanctuaries and capitals is handled in zone update - if(HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP) && !sWorld.IsFFAPvPRealm()) - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_FFA_PVP); - } + pvpInfo.inFFAPvPArea = area && (area->flags & AREA_FLAG_ARENA); + UpdatePvPState(true); UpdateAreaDependentAuras(newArea); } -void Player::UpdateZone(uint32 newZone) +void Player::UpdateZone(uint32 newZone, uint32 newArea) { - uint32 oldZoneId = m_zoneUpdateId; + if(m_zoneUpdateId != newZone) + { + sOutdoorPvPMgr.HandlePlayerLeaveZone(this, m_zoneUpdateId); + sOutdoorPvPMgr.HandlePlayerEnterZone(this, newZone); + SendInitWorldStates(newZone, newArea); // only if really enters to new zone, not just area change, works strange... + } + m_zoneUpdateId = newZone; m_zoneUpdateTimer = ZONE_UPDATE_INTERVAL; // zone changed, so area changed as well, update it - UpdateArea(GetAreaId()); + UpdateArea(newArea); AreaTableEntry const* zone = GetAreaEntryByAreaID(newZone); if(!zone) return; - // inform outdoor pvp - if(oldZoneId != m_zoneUpdateId) - { - sOutdoorPvPMgr.HandlePlayerLeaveZone(this, oldZoneId); - sOutdoorPvPMgr.HandlePlayerEnterZone(this, m_zoneUpdateId); - } - if (sWorld.getConfig(CONFIG_WEATHER)) { Weather *wth = sWorld.FindWeather(zone->ID); @@ -6363,32 +6292,34 @@ void Player::UpdateZone(uint32 newZone) } } - pvpInfo.inHostileArea = - GetTeam() == ALLIANCE && zone->team == AREATEAM_HORDE || - GetTeam() == HORDE && zone->team == AREATEAM_ALLY || - sWorld.IsPvPRealm() && zone->team == AREATEAM_NONE || - InBattleGround(); // overwrite for battlegrounds, maybe batter some zone flags but current known not 100% fit to this - - if(pvpInfo.inHostileArea) // in hostile area + // in PvP, any not controlled zone (except zone->team == 6, default case) + // in PvE, only opposition team capital + switch(zone->team) { - if(!IsPvP() || pvpInfo.endTimer != 0) - UpdatePvP(true, true); - } - else // in friendly area - { - if(IsPvP() && !HasFlag(PLAYER_FLAGS,PLAYER_FLAGS_IN_PVP) && pvpInfo.endTimer == 0) - pvpInfo.endTimer = time(0); // start toggle-off + case AREATEAM_ALLY: + pvpInfo.inHostileArea = GetTeam() != ALLIANCE && (sWorld.IsPvPRealm() || zone->flags & AREA_FLAG_CAPITAL); + break; + case AREATEAM_HORDE: + pvpInfo.inHostileArea = GetTeam() != HORDE && (sWorld.IsPvPRealm() || zone->flags & AREA_FLAG_CAPITAL); + break; + case AREATEAM_NONE: + // overwrite for battlegrounds, maybe batter some zone flags but current known not 100% fit to this + pvpInfo.inHostileArea = sWorld.IsPvPRealm() || InBattleGround() || (zone->flags & AREA_FLAG_OUTDOOR_PVP); + break; + default: // 6 in fact + pvpInfo.inHostileArea = false; + break; } - if(zone->flags & AREA_FLAG_SANCTUARY) // in sanctuary + pvpInfo.inNoPvPArea = false; + if((zone->flags & AREA_FLAG_SANCTUARY) || zone->mapid == 609) // in sanctuary { - SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_SANCTUARY); - if(sWorld.IsFFAPvPRealm()) - RemoveFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_SANCTUARY); + pvpInfo.inNoPvPArea = true; } else { - RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_SANCTUARY); + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_SANCTUARY); } if(zone->flags & AREA_FLAG_CAPITAL) // in capital city @@ -6396,9 +6327,7 @@ void Player::UpdateZone(uint32 newZone) SetFlag(PLAYER_FLAGS, PLAYER_FLAGS_RESTING); SetRestType(REST_TYPE_IN_CITY); InnEnter(time(0),GetMapId(),0,0,0); - - if(sWorld.IsFFAPvPRealm()) - RemoveFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); + pvpInfo.inNoPvPArea = true; } else // anywhere else { @@ -6410,28 +6339,26 @@ void Player::UpdateZone(uint32 newZone) { RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_RESTING); SetRestType(REST_TYPE_NO); - - if(sWorld.IsFFAPvPRealm()) - SetFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); } } else // not in tavern (leave city then) { RemoveFlag(PLAYER_FLAGS, PLAYER_FLAGS_RESTING); SetRestType(REST_TYPE_NO); - - // Set player to FFA PVP when not in rested environment. - if(sWorld.IsFFAPvPRealm()) - SetFlag(PLAYER_FLAGS,PLAYER_FLAGS_FFA_PVP); } } } + UpdatePvPState(); + // remove items with area/map limitations (delete only for alive player to allow back in ghost mode) // if player resurrected at teleport this will be applied in resurrect code if(isAlive()) DestroyZoneLimitedItem( true, newZone ); + // check some item equip limitations (in result lost CanTitanGrip at talent reset, for example) + AutoUnequipOffhandIfNeed(); + // recent client version not send leave/join channel packets for built-in local channels UpdateLocalChannels( newZone ); @@ -6449,7 +6376,7 @@ void Player::CheckDuelDistance(time_t currTime) return; uint64 duelFlagGUID = GetUInt64Value(PLAYER_DUEL_ARBITER); - GameObject* obj = ObjectAccessor::GetGameObject(*this, duelFlagGUID); + GameObject* obj = GetMap()->GetGameObject(duelFlagGUID); if(!obj) return; @@ -6481,7 +6408,7 @@ void Player::CheckDuelDistance(time_t currTime) bool Player::IsOutdoorPvPActive() { - return (isAlive() && !HasInvisibilityAura() && !HasStealthAura() && (HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_IN_PVP) || sWorld.IsPvPRealm()) && !HasUnitMovementFlag(MOVEMENTFLAG_FLYING2) && !isInFlight()); + return (isAlive() && !HasInvisibilityAura() && !HasStealthAura() && (HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_IN_PVP) || sWorld.IsPvPRealm()) && !HasUnitMovementFlag(MOVEMENTFLAG_FLYING) && !isInFlight()); } void Player::DuelComplete(DuelCompleteType type) @@ -6490,6 +6417,8 @@ void Player::DuelComplete(DuelCompleteType type) if(!duel) return; + sLog.outDebug("Duel Complete %s %s", GetName(), duel->opponent->GetName()); + WorldPacket data(SMSG_DUEL_COMPLETE, (1)); data << (uint8)((type != DUEL_INTERUPTED) ? 1 : 0); GetSession()->SendPacket(&data); @@ -6504,48 +6433,40 @@ void Player::DuelComplete(DuelCompleteType type) SendMessageToSet(&data,true); } - // cool-down duel spell - /*data.Initialize(SMSG_SPELL_COOLDOWN, 17); - - data<<GetGUID(); - data<<uint8(0x0); - - data<<(uint32)7266; - data<<uint32(0x0); - GetSession()->SendPacket(&data); - data.Initialize(SMSG_SPELL_COOLDOWN, 17); - data<<duel->opponent->GetGUID(); - data<<uint8(0x0); - data<<(uint32)7266; - data<<uint32(0x0); - duel->opponent->GetSession()->SendPacket(&data);*/ + if (type == DUEL_WON) + { + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_LOSE_DUEL, 1); + if (duel->opponent) + duel->opponent->GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_WIN_DUEL, 1); + } //Remove Duel Flag object - GameObject* obj = ObjectAccessor::GetGameObject(*this, GetUInt64Value(PLAYER_DUEL_ARBITER)); + GameObject* obj = GetMap()->GetGameObject(GetUInt64Value(PLAYER_DUEL_ARBITER)); if(obj) duel->initiator->RemoveGameObject(obj,true); /* remove auras */ - std::vector<uint32> auras2remove; - AuraMap const& vAuras = duel->opponent->GetAuras(); - for (AuraMap::const_iterator i = vAuras.begin(); i != vAuras.end(); ++i) + AuraMap &itsAuras = duel->opponent->GetAuras(); + for(AuraMap::iterator i = itsAuras.begin(); i != itsAuras.end();) { if (!i->second->IsPositive() && i->second->GetCasterGUID() == GetGUID() && i->second->GetAuraApplyTime() >= duel->startTime) - auras2remove.push_back(i->second->GetId()); + { + duel->opponent->RemoveAura(i); + } + else + ++i; } - for(size_t i=0; i<auras2remove.size(); i++) - duel->opponent->RemoveAurasDueToSpell(auras2remove[i]); - - auras2remove.clear(); - AuraMap const& auras = GetAuras(); - for (AuraMap::const_iterator i = auras.begin(); i != auras.end(); ++i) + AuraMap &myAuras = GetAuras(); + for(AuraMap::iterator i = myAuras.begin(); i != myAuras.end();) { if (!i->second->IsPositive() && i->second->GetCasterGUID() == duel->opponent->GetGUID() && i->second->GetAuraApplyTime() >= duel->startTime) - auras2remove.push_back(i->second->GetId()); + { + RemoveAura(i); + } + else + ++i; } - for(size_t i=0; i<auras2remove.size(); i++) - RemoveAurasDueToSpell(auras2remove[i]); // cleanup combo points if(GetComboTarget()==duel->opponent->GetGUID()) @@ -6582,7 +6503,7 @@ void Player::_ApplyItemMods(Item *item, uint8 slot,bool apply) return; // not apply mods for broken item - if(item->IsBroken() && apply) + if(item->IsBroken()) return; ItemPrototype const *proto = item->GetProto(); @@ -6592,7 +6513,12 @@ void Player::_ApplyItemMods(Item *item, uint8 slot,bool apply) sLog.outDetail("applying mods for item %u ",item->GetGUIDLow()); - uint32 attacktype = Player::GetAttackBySlot(slot); + uint8 attacktype = Player::GetAttackBySlot(slot); + + //check disarm only on mod apply to allow remove item mods + if (!CanUseAttackType(attacktype) ) + return; + if(attacktype < MAX_ATTACK) _ApplyWeaponDependentAuraMods(item,WeaponAttackType(attacktype),apply); @@ -6610,19 +6536,38 @@ void Player::_ApplyItemMods(Item *item, uint8 slot,bool apply) sLog.outDebug("_ApplyItemMods complete."); } -void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) +void Player::_ApplyItemBonuses(ItemPrototype const *proto, uint8 slot, bool apply) { if(slot >= INVENTORY_SLOT_BAG_END || !proto) return; - for (int i = 0; i < 10; i++) + ScalingStatDistributionEntry const *ssd = proto->ScalingStatDistribution ? sScalingStatDistributionStore.LookupEntry(proto->ScalingStatDistribution) : 0; + ScalingStatValuesEntry const *ssv = proto->ScalingStatValue ? sScalingStatValuesStore.LookupEntry(getLevel()) : 0; + + for (uint8 i = 0; i < MAX_ITEM_PROTO_STATS; ++i) { - float val = float (proto->ItemStat[i].ItemStatValue); + uint32 statType = 0; + int32 val = 0; + // If set ScalingStatDistribution need get stats and values from it + if (ssd && ssv) + { + if (ssd->StatMod[i] < 0) + continue; + statType = ssd->StatMod[i]; + val = (ssv->getssdMultiplier(proto->ScalingStatValue) * ssd->Modifier[i]) / 10000; + } + else + { + if (i >= proto->StatsCount) + continue; + statType = proto->ItemStat[i].ItemStatType; + val = proto->ItemStat[i].ItemStatValue; + } - if(val==0) + if(val == 0) continue; - switch (proto->ItemStat[i].ItemStatType) + switch (statType) { case ITEM_MOD_MANA: HandleStatModifier(UNIT_MOD_MANA, BASE_VALUE, float(val), apply); @@ -6740,11 +6685,47 @@ void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) case ITEM_MOD_EXPERTISE_RATING: ApplyRatingMod(CR_EXPERTISE, int32(val), apply); break; + case ITEM_MOD_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER, TOTAL_VALUE, float(val), apply); + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(val), apply); + break; + case ITEM_MOD_RANGED_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(val), apply); + break; + case ITEM_MOD_FERAL_ATTACK_POWER: + ApplyFeralAPBonus(int32(val), apply); + break; + case ITEM_MOD_SPELL_HEALING_DONE: + ApplySpellHealingBonus(int32(val), apply); + break; + case ITEM_MOD_SPELL_DAMAGE_DONE: + ApplySpellDamageBonus(int32(val), apply); + break; + case ITEM_MOD_MANA_REGENERATION: + ApplyManaRegenBonus(int32(val), apply); + break; + case ITEM_MOD_ARMOR_PENETRATION_RATING: + ApplyRatingMod(CR_ARMOR_PENETRATION, int32(val), apply); + break; + case ITEM_MOD_SPELL_POWER: + ApplySpellHealingBonus(int32(val), apply); + ApplySpellDamageBonus(int32(val), apply); + break; } } - if (proto->Armor) - HandleStatModifier(UNIT_MOD_ARMOR, BASE_VALUE, float(proto->Armor), apply); + // If set ScalingStatValue armor get it or use item armor + uint32 armor = proto->Armor; + if (ssv) + { + if (uint32 ssvarmor = ssv->getArmorMod(proto->ScalingStatValue)) + armor = ssvarmor; + } + // Add armor bonus from ArmorDamageModifier if > 0 + if (proto->ArmorDamageModifier > 0) + armor+=proto->ArmorDamageModifier; + if (armor) + HandleStatModifier(UNIT_MOD_ARMOR, BASE_VALUE, float(armor), apply); if (proto->Block) HandleBaseModValue(SHIELD_BLOCK_VALUE, FLAT_MOD, float(proto->Block), apply); @@ -6781,20 +6762,47 @@ void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) attType = OFF_ATTACK; } - if (proto->Damage[0].DamageMin > 0 ) + float minDamage = proto->Damage[0].DamageMin; + float maxDamage = proto->Damage[0].DamageMax; + int32 extraDPS = 0; + // If set dpsMod in ScalingStatValue use it for min (70% from average), max (130% from average) damage + if (ssv) { - damage = apply ? proto->Damage[0].DamageMin : BASE_MINDAMAGE; + if (extraDPS = ssv->getDPSMod(proto->ScalingStatValue)) + { + float average = extraDPS * proto->Delay / 1000.0f; + minDamage = 0.7f * average; + maxDamage = 1.3f * average; + } + } + if (minDamage > 0 ) + { + damage = apply ? minDamage : BASE_MINDAMAGE; SetBaseWeaponDamage(attType, MINDAMAGE, damage); //sLog.outError("applying mindam: assigning %f to weapon mindamage, now is: %f", damage, GetWeaponDamageRange(attType, MINDAMAGE)); } - if (proto->Damage[0].DamageMax > 0 ) + if (maxDamage > 0 ) { - damage = apply ? proto->Damage[0].DamageMax : BASE_MAXDAMAGE; + damage = apply ? maxDamage : BASE_MAXDAMAGE; SetBaseWeaponDamage(attType, MAXDAMAGE, damage); } - if(!IsUseEquipedWeapon(slot==EQUIPMENT_SLOT_MAINHAND)) + // Apply feral bonus from ScalingStatValue if set + if (ssv) + { + if (int32 feral_bonus = ssv->getFeralBonus(proto->ScalingStatValue)) + ApplyFeralAPBonus(feral_bonus, apply); + } + // Druids get feral AP bonus from weapon dps (lso use DPS from ScalingStatValue) + if(getClass() == CLASS_DRUID) + { + int32 feral_bonus = proto->getFeralBonus(extraDPS); + if (feral_bonus > 0) + ApplyFeralAPBonus(feral_bonus, apply); + } + + if(IsInFeralForm() || !CanUseAttackType(attType)) return; if (proto->Delay) @@ -6813,20 +6821,20 @@ void Player::_ApplyItemBonuses(ItemPrototype const *proto,uint8 slot,bool apply) void Player::_ApplyWeaponDependentAuraMods(Item *item,WeaponAttackType attackType,bool apply) { - AuraList const& auraCritList = GetAurasByType(SPELL_AURA_MOD_CRIT_PERCENT); - for(AuraList::const_iterator itr = auraCritList.begin(); itr!=auraCritList.end();++itr) + AuraEffectList const& auraCritList = GetAurasByType(SPELL_AURA_MOD_CRIT_PERCENT); + for(AuraEffectList::const_iterator itr = auraCritList.begin(); itr!=auraCritList.end();++itr) _ApplyWeaponDependentAuraCritMod(item,attackType,*itr,apply); - AuraList const& auraDamageFlatList = GetAurasByType(SPELL_AURA_MOD_DAMAGE_DONE); - for(AuraList::const_iterator itr = auraDamageFlatList.begin(); itr!=auraDamageFlatList.end();++itr) + AuraEffectList const& auraDamageFlatList = GetAurasByType(SPELL_AURA_MOD_DAMAGE_DONE); + for(AuraEffectList::const_iterator itr = auraDamageFlatList.begin(); itr!=auraDamageFlatList.end();++itr) _ApplyWeaponDependentAuraDamageMod(item,attackType,*itr,apply); - AuraList const& auraDamagePCTList = GetAurasByType(SPELL_AURA_MOD_DAMAGE_PERCENT_DONE); - for(AuraList::const_iterator itr = auraDamagePCTList.begin(); itr!=auraDamagePCTList.end();++itr) + AuraEffectList const& auraDamagePCTList = GetAurasByType(SPELL_AURA_MOD_DAMAGE_PERCENT_DONE); + for(AuraEffectList::const_iterator itr = auraDamagePCTList.begin(); itr!=auraDamagePCTList.end();++itr) _ApplyWeaponDependentAuraDamageMod(item,attackType,*itr,apply); } -void Player::_ApplyWeaponDependentAuraCritMod(Item *item, WeaponAttackType attackType, Aura* aura, bool apply) +void Player::_ApplyWeaponDependentAuraCritMod(Item *item, WeaponAttackType attackType, AuraEffect* aura, bool apply) { // generic not weapon specific case processes in aura code if(aura->GetSpellProto()->EquippedItemClass == -1) @@ -6843,15 +6851,14 @@ void Player::_ApplyWeaponDependentAuraCritMod(Item *item, WeaponAttackType attac if (item->IsFitToSpellRequirements(aura->GetSpellProto())) { - HandleBaseModValue(mod, FLAT_MOD, float (aura->GetModifierValue()), apply); + HandleBaseModValue(mod, FLAT_MOD, float (aura->GetAmount()), apply); } } -void Player::_ApplyWeaponDependentAuraDamageMod(Item *item, WeaponAttackType attackType, Aura* aura, bool apply) +void Player::_ApplyWeaponDependentAuraDamageMod(Item *item, WeaponAttackType attackType, AuraEffect* aura, bool apply) { // ignore spell mods for not wands - Modifier const* modifier = aura->GetModifier(); - if((modifier->m_miscvalue & SPELL_SCHOOL_MASK_NORMAL)==0 && (getClassMask() & CLASSMASK_WAND_USERS)==0) + if((aura->GetMiscValue() & SPELL_SCHOOL_MASK_NORMAL)==0 && (getClassMask() & CLASSMASK_WAND_USERS)==0) return; // generic not weapon specific case processes in aura code @@ -6868,7 +6875,7 @@ void Player::_ApplyWeaponDependentAuraDamageMod(Item *item, WeaponAttackType att } UnitModifierType unitModType = TOTAL_VALUE; - switch(modifier->m_auraname) + switch(aura->GetAuraName()) { case SPELL_AURA_MOD_DAMAGE_DONE: unitModType = TOTAL_VALUE; break; case SPELL_AURA_MOD_DAMAGE_PERCENT_DONE: unitModType = TOTAL_PCT; break; @@ -6877,7 +6884,7 @@ void Player::_ApplyWeaponDependentAuraDamageMod(Item *item, WeaponAttackType att if (item->IsFitToSpellRequirements(aura->GetSpellProto())) { - HandleStatModifier(unitMod, unitModType, float(aura->GetModifierValue()),apply); + HandleStatModifier(unitMod, unitModType, float(aura->GetAmount()),apply); } } @@ -6890,7 +6897,7 @@ void Player::ApplyItemEquipSpell(Item *item, bool apply, bool form_change) if(!proto) return; - for (int i = 0; i < 5; i++) + for (uint8 i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) { _Spell const& spellData = proto->Spells[i]; @@ -6916,29 +6923,15 @@ void Player::ApplyEquipSpell(SpellEntry const* spellInfo, Item* item, bool apply if(apply) { // Cannot be used in this stance/form - if(GetErrorAtShapeshiftedCast(spellInfo, m_form)!=0) + if(GetErrorAtShapeshiftedCast(spellInfo, m_form) != SPELL_CAST_OK) return; if(form_change) // check aura active state from other form { - bool found = false; - for (int k=0; k < 3; ++k) - { - spellEffectPair spair = spellEffectPair(spellInfo->Id, k); - for (AuraMap::iterator iter = m_Auras.lower_bound(spair); iter != m_Auras.upper_bound(spair); ++iter) - { - if(!item || iter->second->GetCastItemGUID() == item->GetGUID()) - { - found = true; - break; - } - } - if(found) - break; - } - - if(found) // and skip re-cast already active aura at form change - return; + AuraMap const& auras = GetAuras(); + for(AuraMap::const_iterator itr = auras.lower_bound(spellInfo->Id); itr != auras.upper_bound(spellInfo->Id); ++itr) + if(!item || itr->second->GetCastItemGUID()==item->GetGUID()) + return; } DEBUG_LOG("WORLD: cast %s Equip spellId - %i", (item ? "item" : "itemset"), spellInfo->Id); @@ -6950,7 +6943,7 @@ void Player::ApplyEquipSpell(SpellEntry const* spellInfo, Item* item, bool apply if(form_change) // check aura compatibility { // Cannot be used in this stance/form - if(GetErrorAtShapeshiftedCast(spellInfo, m_form)==0) + if(GetErrorAtShapeshiftedCast(spellInfo, m_form)==SPELL_CAST_OK) return; // and remove only not compatible at form change } @@ -6963,7 +6956,7 @@ void Player::ApplyEquipSpell(SpellEntry const* spellInfo, Item* item, bool apply void Player::UpdateEquipSpellsAtFormChange() { - for (int i = 0; i < INVENTORY_SLOT_BAG_END; i++) + for (uint8 i = 0; i < INVENTORY_SLOT_BAG_END; i++) { if(m_items[i] && !m_items[i]->IsBroken()) { @@ -7022,11 +7015,6 @@ void Player::CastItemCombatSpell(Unit *target, WeaponAttackType attType, uint32 if (!((Player*)this)->IsUseEquipedWeapon(true)) continue; } - else - { - if (((Player*)this)->IsInFeralForm()) - continue; - } } ((Player*)this)->CastItemCombatSpell(target, attType, procVictim, procEx, item, proto); } @@ -7037,6 +7025,7 @@ void Player::CastItemCombatSpell(Unit *target, WeaponAttackType attType, uint32 { // Can do effect if any damage done to target if (procVictim & PROC_FLAG_TAKEN_ANY_DAMAGE) + //if (damageInfo->procVictim & PROC_FLAG_TAKEN_ANY_DAMAGE) { for (int i = 0; i < 5; i++) { @@ -7066,7 +7055,7 @@ void Player::CastItemCombatSpell(Unit *target, WeaponAttackType attType, uint32 if(spellData.SpellPPMRate) { uint32 WeaponSpeed = GetAttackTime(attType); - chance = GetPPMProcChance(WeaponSpeed, spellData.SpellPPMRate); + chance = GetPPMProcChance(WeaponSpeed, spellData.SpellPPMRate, spellInfo); } else if(chance > 100.0f) { @@ -7101,6 +7090,7 @@ void Player::CastItemCombatSpell(Unit *target, WeaponAttackType attType, uint32 { // Can do effect if any damage done to target if (!(procVictim & PROC_FLAG_TAKEN_ANY_DAMAGE)) + //if (!(damageInfo->procVictim & PROC_FLAG_TAKEN_ANY_DAMAGE)) continue; } @@ -7116,7 +7106,7 @@ void Player::CastItemCombatSpell(Unit *target, WeaponAttackType attType, uint32 if (entry && entry->PPMChance) { uint32 WeaponSpeed = GetAttackTime(attType); - chance = GetPPMProcChance(WeaponSpeed, entry->PPMChance); + chance = GetPPMProcChance(WeaponSpeed, entry->PPMChance, spellInfo); } else if (entry && entry->customChance) chance = entry->customChance; @@ -7135,11 +7125,97 @@ void Player::CastItemCombatSpell(Unit *target, WeaponAttackType attType, uint32 } } +void Player::CastItemUseSpell(Item *item,SpellCastTargets const& targets,uint8 cast_count, uint32 glyphIndex) +{ + ItemPrototype const* proto = item->GetProto(); + // special learning case + if(proto->Spells[0].SpellId==SPELL_ID_GENERIC_LEARN || proto->Spells[0].SpellId==SPELL_ID_GENERIC_LEARN_PET) + { + uint32 learn_spell_id = proto->Spells[0].SpellId; + uint32 learning_spell_id = proto->Spells[1].SpellId; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(learn_spell_id); + if(!spellInfo) + { + sLog.outError("Player::CastItemUseSpell: Item (Entry: %u) in have wrong spell id %u, ignoring ",proto->ItemId, learn_spell_id); + SendEquipError(EQUIP_ERR_NONE,item,NULL); + return; + } + + Spell *spell = new Spell(this, spellInfo,false); + spell->m_CastItem = item; + spell->m_cast_count = cast_count; //set count of casts + spell->m_currentBasePoints[0] = learning_spell_id; + spell->prepare(&targets); + return; + } + + // use triggered flag only for items with many spell casts and for not first cast + int count = 0; + + // item spells casted at use + for(int i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) + { + _Spell const& spellData = proto->Spells[i]; + + // no spell + if(!spellData.SpellId) + continue; + + // wrong triggering type + if( spellData.SpellTrigger != ITEM_SPELLTRIGGER_ON_USE && spellData.SpellTrigger != ITEM_SPELLTRIGGER_ON_NO_DELAY_USE) + continue; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellData.SpellId); + if(!spellInfo) + { + sLog.outError("Player::CastItemUseSpell: Item (Entry: %u) in have wrong spell id %u, ignoring",proto->ItemId, spellData.SpellId); + continue; + } + + Spell *spell = new Spell(this, spellInfo, (count > 0)); + spell->m_CastItem = item; + spell->m_cast_count = cast_count; // set count of casts + spell->m_glyphIndex = glyphIndex; // glyph index + spell->prepare(&targets); + + ++count; + } + + // Item enchantments spells casted at use + for(int e_slot = 0; e_slot < MAX_ENCHANTMENT_SLOT; ++e_slot) + { + uint32 enchant_id = item->GetEnchantmentId(EnchantmentSlot(e_slot)); + SpellItemEnchantmentEntry const *pEnchant = sSpellItemEnchantmentStore.LookupEntry(enchant_id); + if(!pEnchant) continue; + for (int s=0;s<3;s++) + { + if(pEnchant->type[s]!=ITEM_ENCHANTMENT_TYPE_USE_SPELL) + continue; + + SpellEntry const *spellInfo = sSpellStore.LookupEntry(pEnchant->spellid[s]); + if (!spellInfo) + { + sLog.outError("Player::CastItemUseSpell Enchant %i, cast unknown spell %i", pEnchant->ID, pEnchant->spellid[s]); + continue; + } + + Spell *spell = new Spell(this, spellInfo, (count > 0)); + spell->m_CastItem = item; + spell->m_cast_count = cast_count; // set count of casts + spell->m_glyphIndex = glyphIndex; // glyph index + spell->prepare(&targets); + + ++count; + } + } +} + void Player::_RemoveAllItemMods() { sLog.outDebug("_RemoveAllItemMods start."); - for (int i = 0; i < INVENTORY_SLOT_BAG_END; i++) + for (uint8 i = 0; i < INVENTORY_SLOT_BAG_END; i++) { if(m_items[i]) { @@ -7159,7 +7235,7 @@ void Player::_RemoveAllItemMods() } } - for (int i = 0; i < INVENTORY_SLOT_BAG_END; i++) + for (uint8 i = 0; i < INVENTORY_SLOT_BAG_END; i++) { if(m_items[i]) { @@ -7187,7 +7263,7 @@ void Player::_ApplyAllItemMods() { sLog.outDebug("_ApplyAllItemMods start."); - for (int i = 0; i < INVENTORY_SLOT_BAG_END; i++) + for (uint8 i = 0; i < INVENTORY_SLOT_BAG_END; i++) { if(m_items[i]) { @@ -7209,7 +7285,7 @@ void Player::_ApplyAllItemMods() } } - for (int i = 0; i < INVENTORY_SLOT_BAG_END; i++) + for (uint8 i = 0; i < INVENTORY_SLOT_BAG_END; i++) { if(m_items[i]) { @@ -7324,12 +7400,6 @@ void Player::RemovedInsignia(Player* looterPlr) looterPlr->SendLoot(bones->GetGUID(), LOOT_INSIGNIA); } -/*Loot type MUST be -1-corpse, go -2-skinning -3-Fishing -*/ - void Player::SendLootRelease( uint64 guid ) { WorldPacket data( SMSG_LOOT_RELEASE_RESPONSE, (8+1) ); @@ -7339,6 +7409,9 @@ void Player::SendLootRelease( uint64 guid ) void Player::SendLoot(uint64 guid, LootType loot_type) { + if (uint64 lguid = GetLootGUID()) + m_session->DoLootRelease(lguid); + Loot *loot = 0; PermissionTypes permission = ALL_PERMISSION; @@ -7346,8 +7419,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) if (IS_GAMEOBJECT_GUID(guid)) { sLog.outDebug(" IS_GAMEOBJECT_GUID(guid)"); - GameObject *go = - ObjectAccessor::GetGameObject(*this, guid); + GameObject *go = GetMap()->GetGameObject(guid); // not check distance for GO in case owned GO (fishing bobber case, for example) // And permit out of range GO with no owner in case fishing hole @@ -7359,7 +7431,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) loot = &go->loot; - if(go->getLootState() == GO_READY) + if (go->getLootState() == GO_READY) { uint32 lootid = go->GetLootId(); @@ -7373,15 +7445,15 @@ void Player::SendLoot(uint64 guid, LootType loot_type) return; } - if(lootid) + if (lootid) { sLog.outDebug(" if(lootid)"); loot->clear(); - loot->FillLoot(lootid, LootTemplates_Gameobject, this); + loot->FillLoot(lootid, LootTemplates_Gameobject, this, false); } - if(loot_type == LOOT_FISHING) - go->getFishLoot(loot); + if (loot_type == LOOT_FISHING) + go->getFishLoot(loot,this); go->SetLootState(GO_ACTIVATED); } @@ -7396,39 +7468,28 @@ void Player::SendLoot(uint64 guid, LootType loot_type) return; } - if(loot_type == LOOT_DISENCHANTING) - { - loot = &item->loot; - - if(!item->m_lootGenerated) - { - item->m_lootGenerated = true; - loot->clear(); - loot->FillLoot(item->GetProto()->DisenchantID, LootTemplates_Disenchant, this); - } - } - else if(loot_type == LOOT_PROSPECTING) - { - loot = &item->loot; + loot = &item->loot; - if(!item->m_lootGenerated) - { - item->m_lootGenerated = true; - loot->clear(); - loot->FillLoot(item->GetEntry(), LootTemplates_Prospecting, this); - } - } - else + if (!item->m_lootGenerated) { - loot = &item->loot; + item->m_lootGenerated = true; + loot->clear(); - if(!item->m_lootGenerated) + switch(loot_type) { - item->m_lootGenerated = true; - loot->clear(); - loot->FillLoot(item->GetEntry(), LootTemplates_Item, this); - - loot->generateMoneyLoot(item->GetProto()->MinMoneyLoot,item->GetProto()->MaxMoneyLoot); + case LOOT_DISENCHANTING: + loot->FillLoot(item->GetProto()->DisenchantID, LootTemplates_Disenchant, this,true); + break; + case LOOT_PROSPECTING: + loot->FillLoot(item->GetEntry(), LootTemplates_Prospecting, this,true); + break; + case LOOT_MILLING: + loot->FillLoot(item->GetEntry(), LootTemplates_Milling, this,true); + break; + default: + loot->FillLoot(item->GetEntry(), LootTemplates_Item, this,true); + loot->generateMoneyLoot(item->GetProto()->MinMoneyLoot,item->GetProto()->MaxMoneyLoot); + break; } } } @@ -7450,10 +7511,10 @@ void Player::SendLoot(uint64 guid, LootType loot_type) uint32 pLevel = bones->loot.gold; bones->loot.clear(); if(GetBattleGround()->GetTypeID() == BATTLEGROUND_AV) - loot->FillLoot(1, LootTemplates_Creature, this); + loot->FillLoot(1, LootTemplates_Creature, this, true); // It may need a better formula // Now it works like this: lvl10: ~6copper, lvl70: ~9silver - bones->loot.gold = (uint32)( GetMap()->urand(50, 150) * 0.016f * pow( ((float)pLevel)/5.76f, 2.5f) * sWorld.getRate(RATE_DROP_MONEY) ); + bones->loot.gold = (uint32)( urand(50, 150) * 0.016f * pow( ((float)pLevel)/5.76f, 2.5f) * sWorld.getRate(RATE_DROP_MONEY) ); } if (bones->lootRecipient != this) @@ -7461,7 +7522,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) } else { - Creature *creature = ObjectAccessor::GetCreature(*this, guid); + Creature *creature = GetMap()->GetCreature(guid); // must be in range and creature must be alive for pickpocket and must be dead for another loot if (!creature || creature->isAlive()!=(loot_type == LOOT_PICKPOCKETING) || !creature->IsWithinDistInMap(this,INTERACTION_DISTANCE)) @@ -7470,7 +7531,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) return; } - if(loot_type == LOOT_PICKPOCKETING && IsFriendlyTo(creature)) + if (loot_type == LOOT_PICKPOCKETING && IsFriendlyTo(creature)) { SendLootRelease(guid); return; @@ -7478,19 +7539,19 @@ void Player::SendLoot(uint64 guid, LootType loot_type) loot = &creature->loot; - if(loot_type == LOOT_PICKPOCKETING) + if (loot_type == LOOT_PICKPOCKETING) { - if ( !creature->lootForPickPocketed ) + if (!creature->lootForPickPocketed) { creature->lootForPickPocketed = true; loot->clear(); if (uint32 lootid = creature->GetCreatureInfo()->pickpocketLootId) - loot->FillLoot(lootid, LootTemplates_Pickpocketing, this); + loot->FillLoot(lootid, LootTemplates_Pickpocketing, this, false); // Generate extra money for pick pocket loot - const uint32 a = GetMap()->urand(0, creature->getLevel()/2); - const uint32 b = GetMap()->urand(0, getLevel()/2); + const uint32 a = urand(0, creature->getLevel()/2); + const uint32 b = urand(0, getLevel()/2); loot->gold = uint32(10 * (a + b) * sWorld.getRate(RATE_DROP_MONEY)); } } @@ -7510,17 +7571,17 @@ void Player::SendLoot(uint64 guid, LootType loot_type) loot->clear(); } - if(!creature->lootForBody) + if (!creature->lootForBody) { creature->lootForBody = true; loot->clear(); if (uint32 lootid = creature->GetCreatureInfo()->lootid) - loot->FillLoot(lootid, LootTemplates_Creature, recipient); + loot->FillLoot(lootid, LootTemplates_Creature, recipient, false); loot->generateMoneyLoot(creature->GetCreatureInfo()->mingold,creature->GetCreatureInfo()->maxgold); - if(Group* group = recipient->GetGroup()) + if (Group* group = recipient->GetGroup()) { group->UpdateLooterGuid(creature,true); @@ -7546,20 +7607,20 @@ void Player::SendLoot(uint64 guid, LootType loot_type) if (loot_type == LOOT_SKINNING) { loot->clear(); - loot->FillLoot(creature->GetCreatureInfo()->SkinLootId, LootTemplates_Skinning, this); + loot->FillLoot(creature->GetCreatureInfo()->SkinLootId, LootTemplates_Skinning, this, false); } // set group rights only for loot_type != LOOT_SKINNING else { if(Group* group = GetGroup()) { - if( group == recipient->GetGroup() ) + if (group == recipient->GetGroup()) { - if(group->GetLootMethod() == FREE_FOR_ALL) + if (group->GetLootMethod() == FREE_FOR_ALL) permission = ALL_PERMISSION; - else if(group->GetLooterGuid() == GetGUID()) + else if (group->GetLooterGuid() == GetGUID()) { - if(group->GetLootMethod() == MASTER_LOOT) + if (group->GetLootMethod() == MASTER_LOOT) permission = MASTER_PERMISSION; else permission = ALL_PERMISSION; @@ -7570,7 +7631,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) else permission = NONE_PERMISSION; } - else if(recipient == this) + else if (recipient == this) permission = ALL_PERMISSION; else permission = NONE_PERMISSION; @@ -7580,51 +7641,22 @@ void Player::SendLoot(uint64 guid, LootType loot_type) SetLootGUID(guid); - QuestItemList *q_list = 0; - if (permission != NONE_PERMISSION) - { - QuestItemMap const& lootPlayerQuestItems = loot->GetPlayerQuestItems(); - QuestItemMap::const_iterator itr = lootPlayerQuestItems.find(GetGUIDLow()); - if (itr == lootPlayerQuestItems.end()) - q_list = loot->FillQuestLoot(this); - else - q_list = itr->second; - } - - QuestItemList *ffa_list = 0; - if (permission != NONE_PERMISSION) - { - QuestItemMap const& lootPlayerFFAItems = loot->GetPlayerFFAItems(); - QuestItemMap::const_iterator itr = lootPlayerFFAItems.find(GetGUIDLow()); - if (itr == lootPlayerFFAItems.end()) - ffa_list = loot->FillFFALoot(this); - else - ffa_list = itr->second; - } - - QuestItemList *conditional_list = 0; - if (permission != NONE_PERMISSION) + // LOOT_INSIGNIA and LOOT_FISHINGHOLE unsupported by client + switch(loot_type) { - QuestItemMap const& lootPlayerNonQuestNonFFAConditionalItems = loot->GetPlayerNonQuestNonFFAConditionalItems(); - QuestItemMap::const_iterator itr = lootPlayerNonQuestNonFFAConditionalItems.find(GetGUIDLow()); - if (itr == lootPlayerNonQuestNonFFAConditionalItems.end()) - conditional_list = loot->FillNonQuestNonFFAConditionalLoot(this); - else - conditional_list = itr->second; + case LOOT_INSIGNIA: loot_type = LOOT_SKINNING; break; + case LOOT_FISHINGHOLE: loot_type = LOOT_FISHING; break; + default: break; } - // LOOT_PICKPOCKETING, LOOT_PROSPECTING, LOOT_DISENCHANTING and LOOT_INSIGNIA unsupported by client, sending LOOT_SKINNING instead - if(loot_type == LOOT_PICKPOCKETING || loot_type == LOOT_DISENCHANTING || loot_type == LOOT_PROSPECTING || loot_type == LOOT_INSIGNIA) - loot_type = LOOT_SKINNING; - - if(loot_type == LOOT_FISHINGHOLE) - loot_type = LOOT_FISHING; + // need know merged fishing/corpse loot type for achievements + loot->loot_type = loot_type; WorldPacket data(SMSG_LOOT_RESPONSE, (9+50)); // we guess size data << uint64(guid); data << uint8(loot_type); - data << LootView(*loot, q_list, ffa_list, conditional_list, this, permission); + data << LootView(*loot, this, permission); SendDirectMessage(&data); @@ -7632,7 +7664,7 @@ void Player::SendLoot(uint64 guid, LootType loot_type) if (permission != NONE_PERMISSION) loot->AddLooter(GetGUID()); - if ( loot_type == LOOT_CORPSE && !IS_ITEM_GUID(guid) ) + if (loot_type == LOOT_CORPSE && !IS_ITEM_GUID(guid)) SetFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_LOOTING); } @@ -7657,20 +7689,16 @@ void Player::SendUpdateWorldState(uint32 Field, uint32 Value) GetSession()->SendPacket(&data); } -void Player::SendInitWorldStates(bool forceZone, uint32 forceZoneId) +void Player::SendInitWorldStates(uint32 zoneid, uint32 areaid) { // data depends on zoneid/mapid... BattleGround* bg = GetBattleGround(); uint16 NumberOfFields = 0; uint32 mapid = GetMapId(); - uint32 zoneid; - if(forceZone) - zoneid = forceZoneId; - else - zoneid = GetZoneId(); OutdoorPvP * pvp = sOutdoorPvPMgr.GetOutdoorPvPToZoneId(zoneid); - uint32 areaid = GetAreaId(); + sLog.outDebug("Sending SMSG_INIT_WORLD_STATES to Map:%u, Zone: %u", mapid, zoneid); + // may be exist better way to do this... switch(zoneid) { @@ -7691,46 +7719,46 @@ void Player::SendInitWorldStates(bool forceZone, uint32 forceZoneId) case 1537: case 2257: case 2918: - NumberOfFields = 6; + NumberOfFields = 8; break; case 139: - NumberOfFields = 39; + NumberOfFields = 41; break; case 1377: - NumberOfFields = 13; + NumberOfFields = 15; break; case 2597: - NumberOfFields = 81; + NumberOfFields = 83; break; case 3277: - NumberOfFields = 14; + NumberOfFields = 16; break; case 3358: case 3820: - NumberOfFields = 38; + NumberOfFields = 40; break; case 3483: - NumberOfFields = 25; + NumberOfFields = 27; break; case 3518: - NumberOfFields = 37; + NumberOfFields = 39; break; case 3519: - NumberOfFields = 36; + NumberOfFields = 38; break; case 3521: - NumberOfFields = 35; + NumberOfFields = 37; break; case 3698: case 3702: case 3968: - NumberOfFields = 9; + NumberOfFields = 11; break; case 3703: - NumberOfFields = 9; + NumberOfFields = 11; break; default: - NumberOfFields = 10; + NumberOfFields = 12; break; } @@ -7745,6 +7773,10 @@ void Player::SendInitWorldStates(bool forceZone, uint32 forceZoneId) data << uint32(0x8d5) << uint32(0x0); // 4 data << uint32(0x8d4) << uint32(0x0); // 5 data << uint32(0x8d3) << uint32(0x0); // 6 + // 7 1 - Arena season in progress, 0 - end of season + data << uint32(0xC77) << uint32(sWorld.getConfig(CONFIG_ARENA_SEASON_IN_PROGRESS)); + // 8 Arena season id + data << uint32(0xF3D) << uint32(sWorld.getConfig(CONFIG_ARENA_SEASON_ID)); if(mapid == 530) // Outland { data << uint32(0x9bf) << uint32(0x0); // 7 @@ -8246,7 +8278,7 @@ void Player::SetVirtualItemSlot( uint8 i, Item* item) } } -void Player::SetSheath( uint32 sheathed ) +void Player::SetSheath( SheathState sheathed ) { switch (sheathed) { @@ -8272,7 +8304,7 @@ void Player::SetSheath( uint32 sheathed ) SetVirtualItemSlot(2,NULL); break; } - SetByteValue(UNIT_FIELD_BYTES_2, 0, sheathed); // this must visualize Sheath changing for other players... + Unit::SetSheath(sheathed); // this must visualize Sheath changing for other players... } uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap ) const @@ -8338,7 +8370,8 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap // (this will be replace mainhand weapon at auto equip instead unwonted "you don't known dual wielding" ... if(CanDualWield()) slots[1] = EQUIPMENT_SLOT_OFFHAND; - };break; + break; + }; case INVTYPE_SHIELD: slots[0] = EQUIPMENT_SLOT_OFFHAND; break; @@ -8347,6 +8380,8 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap break; case INVTYPE_2HWEAPON: slots[0] = EQUIPMENT_SLOT_MAINHAND; + if (CanDualWield() && CanTitanGrip()) + slots[1] = EQUIPMENT_SLOT_OFFHAND; break; case INVTYPE_TABARD: slots[0] = EQUIPMENT_SLOT_TABARD; @@ -8367,10 +8402,10 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap slots[0] = EQUIPMENT_SLOT_RANGED; break; case INVTYPE_BAG: - slots[0] = INVENTORY_SLOT_BAG_1; - slots[1] = INVENTORY_SLOT_BAG_2; - slots[2] = INVENTORY_SLOT_BAG_3; - slots[3] = INVENTORY_SLOT_BAG_4; + slots[0] = INVENTORY_SLOT_BAG_START + 0; + slots[1] = INVENTORY_SLOT_BAG_START + 1; + slots[2] = INVENTORY_SLOT_BAG_START + 2; + slots[3] = INVENTORY_SLOT_BAG_START + 3; break; case INVTYPE_RELIC: { @@ -8392,6 +8427,10 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap if (pClass == CLASS_WARLOCK) slots[0] = EQUIPMENT_SLOT_RANGED; break; + case ITEM_SUBCLASS_ARMOR_SIGIL: + if (pClass == CLASS_DEATH_KNIGHT) + slots[0] = EQUIPMENT_SLOT_RANGED; + break; } break; } @@ -8403,7 +8442,7 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap { if( swap || !GetItemByPos( INVENTORY_SLOT_BAG_0, slot ) ) { - for (int i = 0; i < 4; i++) + for (uint8 i = 0; i < 4; i++) { if ( slots[i] == slot ) return slot; @@ -8413,24 +8452,18 @@ uint8 Player::FindEquipSlot( ItemPrototype const* proto, uint32 slot, bool swap else { // search free slot at first - for (int i = 0; i < 4; i++) + for (uint8 i = 0; i < 4; i++) { if ( slots[i] != NULL_SLOT && !GetItemByPos( INVENTORY_SLOT_BAG_0, slots[i] ) ) { - // in case 2hand equipped weapon offhand slot empty but not free - if(slots[i]==EQUIPMENT_SLOT_OFFHAND) - { - Item* mainItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_MAINHAND ); - if(!mainItem || mainItem->GetProto()->InventoryType != INVTYPE_2HWEAPON) - return slots[i]; - } - else + // in case 2hand equipped weapon (without titan grip) offhand slot empty but not free + if(slots[i]!=EQUIPMENT_SLOT_OFFHAND || !IsTwoHandUsed()) return slots[i]; } } // if not found free and can swap return first appropriate from used - for (int i = 0; i < 4; i++) + for (uint8 i = 0; i < 4; i++) { if ( slots[i] != NULL_SLOT && swap ) return slots[i]; @@ -8448,7 +8481,7 @@ uint8 Player::CanUnequipItems( uint32 item, uint32 count ) const uint8 res = EQUIP_ERR_OK; - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) { pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8464,7 +8497,7 @@ uint8 Player::CanUnequipItems( uint32 item, uint32 count ) const res = ires; } } - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8474,7 +8507,7 @@ uint8 Player::CanUnequipItems( uint32 item, uint32 count ) const return EQUIP_ERR_OK; } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8485,7 +8518,7 @@ uint8 Player::CanUnequipItems( uint32 item, uint32 count ) const } } Bag *pBag; - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pBag ) @@ -8510,19 +8543,19 @@ uint8 Player::CanUnequipItems( uint32 item, uint32 count ) const uint32 Player::GetItemCount( uint32 item, bool inBankAlso, Item* skipItem ) const { uint32 count = 0; - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem != skipItem && pItem->GetEntry() == item ) count += pItem->GetCount(); } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem != skipItem && pItem->GetEntry() == item ) count += pItem->GetCount(); } - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pBag ) @@ -8531,7 +8564,7 @@ uint32 Player::GetItemCount( uint32 item, bool inBankAlso, Item* skipItem ) cons if(skipItem && skipItem->GetProto()->GemProperties) { - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem != skipItem && pItem->GetProto()->Socket[0].Color ) @@ -8541,13 +8574,13 @@ uint32 Player::GetItemCount( uint32 item, bool inBankAlso, Item* skipItem ) cons if(inBankAlso) { - for(int i = BANK_SLOT_ITEM_START; i < BANK_SLOT_ITEM_END; i++) + for(uint8 i = BANK_SLOT_ITEM_START; i < BANK_SLOT_ITEM_END; i++) { Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem != skipItem && pItem->GetEntry() == item ) count += pItem->GetCount(); } - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pBag ) @@ -8556,7 +8589,7 @@ uint32 Player::GetItemCount( uint32 item, bool inBankAlso, Item* skipItem ) cons if(skipItem && skipItem->GetProto()->GemProperties) { - for(int i = BANK_SLOT_ITEM_START; i < BANK_SLOT_ITEM_END; i++) + for(uint8 i = BANK_SLOT_ITEM_START; i < BANK_SLOT_ITEM_END; i++) { Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem != skipItem && pItem->GetProto()->Socket[0].Color ) @@ -8570,20 +8603,20 @@ uint32 Player::GetItemCount( uint32 item, bool inBankAlso, Item* skipItem ) cons Item* Player::GetItemByGuid( uint64 guid ) const { - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetGUID() == guid ) return pItem; } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetGUID() == guid ) return pItem; } - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { Bag *pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pBag ) @@ -8596,7 +8629,7 @@ Item* Player::GetItemByGuid( uint64 guid ) const } } } - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { Bag *pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pBag ) @@ -8622,7 +8655,7 @@ Item* Player::GetItemByPos( uint16 pos ) const Item* Player::GetItemByPos( uint8 bag, uint8 slot ) const { - if( bag == INVENTORY_SLOT_BAG_0 && ( slot < BANK_SLOT_BAG_END || slot >= KEYRING_SLOT_START && slot < KEYRING_SLOT_END ) ) + if( bag == INVENTORY_SLOT_BAG_0 && ( slot < BANK_SLOT_BAG_END || slot >= KEYRING_SLOT_START && slot < CURRENCYTOKEN_SLOT_END ) ) return m_items[slot]; else if(bag >= INVENTORY_SLOT_BAG_START && bag < INVENTORY_SLOT_BAG_END || bag >= BANK_SLOT_BAG_START && bag < BANK_SLOT_BAG_END ) @@ -8645,14 +8678,14 @@ Item* Player::GetWeaponForAttack(WeaponAttackType attackType, bool useable) cons default: return NULL; } - Item* item = GetItemByPos(INVENTORY_SLOT_BAG_0, slot); + Item* item = GetUseableItemByPos(INVENTORY_SLOT_BAG_0, slot); if (!item || item->GetProto()->Class != ITEM_CLASS_WEAPON) return NULL; if(!useable) return item; - if( item->IsBroken() || !IsUseEquipedWeapon(attackType==BASE_ATTACK) ) + if( item->IsBroken() || IsInFeralForm()) return NULL; return item; @@ -8660,7 +8693,7 @@ Item* Player::GetWeaponForAttack(WeaponAttackType attackType, bool useable) cons Item* Player::GetShield(bool useable) const { - Item* item = GetItemByPos(INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND); + Item* item = GetUseableItemByPos(INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND); if (!item || item->GetProto()->Class != ITEM_CLASS_ARMOR) return NULL; @@ -8673,7 +8706,7 @@ Item* Player::GetShield(bool useable) const return item; } -uint32 Player::GetAttackBySlot( uint8 slot ) +uint8 Player::GetAttackBySlot( uint8 slot ) { switch(slot) { @@ -8684,14 +8717,6 @@ uint32 Player::GetAttackBySlot( uint8 slot ) } } -bool Player::HasBankBagSlot( uint8 slot ) const -{ - uint32 maxslot = GetByteValue(PLAYER_BYTES_2, 2) + BANK_SLOT_BAG_START; - if( slot < maxslot ) - return true; - return false; -} - bool Player::IsInventoryPos( uint8 bag, uint8 slot ) { if( bag == INVENTORY_SLOT_BAG_0 && slot == NULL_SLOT ) @@ -8700,7 +8725,7 @@ bool Player::IsInventoryPos( uint8 bag, uint8 slot ) return true; if( bag >= INVENTORY_SLOT_BAG_START && bag < INVENTORY_SLOT_BAG_END ) return true; - if( bag == INVENTORY_SLOT_BAG_0 && ( slot >= KEYRING_SLOT_START && slot < KEYRING_SLOT_END ) ) + if( bag == INVENTORY_SLOT_BAG_0 && ( slot >= KEYRING_SLOT_START && slot < CURRENCYTOKEN_SLOT_END ) ) return true; return false; } @@ -8811,7 +8836,7 @@ bool Player::IsValidPos( uint8 bag, uint8 slot ) bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const { uint32 tempcount = 0; - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8821,7 +8846,7 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const return true; } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8831,7 +8856,7 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const return true; } } - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { if(Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { @@ -8850,7 +8875,7 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const if(inBankAlso) { - for(int i = BANK_SLOT_ITEM_START; i < BANK_SLOT_ITEM_END; i++) + for(uint8 i = BANK_SLOT_ITEM_START; i < BANK_SLOT_ITEM_END; i++) { Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEntry() == item ) @@ -8860,7 +8885,7 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const return true; } } - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { if(Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { @@ -8881,31 +8906,76 @@ bool Player::HasItemCount( uint32 item, uint32 count, bool inBankAlso ) const return false; } -Item* Player::GetItemOrItemWithGemEquipped( uint32 item ) const +bool Player::HasItemOrGemWithIdEquipped( uint32 item, uint32 count, uint8 except_slot ) const { - Item *pItem; - for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) + uint32 tempcount = 0; + for(uint8 i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) - return pItem; + if(i == except_slot) + continue; + + Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + if( pItem && pItem->GetEntry() == item) + { + tempcount += pItem->GetCount(); + if( tempcount >= count ) + return true; + } } ItemPrototype const *pProto = objmgr.GetItemPrototype(item); if (pProto && pProto->GemProperties) { - for(int i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetProto()->Socket[0].Color ) + if(i == except_slot) + continue; + + Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + if( pItem && pItem->GetProto()->Socket[0].Color) { - if (pItem->GetGemCountWithID(item) > 0 ) - return pItem; + tempcount += pItem->GetGemCountWithID(item); + if( tempcount >= count ) + return true; } } } - return NULL; + return false; +} + +bool Player::HasItemOrGemWithLimitCategoryEquipped( uint32 limitCategory, uint32 count, uint8 except_slot ) const +{ + uint32 tempcount = 0; + for(uint8 i = EQUIPMENT_SLOT_START; i < EQUIPMENT_SLOT_END; ++i) + { + if(i == except_slot) + continue; + + Item *pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + if (!pItem) + continue; + + ItemPrototype const *pProto = pItem->GetProto(); + if (!pProto) + continue; + + if (pProto->ItemLimitCategory == limitCategory) + { + tempcount += pItem->GetCount(); + if( tempcount >= count ) + return true; + } + + if( pProto->Socket[0].Color) + { + tempcount += pItem->GetGemCountWithLimitCategory(limitCategory); + if( tempcount >= count ) + return true; + } + } + + return false; } uint8 Player::_CanTakeMoreSimilarItems(uint32 entry, uint32 count, Item* pItem, uint32* no_space_count ) const @@ -8919,12 +8989,12 @@ uint8 Player::_CanTakeMoreSimilarItems(uint32 entry, uint32 count, Item* pItem, } // no maximum - if(pProto->MaxCount == 0) + if(pProto->MaxCount <= 0) return EQUIP_ERR_OK; uint32 curcount = GetItemCount(pProto->ItemId,true,pItem); - if( curcount + count > pProto->MaxCount ) + if (curcount + count > uint32(pProto->MaxCount)) { if(no_space_count) *no_space_count = count +curcount - pProto->MaxCount; @@ -8939,13 +9009,13 @@ bool Player::HasItemTotemCategory( uint32 TotemCategory ) const Item *pItem; for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_ITEM_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + pItem = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && IsTotemCategoryCompatiableWith(pItem->GetProto()->TotemCategory,TotemCategory )) return true; } - for(uint8 i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; ++i) + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + pItem = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && IsTotemCategoryCompatiableWith(pItem->GetProto()->TotemCategory,TotemCategory )) return true; } @@ -8955,7 +9025,7 @@ bool Player::HasItemTotemCategory( uint32 TotemCategory ) const { for(uint32 j = 0; j < pBag->GetBagSize(); ++j) { - pItem = GetItemByPos( i, j ); + pItem = GetUseableItemByPos( i, j ); if( pItem && IsTotemCategoryCompatiableWith(pItem->GetProto()->TotemCategory,TotemCategory )) return true; } @@ -8983,6 +9053,10 @@ uint8 Player::_CanStoreItem_InSpecificSlot( uint8 bag, uint8 slot, ItemPosCountV if(slot >= KEYRING_SLOT_START && slot < KEYRING_SLOT_START+GetMaxKeyringSize() && !(pProto->BagFamily & BAG_FAMILY_MASK_KEYS)) return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; + // currencytoken case + if(slot >= CURRENCYTOKEN_SLOT_START && slot < CURRENCYTOKEN_SLOT_END && !(pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS)) + return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; + // prevent cheating if(slot >= BUYBACK_SLOT_START && slot < BUYBACK_SLOT_END || slot >= PLAYER_SLOT_END) return EQUIP_ERR_ITEM_DOESNT_GO_INTO_BAG; @@ -9002,7 +9076,7 @@ uint8 Player::_CanStoreItem_InSpecificSlot( uint8 bag, uint8 slot, ItemPosCountV } // non empty stack with space - need_space = pProto->Stackable; + need_space = pProto->GetMaxStackSize(); } // non empty slot, check item type else @@ -9012,10 +9086,11 @@ uint8 Player::_CanStoreItem_InSpecificSlot( uint8 bag, uint8 slot, ItemPosCountV return EQUIP_ERR_ITEM_CANT_STACK; // check free space - if(pItem2->GetCount() >= pProto->Stackable) + if(pItem2->GetCount() >= pProto->GetMaxStackSize()) return EQUIP_ERR_ITEM_CANT_STACK; - need_space = pProto->Stackable - pItem2->GetCount(); + // free stack space or infinity + need_space = pProto->GetMaxStackSize() - pItem2->GetCount(); } if(need_space > count) @@ -9069,9 +9144,9 @@ uint8 Player::_CanStoreItem_InBag( uint8 bag, ItemPosCountVec &dest, ItemPrototy if( pItem2 ) { - if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->Stackable ) + if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->GetMaxStackSize()) { - uint32 need_space = pProto->Stackable - pItem2->GetCount(); + uint32 need_space = pProto->GetMaxStackSize() - pItem2->GetCount(); if(need_space > count) need_space = count; @@ -9088,7 +9163,7 @@ uint8 Player::_CanStoreItem_InBag( uint8 bag, ItemPosCountVec &dest, ItemPrototy } else { - uint32 need_space = pProto->Stackable; + uint32 need_space = pProto->GetMaxStackSize(); if(need_space > count) need_space = count; @@ -9126,9 +9201,9 @@ uint8 Player::_CanStoreItem_InInventorySlots( uint8 slot_begin, uint8 slot_end, if( pItem2 ) { - if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->Stackable ) + if(pItem2->GetEntry() == pProto->ItemId && pItem2->GetCount() < pProto->GetMaxStackSize()) { - uint32 need_space = pProto->Stackable - pItem2->GetCount(); + uint32 need_space = pProto->GetMaxStackSize() - pItem2->GetCount(); if(need_space > count) need_space = count; ItemPosCount newPosition = ItemPosCount((INVENTORY_SLOT_BAG_0 << 8) | j, need_space); @@ -9144,7 +9219,7 @@ uint8 Player::_CanStoreItem_InInventorySlots( uint8 slot_begin, uint8 slot_end, } else { - uint32 need_space = pProto->Stackable; + uint32 need_space = pProto->GetMaxStackSize(); if(need_space > count) need_space = count; @@ -9174,7 +9249,7 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED :EQUIP_ERR_ITEM_NOT_FOUND; } - if(pItem && pItem->IsBindedNotWith(GetGUID())) + if(pItem && pItem->IsBindedNotWith(this)) { if(no_space_count) *no_space_count = count; @@ -9223,11 +9298,11 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 if( bag != NULL_BAG ) { // search stack in bag for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { if( bag == INVENTORY_SLOT_BAG_0 ) // inventory { - res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,KEYRING_SLOT_END,dest,pProto,count,true,pItem,bag,slot); + res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) { if(no_space_count) @@ -9313,6 +9388,44 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 *no_space_count = count + no_similar_count; return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; } + + res = _CanStoreItem_InInventorySlots(CURRENCYTOKEN_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,false,pItem,bag,slot); + if(res!=EQUIP_ERR_OK) + { + if(no_space_count) + *no_space_count = count + no_similar_count; + return res; + } + + if(count==0) + { + if(no_similar_count==0) + return EQUIP_ERR_OK; + + if(no_space_count) + *no_space_count = count + no_similar_count; + return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; + } + } + else if(pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS) + { + res = _CanStoreItem_InInventorySlots(CURRENCYTOKEN_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,false,pItem,bag,slot); + if(res!=EQUIP_ERR_OK) + { + if(no_space_count) + *no_space_count = count + no_similar_count; + return res; + } + + if(count==0) + { + if(no_similar_count==0) + return EQUIP_ERR_OK; + + if(no_space_count) + *no_space_count = count + no_similar_count; + return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; + } } res = _CanStoreItem_InInventorySlots(INVENTORY_SLOT_ITEM_START,INVENTORY_SLOT_ITEM_END,dest,pProto,count,false,pItem,bag,slot); @@ -9361,9 +9474,9 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 // not specific bag or have space for partly store only in specific bag // search stack for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { - res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,KEYRING_SLOT_END,dest,pProto,count,true,pItem,bag,slot); + res = _CanStoreItem_InInventorySlots(KEYRING_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) { if(no_space_count) @@ -9401,7 +9514,7 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 if( pProto->BagFamily ) { - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint32 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,true,false,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -9419,7 +9532,7 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 } } - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint32 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,true,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -9461,8 +9574,28 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; } } + else if(pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS) + { + res = _CanStoreItem_InInventorySlots(CURRENCYTOKEN_SLOT_START,CURRENCYTOKEN_SLOT_END,dest,pProto,count,false,pItem,bag,slot); + if(res!=EQUIP_ERR_OK) + { + if(no_space_count) + *no_space_count = count + no_similar_count; + return res; + } + + if(count==0) + { + if(no_similar_count==0) + return EQUIP_ERR_OK; - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + if(no_space_count) + *no_space_count = count + no_similar_count; + return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; + } + } + + for(uint32 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,false,false,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -9499,7 +9632,7 @@ uint8 Player::_CanStoreItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, uint3 return EQUIP_ERR_CANT_CARRY_MORE_OF_THIS; } - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,false,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -9531,12 +9664,14 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const int inv_slot_items[INVENTORY_SLOT_ITEM_END-INVENTORY_SLOT_ITEM_START]; int inv_bags[INVENTORY_SLOT_BAG_END-INVENTORY_SLOT_BAG_START][MAX_BAG_SIZE]; int inv_keys[KEYRING_SLOT_END-KEYRING_SLOT_START]; + int inv_tokens[CURRENCYTOKEN_SLOT_END-CURRENCYTOKEN_SLOT_START]; memset(inv_slot_items,0,sizeof(int)*(INVENTORY_SLOT_ITEM_END-INVENTORY_SLOT_ITEM_START)); memset(inv_bags,0,sizeof(int)*(INVENTORY_SLOT_BAG_END-INVENTORY_SLOT_BAG_START)*MAX_BAG_SIZE); memset(inv_keys,0,sizeof(int)*(KEYRING_SLOT_END-KEYRING_SLOT_START)); + memset(inv_tokens,0,sizeof(int)*(CURRENCYTOKEN_SLOT_END-CURRENCYTOKEN_SLOT_START)); - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); @@ -9546,7 +9681,7 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + for(uint8 i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) { pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); @@ -9556,7 +9691,17 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } } - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = CURRENCYTOKEN_SLOT_START; i < CURRENCYTOKEN_SLOT_END; i++) + { + pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); + + if (pItem2 && !pItem2->IsInTrade()) + { + inv_tokens[i-CURRENCYTOKEN_SLOT_START] = pItem2->GetCount(); + } + } + + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { if(Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { @@ -9572,7 +9717,7 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } // check free space for all items - for (int k=0;k<count;k++) + for (int k = 0; k < count; ++k) { Item *pItem = pItems[k]; @@ -9587,7 +9732,7 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const return EQUIP_ERR_ITEM_NOT_FOUND; // item it 'bind' - if(pItem->IsBindedNotWith(GetGUID())) + if(pItem->IsBindedNotWith(this)) return EQUIP_ERR_DONT_OWN_THAT_ITEM; Bag *pBag; @@ -9599,14 +9744,14 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const return res; // search stack for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { bool b_found = false; - for(int t = KEYRING_SLOT_START; t < KEYRING_SLOT_END; t++) + for(int t = KEYRING_SLOT_START; t < KEYRING_SLOT_END; ++t) { pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, t ); - if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_keys[t-KEYRING_SLOT_START] + pItem->GetCount() <= pProto->Stackable ) + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_keys[t-KEYRING_SLOT_START] + pItem->GetCount() <= pProto->GetMaxStackSize()) { inv_keys[t-KEYRING_SLOT_START] += pItem->GetCount(); b_found = true; @@ -9615,10 +9760,22 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } if (b_found) continue; - for(int t = INVENTORY_SLOT_ITEM_START; t < INVENTORY_SLOT_ITEM_END; t++) + for(int t = CURRENCYTOKEN_SLOT_START; t < CURRENCYTOKEN_SLOT_END; ++t) { pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, t ); - if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_slot_items[t-INVENTORY_SLOT_ITEM_START] + pItem->GetCount() <= pProto->Stackable ) + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_tokens[t-CURRENCYTOKEN_SLOT_START] + pItem->GetCount() <= pProto->GetMaxStackSize()) + { + inv_tokens[t-CURRENCYTOKEN_SLOT_START] += pItem->GetCount(); + b_found = true; + break; + } + } + if (b_found) continue; + + for(int t = INVENTORY_SLOT_ITEM_START; t < INVENTORY_SLOT_ITEM_END; ++t) + { + pItem2 = GetItemByPos( INVENTORY_SLOT_BAG_0, t ); + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_slot_items[t-INVENTORY_SLOT_ITEM_START] + pItem->GetCount() <= pProto->GetMaxStackSize()) { inv_slot_items[t-INVENTORY_SLOT_ITEM_START] += pItem->GetCount(); b_found = true; @@ -9627,15 +9784,15 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const } if (b_found) continue; - for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; t++) + for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; ++t) { pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, t ); - if( pBag ) + if( pBag && ItemCanGoIntoBag(pItem->GetProto(), pBag->GetProto())) { for(uint32 j = 0; j < pBag->GetBagSize(); j++) { pItem2 = GetItemByPos( t, j ); - if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_bags[t-INVENTORY_SLOT_BAG_START][j] + pItem->GetCount() <= pProto->Stackable ) + if( pItem2 && pItem2->GetEntry() == pItem->GetEntry() && inv_bags[t-INVENTORY_SLOT_BAG_START][j] + pItem->GetCount() <= pProto->GetMaxStackSize()) { inv_bags[t-INVENTORY_SLOT_BAG_START][j] += pItem->GetCount(); b_found = true; @@ -9667,7 +9824,22 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const if (b_found) continue; - for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; t++) + if(pProto->BagFamily & BAG_FAMILY_MASK_CURRENCY_TOKENS) + { + for(uint32 t = CURRENCYTOKEN_SLOT_START; t < CURRENCYTOKEN_SLOT_END; ++t) + { + if( inv_tokens[t-CURRENCYTOKEN_SLOT_START] == 0 ) + { + inv_tokens[t-CURRENCYTOKEN_SLOT_START] = 1; + b_found = true; + break; + } + } + } + + if (b_found) continue; + + for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; ++t) { pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, t ); if( pBag ) @@ -9695,7 +9867,7 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const // search free slot bool b_found = false; - for(int t = INVENTORY_SLOT_ITEM_START; t < INVENTORY_SLOT_ITEM_END; t++) + for(int t = INVENTORY_SLOT_ITEM_START; t < INVENTORY_SLOT_ITEM_END; ++t) { if( inv_slot_items[t-INVENTORY_SLOT_ITEM_START] == 0 ) { @@ -9707,7 +9879,7 @@ uint8 Player::CanStoreItems( Item **pItems,int count) const if (b_found) continue; // search free slot in bags - for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; t++) + for(int t = INVENTORY_SLOT_BAG_START; !b_found && t < INVENTORY_SLOT_BAG_END; ++t) { pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, t ); if( pBag ) @@ -9762,12 +9934,7 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo ItemPrototype const *pProto = pItem->GetProto(); if( pProto ) { - // May be here should be more stronger checks; STUNNED checked - // ROOT, CONFUSED, DISTRACTED, FLEEING this needs to be checked. - if (not_loading && hasUnitState(UNIT_STAT_STUNNED)) - return EQUIP_ERR_YOU_ARE_STUNNED; - - if(pItem->IsBindedNotWith(GetGUID())) + if(pItem->IsBindedNotWith(this)) return EQUIP_ERR_DONT_OWN_THAT_ITEM; // check count of items (skip for auto move for same player from bank) @@ -9775,78 +9942,67 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo if(res != EQUIP_ERR_OK) return res; - // do not allow equipping gear except weapons, offhands, projectiles, relics in - // - combat - // - in-progress arenas - if( !pProto->CanChangeEquipStateInCombat() ) + // check this only in game + if(not_loading) { - if( isInCombat() ) - return EQUIP_ERR_NOT_IN_COMBAT; + // May be here should be more stronger checks; STUNNED checked + // ROOT, CONFUSED, DISTRACTED, FLEEING this needs to be checked. + if (hasUnitState(UNIT_STAT_STUNNED)) + return EQUIP_ERR_YOU_ARE_STUNNED; + + // do not allow equipping gear except weapons, offhands, projectiles, relics in + // - combat + // - in-progress arenas + if( !pProto->CanChangeEquipStateInCombat() ) + { + if( isInCombat() ) + return EQUIP_ERR_NOT_IN_COMBAT; - if(BattleGround* bg = GetBattleGround()) - if( bg->isArena() && bg->GetStatus() == STATUS_IN_PROGRESS ) - return EQUIP_ERR_NOT_DURING_ARENA_MATCH; - } + if(BattleGround* bg = GetBattleGround()) + if( bg->isArena() && bg->GetStatus() == STATUS_IN_PROGRESS ) + return EQUIP_ERR_NOT_DURING_ARENA_MATCH; + } + + if(isInCombat()&& pProto->Class == ITEM_CLASS_WEAPON && m_weaponChangeTimer != 0) + return EQUIP_ERR_CANT_DO_RIGHT_NOW; // maybe exist better err - if(isInCombat()&& pProto->Class == ITEM_CLASS_WEAPON && m_weaponChangeTimer != 0) - return EQUIP_ERR_CANT_DO_RIGHT_NOW; // maybe exist better err + if(IsNonMeleeSpellCasted(false)) + return EQUIP_ERR_CANT_DO_RIGHT_NOW; + } - if(IsNonMeleeSpellCasted(false)) - return EQUIP_ERR_CANT_DO_RIGHT_NOW; + ScalingStatDistributionEntry const *ssd = pProto->ScalingStatDistribution ? sScalingStatDistributionStore.LookupEntry(pProto->ScalingStatDistribution) : 0; + if (ssd && ssd->MaxLevel < getLevel()) + return EQUIP_ERR_ITEM_CANT_BE_EQUIPPED; uint8 eslot = FindEquipSlot( pProto, slot, swap ); - if( eslot == NULL_SLOT ) + if (eslot == NULL_SLOT) return EQUIP_ERR_ITEM_CANT_BE_EQUIPPED; - uint8 msg = CanUseItem( pItem , not_loading ); - if( msg != EQUIP_ERR_OK ) + uint8 msg = CanUseItem(pItem , not_loading); + if (msg != EQUIP_ERR_OK) return msg; - if( !swap && GetItemByPos( INVENTORY_SLOT_BAG_0, eslot ) ) + if (!swap && GetItemByPos(INVENTORY_SLOT_BAG_0, eslot)) return EQUIP_ERR_NO_EQUIPMENT_SLOT_AVAILABLE; - // check unique-equipped on item - if (pProto->Flags & ITEM_FLAGS_UNIQUE_EQUIPPED) - { - // there is an equip limit on this item - Item* tItem = GetItemOrItemWithGemEquipped(pProto->ItemId); - if (tItem && (!swap || tItem->GetSlot() != eslot ) ) - return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; - } - - // check unique-equipped on gems - for(uint32 enchant_slot = SOCK_ENCHANTMENT_SLOT; enchant_slot < SOCK_ENCHANTMENT_SLOT+3; ++enchant_slot) - { - uint32 enchant_id = pItem->GetEnchantmentId(EnchantmentSlot(enchant_slot)); - if(!enchant_id) - continue; - SpellItemEnchantmentEntry const* enchantEntry = sSpellItemEnchantmentStore.LookupEntry(enchant_id); - if(!enchantEntry) - continue; - - ItemPrototype const* pGem = objmgr.GetItemPrototype(enchantEntry->GemID); - if(pGem && (pGem->Flags & ITEM_FLAGS_UNIQUE_EQUIPPED)) - { - Item* tItem = GetItemOrItemWithGemEquipped(enchantEntry->GemID); - if(tItem && (!swap || tItem->GetSlot() != eslot )) - return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; - } - } + // if swap ignore item (equipped also) + if (uint8 res2 = CanEquipUniqueItem(pItem, swap ? eslot : NULL_SLOT)) + return res2; // check unique-equipped special item classes if (pProto->Class == ITEM_CLASS_QUIVER) { - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; ++i) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; ++i) { - if( Item* pBag = GetItemByPos( INVENTORY_SLOT_BAG_0, i ) ) + if (Item* pBag = GetItemByPos(INVENTORY_SLOT_BAG_0, i)) { - if( ItemPrototype const* pBagProto = pBag->GetProto() ) + if (pBag != pItem) { - if( pBagProto->Class==pProto->Class && (!swap || pBag->GetSlot() != eslot ) ) + if (ItemPrototype const* pBagProto = pBag->GetProto()) { - if(pBagProto->SubClass == ITEM_SUBCLASS_AMMO_POUCH) - return EQUIP_ERR_CAN_EQUIP_ONLY1_AMMOPOUCH; - else - return EQUIP_ERR_CAN_EQUIP_ONLY1_QUIVER; + if (pBagProto->Class==pProto->Class && (!swap || pBag->GetSlot() != eslot)) + return (pBagProto->SubClass == ITEM_SUBCLASS_AMMO_POUCH) + ? EQUIP_ERR_CAN_EQUIP_ONLY1_AMMOPOUCH + : EQUIP_ERR_CAN_EQUIP_ONLY1_QUIVER; } } } @@ -9855,44 +10011,51 @@ uint8 Player::CanEquipItem( uint8 slot, uint16 &dest, Item *pItem, bool swap, bo uint32 type = pProto->InventoryType; - if(eslot == EQUIPMENT_SLOT_OFFHAND) + if (eslot == EQUIPMENT_SLOT_OFFHAND) { - if( type == INVTYPE_WEAPON || type == INVTYPE_WEAPONOFFHAND ) + if (type == INVTYPE_WEAPON || type == INVTYPE_WEAPONOFFHAND) { - if(!CanDualWield()) + if (!CanDualWield()) return EQUIP_ERR_CANT_DUAL_WIELD; } - - Item *mainItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_MAINHAND ); - if(mainItem) + else if (type == INVTYPE_2HWEAPON) { - if(mainItem->GetProto()->InventoryType == INVTYPE_2HWEAPON) - return EQUIP_ERR_CANT_EQUIP_WITH_TWOHANDED; + if (!CanDualWield() || !CanTitanGrip()) + return EQUIP_ERR_CANT_DUAL_WIELD; } + + if (IsTwoHandUsed()) + return EQUIP_ERR_CANT_EQUIP_WITH_TWOHANDED; } // equip two-hand weapon case (with possible unequip 2 items) - if( type == INVTYPE_2HWEAPON ) + if (type == INVTYPE_2HWEAPON) { - if(eslot != EQUIPMENT_SLOT_MAINHAND) + if (eslot == EQUIPMENT_SLOT_OFFHAND) + { + if (!CanTitanGrip()) + return EQUIP_ERR_ITEM_CANT_BE_EQUIPPED; + } + else if (eslot != EQUIPMENT_SLOT_MAINHAND) return EQUIP_ERR_ITEM_CANT_BE_EQUIPPED; - // offhand item must can be stored in inventory for offhand item and it also must be unequipped - Item *offItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND ); - ItemPosCountVec off_dest; - if( offItem && (!not_loading || - CanUnequipItem(uint16(INVENTORY_SLOT_BAG_0) << 8 | EQUIPMENT_SLOT_OFFHAND,false) != EQUIP_ERR_OK || - CanStoreItem( NULL_BAG, NULL_SLOT, off_dest, offItem, false ) != EQUIP_ERR_OK ) ) - return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED : EQUIP_ERR_INVENTORY_FULL; + if (!CanTitanGrip()) + { + // offhand item must can be stored in inventory for offhand item and it also must be unequipped + Item *offItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND ); + ItemPosCountVec off_dest; + if (offItem && (!not_loading || + CanUnequipItem(uint16(INVENTORY_SLOT_BAG_0) << 8 | EQUIPMENT_SLOT_OFFHAND,false) != EQUIP_ERR_OK || + CanStoreItem( NULL_BAG, NULL_SLOT, off_dest, offItem, false ) != EQUIP_ERR_OK )) + return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED : EQUIP_ERR_INVENTORY_FULL; + } } dest = ((INVENTORY_SLOT_BAG_0 << 8) | eslot); return EQUIP_ERR_OK; } } - if( !swap ) - return EQUIP_ERR_ITEM_NOT_FOUND; - else - return EQUIP_ERR_ITEMS_CANT_BE_SWAPPED; + + return !swap ? EQUIP_ERR_ITEM_NOT_FOUND : EQUIP_ERR_ITEMS_CANT_BE_SWAPPED; } uint8 Player::CanUnequipItem( uint16 pos, bool swap ) const @@ -9934,57 +10097,44 @@ uint8 Player::CanUnequipItem( uint16 pos, bool swap ) const uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *pItem, bool swap, bool not_loading ) const { - if( !pItem ) + if (!pItem) return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED : EQUIP_ERR_ITEM_NOT_FOUND; uint32 count = pItem->GetCount(); sLog.outDebug( "STORAGE: CanBankItem bag = %u, slot = %u, item = %u, count = %u", bag, slot, pItem->GetEntry(), pItem->GetCount()); ItemPrototype const *pProto = pItem->GetProto(); - if( !pProto ) + if (!pProto) return swap ? EQUIP_ERR_ITEMS_CANT_BE_SWAPPED : EQUIP_ERR_ITEM_NOT_FOUND; - if( pItem->IsBindedNotWith(GetGUID()) ) + if (pItem->IsBindedNotWith(this)) return EQUIP_ERR_DONT_OWN_THAT_ITEM; // check count of items (skip for auto move for same player from bank) uint8 res = CanTakeMoreSimilarItems(pItem); - if(res != EQUIP_ERR_OK) + if (res != EQUIP_ERR_OK) return res; // in specific slot - if( bag != NULL_BAG && slot != NULL_SLOT ) + if (bag != NULL_BAG && slot != NULL_SLOT) { - if( pProto->InventoryType == INVTYPE_BAG ) - { - Bag *pBag = (Bag*)pItem; - if( pBag ) - { - if( slot >= BANK_SLOT_BAG_START && slot < BANK_SLOT_BAG_END ) - { - if( !HasBankBagSlot( slot ) ) - return EQUIP_ERR_MUST_PURCHASE_THAT_BAG_SLOT; - if( uint8 cantuse = CanUseItem( pItem, not_loading ) != EQUIP_ERR_OK ) - return cantuse; - } - else - { - if( !pBag->IsEmpty() ) - return EQUIP_ERR_NONEMPTY_BAG_OVER_OTHER_BAG; - } - } - } - else + if (slot >= BANK_SLOT_BAG_START && slot < BANK_SLOT_BAG_END) { - if( slot >= BANK_SLOT_BAG_START && slot < BANK_SLOT_BAG_END ) + if (!pItem->IsBag()) return EQUIP_ERR_ITEM_DOESNT_GO_TO_SLOT; + + if (slot - BANK_SLOT_BAG_START >= GetBankBagSlotCount()) + return EQUIP_ERR_MUST_PURCHASE_THAT_BAG_SLOT; + + if (uint8 cantuse = CanUseItem( pItem, not_loading ) != EQUIP_ERR_OK) + return cantuse; } res = _CanStoreItem_InSpecificSlot(bag,slot,dest,pProto,count,swap,pItem); - if(res!=EQUIP_ERR_OK) + if (res!=EQUIP_ERR_OK) return res; - if(count==0) + if (count==0) return EQUIP_ERR_OK; } @@ -10001,7 +10151,7 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p } // search stack in bag for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { if( bag == INVENTORY_SLOT_BAG_0 ) { @@ -10038,14 +10188,14 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p } else { - res = _CanStoreItem_InBag(bag,dest,pProto,count,false,false,pItem,NULL_BAG,slot); - if(res!=EQUIP_ERR_OK) - res = _CanStoreItem_InBag(bag,dest,pProto,count,false,true,pItem,NULL_BAG,slot); + res = _CanStoreItem_InBag(bag, dest, pProto, count, false, false, pItem, NULL_BAG, slot); + if(res != EQUIP_ERR_OK) + res = _CanStoreItem_InBag(bag, dest, pProto, count, false, true, pItem, NULL_BAG, slot); - if(res!=EQUIP_ERR_OK) + if(res != EQUIP_ERR_OK) return res; - if(count==0) + if(count == 0) return EQUIP_ERR_OK; } } @@ -10053,20 +10203,20 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p // not specific bag or have space for partly store only in specific bag // search stack for merge to - if( pProto->Stackable > 1 ) + if( pProto->Stackable != 1 ) { // in slots res = _CanStoreItem_InInventorySlots(BANK_SLOT_ITEM_START,BANK_SLOT_ITEM_END,dest,pProto,count,true,pItem,bag,slot); - if(res!=EQUIP_ERR_OK) + if(res != EQUIP_ERR_OK) return res; - if(count==0) + if(count == 0) return EQUIP_ERR_OK; // in special bags if( pProto->BagFamily ) { - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,true,false,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -10077,7 +10227,7 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p } } - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,true,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -10091,7 +10241,7 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p // search free place in special bag if( pProto->BagFamily ) { - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,false,false,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -10110,7 +10260,7 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p if(count==0) return EQUIP_ERR_OK; - for(int i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) + for(uint8 i = BANK_SLOT_BAG_START; i < BANK_SLOT_BAG_END; i++) { res = _CanStoreItem_InBag(i,dest,pProto,count,false,true,pItem,bag,slot); if(res!=EQUIP_ERR_OK) @@ -10124,38 +10274,49 @@ uint8 Player::CanBankItem( uint8 bag, uint8 slot, ItemPosCountVec &dest, Item *p uint8 Player::CanUseItem( Item *pItem, bool not_loading ) const { - if( pItem ) + if (pItem) { sLog.outDebug( "STORAGE: CanUseItem item = %u", pItem->GetEntry()); - if( !isAlive() && not_loading ) + + if (!isAlive() && not_loading) return EQUIP_ERR_YOU_ARE_DEAD; - //if( isStunned() ) + + //if (isStunned()) // return EQUIP_ERR_YOU_ARE_STUNNED; + ItemPrototype const *pProto = pItem->GetProto(); - if( pProto ) + if (pProto) { - if( pItem->IsBindedNotWith(GetGUID()) ) + if (pItem->IsBindedNotWith(this)) return EQUIP_ERR_DONT_OWN_THAT_ITEM; - if( (pProto->AllowableClass & getClassMask()) == 0 || (pProto->AllowableRace & getRaceMask()) == 0 ) + + if ((pProto->AllowableClass & getClassMask()) == 0 || (pProto->AllowableRace & getRaceMask()) == 0) return EQUIP_ERR_YOU_CAN_NEVER_USE_THAT_ITEM; - if( pItem->GetSkill() != 0 ) + + if (pItem->GetSkill() != 0) { - if( GetSkillValue( pItem->GetSkill() ) == 0 ) + if (GetSkillValue( pItem->GetSkill() ) == 0) return EQUIP_ERR_NO_REQUIRED_PROFICIENCY; } - if( pProto->RequiredSkill != 0 ) + + if (pProto->RequiredSkill != 0) { - if( GetSkillValue( pProto->RequiredSkill ) == 0 ) + if (GetSkillValue( pProto->RequiredSkill ) == 0) return EQUIP_ERR_NO_REQUIRED_PROFICIENCY; - else if( GetSkillValue( pProto->RequiredSkill ) < pProto->RequiredSkillRank ) + + if (GetSkillValue( pProto->RequiredSkill ) < pProto->RequiredSkillRank) return EQUIP_ERR_ERR_CANT_EQUIP_SKILL; } - if( pProto->RequiredSpell != 0 && !HasSpell( pProto->RequiredSpell ) ) + + if (pProto->RequiredSpell != 0 && !HasSpell(pProto->RequiredSpell)) return EQUIP_ERR_NO_REQUIRED_PROFICIENCY; - if( pProto->RequiredReputationFaction && uint32(GetReputationRank(pProto->RequiredReputationFaction)) < pProto->RequiredReputationRank ) + + if (pProto->RequiredReputationFaction && uint32(GetReputationRank(pProto->RequiredReputationFaction)) < pProto->RequiredReputationRank) return EQUIP_ERR_CANT_EQUIP_REPUTATION; - if( getLevel() < pProto->RequiredLevel ) + + if (getLevel() < pProto->RequiredLevel) return EQUIP_ERR_CANT_EQUIP_LEVEL_I; + return EQUIP_ERR_OK; } } @@ -10209,7 +10370,7 @@ uint8 Player::CanUseAmmo( uint32 item ) const } if( pProto->RequiredSpell != 0 && !HasSpell( pProto->RequiredSpell ) ) return EQUIP_ERR_NO_REQUIRED_PROFICIENCY; - /*if( GetReputation() < pProto->RequiredReputation ) + /*if( GetReputationMgr().GetReputation() < pProto->RequiredReputation ) return EQUIP_ERR_CANT_EQUIP_REPUTATION; */ if( getLevel() < pProto->RequiredLevel ) @@ -10283,7 +10444,7 @@ Item* Player::StoreItem( ItemPosCountVec const& dest, Item* pItem, bool update ) return NULL; Item* lastItem = pItem; - + uint32 entry = pItem->GetEntry(); for(ItemPosCountVec::const_iterator itr = dest.begin(); itr != dest.end(); ) { uint16 pos = itr->pos; @@ -10299,7 +10460,7 @@ Item* Player::StoreItem( ItemPosCountVec const& dest, Item* pItem, bool update ) lastItem = _StoreItem(pos,pItem,count,true,update); } - + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_OWN_ITEM, entry); return lastItem; } @@ -10316,32 +10477,36 @@ Item* Player::_StoreItem( uint16 pos, Item *pItem, uint32 count, bool clone, boo Item *pItem2 = GetItemByPos( bag, slot ); - if( !pItem2 ) + if (!pItem2) { - if(clone) - pItem = pItem->CloneItem(count,this); + if (clone) + pItem = pItem->CloneItem(count, this); else pItem->SetCount(count); - if(!pItem) + if (!pItem) return NULL; - if( pItem->GetProto()->Bonding == BIND_WHEN_PICKED_UP || + if (pItem->GetProto()->Bonding == BIND_WHEN_PICKED_UP || pItem->GetProto()->Bonding == BIND_QUEST_ITEM || - pItem->GetProto()->Bonding == BIND_WHEN_EQUIPED && IsBagPos(pos) ) + (pItem->GetProto()->Bonding == BIND_WHEN_EQUIPED && IsBagPos(pos))) pItem->SetBinding( true ); - if( bag == INVENTORY_SLOT_BAG_0 ) + if (bag == INVENTORY_SLOT_BAG_0) { m_items[slot] = pItem; - SetUInt64Value( (uint16)(PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2) ), pItem->GetGUID() ); + SetUInt64Value( PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2), pItem->GetGUID() ); pItem->SetUInt64Value( ITEM_FIELD_CONTAINED, GetGUID() ); pItem->SetUInt64Value( ITEM_FIELD_OWNER, GetGUID() ); pItem->SetSlot( slot ); pItem->SetContainer( NULL ); - if( IsInWorld() && update ) + // need update known currency + if (slot >= CURRENCYTOKEN_SLOT_START && slot < CURRENCYTOKEN_SLOT_END) + UpdateKnownCurrencies(pItem->GetEntry(), true); + + if (IsInWorld() && update) { pItem->AddToWorld(); pItem->SendUpdateToPlayer( this ); @@ -10349,20 +10514,16 @@ Item* Player::_StoreItem( uint16 pos, Item *pItem, uint32 count, bool clone, boo pItem->SetState(ITEM_CHANGED, this); } - else + else if (Bag *pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, bag )) { - Bag *pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, bag ); - if( pBag ) + pBag->StoreItem( slot, pItem, update ); + if( IsInWorld() && update ) { - pBag->StoreItem( slot, pItem, update ); - if( IsInWorld() && update ) - { - pItem->AddToWorld(); - pItem->SendUpdateToPlayer( this ); - } - pItem->SetState(ITEM_CHANGED, this); - pBag->SetState(ITEM_CHANGED, this); + pItem->AddToWorld(); + pItem->SendUpdateToPlayer( this ); } + pItem->SetState(ITEM_CHANGED, this); + pBag->SetState(ITEM_CHANGED, this); } AddEnchantmentDurations(pItem); @@ -10372,19 +10533,19 @@ Item* Player::_StoreItem( uint16 pos, Item *pItem, uint32 count, bool clone, boo } else { - if( pItem2->GetProto()->Bonding == BIND_WHEN_PICKED_UP || + if (pItem2->GetProto()->Bonding == BIND_WHEN_PICKED_UP || pItem2->GetProto()->Bonding == BIND_QUEST_ITEM || - pItem2->GetProto()->Bonding == BIND_WHEN_EQUIPED && IsBagPos(pos) ) + (pItem2->GetProto()->Bonding == BIND_WHEN_EQUIPED && IsBagPos(pos))) pItem2->SetBinding( true ); pItem2->SetCount( pItem2->GetCount() + count ); - if( IsInWorld() && update ) + if (IsInWorld() && update) pItem2->SendUpdateToPlayer( this ); - if(!clone) + if (!clone) { // delete item (it not in any slot currently) - if( IsInWorld() && update ) + if (IsInWorld() && update) { pItem->RemoveFromWorld(); pItem->DestroyForPlayer( this ); @@ -10396,6 +10557,7 @@ Item* Player::_StoreItem( uint16 pos, Item *pItem, uint32 count, bool clone, boo pItem->SetOwnerGUID(GetGUID()); // prevent error at next SetState in case trade/mail/buy from vendor pItem->SetState(ITEM_REMOVED, this); } + // AddItemDurations(pItem2); - pItem2 already have duration listed for player AddEnchantmentDurations(pItem2); @@ -10407,108 +10569,119 @@ Item* Player::_StoreItem( uint16 pos, Item *pItem, uint32 count, bool clone, boo Item* Player::EquipNewItem( uint16 pos, uint32 item, bool update ) { - Item *pItem = Item::CreateItem( item, 1, this ); - if( pItem ) + if (Item *pItem = Item::CreateItem( item, 1, this )) { ItemAddedQuestCheck( item, 1 ); - Item * retItem = EquipItem( pos, pItem, update ); - - return retItem; + return EquipItem( pos, pItem, update ); } + return NULL; } Item* Player::EquipItem( uint16 pos, Item *pItem, bool update ) { - if( pItem ) - { - AddEnchantmentDurations(pItem); - AddItemDurations(pItem); - uint8 bag = pos >> 8; - uint8 slot = pos & 255; + AddEnchantmentDurations(pItem); + AddItemDurations(pItem); + + uint8 bag = pos >> 8; + uint8 slot = pos & 255; - Item *pItem2 = GetItemByPos( bag, slot ); + Item *pItem2 = GetItemByPos( bag, slot ); - if( !pItem2 ) - { - VisualizeItem( slot, pItem); + if( !pItem2 ) + { + VisualizeItem( slot, pItem); - if(isAlive()) - { - ItemPrototype const *pProto = pItem->GetProto(); + if(isAlive()) + { + ItemPrototype const *pProto = pItem->GetProto(); - // item set bonuses applied only at equip and removed at unequip, and still active for broken items - if(pProto && pProto->ItemSet) - AddItemsSetItem(this,pItem); + // item set bonuses applied only at equip and removed at unequip, and still active for broken items + if(pProto && pProto->ItemSet) + AddItemsSetItem(this, pItem); - _ApplyItemMods(pItem, slot, true); + _ApplyItemMods(pItem, slot, true); - if(pProto && isInCombat()&& pProto->Class == ITEM_CLASS_WEAPON && m_weaponChangeTimer == 0) - { - uint32 cooldownSpell = SPELL_ID_WEAPON_SWITCH_COOLDOWN_1_5s; + if(pProto && isInCombat()&& pProto->Class == ITEM_CLASS_WEAPON && m_weaponChangeTimer == 0) + { + uint32 cooldownSpell = SPELL_ID_WEAPON_SWITCH_COOLDOWN_1_5s; - if (getClass() == CLASS_ROGUE) - cooldownSpell = SPELL_ID_WEAPON_SWITCH_COOLDOWN_1_0s; + if (getClass() == CLASS_ROGUE) + cooldownSpell = SPELL_ID_WEAPON_SWITCH_COOLDOWN_1_0s; - SpellEntry const* spellProto = sSpellStore.LookupEntry(cooldownSpell); + SpellEntry const* spellProto = sSpellStore.LookupEntry(cooldownSpell); - if (!spellProto) - sLog.outError("Weapon switch cooldown spell %u couldn't be found in Spell.dbc", cooldownSpell); - else - { - m_weaponChangeTimer = spellProto->StartRecoveryTime; - - WorldPacket data(SMSG_SPELL_COOLDOWN, 8+1+4); - data << uint64(GetGUID()); - data << uint8(1); - data << uint32(cooldownSpell); - data << uint32(0); - GetSession()->SendPacket(&data); - } + if (!spellProto) + sLog.outError("Weapon switch cooldown spell %u couldn't be found in Spell.dbc", cooldownSpell); + else + { + m_weaponChangeTimer = spellProto->StartRecoveryTime; + + WorldPacket data(SMSG_SPELL_COOLDOWN, 8+1+4); + data << uint64(GetGUID()); + data << uint8(1); + data << uint32(cooldownSpell); + data << uint32(0); + GetSession()->SendPacket(&data); } } + } - if( IsInWorld() && update ) - { - pItem->AddToWorld(); - pItem->SendUpdateToPlayer( this ); - } + if( IsInWorld() && update ) + { + pItem->AddToWorld(); + pItem->SendUpdateToPlayer( this ); + } - ApplyEquipCooldown(pItem); + ApplyEquipCooldown(pItem); - if( slot == EQUIPMENT_SLOT_MAINHAND ) - UpdateExpertise(BASE_ATTACK); - else if( slot == EQUIPMENT_SLOT_OFFHAND ) - UpdateExpertise(OFF_ATTACK); - } - else + // update expertise and armor penetration - passive auras may need it + + if( slot == EQUIPMENT_SLOT_MAINHAND ) + UpdateExpertise(BASE_ATTACK); + else if( slot == EQUIPMENT_SLOT_OFFHAND ) + UpdateExpertise(OFF_ATTACK); + + switch(slot) { - pItem2->SetCount( pItem2->GetCount() + pItem->GetCount() ); - if( IsInWorld() && update ) - pItem2->SendUpdateToPlayer( this ); + case EQUIPMENT_SLOT_MAINHAND: + case EQUIPMENT_SLOT_OFFHAND: + case EQUIPMENT_SLOT_RANGED: + RecalculateRating(CR_ARMOR_PENETRATION); + default: + break; + } + } + else + { + pItem2->SetCount( pItem2->GetCount() + pItem->GetCount() ); + if( IsInWorld() && update ) + pItem2->SendUpdateToPlayer( this ); - // delete item (it not in any slot currently) - //pItem->DeleteFromDB(); - if( IsInWorld() && update ) - { - pItem->RemoveFromWorld(); - pItem->DestroyForPlayer( this ); - } + // delete item (it not in any slot currently) + //pItem->DeleteFromDB(); + if( IsInWorld() && update ) + { + pItem->RemoveFromWorld(); + pItem->DestroyForPlayer( this ); + } - RemoveEnchantmentDurations(pItem); - RemoveItemDurations(pItem); + RemoveEnchantmentDurations(pItem); + RemoveItemDurations(pItem); - pItem->SetOwnerGUID(GetGUID()); // prevent error at next SetState in case trade/mail/buy from vendor - pItem->SetState(ITEM_REMOVED, this); - pItem2->SetState(ITEM_CHANGED, this); + pItem->SetOwnerGUID(GetGUID()); // prevent error at next SetState in case trade/mail/buy from vendor + pItem->SetState(ITEM_REMOVED, this); + pItem2->SetState(ITEM_CHANGED, this); - ApplyEquipCooldown(pItem2); + ApplyEquipCooldown(pItem2); - return pItem2; - } + return pItem2; } + // only for full equip instead adding to stack + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_EQUIP_ITEM, pItem->GetEntry()); + return pItem; } @@ -10527,46 +10700,23 @@ void Player::QuickEquipItem( uint16 pos, Item *pItem) pItem->AddToWorld(); pItem->SendUpdateToPlayer( this ); } + + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_EQUIP_ITEM, pItem->GetEntry()); } } void Player::SetVisibleItemSlot(uint8 slot, Item *pItem) { - // PLAYER_VISIBLE_ITEM_i_CREATOR // Size: 2 - // PLAYER_VISIBLE_ITEM_i_0 // Size: 12 - // entry // Size: 1 - // inspected enchantments // Size: 6 - // ? // Size: 5 - // PLAYER_VISIBLE_ITEM_i_PROPERTIES // Size: 1 (property,suffix factor) - // PLAYER_VISIBLE_ITEM_i_PAD // Size: 1 - // // = 16 - if(pItem) { - SetUInt64Value(PLAYER_VISIBLE_ITEM_1_CREATOR + (slot * MAX_VISIBLE_ITEM_OFFSET), pItem->GetUInt64Value(ITEM_FIELD_CREATOR)); - - int VisibleBase = PLAYER_VISIBLE_ITEM_1_0 + (slot * MAX_VISIBLE_ITEM_OFFSET); - SetUInt32Value(VisibleBase + 0, pItem->GetEntry()); - - for(int i = 0; i < MAX_INSPECTED_ENCHANTMENT_SLOT; ++i) - SetUInt32Value(VisibleBase + 1 + i, pItem->GetEnchantmentId(EnchantmentSlot(i))); - - // Use SetInt16Value to prevent set high part to FFFF for negative value - SetInt16Value( PLAYER_VISIBLE_ITEM_1_PROPERTIES + (slot * MAX_VISIBLE_ITEM_OFFSET), 0, pItem->GetItemRandomPropertyId()); - SetUInt32Value(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 1 + (slot * MAX_VISIBLE_ITEM_OFFSET), pItem->GetItemSuffixFactor()); + SetUInt32Value(PLAYER_VISIBLE_ITEM_1_ENTRYID + (slot * 2), pItem->GetEntry()); + SetUInt16Value(PLAYER_VISIBLE_ITEM_1_ENCHANTMENT + (slot * 2), 0, pItem->GetEnchantmentId(PERM_ENCHANTMENT_SLOT)); + SetUInt16Value(PLAYER_VISIBLE_ITEM_1_ENCHANTMENT + (slot * 2), 1, pItem->GetEnchantmentId(TEMP_ENCHANTMENT_SLOT)); } else { - SetUInt64Value(PLAYER_VISIBLE_ITEM_1_CREATOR + (slot * MAX_VISIBLE_ITEM_OFFSET), 0); - - int VisibleBase = PLAYER_VISIBLE_ITEM_1_0 + (slot * MAX_VISIBLE_ITEM_OFFSET); - SetUInt32Value(VisibleBase + 0, 0); - - for(int i = 0; i < MAX_INSPECTED_ENCHANTMENT_SLOT; ++i) - SetUInt32Value(VisibleBase + 1 + i, 0); - - SetUInt32Value(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 0 + (slot * MAX_VISIBLE_ITEM_OFFSET), 0); - SetUInt32Value(PLAYER_VISIBLE_ITEM_1_PROPERTIES + 1 + (slot * MAX_VISIBLE_ITEM_OFFSET), 0); + SetUInt32Value(PLAYER_VISIBLE_ITEM_1_ENTRYID + (slot * 2), 0); + SetUInt32Value(PLAYER_VISIBLE_ITEM_1_ENCHANTMENT + (slot * 2), 0); } } @@ -10582,14 +10732,14 @@ void Player::VisualizeItem( uint8 slot, Item *pItem) sLog.outDebug( "STORAGE: EquipItem slot = %u, item = %u", slot, pItem->GetEntry()); m_items[slot] = pItem; - SetUInt64Value( (uint16)(PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2) ), pItem->GetGUID() ); + SetUInt64Value( PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2), pItem->GetGUID() ); pItem->SetUInt64Value( ITEM_FIELD_CONTAINED, GetGUID() ); pItem->SetUInt64Value( ITEM_FIELD_OWNER, GetGUID() ); pItem->SetSlot( slot ); pItem->SetContainer( NULL ); if( slot < EQUIPMENT_SLOT_END ) - SetVisibleItemSlot(slot,pItem); + SetVisibleItemSlot(slot, pItem); pItem->SetState(ITEM_CHANGED, this); } @@ -10617,35 +10767,54 @@ void Player::RemoveItem( uint8 bag, uint8 slot, bool update ) // item set bonuses applied only at equip and removed at unequip, and still active for broken items if(pProto && pProto->ItemSet) - RemoveItemsSetItem(this,pProto); + RemoveItemsSetItem(this, pProto); _ApplyItemMods(pItem, slot, false); // remove item dependent auras and casts (only weapon and armor slots) if(slot < EQUIPMENT_SLOT_END) + { RemoveItemDependentAurasAndCasts(pItem); - // remove held enchantments - if ( slot == EQUIPMENT_SLOT_MAINHAND ) - { - if (pItem->GetItemSuffixFactor()) + // remove held enchantments, update expertise + if ( slot == EQUIPMENT_SLOT_MAINHAND ) { - pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_3); - pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_4); + if (pItem->GetItemSuffixFactor()) + { + pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_3); + pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_4); + } + else + { + pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_0); + pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_1); + } + + UpdateExpertise(BASE_ATTACK); } - else + else if( slot == EQUIPMENT_SLOT_OFFHAND ) + UpdateExpertise(OFF_ATTACK); + // update armor penetration - passive auras may need it + switch(slot) { - pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_0); - pItem->ClearEnchantment(PROP_ENCHANTMENT_SLOT_1); + case EQUIPMENT_SLOT_MAINHAND: + case EQUIPMENT_SLOT_OFFHAND: + case EQUIPMENT_SLOT_RANGED: + RecalculateRating(CR_ARMOR_PENETRATION); + default: + break; } } } + // need update known currency + else if (slot >= CURRENCYTOKEN_SLOT_START && slot < CURRENCYTOKEN_SLOT_END) + UpdateKnownCurrencies(pItem->GetEntry(), false); m_items[slot] = NULL; - SetUInt64Value((uint16)(PLAYER_FIELD_INV_SLOT_HEAD + (slot*2)), 0); + SetUInt64Value(PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2), 0); if ( slot < EQUIPMENT_SLOT_END ) - SetVisibleItemSlot(slot,NULL); + SetVisibleItemSlot(slot, NULL); } else { @@ -10658,11 +10827,6 @@ void Player::RemoveItem( uint8 bag, uint8 slot, bool update ) pItem->SetSlot( NULL_SLOT ); if( IsInWorld() && update ) pItem->SendUpdateToPlayer( this ); - - if( slot == EQUIPMENT_SLOT_MAINHAND ) - UpdateExpertise(BASE_ATTACK); - else if( slot == EQUIPMENT_SLOT_OFFHAND ) - UpdateExpertise(OFF_ATTACK); } } @@ -10671,8 +10835,8 @@ void Player::MoveItemFromInventory(uint8 bag, uint8 slot, bool update) { if(Item* it = GetItemByPos(bag,slot)) { - ItemRemovedQuestCheck(it->GetEntry(),it->GetCount()); - RemoveItem( bag,slot,update); + ItemRemovedQuestCheck(it->GetEntry(), it->GetCount()); + RemoveItem(bag, slot, update); it->RemoveFromUpdateQueueOf(this); if(it->IsInWorld()) { @@ -10686,13 +10850,13 @@ void Player::MoveItemFromInventory(uint8 bag, uint8 slot, bool update) void Player::MoveItemToInventory(ItemPosCountVec const& dest, Item* pItem, bool update, bool in_characterInventoryDB) { // update quest counters - ItemAddedQuestCheck(pItem->GetEntry(),pItem->GetCount()); + ItemAddedQuestCheck(pItem->GetEntry(), pItem->GetCount()); // store item - Item* pLastItem = StoreItem( dest, pItem, update); + Item* pLastItem = StoreItem(dest, pItem, update); // only set if not merged to existed stack (pItem can be deleted already but we can compare pointers any way) - if(pLastItem==pItem) + if(pLastItem == pItem) { // update owner for last item (this can be original item with wrong owner if(pLastItem->GetOwnerGUID() != GetGUID()) @@ -10714,8 +10878,8 @@ void Player::DestroyItem( uint8 bag, uint8 slot, bool update ) // start from destroy contained items (only equipped bag can have its) if (pItem->IsBag() && pItem->IsEquipped()) // this also prevent infinity loop if empty bag stored in bag==slot { - for (int i = 0; i < MAX_BAG_SIZE; i++) - DestroyItem(slot,i,update); + for (uint8 i = 0; i < MAX_BAG_SIZE; ++i) + DestroyItem(slot, i, update); } if(pItem->HasFlag(ITEM_FIELD_FLAGS, ITEM_FLAGS_WRAPPED)) @@ -10728,7 +10892,7 @@ void Player::DestroyItem( uint8 bag, uint8 slot, bool update ) if( bag == INVENTORY_SLOT_BAG_0 ) { - SetUInt64Value((uint16)(PLAYER_FIELD_INV_SLOT_HEAD + (slot*2)), 0); + SetUInt64Value(PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2), 0); // equipment and equipped bags can have applied bonuses if ( slot < INVENTORY_SLOT_BAG_END ) @@ -10737,7 +10901,7 @@ void Player::DestroyItem( uint8 bag, uint8 slot, bool update ) // item set bonuses applied only at equip and removed at unequip, and still active for broken items if(pProto && pProto->ItemSet) - RemoveItemsSetItem(this,pProto); + RemoveItemsSetItem(this, pProto); _ApplyItemMods(pItem, slot, false); } @@ -10747,9 +10911,28 @@ void Player::DestroyItem( uint8 bag, uint8 slot, bool update ) // remove item dependent auras and casts (only weapon and armor slots) RemoveItemDependentAurasAndCasts(pItem); + // update expertise and armor penetration - passive auras may need it + switch(slot) + { + case EQUIPMENT_SLOT_MAINHAND: + case EQUIPMENT_SLOT_OFFHAND: + case EQUIPMENT_SLOT_RANGED: + RecalculateRating(CR_ARMOR_PENETRATION); + default: + break; + } + + if ( slot == EQUIPMENT_SLOT_MAINHAND ) + UpdateExpertise(BASE_ATTACK); + else if( slot == EQUIPMENT_SLOT_OFFHAND ) + UpdateExpertise(OFF_ATTACK); + // equipment visual show - SetVisibleItemSlot(slot,NULL); + SetVisibleItemSlot(slot, NULL); } + // need update known currency + else if (slot >= CURRENCYTOKEN_SLOT_START && slot < CURRENCYTOKEN_SLOT_END) + UpdateKnownCurrencies(pItem->GetEntry(), false); m_items[slot] = NULL; } @@ -10772,92 +10955,94 @@ void Player::DestroyItem( uint8 bag, uint8 slot, bool update ) void Player::DestroyItemCount( uint32 item, uint32 count, bool update, bool unequip_check) { sLog.outDebug( "STORAGE: DestroyItemCount item = %u, count = %u", item, count); - Item *pItem; - ItemPrototype const *pProto; uint32 remcount = 0; // in inventory - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { - if( pItem->GetCount() + remcount <= count ) + if (pItem->GetEntry() == item) { - // all items in inventory can unequipped - remcount += pItem->GetCount(); - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + if (pItem->GetCount() + remcount <= count) + { + // all items in inventory can unequipped + remcount += pItem->GetCount(); + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - if(remcount >=count) + if (remcount >= count) + return; + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() & update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); return; - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() & update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; + } } } } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) + + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { - if( pItem->GetCount() + remcount <= count ) + if (pItem->GetEntry() == item) { - // all keys can be unequipped - remcount += pItem->GetCount(); - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + if (pItem->GetCount() + remcount <= count) + { + // all keys can be unequipped + remcount += pItem->GetCount(); + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - if(remcount >=count) + if (remcount >= count) + return; + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() & update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); return; - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() & update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; + } } } } // in inventory bags - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { if(Bag *pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { for(uint32 j = 0; j < pBag->GetBagSize(); j++) { - pItem = pBag->GetItemByPos(j); - if( pItem && pItem->GetEntry() == item ) + if(Item* pItem = pBag->GetItemByPos(j)) { - // all items in bags can be unequipped - if( pItem->GetCount() + remcount <= count ) + if (pItem->GetEntry() == item) { - remcount += pItem->GetCount(); - DestroyItem( i, j, update ); + // all items in bags can be unequipped + if (pItem->GetCount() + remcount <= count) + { + remcount += pItem->GetCount(); + DestroyItem( i, j, update ); - if(remcount >=count) + if (remcount >= count) + return; + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() && update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); return; - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() && update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; + } } } } @@ -10865,31 +11050,32 @@ void Player::DestroyItemCount( uint32 item, uint32 count, bool update, bool uneq } // in equipment and bag list - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) { - pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetEntry() == item ) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) { - if( pItem->GetCount() + remcount <= count ) + if (pItem && pItem->GetEntry() == item) { - if(!unequip_check || CanUnequipItem(INVENTORY_SLOT_BAG_0 << 8 | i,false) == EQUIP_ERR_OK ) + if (pItem->GetCount() + remcount <= count) { - remcount += pItem->GetCount(); - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + if (!unequip_check || CanUnequipItem(INVENTORY_SLOT_BAG_0 << 8 | i, false) == EQUIP_ERR_OK ) + { + remcount += pItem->GetCount(); + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - if(remcount >=count) - return; + if (remcount >= count) + return; + } + } + else + { + ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); + pItem->SetCount( pItem->GetCount() - count + remcount ); + if (IsInWorld() & update) + pItem->SendUpdateToPlayer( this ); + pItem->SetState(ITEM_CHANGED, this); + return; } - } - else - { - pProto = pItem->GetProto(); - ItemRemovedQuestCheck( pItem->GetEntry(), count - remcount ); - pItem->SetCount( pItem->GetCount() - count + remcount ); - if( IsInWorld() & update ) - pItem->SendUpdateToPlayer( this ); - pItem->SetState(ITEM_CHANGED, this); - return; } } } @@ -10900,41 +11086,29 @@ void Player::DestroyZoneLimitedItem( bool update, uint32 new_zone ) sLog.outDebug( "STORAGE: DestroyZoneLimitedItem in map %u and area %u", GetMapId(), new_zone ); // in inventory - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } - for(int i = KEYRING_SLOT_START; i < KEYRING_SLOT_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(), new_zone)) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); + + for(uint8 i = KEYRING_SLOT_START; i < CURRENCYTOKEN_SLOT_END; ++i) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(), new_zone)) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); // in inventory bags - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pBag ) - { + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + if (Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) for(uint32 j = 0; j < pBag->GetBagSize(); j++) - { - Item* pItem = pBag->GetItemByPos(j); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( i, j, update); - } - } - } + if (Item* pItem = pBag->GetItemByPos(j)) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(), new_zone)) + DestroyItem(i, j, update); // in equipment and bag list - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->IsLimitedToAnotherMapOrZone(GetMapId(),new_zone) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsLimitedToAnotherMapOrZone(GetMapId(), new_zone)) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); } void Player::DestroyConjuredItems( bool update ) @@ -10944,41 +11118,24 @@ void Player::DestroyConjuredItems( bool update ) sLog.outDebug( "STORAGE: DestroyConjuredItems" ); // in inventory - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetProto() && - (pItem->GetProto()->Class == ITEM_CLASS_CONSUMABLE) && - (pItem->GetProto()->Flags & ITEM_FLAGS_CONJURED) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsConjuredConsumable()) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); // in inventory bags - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pBag ) - { + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + if (Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i )) for(uint32 j = 0; j < pBag->GetBagSize(); j++) - { - Item* pItem = pBag->GetItemByPos(j); - if( pItem && pItem->GetProto() && - (pItem->GetProto()->Class == ITEM_CLASS_CONSUMABLE) && - (pItem->GetProto()->Flags & ITEM_FLAGS_CONJURED) ) - DestroyItem( i, j, update); - } - } - } + if (Item* pItem = pBag->GetItemByPos(j)) + if (pItem->IsConjuredConsumable()) + DestroyItem( i, j, update); // in equipment and bag list - for(int i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) - { - Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); - if( pItem && pItem->GetProto() && - (pItem->GetProto()->Class == ITEM_CLASS_CONSUMABLE) && - (pItem->GetProto()->Flags & ITEM_FLAGS_CONJURED) ) - DestroyItem( INVENTORY_SLOT_BAG_0, i, update); - } + for(uint8 i = EQUIPMENT_SLOT_START; i < INVENTORY_SLOT_BAG_END; i++) + if (Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + if (pItem->IsConjuredConsumable()) + DestroyItem( INVENTORY_SLOT_BAG_0, i, update); } void Player::DestroyItemCount( Item* pItem, uint32 &count, bool update ) @@ -10990,7 +11147,7 @@ void Player::DestroyItemCount( Item* pItem, uint32 &count, bool update ) if( pItem->GetCount() <= count ) { - count-= pItem->GetCount(); + count -= pItem->GetCount(); DestroyItem( pItem->GetBagSlot(),pItem->GetSlot(), update); } @@ -11134,6 +11291,8 @@ void Player::SwapItem( uint16 src, uint16 dst ) return; } + // SRC checks + if(pSrcItem->m_lootGenerated) // prevent swap looting item { //best error message found for attempting to swap while looting @@ -11144,8 +11303,8 @@ void Player::SwapItem( uint16 src, uint16 dst ) // check unequip potability for equipped items and bank bags if(IsEquipmentPos ( src ) || IsBagPos ( src )) { - // bags can be swapped with empty bag slots - uint8 msg = CanUnequipItem( src, !IsBagPos ( src ) || IsBagPos ( dst )); + // bags can be swapped with empty bag slots, or with empty bag (items move possibility checked later) + uint8 msg = CanUnequipItem( src, !IsBagPos ( src ) || IsBagPos ( dst ) || pDstItem && pDstItem->IsBag() && ((Bag*)pDstItem)->IsEmpty()); if(msg != EQUIP_ERR_OK) { SendEquipError( msg, pSrcItem, pDstItem ); @@ -11160,6 +11319,34 @@ void Player::SwapItem( uint16 src, uint16 dst ) return; } + // DST checks + + if (pDstItem) + { + if(pDstItem->m_lootGenerated) // prevent swap looting item + { + //best error message found for attempting to swap while looting + SendEquipError( EQUIP_ERR_CANT_DO_RIGHT_NOW, pDstItem, NULL ); + return; + } + + // check unequip potability for equipped items and bank bags + if(IsEquipmentPos ( dst ) || IsBagPos ( dst )) + { + // bags can be swapped with empty bag slots, or with empty bag (items move possibility checked later) + uint8 msg = CanUnequipItem( dst, !IsBagPos ( dst ) || IsBagPos ( src ) || pSrcItem->IsBag() && ((Bag*)pSrcItem)->IsEmpty()); + if(msg != EQUIP_ERR_OK) + { + SendEquipError( msg, pSrcItem, pDstItem ); + return; + } + } + } + + // NOW this is or item move (swap with empty), or swap with another item (including bags in bag possitions) + // or swap empty bag with another empty or not empty bag (with items exchange) + + // Move case if( !pDstItem ) { if( IsInventoryPos( dst ) ) @@ -11199,143 +11386,190 @@ void Player::SwapItem( uint16 src, uint16 dst ) } RemoveItem(srcbag, srcslot, true); - EquipItem( dest, pSrcItem, true); + EquipItem(dest, pSrcItem, true); AutoUnequipOffhandIfNeed(); } + + return; } - else // if (!pDstItem) + + // attempt merge to / fill target item + if(!pSrcItem->IsBag() && !pDstItem->IsBag()) { - if(pDstItem->m_lootGenerated) // prevent swap looting item - { - //best error message found for attempting to swap while looting - SendEquipError( EQUIP_ERR_CANT_DO_RIGHT_NOW, pDstItem, NULL ); + uint8 msg; + ItemPosCountVec sDest; + uint16 eDest; + if( IsInventoryPos( dst ) ) + msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, false ); + else if( IsBankPos ( dst ) ) + msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, false ); + else if( IsEquipmentPos ( dst ) ) + msg = CanEquipItem( dstslot, eDest, pSrcItem, false ); + else return; - } - // check unequip potability for equipped items and bank bags - if(IsEquipmentPos ( dst ) || IsBagPos ( dst )) + // can be merge/fill + if(msg == EQUIP_ERR_OK) { - // bags can be swapped with empty bag slots - uint8 msg = CanUnequipItem( dst, !IsBagPos ( dst ) || IsBagPos ( src ) ); - if(msg != EQUIP_ERR_OK) + if( pSrcItem->GetCount() + pDstItem->GetCount() <= pSrcItem->GetProto()->GetMaxStackSize()) { - SendEquipError( msg, pSrcItem, pDstItem ); - return; - } - } + RemoveItem(srcbag, srcslot, true); - // attempt merge to / fill target item - { - uint8 msg; - ItemPosCountVec sDest; - uint16 eDest; - if( IsInventoryPos( dst ) ) - msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, false ); - else if( IsBankPos ( dst ) ) - msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, false ); - else if( IsEquipmentPos ( dst ) ) - msg = CanEquipItem( dstslot, eDest, pSrcItem, false ); - else - return; - - // can be merge/fill - if(msg == EQUIP_ERR_OK) - { - if( pSrcItem->GetCount() + pDstItem->GetCount() <= pSrcItem->GetProto()->Stackable ) + if( IsInventoryPos( dst ) ) + StoreItem( sDest, pSrcItem, true); + else if( IsBankPos ( dst ) ) + BankItem( sDest, pSrcItem, true); + else if( IsEquipmentPos ( dst ) ) { - RemoveItem(srcbag, srcslot, true); - - if( IsInventoryPos( dst ) ) - StoreItem( sDest, pSrcItem, true); - else if( IsBankPos ( dst ) ) - BankItem( sDest, pSrcItem, true); - else if( IsEquipmentPos ( dst ) ) - { - EquipItem( eDest, pSrcItem, true); - AutoUnequipOffhandIfNeed(); - } + EquipItem( eDest, pSrcItem, true); + AutoUnequipOffhandIfNeed(); } - else + } + else + { + pSrcItem->SetCount( pSrcItem->GetCount() + pDstItem->GetCount() - pSrcItem->GetProto()->GetMaxStackSize()); + pDstItem->SetCount( pSrcItem->GetProto()->GetMaxStackSize()); + pSrcItem->SetState(ITEM_CHANGED, this); + pDstItem->SetState(ITEM_CHANGED, this); + if( IsInWorld() ) { - pSrcItem->SetCount( pSrcItem->GetCount() + pDstItem->GetCount() - pSrcItem->GetProto()->Stackable ); - pDstItem->SetCount( pSrcItem->GetProto()->Stackable ); - pSrcItem->SetState(ITEM_CHANGED, this); - pDstItem->SetState(ITEM_CHANGED, this); - if( IsInWorld() ) - { - pSrcItem->SendUpdateToPlayer( this ); - pDstItem->SendUpdateToPlayer( this ); - } + pSrcItem->SendUpdateToPlayer( this ); + pDstItem->SendUpdateToPlayer( this ); } - return; } + return; } + } - // impossible merge/fill, do real swap - uint8 msg; + // impossible merge/fill, do real swap + uint8 msg; - // check src->dest move possibility - ItemPosCountVec sDest; - uint16 eDest; - if( IsInventoryPos( dst ) ) - msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, true ); - else if( IsBankPos( dst ) ) - msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, true ); - else if( IsEquipmentPos( dst ) ) - { - msg = CanEquipItem( dstslot, eDest, pSrcItem, true ); - if( msg == EQUIP_ERR_OK ) - msg = CanUnequipItem( eDest, true ); - } + // check src->dest move possibility + ItemPosCountVec sDest; + uint16 eDest = 0; + if( IsInventoryPos( dst ) ) + msg = CanStoreItem( dstbag, dstslot, sDest, pSrcItem, true ); + else if( IsBankPos( dst ) ) + msg = CanBankItem( dstbag, dstslot, sDest, pSrcItem, true ); + else if( IsEquipmentPos( dst ) ) + { + msg = CanEquipItem( dstslot, eDest, pSrcItem, true ); + if( msg == EQUIP_ERR_OK ) + msg = CanUnequipItem( eDest, true ); + } - if( msg != EQUIP_ERR_OK ) + if( msg != EQUIP_ERR_OK ) + { + SendEquipError( msg, pSrcItem, pDstItem ); + return; + } + + // check dest->src move possibility + ItemPosCountVec sDest2; + uint16 eDest2 = 0; + if( IsInventoryPos( src ) ) + msg = CanStoreItem( srcbag, srcslot, sDest2, pDstItem, true ); + else if( IsBankPos( src ) ) + msg = CanBankItem( srcbag, srcslot, sDest2, pDstItem, true ); + else if( IsEquipmentPos( src ) ) + { + msg = CanEquipItem( srcslot, eDest2, pDstItem, true); + if( msg == EQUIP_ERR_OK ) + msg = CanUnequipItem( eDest2, true); + } + + if( msg != EQUIP_ERR_OK ) + { + SendEquipError( msg, pDstItem, pSrcItem ); + return; + } + + // Check bag swap with item exchange (one from empty in not bag possition (equipped (not possible in fact) or store) + if(pSrcItem->IsBag() && pDstItem->IsBag()) + { + Bag* emptyBag = NULL; + Bag* fullBag = NULL; + if(((Bag*)pSrcItem)->IsEmpty() && !IsBagPos(src)) { - SendEquipError( msg, pSrcItem, pDstItem ); - return; + emptyBag = (Bag*)pSrcItem; + fullBag = (Bag*)pDstItem; } - - // check dest->src move possibility - ItemPosCountVec sDest2; - uint16 eDest2; - if( IsInventoryPos( src ) ) - msg = CanStoreItem( srcbag, srcslot, sDest2, pDstItem, true ); - else if( IsBankPos( src ) ) - msg = CanBankItem( srcbag, srcslot, sDest2, pDstItem, true ); - else if( IsEquipmentPos( src ) ) + else if(((Bag*)pDstItem)->IsEmpty() && !IsBagPos(dst)) { - msg = CanEquipItem( srcslot, eDest2, pDstItem, true); - if( msg == EQUIP_ERR_OK ) - msg = CanUnequipItem( eDest2, true); + emptyBag = (Bag*)pDstItem; + fullBag = (Bag*)pSrcItem; } - if( msg != EQUIP_ERR_OK ) + // bag swap (with items exchange) case + if(emptyBag && fullBag) { - SendEquipError( msg, pDstItem, pSrcItem ); - return; - } + ItemPrototype const* emotyProto = emptyBag->GetProto(); - // now do moves, remove... - RemoveItem(dstbag, dstslot, false); - RemoveItem(srcbag, srcslot, false); + uint32 count = 0; - // add to dest - if( IsInventoryPos( dst ) ) - StoreItem(sDest, pSrcItem, true); - else if( IsBankPos( dst ) ) - BankItem(sDest, pSrcItem, true); - else if( IsEquipmentPos( dst ) ) - EquipItem(eDest, pSrcItem, true); - - // add to src - if( IsInventoryPos( src ) ) - StoreItem(sDest2, pDstItem, true); - else if( IsBankPos( src ) ) - BankItem(sDest2, pDstItem, true); - else if( IsEquipmentPos( src ) ) - EquipItem(eDest2, pDstItem, true); + for(uint32 i=0; i < fullBag->GetBagSize(); ++i) + { + Item *bagItem = fullBag->GetItemByPos(i); + if (!bagItem) + continue; - AutoUnequipOffhandIfNeed(); + ItemPrototype const* bagItemProto = bagItem->GetProto(); + if (!bagItemProto || !ItemCanGoIntoBag(bagItemProto, emotyProto)) + { + // one from items not go to empty target bag + SendEquipError( EQUIP_ERR_NONEMPTY_BAG_OVER_OTHER_BAG, pSrcItem, pDstItem ); + return; + } + + ++count; + } + + + if (count > emptyBag->GetBagSize()) + { + // too small targeted bag + SendEquipError( EQUIP_ERR_ITEMS_CANT_BE_SWAPPED, pSrcItem, pDstItem ); + return; + } + + // Items swap + count = 0; // will pos in new bag + for(uint32 i = 0; i< fullBag->GetBagSize(); ++i) + { + Item *bagItem = fullBag->GetItemByPos(i); + if (!bagItem) + continue; + + fullBag->RemoveItem(i, true); + emptyBag->StoreItem(count, bagItem, true); + bagItem->SetState(ITEM_CHANGED, this); + + ++count; + } + } } + + // now do moves, remove... + RemoveItem(dstbag, dstslot, false); + RemoveItem(srcbag, srcslot, false); + + // add to dest + if( IsInventoryPos( dst ) ) + StoreItem(sDest, pSrcItem, true); + else if( IsBankPos( dst ) ) + BankItem(sDest, pSrcItem, true); + else if( IsEquipmentPos( dst ) ) + EquipItem(eDest, pSrcItem, true); + + // add to src + if( IsInventoryPos( src ) ) + StoreItem(sDest2, pDstItem, true); + else if( IsBankPos( src ) ) + BankItem(sDest2, pDstItem, true); + else if( IsEquipmentPos( src ) ) + EquipItem(eDest2, pDstItem, true); + + AutoUnequipOffhandIfNeed(); } void Player::AddItemToBuyBackSlot( Item *pItem ) @@ -11379,7 +11613,7 @@ void Player::AddItemToBuyBackSlot( Item *pItem ) uint32 etime = uint32(base - m_logintime + (30 * 3600)); uint32 eslot = slot - BUYBACK_SLOT_START; - SetUInt64Value( PLAYER_FIELD_VENDORBUYBACK_SLOT_1 + eslot * 2, pItem->GetGUID() ); + SetUInt64Value( PLAYER_FIELD_VENDORBUYBACK_SLOT_1 + (eslot * 2), pItem->GetGUID() ); ItemPrototype const *pProto = pItem->GetProto(); if( pProto ) SetUInt32Value( PLAYER_FIELD_BUYBACK_PRICE_1 + eslot, pProto->SellPrice * pItem->GetCount() ); @@ -11388,7 +11622,7 @@ void Player::AddItemToBuyBackSlot( Item *pItem ) SetUInt32Value( PLAYER_FIELD_BUYBACK_TIMESTAMP_1 + eslot, (uint32)etime ); // move to next (for non filled list is move most optimized choice) - if(m_currentBuybackSlot < BUYBACK_SLOT_END-1) + if(m_currentBuybackSlot < BUYBACK_SLOT_END - 1) ++m_currentBuybackSlot; } } @@ -11416,7 +11650,7 @@ void Player::RemoveItemFromBuyBackSlot( uint32 slot, bool del ) m_items[slot] = NULL; uint32 eslot = slot - BUYBACK_SLOT_START; - SetUInt64Value( PLAYER_FIELD_VENDORBUYBACK_SLOT_1 + eslot * 2, 0 ); + SetUInt64Value( PLAYER_FIELD_VENDORBUYBACK_SLOT_1 + (eslot * 2), 0 ); SetUInt32Value( PLAYER_FIELD_BUYBACK_PRICE_1 + eslot, 0 ); SetUInt32Value( PLAYER_FIELD_BUYBACK_TIMESTAMP_1 + eslot, 0 ); @@ -11428,7 +11662,7 @@ void Player::RemoveItemFromBuyBackSlot( uint32 slot, bool del ) void Player::SendEquipError( uint8 msg, Item* pItem, Item *pItem2 ) { - sLog.outDebug( "WORLD: Sent SMSG_INVENTORY_CHANGE_FAILURE (%u)",msg); + sLog.outDebug( "WORLD: Sent SMSG_INVENTORY_CHANGE_FAILURE (%u)", msg); WorldPacket data( SMSG_INVENTORY_CHANGE_FAILURE, (msg == EQUIP_ERR_CANT_EQUIP_LEVEL_I ? 22 : 18) ); data << uint8(msg); @@ -11480,7 +11714,7 @@ void Player::ClearTrade() { tradeGold = 0; acceptTrade = false; - for(int i = 0; i < TRADE_SLOT_COUNT; i++) + for(uint8 i = 0; i < TRADE_SLOT_COUNT; i++) tradeItems[i] = NULL_SLOT; } @@ -11511,9 +11745,9 @@ void Player::UpdateItemDuration(uint32 time, bool realtimeonly) if(m_itemDuration.empty()) return; - sLog.outDebug("Player::UpdateItemDuration(%u,%u)", time,realtimeonly); + sLog.outDebug("Player::UpdateItemDuration(%u,%u)", time, realtimeonly); - for(ItemDurationList::iterator itr = m_itemDuration.begin();itr != m_itemDuration.end(); ) + for(ItemDurationList::const_iterator itr = m_itemDuration.begin(); itr != m_itemDuration.end(); ) { Item* item = *itr; ++itr; // current element can be erased in UpdateDuration @@ -11528,14 +11762,14 @@ void Player::UpdateEnchantTime(uint32 time) for(EnchantDurationList::iterator itr = m_enchantDuration.begin(),next;itr != m_enchantDuration.end();itr=next) { assert(itr->item); - next=itr; + next = itr; if(!itr->item->GetEnchantmentId(itr->slot)) { next = m_enchantDuration.erase(itr); } else if(itr->leftduration <= time) { - ApplyEnchantment(itr->item,itr->slot,false,false); + ApplyEnchantment(itr->item, itr->slot, false, false); itr->item->ClearEnchantment(itr->slot); next = m_enchantDuration.erase(itr); } @@ -11549,25 +11783,25 @@ void Player::UpdateEnchantTime(uint32 time) void Player::AddEnchantmentDurations(Item *item) { - for(int x=0;x<MAX_ENCHANTMENT_SLOT;++x) + for(int x = 0; x < MAX_ENCHANTMENT_SLOT; ++x) { if(!item->GetEnchantmentId(EnchantmentSlot(x))) continue; uint32 duration = item->GetEnchantmentDuration(EnchantmentSlot(x)); if( duration > 0 ) - AddEnchantmentDuration(item,EnchantmentSlot(x),duration); + AddEnchantmentDuration(item, EnchantmentSlot(x), duration); } } void Player::RemoveEnchantmentDurations(Item *item) { - for(EnchantDurationList::iterator itr = m_enchantDuration.begin();itr != m_enchantDuration.end();) + for(EnchantDurationList::iterator itr = m_enchantDuration.begin(); itr != m_enchantDuration.end();) { if(itr->item == item) { // save duration in item - item->SetEnchantmentDuration(EnchantmentSlot(itr->slot),itr->leftduration); + item->SetEnchantmentDuration(EnchantmentSlot(itr->slot), itr->leftduration); itr = m_enchantDuration.erase(itr); } else @@ -11575,31 +11809,24 @@ void Player::RemoveEnchantmentDurations(Item *item) } } -void Player::RemoveAllEnchantments(EnchantmentSlot slot, bool arena) +void Player::RemoveArenaEnchantments(EnchantmentSlot slot) { // remove enchantments from equipped items first to clean up the m_enchantDuration list - for(EnchantDurationList::iterator itr = m_enchantDuration.begin(),next;itr != m_enchantDuration.end();itr=next) + for(EnchantDurationList::iterator itr = m_enchantDuration.begin(), next; itr != m_enchantDuration.end(); itr = next) { next = itr; - if(itr->slot==slot) + if(itr->slot == slot) { - if(arena && itr->item) + if(itr->item && itr->item->GetEnchantmentId(slot)) { - uint32 enchant_id = itr->item->GetEnchantmentId(slot); - if(enchant_id) + // Poisons and DK runes are enchants which are allowed on arenas + if (spellmgr.IsArenaAllowedEnchancment(itr->item->GetEnchantmentId(slot))) { - SpellItemEnchantmentEntry const *pEnchant = sSpellItemEnchantmentStore.LookupEntry(enchant_id); - if(pEnchant && pEnchant->aura_id == ITEM_ENCHANTMENT_AURAID_POISON) - { - ++next; - continue; - } + ++next; + continue; } - } - if(itr->item && itr->item->GetEnchantmentId(slot)) - { // remove from stats - ApplyEnchantment(itr->item,slot,false,false); + ApplyEnchantment(itr->item, slot, false, false); // remove visual itr->item->ClearEnchantment(slot); } @@ -11613,7 +11840,7 @@ void Player::RemoveAllEnchantments(EnchantmentSlot slot, bool arena) // remove enchants from inventory items // NOTE: no need to remove these from stats, since these aren't equipped // in inventory - for(int i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) + for(uint8 i = INVENTORY_SLOT_ITEM_START; i < INVENTORY_SLOT_ITEM_END; i++) { Item* pItem = GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pItem && pItem->GetEnchantmentId(slot) ) @@ -11621,7 +11848,7 @@ void Player::RemoveAllEnchantments(EnchantmentSlot slot, bool arena) } // in inventory bags - for(int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) + for(uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END; i++) { Bag* pBag = (Bag*)GetItemByPos( INVENTORY_SLOT_BAG_0, i ); if( pBag ) @@ -11645,19 +11872,19 @@ void Player::AddEnchantmentDuration(Item *item,EnchantmentSlot slot,uint32 durat if(slot >= MAX_ENCHANTMENT_SLOT) return; - for(EnchantDurationList::iterator itr = m_enchantDuration.begin();itr != m_enchantDuration.end();++itr) + for(EnchantDurationList::iterator itr = m_enchantDuration.begin(); itr != m_enchantDuration.end(); ++itr) { if(itr->item == item && itr->slot == slot) { - itr->item->SetEnchantmentDuration(itr->slot,itr->leftduration); + itr->item->SetEnchantmentDuration(itr->slot, itr->leftduration); m_enchantDuration.erase(itr); break; } } if(item && duration > 0 ) { - GetSession()->SendItemEnchantTimeUpdate(GetGUID(), item->GetGUID(),slot,uint32(duration/1000)); - m_enchantDuration.push_back(EnchantDuration(item,slot,duration)); + GetSession()->SendItemEnchantTimeUpdate(GetGUID(), item->GetGUID(), slot, uint32(duration/1000)); + m_enchantDuration.push_back(EnchantDuration(item, slot, duration)); } } @@ -11667,7 +11894,7 @@ void Player::ApplyEnchantment(Item *item,bool apply) ApplyEnchantment(item, EnchantmentSlot(slot), apply); } -void Player::ApplyEnchantment(Item *item,EnchantmentSlot slot,bool apply, bool apply_dur, bool ignore_condition) +void Player::ApplyEnchantment(Item *item, EnchantmentSlot slot, bool apply, bool apply_dur, bool ignore_condition) { if(!item) return; @@ -11689,268 +11916,320 @@ void Player::ApplyEnchantment(Item *item,EnchantmentSlot slot,bool apply, bool a if(!ignore_condition && pEnchant->EnchantmentCondition && !((Player*)this)->EnchantmentFitsRequirements(pEnchant->EnchantmentCondition, -1)) return; - for (int s=0; s<3; s++) + if (!item->IsBroken()) { - uint32 enchant_display_type = pEnchant->type[s]; - uint32 enchant_amount = pEnchant->amount[s]; - uint32 enchant_spell_id = pEnchant->spellid[s]; - - switch(enchant_display_type) + for (int s = 0; s < 3; ++s) { - case ITEM_ENCHANTMENT_TYPE_NONE: - break; - case ITEM_ENCHANTMENT_TYPE_COMBAT_SPELL: - // processed in Player::CastItemCombatSpell - break; - case ITEM_ENCHANTMENT_TYPE_DAMAGE: - if (item->GetSlot() == EQUIPMENT_SLOT_MAINHAND) - HandleStatModifier(UNIT_MOD_DAMAGE_MAINHAND, TOTAL_VALUE, float(enchant_amount), apply); - else if (item->GetSlot() == EQUIPMENT_SLOT_OFFHAND) - HandleStatModifier(UNIT_MOD_DAMAGE_OFFHAND, TOTAL_VALUE, float(enchant_amount), apply); - else if (item->GetSlot() == EQUIPMENT_SLOT_RANGED) - HandleStatModifier(UNIT_MOD_DAMAGE_RANGED, TOTAL_VALUE, float(enchant_amount), apply); - break; - case ITEM_ENCHANTMENT_TYPE_EQUIP_SPELL: - if(enchant_spell_id) - { - if(apply) + uint32 enchant_display_type = pEnchant->type[s]; + uint32 enchant_amount = pEnchant->amount[s]; + uint32 enchant_spell_id = pEnchant->spellid[s]; + + switch(enchant_display_type) + { + case ITEM_ENCHANTMENT_TYPE_NONE: + break; + case ITEM_ENCHANTMENT_TYPE_COMBAT_SPELL: + // processed in Player::CastItemCombatSpell + break; + case ITEM_ENCHANTMENT_TYPE_DAMAGE: + if (item->GetSlot() == EQUIPMENT_SLOT_MAINHAND) + HandleStatModifier(UNIT_MOD_DAMAGE_MAINHAND, TOTAL_VALUE, float(enchant_amount), apply); + else if (item->GetSlot() == EQUIPMENT_SLOT_OFFHAND) + HandleStatModifier(UNIT_MOD_DAMAGE_OFFHAND, TOTAL_VALUE, float(enchant_amount), apply); + else if (item->GetSlot() == EQUIPMENT_SLOT_RANGED) + HandleStatModifier(UNIT_MOD_DAMAGE_RANGED, TOTAL_VALUE, float(enchant_amount), apply); + break; + case ITEM_ENCHANTMENT_TYPE_EQUIP_SPELL: + if(enchant_spell_id) { - int32 basepoints = 0; - // Random Property Exist - try found basepoints for spell (basepoints depends from item suffix factor) - if (item->GetItemRandomPropertyId()) + if(apply) { - ItemRandomSuffixEntry const *item_rand = sItemRandomSuffixStore.LookupEntry(abs(item->GetItemRandomPropertyId())); - if (item_rand) + int32 basepoints = 0; + // Random Property Exist - try found basepoints for spell (basepoints depends from item suffix factor) + if (item->GetItemRandomPropertyId()) { - // Search enchant_amount - for (int k=0; k<3; k++) + ItemRandomSuffixEntry const *item_rand = sItemRandomSuffixStore.LookupEntry(abs(item->GetItemRandomPropertyId())); + if (item_rand) { - if(item_rand->enchant_id[k] == enchant_id) + // Search enchant_amount + for (int k = 0; k < 3; ++k) { - basepoints = int32((item_rand->prefix[k]*item->GetItemSuffixFactor()) / 10000 ); - break; + if(item_rand->enchant_id[k] == enchant_id) + { + basepoints = int32((item_rand->prefix[k] * item->GetItemSuffixFactor()) / 10000 ); + break; + } } } } + // Cast custom spell vs all equal basepoints getted from enchant_amount + if (basepoints) + CastCustomSpell(this, enchant_spell_id, &basepoints, &basepoints, &basepoints, true, item); + else + CastSpell(this, enchant_spell_id, true, item); } - // Cast custom spell vs all equal basepoints getted from enchant_amount - if (basepoints) - CastCustomSpell(this,enchant_spell_id,&basepoints,&basepoints,&basepoints,true,item); else - CastSpell(this,enchant_spell_id,true,item); + RemoveAurasDueToItemSpell(item, enchant_spell_id); } - else - RemoveAurasDueToItemSpell(item,enchant_spell_id); - } - break; - case ITEM_ENCHANTMENT_TYPE_RESISTANCE: - if (!enchant_amount) - { - ItemRandomSuffixEntry const *item_rand = sItemRandomSuffixStore.LookupEntry(abs(item->GetItemRandomPropertyId())); - if(item_rand) + break; + case ITEM_ENCHANTMENT_TYPE_RESISTANCE: + if (!enchant_amount) { - for (int k=0; k<3; k++) + ItemRandomSuffixEntry const *item_rand = sItemRandomSuffixStore.LookupEntry(abs(item->GetItemRandomPropertyId())); + if(item_rand) { - if(item_rand->enchant_id[k] == enchant_id) + for (int k = 0; k < 3; ++k) { - enchant_amount = uint32((item_rand->prefix[k]*item->GetItemSuffixFactor()) / 10000 ); - break; + if(item_rand->enchant_id[k] == enchant_id) + { + enchant_amount = uint32((item_rand->prefix[k] * item->GetItemSuffixFactor()) / 10000 ); + break; + } } } } - } - HandleStatModifier(UnitMods(UNIT_MOD_RESISTANCE_START + enchant_spell_id), TOTAL_VALUE, float(enchant_amount), apply); - break; - case ITEM_ENCHANTMENT_TYPE_STAT: - { - if (!enchant_amount) + HandleStatModifier(UnitMods(UNIT_MOD_RESISTANCE_START + enchant_spell_id), TOTAL_VALUE, float(enchant_amount), apply); + break; + case ITEM_ENCHANTMENT_TYPE_STAT: { - ItemRandomSuffixEntry const *item_rand_suffix = sItemRandomSuffixStore.LookupEntry(abs(item->GetItemRandomPropertyId())); - if(item_rand_suffix) + if (!enchant_amount) { - for (int k=0; k<3; k++) + ItemRandomSuffixEntry const *item_rand_suffix = sItemRandomSuffixStore.LookupEntry(abs(item->GetItemRandomPropertyId())); + if(item_rand_suffix) { - if(item_rand_suffix->enchant_id[k] == enchant_id) + for (int k = 0; k < 3; ++k) { - enchant_amount = uint32((item_rand_suffix->prefix[k]*item->GetItemSuffixFactor()) / 10000 ); - break; + if(item_rand_suffix->enchant_id[k] == enchant_id) + { + enchant_amount = uint32((item_rand_suffix->prefix[k] * item->GetItemSuffixFactor()) / 10000 ); + break; + } } } } - } - sLog.outDebug("Adding %u to stat nb %u",enchant_amount,enchant_spell_id); - switch (enchant_spell_id) - { - case ITEM_MOD_AGILITY: - sLog.outDebug("+ %u AGILITY",enchant_amount); - HandleStatModifier(UNIT_MOD_STAT_AGILITY, TOTAL_VALUE, float(enchant_amount), apply); - ApplyStatBuffMod(STAT_AGILITY, enchant_amount, apply); - break; - case ITEM_MOD_STRENGTH: - sLog.outDebug("+ %u STRENGTH",enchant_amount); - HandleStatModifier(UNIT_MOD_STAT_STRENGTH, TOTAL_VALUE, float(enchant_amount), apply); - ApplyStatBuffMod(STAT_STRENGTH, enchant_amount, apply); - break; - case ITEM_MOD_INTELLECT: - sLog.outDebug("+ %u INTELLECT",enchant_amount); - HandleStatModifier(UNIT_MOD_STAT_INTELLECT, TOTAL_VALUE, float(enchant_amount), apply); - ApplyStatBuffMod(STAT_INTELLECT, enchant_amount, apply); - break; - case ITEM_MOD_SPIRIT: - sLog.outDebug("+ %u SPIRIT",enchant_amount); - HandleStatModifier(UNIT_MOD_STAT_SPIRIT, TOTAL_VALUE, float(enchant_amount), apply); - ApplyStatBuffMod(STAT_SPIRIT, enchant_amount, apply); - break; - case ITEM_MOD_STAMINA: - sLog.outDebug("+ %u STAMINA",enchant_amount); - HandleStatModifier(UNIT_MOD_STAT_STAMINA, TOTAL_VALUE, float(enchant_amount), apply); - ApplyStatBuffMod(STAT_STAMINA, enchant_amount, apply); - break; - case ITEM_MOD_DEFENSE_SKILL_RATING: - ((Player*)this)->ApplyRatingMod(CR_DEFENSE_SKILL, enchant_amount, apply); - sLog.outDebug("+ %u DEFENCE", enchant_amount); - break; - case ITEM_MOD_DODGE_RATING: - ((Player*)this)->ApplyRatingMod(CR_DODGE, enchant_amount, apply); - sLog.outDebug("+ %u DODGE", enchant_amount); - break; - case ITEM_MOD_PARRY_RATING: - ((Player*)this)->ApplyRatingMod(CR_PARRY, enchant_amount, apply); - sLog.outDebug("+ %u PARRY", enchant_amount); - break; - case ITEM_MOD_BLOCK_RATING: - ((Player*)this)->ApplyRatingMod(CR_BLOCK, enchant_amount, apply); - sLog.outDebug("+ %u SHIELD_BLOCK", enchant_amount); - break; - case ITEM_MOD_HIT_MELEE_RATING: - ((Player*)this)->ApplyRatingMod(CR_HIT_MELEE, enchant_amount, apply); - sLog.outDebug("+ %u MELEE_HIT", enchant_amount); - break; - case ITEM_MOD_HIT_RANGED_RATING: - ((Player*)this)->ApplyRatingMod(CR_HIT_RANGED, enchant_amount, apply); - sLog.outDebug("+ %u RANGED_HIT", enchant_amount); - break; - case ITEM_MOD_HIT_SPELL_RATING: - ((Player*)this)->ApplyRatingMod(CR_HIT_SPELL, enchant_amount, apply); - sLog.outDebug("+ %u SPELL_HIT", enchant_amount); - break; - case ITEM_MOD_CRIT_MELEE_RATING: - ((Player*)this)->ApplyRatingMod(CR_CRIT_MELEE, enchant_amount, apply); - sLog.outDebug("+ %u MELEE_CRIT", enchant_amount); - break; - case ITEM_MOD_CRIT_RANGED_RATING: - ((Player*)this)->ApplyRatingMod(CR_CRIT_RANGED, enchant_amount, apply); - sLog.outDebug("+ %u RANGED_CRIT", enchant_amount); - break; - case ITEM_MOD_CRIT_SPELL_RATING: - ((Player*)this)->ApplyRatingMod(CR_CRIT_SPELL, enchant_amount, apply); - sLog.outDebug("+ %u SPELL_CRIT", enchant_amount); - break; -// Values from ITEM_STAT_MELEE_HA_RATING to ITEM_MOD_HASTE_RANGED_RATING are never used -// in Enchantments -// case ITEM_MOD_HIT_TAKEN_MELEE_RATING: -// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_MELEE, enchant_amount, apply); -// break; -// case ITEM_MOD_HIT_TAKEN_RANGED_RATING: -// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_RANGED, enchant_amount, apply); -// break; -// case ITEM_MOD_HIT_TAKEN_SPELL_RATING: -// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_SPELL, enchant_amount, apply); -// break; -// case ITEM_MOD_CRIT_TAKEN_MELEE_RATING: -// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_MELEE, enchant_amount, apply); -// break; -// case ITEM_MOD_CRIT_TAKEN_RANGED_RATING: -// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_RANGED, enchant_amount, apply); -// break; -// case ITEM_MOD_CRIT_TAKEN_SPELL_RATING: -// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_SPELL, enchant_amount, apply); -// break; -// case ITEM_MOD_HASTE_MELEE_RATING: -// ((Player*)this)->ApplyRatingMod(CR_HASTE_MELEE, enchant_amount, apply); -// break; -// case ITEM_MOD_HASTE_RANGED_RATING: -// ((Player*)this)->ApplyRatingMod(CR_HASTE_RANGED, enchant_amount, apply); -// break; - case ITEM_MOD_HASTE_SPELL_RATING: - ((Player*)this)->ApplyRatingMod(CR_HASTE_SPELL, enchant_amount, apply); - break; - case ITEM_MOD_HIT_RATING: - ((Player*)this)->ApplyRatingMod(CR_HIT_MELEE, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_HIT_RANGED, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_HIT_SPELL, enchant_amount, apply); - sLog.outDebug("+ %u HIT", enchant_amount); - break; - case ITEM_MOD_CRIT_RATING: - ((Player*)this)->ApplyRatingMod(CR_CRIT_MELEE, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_CRIT_RANGED, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_CRIT_SPELL, enchant_amount, apply); - sLog.outDebug("+ %u CRITICAL", enchant_amount); - break; -// Values ITEM_MOD_HIT_TAKEN_RATING and ITEM_MOD_CRIT_TAKEN_RATING are never used in Enchantment -// case ITEM_MOD_HIT_TAKEN_RATING: -// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_MELEE, enchant_amount, apply); -// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_RANGED, enchant_amount, apply); -// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_SPELL, enchant_amount, apply); -// break; -// case ITEM_MOD_CRIT_TAKEN_RATING: -// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_MELEE, enchant_amount, apply); -// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_RANGED, enchant_amount, apply); -// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_SPELL, enchant_amount, apply); -// break; - case ITEM_MOD_RESILIENCE_RATING: - ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_MELEE, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_RANGED, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_SPELL, enchant_amount, apply); - sLog.outDebug("+ %u RESILIENCE", enchant_amount); - break; - case ITEM_MOD_HASTE_RATING: - ((Player*)this)->ApplyRatingMod(CR_HASTE_MELEE, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_HASTE_RANGED, enchant_amount, apply); - ((Player*)this)->ApplyRatingMod(CR_HASTE_SPELL, enchant_amount, apply); - sLog.outDebug("+ %u HASTE", enchant_amount); - break; - case ITEM_MOD_EXPERTISE_RATING: - ((Player*)this)->ApplyRatingMod(CR_EXPERTISE, enchant_amount, apply); - sLog.outDebug("+ %u EXPERTISE", enchant_amount); - break; - default: - break; - } - break; - } - case ITEM_ENCHANTMENT_TYPE_TOTEM: // Shaman Rockbiter Weapon - { - if(getClass() == CLASS_SHAMAN) - { - float addValue = 0.0f; - if(item->GetSlot() == EQUIPMENT_SLOT_MAINHAND) + sLog.outDebug("Adding %u to stat nb %u",enchant_amount,enchant_spell_id); + switch (enchant_spell_id) { - addValue = float(enchant_amount * item->GetProto()->Delay/1000.0f); - HandleStatModifier(UNIT_MOD_DAMAGE_MAINHAND, TOTAL_VALUE, addValue, apply); + case ITEM_MOD_MANA: + sLog.outDebug("+ %u MANA",enchant_amount); + HandleStatModifier(UNIT_MOD_MANA, BASE_VALUE, float(enchant_amount), apply); + break; + case ITEM_MOD_HEALTH: + sLog.outDebug("+ %u HEALTH",enchant_amount); + HandleStatModifier(UNIT_MOD_HEALTH, BASE_VALUE, float(enchant_amount), apply); + break; + case ITEM_MOD_AGILITY: + sLog.outDebug("+ %u AGILITY",enchant_amount); + HandleStatModifier(UNIT_MOD_STAT_AGILITY, TOTAL_VALUE, float(enchant_amount), apply); + ApplyStatBuffMod(STAT_AGILITY, enchant_amount, apply); + break; + case ITEM_MOD_STRENGTH: + sLog.outDebug("+ %u STRENGTH",enchant_amount); + HandleStatModifier(UNIT_MOD_STAT_STRENGTH, TOTAL_VALUE, float(enchant_amount), apply); + ApplyStatBuffMod(STAT_STRENGTH, enchant_amount, apply); + break; + case ITEM_MOD_INTELLECT: + sLog.outDebug("+ %u INTELLECT",enchant_amount); + HandleStatModifier(UNIT_MOD_STAT_INTELLECT, TOTAL_VALUE, float(enchant_amount), apply); + ApplyStatBuffMod(STAT_INTELLECT, enchant_amount, apply); + break; + case ITEM_MOD_SPIRIT: + sLog.outDebug("+ %u SPIRIT",enchant_amount); + HandleStatModifier(UNIT_MOD_STAT_SPIRIT, TOTAL_VALUE, float(enchant_amount), apply); + ApplyStatBuffMod(STAT_SPIRIT, enchant_amount, apply); + break; + case ITEM_MOD_STAMINA: + sLog.outDebug("+ %u STAMINA",enchant_amount); + HandleStatModifier(UNIT_MOD_STAT_STAMINA, TOTAL_VALUE, float(enchant_amount), apply); + ApplyStatBuffMod(STAT_STAMINA, enchant_amount, apply); + break; + case ITEM_MOD_DEFENSE_SKILL_RATING: + ((Player*)this)->ApplyRatingMod(CR_DEFENSE_SKILL, enchant_amount, apply); + sLog.outDebug("+ %u DEFENCE", enchant_amount); + break; + case ITEM_MOD_DODGE_RATING: + ((Player*)this)->ApplyRatingMod(CR_DODGE, enchant_amount, apply); + sLog.outDebug("+ %u DODGE", enchant_amount); + break; + case ITEM_MOD_PARRY_RATING: + ((Player*)this)->ApplyRatingMod(CR_PARRY, enchant_amount, apply); + sLog.outDebug("+ %u PARRY", enchant_amount); + break; + case ITEM_MOD_BLOCK_RATING: + ((Player*)this)->ApplyRatingMod(CR_BLOCK, enchant_amount, apply); + sLog.outDebug("+ %u SHIELD_BLOCK", enchant_amount); + break; + case ITEM_MOD_HIT_MELEE_RATING: + ((Player*)this)->ApplyRatingMod(CR_HIT_MELEE, enchant_amount, apply); + sLog.outDebug("+ %u MELEE_HIT", enchant_amount); + break; + case ITEM_MOD_HIT_RANGED_RATING: + ((Player*)this)->ApplyRatingMod(CR_HIT_RANGED, enchant_amount, apply); + sLog.outDebug("+ %u RANGED_HIT", enchant_amount); + break; + case ITEM_MOD_HIT_SPELL_RATING: + ((Player*)this)->ApplyRatingMod(CR_HIT_SPELL, enchant_amount, apply); + sLog.outDebug("+ %u SPELL_HIT", enchant_amount); + break; + case ITEM_MOD_CRIT_MELEE_RATING: + ((Player*)this)->ApplyRatingMod(CR_CRIT_MELEE, enchant_amount, apply); + sLog.outDebug("+ %u MELEE_CRIT", enchant_amount); + break; + case ITEM_MOD_CRIT_RANGED_RATING: + ((Player*)this)->ApplyRatingMod(CR_CRIT_RANGED, enchant_amount, apply); + sLog.outDebug("+ %u RANGED_CRIT", enchant_amount); + break; + case ITEM_MOD_CRIT_SPELL_RATING: + ((Player*)this)->ApplyRatingMod(CR_CRIT_SPELL, enchant_amount, apply); + sLog.outDebug("+ %u SPELL_CRIT", enchant_amount); + break; +// Values from ITEM_STAT_MELEE_HA_RATING to ITEM_MOD_HASTE_RANGED_RATING are never used +// in Enchantments +// case ITEM_MOD_HIT_TAKEN_MELEE_RATING: +// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_MELEE, enchant_amount, apply); +// break; +// case ITEM_MOD_HIT_TAKEN_RANGED_RATING: +// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_RANGED, enchant_amount, apply); +// break; +// case ITEM_MOD_HIT_TAKEN_SPELL_RATING: +// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_SPELL, enchant_amount, apply); +// break; +// case ITEM_MOD_CRIT_TAKEN_MELEE_RATING: +// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_MELEE, enchant_amount, apply); +// break; +// case ITEM_MOD_CRIT_TAKEN_RANGED_RATING: +// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_RANGED, enchant_amount, apply); +// break; +// case ITEM_MOD_CRIT_TAKEN_SPELL_RATING: +// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_SPELL, enchant_amount, apply); +// break; +// case ITEM_MOD_HASTE_MELEE_RATING: +// ((Player*)this)->ApplyRatingMod(CR_HASTE_MELEE, enchant_amount, apply); +// break; +// case ITEM_MOD_HASTE_RANGED_RATING: +// ((Player*)this)->ApplyRatingMod(CR_HASTE_RANGED, enchant_amount, apply); +// break; + case ITEM_MOD_HASTE_SPELL_RATING: + ((Player*)this)->ApplyRatingMod(CR_HASTE_SPELL, enchant_amount, apply); + break; + case ITEM_MOD_HIT_RATING: + ((Player*)this)->ApplyRatingMod(CR_HIT_MELEE, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_HIT_RANGED, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_HIT_SPELL, enchant_amount, apply); + sLog.outDebug("+ %u HIT", enchant_amount); + break; + case ITEM_MOD_CRIT_RATING: + ((Player*)this)->ApplyRatingMod(CR_CRIT_MELEE, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_CRIT_RANGED, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_CRIT_SPELL, enchant_amount, apply); + sLog.outDebug("+ %u CRITICAL", enchant_amount); + break; +// Values ITEM_MOD_HIT_TAKEN_RATING and ITEM_MOD_CRIT_TAKEN_RATING are never used in Enchantment +// case ITEM_MOD_HIT_TAKEN_RATING: +// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_MELEE, enchant_amount, apply); +// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_RANGED, enchant_amount, apply); +// ((Player*)this)->ApplyRatingMod(CR_HIT_TAKEN_SPELL, enchant_amount, apply); +// break; +// case ITEM_MOD_CRIT_TAKEN_RATING: +// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_MELEE, enchant_amount, apply); +// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_RANGED, enchant_amount, apply); +// ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_SPELL, enchant_amount, apply); +// break; + case ITEM_MOD_RESILIENCE_RATING: + ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_MELEE, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_RANGED, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_CRIT_TAKEN_SPELL, enchant_amount, apply); + sLog.outDebug("+ %u RESILIENCE", enchant_amount); + break; + case ITEM_MOD_HASTE_RATING: + ((Player*)this)->ApplyRatingMod(CR_HASTE_MELEE, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_HASTE_RANGED, enchant_amount, apply); + ((Player*)this)->ApplyRatingMod(CR_HASTE_SPELL, enchant_amount, apply); + sLog.outDebug("+ %u HASTE", enchant_amount); + break; + case ITEM_MOD_EXPERTISE_RATING: + ((Player*)this)->ApplyRatingMod(CR_EXPERTISE, enchant_amount, apply); + sLog.outDebug("+ %u EXPERTISE", enchant_amount); + break; + case ITEM_MOD_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER, TOTAL_VALUE, float(enchant_amount), apply); + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(enchant_amount), apply); + sLog.outDebug("+ %u ATTACK_POWER", enchant_amount); + break; + case ITEM_MOD_RANGED_ATTACK_POWER: + HandleStatModifier(UNIT_MOD_ATTACK_POWER_RANGED, TOTAL_VALUE, float(enchant_amount), apply); + sLog.outDebug("+ %u RANGED_ATTACK_POWER", enchant_amount); + break; + case ITEM_MOD_FERAL_ATTACK_POWER: + ((Player*)this)->ApplyFeralAPBonus(enchant_amount, apply); + sLog.outDebug("+ %u FERAL_ATTACK_POWER", enchant_amount); + break; + case ITEM_MOD_SPELL_HEALING_DONE: + ((Player*)this)->ApplySpellHealingBonus(enchant_amount, apply); + sLog.outDebug("+ %u SPELL_HEALING_DONE", enchant_amount); + break; + case ITEM_MOD_SPELL_DAMAGE_DONE: + ((Player*)this)->ApplySpellDamageBonus(enchant_amount, apply); + sLog.outDebug("+ %u SPELL_DAMAGE_DONE", enchant_amount); + break; + case ITEM_MOD_MANA_REGENERATION: + ((Player*)this)->ApplyManaRegenBonus(enchant_amount, apply); + sLog.outDebug("+ %u MANA_REGENERATION", enchant_amount); + break; + case ITEM_MOD_ARMOR_PENETRATION_RATING: + ((Player*)this)->ApplyRatingMod(CR_ARMOR_PENETRATION, enchant_amount, apply); + sLog.outDebug("+ %u ARMOR PENETRATION", enchant_amount); + break; + case ITEM_MOD_SPELL_POWER: + ((Player*)this)->ApplySpellHealingBonus(enchant_amount, apply); + ((Player*)this)->ApplySpellDamageBonus(enchant_amount, apply); + sLog.outDebug("+ %u SPELL_POWER", enchant_amount); + break; + default: + break; } - else if(item->GetSlot() == EQUIPMENT_SLOT_OFFHAND ) + break; + } + case ITEM_ENCHANTMENT_TYPE_TOTEM: // Shaman Rockbiter Weapon + { + if(getClass() == CLASS_SHAMAN) { - addValue = float(enchant_amount * item->GetProto()->Delay/1000.0f); - HandleStatModifier(UNIT_MOD_DAMAGE_OFFHAND, TOTAL_VALUE, addValue, apply); + float addValue = 0.0f; + if(item->GetSlot() == EQUIPMENT_SLOT_MAINHAND) + { + addValue = float(enchant_amount * item->GetProto()->Delay / 1000.0f); + HandleStatModifier(UNIT_MOD_DAMAGE_MAINHAND, TOTAL_VALUE, addValue, apply); + } + else if(item->GetSlot() == EQUIPMENT_SLOT_OFFHAND ) + { + addValue = float(enchant_amount * item->GetProto()->Delay / 1000.0f); + HandleStatModifier(UNIT_MOD_DAMAGE_OFFHAND, TOTAL_VALUE, addValue, apply); + } } + break; } - break; - } - default: - sLog.outError("Unknown item enchantment display type: %d",enchant_display_type); - break; - } /*switch(enchant_display_type)*/ - } /*for*/ + case ITEM_ENCHANTMENT_TYPE_USE_SPELL: + // processed in Player::CastItemUseSpell + break; + case ITEM_ENCHANTMENT_TYPE_PRISMATIC_SOCKET: + // nothing do.. + break; + default: + sLog.outError("Unknown item enchantment (id = %d) display type: %d", enchant_id, enchant_display_type); + break; + } /*switch(enchant_display_type)*/ + } /*for*/ + } // visualize enchantment at player and equipped items - if(slot < MAX_INSPECTED_ENCHANTMENT_SLOT) - { - int VisibleBase = PLAYER_VISIBLE_ITEM_1_0 + (item->GetSlot() * MAX_VISIBLE_ITEM_OFFSET); - SetUInt32Value(VisibleBase + 1 + slot, apply? item->GetEnchantmentId(slot) : 0); - } + if(slot == PERM_ENCHANTMENT_SLOT) + SetUInt16Value(PLAYER_VISIBLE_ITEM_1_ENCHANTMENT + (item->GetSlot() * 2), 0, apply ? item->GetEnchantmentId(slot) : 0); + + if(slot == TEMP_ENCHANTMENT_SLOT) + SetUInt16Value(PLAYER_VISIBLE_ITEM_1_ENCHANTMENT + (item->GetSlot() * 2), 1, apply ? item->GetEnchantmentId(slot) : 0); + if(apply_dur) { @@ -11959,27 +12238,27 @@ void Player::ApplyEnchantment(Item *item,EnchantmentSlot slot,bool apply, bool a // set duration uint32 duration = item->GetEnchantmentDuration(slot); if(duration > 0) - AddEnchantmentDuration(item,slot,duration); + AddEnchantmentDuration(item, slot, duration); } else { // duration == 0 will remove EnchantDuration - AddEnchantmentDuration(item,slot,0); + AddEnchantmentDuration(item, slot, 0); } } } void Player::SendEnchantmentDurations() { - for(EnchantDurationList::iterator itr = m_enchantDuration.begin();itr != m_enchantDuration.end();++itr) + for(EnchantDurationList::const_iterator itr = m_enchantDuration.begin(); itr != m_enchantDuration.end(); ++itr) { - GetSession()->SendItemEnchantTimeUpdate(GetGUID(), itr->item->GetGUID(),itr->slot,uint32(itr->leftduration)/1000); + GetSession()->SendItemEnchantTimeUpdate(GetGUID(), itr->item->GetGUID(), itr->slot, uint32(itr->leftduration) / 1000); } } void Player::SendItemDurations() { - for(ItemDurationList::iterator itr = m_itemDuration.begin();itr != m_itemDuration.end();++itr) + for(ItemDurationList::const_iterator itr = m_itemDuration.begin(); itr != m_itemDuration.end(); ++itr) { (*itr)->SendTimeUpdate(this); } @@ -11992,21 +12271,21 @@ void Player::SendNewItem(Item *item, uint32 count, bool received, bool created, // last check 2.0.10 WorldPacket data( SMSG_ITEM_PUSH_RESULT, (8+4+4+4+1+4+4+4+4+4) ); - data << GetGUID(); // player GUID + data << uint64(GetGUID()); // player GUID data << uint32(received); // 0=looted, 1=from npc data << uint32(created); // 0=received, 1=created data << uint32(1); // always 0x01 (probably meant to be count of listed items) - data << (uint8)item->GetBagSlot(); // bagslot + data << uint8(item->GetBagSlot()); // bagslot // item slot, but when added to stack: 0xFFFFFFFF - data << (uint32) ((item->GetCount()==count) ? item->GetSlot() : -1); + data << uint32((item->GetCount() == count) ? item->GetSlot() : -1); data << uint32(item->GetEntry()); // item id data << uint32(item->GetItemSuffixFactor()); // SuffixFactor data << uint32(item->GetItemRandomPropertyId()); // random item property id data << uint32(count); // count of items - data << GetItemCount(item->GetEntry()); // count of items in inventory + data << uint32(GetItemCount(item->GetEntry())); // count of items in inventory if (broadcast && GetGroup()) - GetGroup()->BroadcastPacket(&data); + GetGroup()->BroadcastPacket(&data, true); else GetSession()->SendPacket(&data); } @@ -12020,7 +12299,9 @@ void Player::PrepareQuestMenu( uint64 guid ) Object *pObject; QuestRelations* pObjectQR; QuestRelations* pObjectQIR; - Creature *pCreature = ObjectAccessor::GetCreature(*this, guid); + + // pets also can have quests + Creature *pCreature = ObjectAccessor::GetCreatureOrPetOrVehicle(*this, guid); if( pCreature ) { pObject = (Object*)pCreature; @@ -12029,7 +12310,7 @@ void Player::PrepareQuestMenu( uint64 guid ) } else { - GameObject *pGameObject = ObjectAccessor::GetGameObject(*this, guid); + GameObject *pGameObject = GetMap()->GetGameObject(guid); if( pGameObject ) { pObject = (Object*)pGameObject; @@ -12048,9 +12329,9 @@ void Player::PrepareQuestMenu( uint64 guid ) uint32 quest_id = i->second; QuestStatus status = GetQuestStatus( quest_id ); if ( status == QUEST_STATUS_COMPLETE && !GetQuestRewardStatus( quest_id ) ) - qm.AddMenuItem(quest_id, DIALOG_STATUS_REWARD_REP); + qm.AddMenuItem(quest_id, DIALOG_STATUS_UNK2); else if ( status == QUEST_STATUS_INCOMPLETE ) - qm.AddMenuItem(quest_id, DIALOG_STATUS_INCOMPLETE); + qm.AddMenuItem(quest_id, DIALOG_STATUS_UNK2); else if (status == QUEST_STATUS_AVAILABLE ) qm.AddMenuItem(quest_id, DIALOG_STATUS_CHAT); } @@ -12064,9 +12345,9 @@ void Player::PrepareQuestMenu( uint64 guid ) QuestStatus status = GetQuestStatus( quest_id ); if (pQuest->IsAutoComplete() && CanTakeQuest(pQuest, false)) - qm.AddMenuItem(quest_id, DIALOG_STATUS_REWARD_REP); + qm.AddMenuItem(quest_id, DIALOG_STATUS_UNK2); else if ( status == QUEST_STATUS_NONE && CanTakeQuest( pQuest, false ) ) - qm.AddMenuItem(quest_id, DIALOG_STATUS_AVAILABLE); + qm.AddMenuItem(quest_id, DIALOG_STATUS_CHAT); } } @@ -12086,12 +12367,13 @@ void Player::SendPreparedQuest( uint64 guid ) // Auto open -- maybe also should verify there is no greeting uint32 quest_id = qmi0.m_qId; Quest const* pQuest = objmgr.GetQuestTemplate(quest_id); + if ( pQuest ) { - if( status == DIALOG_STATUS_REWARD_REP && !GetQuestRewardStatus( quest_id ) ) - PlayerTalkClass->SendQuestGiverRequestItems( pQuest, guid, CanRewardQuest(pQuest,false), true ); - else if( status == DIALOG_STATUS_INCOMPLETE ) - PlayerTalkClass->SendQuestGiverRequestItems( pQuest, guid, false, true ); + if( status == DIALOG_STATUS_UNK2 && !GetQuestRewardStatus( quest_id ) ) + PlayerTalkClass->SendQuestGiverRequestItems( pQuest, guid, CanRewardQuest(pQuest, false), true ); + else if( status == DIALOG_STATUS_UNK2 ) + PlayerTalkClass->SendQuestGiverRequestItems( pQuest, guid, CanRewardQuest(pQuest, false), true ); // Send completable on repeatable quest if player don't have quest else if( pQuest->IsRepeatable() && !pQuest->IsDaily() ) PlayerTalkClass->SendQuestGiverRequestItems( pQuest, guid, CanCompleteRepeatableQuest(pQuest), true ); @@ -12106,11 +12388,13 @@ void Player::SendPreparedQuest( uint64 guid ) qe._Delay = 0; qe._Emote = 0; std::string title = ""; - Creature *pCreature = ObjectAccessor::GetCreature(*this, guid); + + // need pet case for some quests + Creature *pCreature = ObjectAccessor::GetCreatureOrPetOrVehicle(*this,guid); if( pCreature ) { uint32 textid = pCreature->GetNpcTextId(); - GossipText * gossiptext = objmgr.GetGossipText(textid); + GossipText const* gossiptext = objmgr.GetGossipText(textid); if( !gossiptext ) { qe._Delay = 0; //TEXTEMOTE_MESSAGE; //zyg: player emote @@ -12170,7 +12454,7 @@ Quest const * Player::GetNextQuest( uint64 guid, Quest const *pQuest ) QuestRelations* pObjectQR; QuestRelations* pObjectQIR; - Creature *pCreature = ObjectAccessor::GetCreature(*this, guid); + Creature *pCreature = ObjectAccessor::GetCreatureOrPetOrVehicle(*this,guid); if( pCreature ) { pObject = (Object*)pCreature; @@ -12179,7 +12463,7 @@ Quest const * Player::GetNextQuest( uint64 guid, Quest const *pQuest ) } else { - GameObject *pGameObject = ObjectAccessor::GetGameObject(*this, guid); + GameObject *pGameObject = GetMap()->GetGameObject(guid); if( pGameObject ) { pObject = (Object*)pGameObject; @@ -12233,14 +12517,14 @@ bool Player::CanAddQuest( Quest const *pQuest, bool msg ) { uint32 count = pQuest->GetSrcItemCount(); ItemPosCountVec dest; - uint8 msg = CanStoreNewItem( NULL_BAG, NULL_SLOT, dest, srcitem, count ); + uint8 msg2 = CanStoreNewItem( NULL_BAG, NULL_SLOT, dest, srcitem, count ); // player already have max number (in most case 1) source item, no additional item needed and quest can be added. - if( msg == EQUIP_ERR_CANT_CARRY_MORE_OF_THIS ) + if( msg2 == EQUIP_ERR_CANT_CARRY_MORE_OF_THIS ) return true; - else if( msg != EQUIP_ERR_OK ) + else if( msg2 != EQUIP_ERR_OK ) { - SendEquipError( msg, NULL, NULL ); + SendEquipError( msg2, NULL, NULL ); return false; } } @@ -12269,7 +12553,7 @@ bool Player::CanCompleteQuest( uint32 quest_id ) if ( qInfo->HasFlag( QUEST_TRINITY_FLAGS_DELIVER ) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; i++) { if( qInfo->ReqItemCount[i]!= 0 && q_status.m_itemcount[i] < qInfo->ReqItemCount[i] ) return false; @@ -12278,7 +12562,7 @@ bool Player::CanCompleteQuest( uint32 quest_id ) if ( qInfo->HasFlag(QUEST_TRINITY_FLAGS_KILL_OR_CAST | QUEST_TRINITY_FLAGS_SPEAKTO) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; i++) { if( qInfo->ReqCreatureOrGOId[i] == 0 ) continue; @@ -12301,7 +12585,7 @@ bool Player::CanCompleteQuest( uint32 quest_id ) } uint32 repFacId = qInfo->GetRepObjectiveFaction(); - if ( repFacId && GetReputation(repFacId) < qInfo->GetRepObjectiveValue() ) + if ( repFacId && GetReputationMgr().GetReputation(repFacId) < qInfo->GetRepObjectiveValue() ) return false; return true; @@ -12319,7 +12603,7 @@ bool Player::CanCompleteRepeatableQuest( Quest const *pQuest ) return false; if (pQuest->HasFlag( QUEST_TRINITY_FLAGS_DELIVER) ) - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; i++) if( pQuest->ReqItemId[i] && pQuest->ReqItemCount[i] && !HasItemCount(pQuest->ReqItemId[i],pQuest->ReqItemCount[i]) ) return false; @@ -12346,7 +12630,7 @@ bool Player::CanRewardQuest( Quest const *pQuest, bool msg ) // prevent receive reward with quest items in bank if ( pQuest->HasFlag( QUEST_TRINITY_FLAGS_DELIVER ) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; i++) { if( pQuest->ReqItemCount[i]!= 0 && GetItemCount(pQuest->ReqItemId[i]) < pQuest->ReqItemCount[i] ) @@ -12414,8 +12698,6 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) // if not exist then created with set uState==NEW and rewarded=false QuestStatusData& questStatusData = mQuestStatus[quest_id]; - if (questStatusData.uState != QUEST_NEW) - questStatusData.uState = QUEST_CHANGED; // check for repeatable quests status reset questStatusData.m_status = QUEST_STATUS_INCOMPLETE; @@ -12423,21 +12705,22 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) if ( pQuest->HasFlag( QUEST_TRINITY_FLAGS_DELIVER ) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; ++i) questStatusData.m_itemcount[i] = 0; } if ( pQuest->HasFlag(QUEST_TRINITY_FLAGS_KILL_OR_CAST | QUEST_TRINITY_FLAGS_SPEAKTO) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; ++i) questStatusData.m_creatureOrGOcount[i] = 0; } GiveQuestSourceItem( pQuest ); - AdjustQuestReqItemCount( pQuest ); + AdjustQuestReqItemCount( pQuest, questStatusData ); if( pQuest->GetRepObjectiveFaction() ) - SetFactionVisibleForFactionId(pQuest->GetRepObjectiveFaction()); + if(FactionEntry const* factionEntry = sFactionStore.LookupEntry(pQuest->GetRepObjectiveFaction())) + GetReputationMgr().SetVisible(factionEntry); uint32 qtime = 0; if( pQuest->HasFlag( QUEST_TRINITY_FLAGS_TIMED ) ) @@ -12446,10 +12729,10 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) // shared timed quest if(questGiver && questGiver->GetTypeId()==TYPEID_PLAYER) - limittime = ((Player*)questGiver)->getQuestStatusMap()[quest_id].m_timer / 1000; + limittime = ((Player*)questGiver)->getQuestStatusMap()[quest_id].m_timer / IN_MILISECONDS; AddTimedQuest( quest_id ); - questStatusData.m_timer = limittime * 1000; + questStatusData.m_timer = limittime * IN_MILISECONDS; qtime = static_cast<uint32>(time(NULL)) + limittime; } else @@ -12457,11 +12740,27 @@ void Player::AddQuest( Quest const *pQuest, Object *questGiver ) SetQuestSlot(log_slot, quest_id, qtime); + if (questStatusData.uState != QUEST_NEW) + questStatusData.uState = QUEST_CHANGED; + //starting initial quest script if(questGiver && pQuest->GetQuestStartScript()!=0) sWorld.ScriptsStart(sQuestStartScripts, pQuest->GetQuestStartScript(), questGiver, this); - UpdateForQuestsGO(); + // Some spells applied at quest activation + SpellAreaForQuestMapBounds saBounds = spellmgr.GetSpellAreaForQuestMapBounds(quest_id,true); + if(saBounds.first != saBounds.second) + { + uint32 zone, area; + GetZoneAndAreaId(zone,area); + + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,zone,area)) + if( !HasAura(itr->second->spellId) ) + CastSpell(this,itr->second->spellId,true); + } + + UpdateForQuestWorldObjects(); } void Player::CompleteQuest( uint32 quest_id ) @@ -12500,7 +12799,7 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver { uint32 quest_id = pQuest->GetQuestId(); - for (int i = 0; i < QUEST_OBJECTIVES_COUNT; i++ ) + for (uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; i++ ) { if ( pQuest->ReqItemId[i] ) DestroyItemCount( pQuest->ReqItemId[i], pQuest->ReqItemCount[i], true); @@ -12558,10 +12857,20 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver if ( getLevel() < sWorld.getConfig(CONFIG_MAX_PLAYER_LEVEL) ) GiveXP( XP , NULL ); else - ModifyMoney( int32(pQuest->GetRewMoneyMaxLevel() * sWorld.getRate(RATE_DROP_MONEY)) ); + { + uint32 money = uint32(pQuest->GetRewMoneyMaxLevel() * sWorld.getRate(RATE_DROP_MONEY)); + ModifyMoney( money ); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_MONEY_FROM_QUEST_REWARD, money); + } // Give player extra money if GetRewOrReqMoney > 0 and get ReqMoney if negative - ModifyMoney( pQuest->GetRewOrReqMoney() ); + if(pQuest->GetRewOrReqMoney()) + { + ModifyMoney( pQuest->GetRewOrReqMoney() ); + + if(pQuest->GetRewOrReqMoney() > 0) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_MONEY_FROM_QUEST_REWARD, pQuest->GetRewOrReqMoney()); + } // honor reward if(pQuest->GetRewHonorableKills()) @@ -12574,6 +12883,12 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver SetTitle(titleEntry); } + if(pQuest->GetBonusTalents()) + { + m_questRewardTalentCount+=pQuest->GetBonusTalents(); + InitTalentForLevel(); + } + // Send reward mail if(pQuest->GetRewMailTemplateId()) { @@ -12605,12 +12920,13 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver Loot questMailLoot; - questMailLoot.FillLoot(pQuest->GetQuestId(), LootTemplates_QuestMail, this); + questMailLoot.FillLoot(pQuest->GetQuestId(), LootTemplates_QuestMail, this,true); // fill mail MailItemsInfo mi; // item list preparing - for(size_t i = 0; mi.size() < MAX_MAIL_ITEMS && i < questMailLoot.items.size(); ++i) + uint32 max_slot = questMailLoot.GetMaxSlotInLootFor(this); + for(uint32 i = 0; mi.size() < MAX_MAIL_ITEMS && i < max_slot; ++i) { if(LootItem* lootitem = questMailLoot.LootItemInSlot(i,this)) { @@ -12622,23 +12938,14 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver } } - for(size_t i = 0; mi.size() < MAX_MAIL_ITEMS && i < questMailLoot.quest_items.size(); ++i) - { - if(LootItem* lootitem = questMailLoot.LootItemInSlot(i+questMailLoot.items.size(),this)) - { - if(Item* item = Item::CreateItem(lootitem->itemid,lootitem->count,this)) - { - item->SaveToDB(); // save for prevent lost at next mail load, if send fail then item will deleted - mi.AddItem(item->GetGUIDLow(), item->GetEntry(), item); - } - } - } - WorldSession::SendMailTo(this, mailType, MAIL_STATIONERY_NORMAL, senderGuidOrEntry, GetGUIDLow(), "", 0, &mi, 0, 0, MAIL_CHECK_MASK_NONE,pQuest->GetRewMailDelaySecs(),pQuest->GetRewMailTemplateId()); } if(pQuest->IsDaily()) + { SetDailyQuestStatus(quest_id); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_DAILY_QUEST, 1); + } if ( !pQuest->IsRepeatable() ) SetQuestStatus(quest_id, QUEST_STATUS_COMPLETE); @@ -12651,6 +12958,37 @@ void Player::RewardQuest( Quest const *pQuest, uint32 reward, Object* questGiver SendQuestReward( pQuest, XP, questGiver ); if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; + if (pQuest->GetZoneOrSort() > 0) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_QUESTS_IN_ZONE, pQuest->GetZoneOrSort()); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_QUEST_COUNT); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_COMPLETE_QUEST, pQuest->GetQuestId()); + + uint32 zone = 0; + uint32 area = 0; + + // remove auras from spells with quest reward state limitations + SpellAreaForQuestMapBounds saEndBounds = spellmgr.GetSpellAreaForQuestEndMapBounds(quest_id); + if(saEndBounds.first != saEndBounds.second) + { + GetZoneAndAreaId(zone,area); + + for(SpellAreaForAreaMap::const_iterator itr = saEndBounds.first; itr != saEndBounds.second; ++itr) + if(!itr->second->IsFitToRequirements(this,zone,area)) + RemoveAurasDueToSpell(itr->second->spellId); + } + + // Some spells applied at quest reward + SpellAreaForQuestMapBounds saBounds = spellmgr.GetSpellAreaForQuestMapBounds(quest_id,false); + if(saBounds.first != saBounds.second) + { + if(!zone || !area) + GetZoneAndAreaId(zone,area); + + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,zone,area)) + if( !HasAura(itr->second->spellId) ) + CastSpell(this,itr->second->spellId,true); + } } void Player::FailQuest( uint32 quest_id ) @@ -12675,8 +13013,9 @@ void Player::FailTimedQuest( uint32 quest_id ) { QuestStatusData& q_status = mQuestStatus[quest_id]; - if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; q_status.m_timer = 0; + if (q_status.uState != QUEST_NEW) + q_status.uState = QUEST_CHANGED; IncompleteQuest( quest_id ); @@ -12786,14 +13125,14 @@ bool Player::SatisfyQuestPreviousQuest( Quest const* qInfo, bool msg ) // each-from-all exclusive group ( < 0) // can be start if only all quests in prev quest exclusive group completed and rewarded - ObjectMgr::ExclusiveQuestGroups::iterator iter = objmgr.mExclusiveQuestGroups.lower_bound(qPrevInfo->GetExclusiveGroup()); + ObjectMgr::ExclusiveQuestGroups::iterator iter2 = objmgr.mExclusiveQuestGroups.lower_bound(qPrevInfo->GetExclusiveGroup()); ObjectMgr::ExclusiveQuestGroups::iterator end = objmgr.mExclusiveQuestGroups.upper_bound(qPrevInfo->GetExclusiveGroup()); - assert(iter!=end); // always must be found if qPrevInfo->ExclusiveGroup != 0 + assert(iter2!=end); // always must be found if qPrevInfo->ExclusiveGroup != 0 - for(; iter != end; ++iter) + for(; iter2 != end; ++iter2) { - uint32 exclude_Id = iter->second; + uint32 exclude_Id = iter2->second; // skip checked quest id, only state of other quests in group is interesting if(exclude_Id == prevId) @@ -12821,14 +13160,14 @@ bool Player::SatisfyQuestPreviousQuest( Quest const* qInfo, bool msg ) // each-from-all exclusive group ( < 0) // can be start if only all quests in prev quest exclusive group active - ObjectMgr::ExclusiveQuestGroups::iterator iter = objmgr.mExclusiveQuestGroups.lower_bound(qPrevInfo->GetExclusiveGroup()); + ObjectMgr::ExclusiveQuestGroups::iterator iter2 = objmgr.mExclusiveQuestGroups.lower_bound(qPrevInfo->GetExclusiveGroup()); ObjectMgr::ExclusiveQuestGroups::iterator end = objmgr.mExclusiveQuestGroups.upper_bound(qPrevInfo->GetExclusiveGroup()); - assert(iter!=end); // always must be found if qPrevInfo->ExclusiveGroup != 0 + assert(iter2!=end); // always must be found if qPrevInfo->ExclusiveGroup != 0 - for(; iter != end; ++iter) + for(; iter2 != end; ++iter2) { - uint32 exclude_Id = iter->second; + uint32 exclude_Id = iter2->second; // skip checked quest id, only state of other quests in group is interesting if(exclude_Id == prevId) @@ -12876,7 +13215,7 @@ bool Player::SatisfyQuestRace( Quest const* qInfo, bool msg ) bool Player::SatisfyQuestReputation( Quest const* qInfo, bool msg ) { uint32 fIdMin = qInfo->GetRequiredMinRepFaction(); //Min required rep - if(fIdMin && GetReputation(fIdMin) < qInfo->GetRequiredMinRepValue()) + if(fIdMin && GetReputationMgr().GetReputation(fIdMin) < qInfo->GetRequiredMinRepValue()) { if( msg ) SendCanTakeQuestResponse( INVALIDREASON_DONT_HAVE_REQ ); @@ -12884,7 +13223,7 @@ bool Player::SatisfyQuestReputation( Quest const* qInfo, bool msg ) } uint32 fIdMax = qInfo->GetRequiredMaxRepFaction(); //Max required rep - if(fIdMax && GetReputation(fIdMax) >= qInfo->GetRequiredMaxRepValue()) + if(fIdMax && GetReputationMgr().GetReputation(fIdMax) >= qInfo->GetRequiredMaxRepValue()) { if( msg ) SendCanTakeQuestResponse( INVALIDREASON_DONT_HAVE_REQ ); @@ -13152,7 +13491,7 @@ void Player::SetQuestStatus( uint32 quest_id, QuestStatus status ) if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; } - UpdateForQuestsGO(); + UpdateForQuestWorldObjects(); } // not used in TrinIty, but used in scripting code @@ -13162,28 +13501,26 @@ uint32 Player::GetReqKillOrCastCurrentCount(uint32 quest_id, int32 entry) if( !qInfo ) return 0; - for (int j = 0; j < QUEST_OBJECTIVES_COUNT; j++) + for (int j = 0; j < QUEST_OBJECTIVES_COUNT; ++j) if ( qInfo->ReqCreatureOrGOId[j] == entry ) return mQuestStatus[quest_id].m_creatureOrGOcount[j]; return 0; } -void Player::AdjustQuestReqItemCount( Quest const* pQuest ) +void Player::AdjustQuestReqItemCount( Quest const* pQuest, QuestStatusData& questStatusData ) { if ( pQuest->HasFlag( QUEST_TRINITY_FLAGS_DELIVER ) ) { - for(int i = 0; i < QUEST_OBJECTIVES_COUNT; i++) + for(uint8 i = 0; i < QUEST_OBJECTIVES_COUNT; ++i) { uint32 reqitemcount = pQuest->ReqItemCount[i]; if( reqitemcount != 0 ) { - uint32 quest_id = pQuest->GetQuestId(); uint32 curitemcount = GetItemCount(pQuest->ReqItemId[i],true); - QuestStatusData& q_status = mQuestStatus[quest_id]; - q_status.m_itemcount[i] = std::min(curitemcount, reqitemcount); - if (q_status.uState != QUEST_NEW) q_status.uState = QUEST_CHANGED; + questStatusData.m_itemcount[i] = std::min(curitemcount, reqitemcount); + if (questStatusData.uState != QUEST_NEW) questStatusData.uState = QUEST_CHANGED; } } } @@ -13191,7 +13528,7 @@ void Player::AdjustQuestReqItemCount( Quest const* pQuest ) uint16 Player::FindQuestSlot( uint32 quest_id ) const { - for ( uint16 i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for ( uint16 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) if ( GetQuestSlotQuestId(i) == quest_id ) return i; @@ -13239,7 +13576,7 @@ void Player::GroupEventHappens( uint32 questId, WorldObject const* pEventObject void Player::ItemAddedQuestCheck( uint32 entry, uint32 count ) { - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if ( questid == 0 ) @@ -13275,12 +13612,12 @@ void Player::ItemAddedQuestCheck( uint32 entry, uint32 count ) } } } - UpdateForQuestsGO(); + UpdateForQuestWorldObjects(); } void Player::ItemRemovedQuestCheck( uint32 entry, uint32 count ) { - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13316,13 +13653,14 @@ void Player::ItemRemovedQuestCheck( uint32 entry, uint32 count ) } } } - UpdateForQuestsGO(); + UpdateForQuestWorldObjects(); } void Player::KilledMonster( uint32 entry, uint64 guid ) { uint32 addkillcount = 1; - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_KILL_CREATURE, entry, addkillcount); + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13377,7 +13715,7 @@ void Player::CastedCreatureOrGO( uint32 entry, uint64 guid, uint32 spell_id ) bool isCreature = IS_CREATURE_GUID(guid); uint32 addCastCount = 1; - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13444,7 +13782,7 @@ void Player::CastedCreatureOrGO( uint32 entry, uint64 guid, uint32 spell_id ) void Player::TalkedToCreature( uint32 entry, uint64 guid ) { uint32 addTalkCount = 1; - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if(!questid) @@ -13499,7 +13837,7 @@ void Player::TalkedToCreature( uint32 entry, uint64 guid ) void Player::MoneyChanged( uint32 count ) { - for( int i = 0; i < MAX_QUEST_LOG_SIZE; i++ ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { uint32 questid = GetQuestSlotQuestId(i); if (!questid) @@ -13527,15 +13865,51 @@ void Player::MoneyChanged( uint32 count ) } } +void Player::ReputationChanged(FactionEntry const* factionEntry ) +{ + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) + { + if(uint32 questid = GetQuestSlotQuestId(i)) + { + if(Quest const* qInfo = objmgr.GetQuestTemplate(questid)) + { + if(qInfo->GetRepObjectiveFaction() == factionEntry->ID ) + { + QuestStatusData& q_status = mQuestStatus[questid]; + if( q_status.m_status == QUEST_STATUS_INCOMPLETE ) + { + if(GetReputationMgr().GetReputation(factionEntry) >= qInfo->GetRepObjectiveValue()) + if ( CanCompleteQuest( questid ) ) + CompleteQuest( questid ); + } + else if( q_status.m_status == QUEST_STATUS_COMPLETE ) + { + if(GetReputationMgr().GetReputation(factionEntry) < qInfo->GetRepObjectiveValue()) + IncompleteQuest( questid ); + } + } + } + } + } +} + bool Player::HasQuestForItem( uint32 itemid ) const { - for( QuestStatusMap::const_iterator i = mQuestStatus.begin( ); i != mQuestStatus.end( ); ++i ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { - QuestStatusData const& q_status = i->second; + uint32 questid = GetQuestSlotQuestId(i); + if ( questid == 0 ) + continue; + + QuestStatusMap::const_iterator qs_itr = mQuestStatus.find(questid); + if(qs_itr == mQuestStatus.end()) + continue; + + QuestStatusData const& q_status = qs_itr->second; if (q_status.m_status == QUEST_STATUS_INCOMPLETE) { - Quest const* qinfo = objmgr.GetQuestTemplate(i->first); + Quest const* qinfo = objmgr.GetQuestTemplate(questid); if(!qinfo) continue; @@ -13555,28 +13929,21 @@ bool Player::HasQuestForItem( uint32 itemid ) const for (int j = 0; j < QUEST_SOURCE_ITEM_IDS_COUNT; j++) { // examined item is a source item - if (qinfo->ReqSourceId[j] == itemid && qinfo->ReqSourceRef[j] > 0 && qinfo->ReqSourceRef[j] <= QUEST_OBJECTIVES_COUNT) + if (qinfo->ReqSourceId[j] == itemid) { - uint32 idx = qinfo->ReqSourceRef[j]-1; + ItemPrototype const *pProto = objmgr.GetItemPrototype(itemid); - // total count of created ReqItems and SourceItems is less than ReqItemCount - if(qinfo->ReqItemId[idx] != 0 && - q_status.m_itemcount[idx] * qinfo->ReqSourceCount[j] + GetItemCount(itemid,true) < qinfo->ReqItemCount[idx] * qinfo->ReqSourceCount[j]) + // 'unique' item + if (pProto->MaxCount && GetItemCount(itemid,true) < pProto->MaxCount) return true; - // total count of casted ReqCreatureOrGOs and SourceItems is less than ReqCreatureOrGOCount - if (qinfo->ReqCreatureOrGOId[idx] != 0) - { - if(q_status.m_creatureOrGOcount[idx] * qinfo->ReqSourceCount[j] + GetItemCount(itemid,true) < qinfo->ReqCreatureOrGOCount[idx] * qinfo->ReqSourceCount[j]) - return true; - } - // spell with SPELL_EFFECT_QUEST_COMPLETE or SPELL_EFFECT_SEND_EVENT (with script) case - else if(qinfo->ReqSpell[idx] != 0) + // allows custom amount drop when not 0 + if (qinfo->ReqSourceCount[j]) { - // not casted and need more reagents/item for use. - if(!q_status.m_explored && GetItemCount(itemid,true) < qinfo->ReqSourceCount[j]) + if (GetItemCount(itemid,true) < qinfo->ReqSourceCount[j]) return true; - } + } else if (GetItemCount(itemid,true) < pProto->Stackable) + return true; } } } @@ -13600,13 +13967,12 @@ void Player::SendQuestReward( Quest const *pQuest, uint32 XP, Object * questGive uint32 questid = pQuest->GetQuestId(); sLog.outDebug( "WORLD: Sent SMSG_QUESTGIVER_QUEST_COMPLETE quest = %u", questid ); gameeventmgr.HandleQuestComplete(questid); - WorldPacket data( SMSG_QUESTGIVER_QUEST_COMPLETE, (4+4+4+4+4+4+pQuest->GetRewItemsCount()*8) ); - data << questid; - data << uint32(0x03); + WorldPacket data( SMSG_QUESTGIVER_QUEST_COMPLETE, (4+4+4+4+4) ); + data << uint32(questid); if ( getLevel() < sWorld.getConfig(CONFIG_MAX_PLAYER_LEVEL) ) { - data << XP; + data << uint32(XP); data << uint32(pQuest->GetRewOrReqMoney()); } else @@ -13614,16 +13980,9 @@ void Player::SendQuestReward( Quest const *pQuest, uint32 XP, Object * questGive data << uint32(0); data << uint32(pQuest->GetRewOrReqMoney() + int32(pQuest->GetRewMoneyMaxLevel() * sWorld.getRate(RATE_DROP_MONEY))); } - data << uint32(0); // new 2.3.0, HonorPoints? - data << uint32( pQuest->GetRewItemsCount() ); // max is 5 - for (uint32 i = 0; i < pQuest->GetRewItemsCount(); ++i) - { - if ( pQuest->RewItemId[i] > 0 ) - data << pQuest->RewItemId[i] << pQuest->RewItemCount[i]; - else - data << uint32(0) << uint32(0); - } + data << uint32(10*Trinity::Honor::hk_honor_at_level(getLevel(), pQuest->GetRewHonorableKills())); + data << uint32(pQuest->GetBonusTalents()); // bonus talents GetSession()->SendPacket( &data ); if (pQuest->GetQuestCompleteScript() != 0) @@ -13634,8 +13993,9 @@ void Player::SendQuestFailed( uint32 quest_id ) { if( quest_id ) { - WorldPacket data( SMSG_QUESTGIVER_QUEST_FAILED, 4 ); + WorldPacket data( SMSG_QUESTGIVER_QUEST_FAILED, 4+4 ); data << quest_id; + data << uint32(0); // failed reason (4 for inventory is full) GetSession()->SendPacket( &data ); sLog.outDebug("WORLD: Sent SMSG_QUESTGIVER_QUEST_FAILED"); } @@ -13674,10 +14034,10 @@ void Player::SendPushToPartyResponse( Player *pPlayer, uint32 msg ) void Player::SendQuestUpdateAddItem( Quest const* pQuest, uint32 item_idx, uint32 count ) { - WorldPacket data( SMSG_QUESTUPDATE_ADD_ITEM, (4+4) ); + WorldPacket data( SMSG_QUESTUPDATE_ADD_ITEM, 0 ); sLog.outDebug( "WORLD: Sent SMSG_QUESTUPDATE_ADD_ITEM" ); - data << pQuest->ReqItemId[item_idx]; - data << count; + //data << pQuest->ReqItemId[item_idx]; + //data << count; GetSession()->SendPacket( &data ); } @@ -13711,20 +14071,23 @@ void Player::SendQuestUpdateAddCreatureOrGo( Quest const* pQuest, uint64 guid, u bool Player::MinimalLoadFromDB( QueryResult *result, uint32 guid ) { bool delete_result = true; - if(!result) + if (!result) { - // 0 1 2 3 4 5 6 7 8 9 - result = CharacterDatabase.PQuery("SELECT guid, data, name, position_x, position_y, position_z, map, totaltime, leveltime, at_login FROM characters WHERE guid = '%u'",guid); - if(!result) return false; + // 0 1 2 3 4 5 6 7 8 9 10 + result = CharacterDatabase.PQuery("SELECT guid, data, name, position_x, position_y, position_z, map, totaltime, leveltime, at_login, zone FROM characters WHERE guid = '%u'",guid); + if (!result) + return false; } - else delete_result = false; + else + delete_result = false; Field *fields = result->Fetch(); - if(!LoadValues( fields[1].GetString())) + if (!LoadValues( fields[1].GetString())) { - sLog.outError("ERROR: Player #%d have broken data in `data` field. Can't be loaded.",GUID_LOPART(guid)); - if(delete_result) delete result; + sLog.outError("Player #%d have broken data in `data` field. Can't be loaded for character list.",GUID_LOPART(guid)); + if (delete_result) + delete result; return false; } @@ -13747,12 +14110,13 @@ bool Player::MinimalLoadFromDB( QueryResult *result, uint32 guid ) _LoadBoundInstances();*/ - if (delete_result) delete result; + if (delete_result) + delete result; - for (int i = 0; i < PLAYER_SLOTS_COUNT; i++) + for (uint8 i = 0; i < PLAYER_SLOTS_COUNT; i++) m_items[i] = NULL; - if( HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_GHOST) ) + if (HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_GHOST)) m_deathState = DEAD; return true; @@ -13768,7 +14132,7 @@ void Player::_LoadDeclinedNames(QueryResult* result) m_declinedname = new DeclinedName; Field *fields = result->Fetch(); - for(int i = 0; i < MAX_DECLINED_NAME_CASES; ++i) + for(uint8 i = 0; i < MAX_DECLINED_NAME_CASES; ++i) m_declinedname->name[i] = fields[i].GetCppString(); delete result; @@ -13793,7 +14157,7 @@ void Player::_LoadArenaTeamInfo(QueryResult *result) ArenaTeam* aTeam = objmgr.GetArenaTeamById(arenateamid); if(!aTeam) { - sLog.outError("FATAL: couldn't load arenateam %u", arenateamid); + sLog.outError("Player::_LoadArenaTeamInfo: couldn't load arenateam %u, week %u, season %u, rating %u", arenateamid, played_week, played_season, personal_rating); continue; } uint8 arenaSlot = aTeam->GetSlot(); @@ -13809,6 +14173,38 @@ void Player::_LoadArenaTeamInfo(QueryResult *result) delete result; } +void Player::_LoadEquipmentSets(QueryResult *result) +{ + // SetPQuery(PLAYER_LOGIN_QUERY_LOADEQUIPMENTSETS, "SELECT setguid, setindex, name, iconname, item0, item1, item2, item3, item4, item5, item6, item7, item8, item9, item10, item11, item12, item13, item14, item15, item16, item17, item18 FROM character_equipmentsets WHERE guid = '%u' ORDER BY setindex", GUID_LOPART(m_guid)); + if (!result) + return; + + uint32 count = 0; + do + { + Field *fields = result->Fetch(); + + EquipmentSet eqSet; + + eqSet.Guid = fields[0].GetUInt64(); + uint32 index = fields[1].GetUInt32(); + eqSet.Name = fields[2].GetCppString(); + eqSet.IconName = fields[3].GetCppString(); + eqSet.state = EQUIPMENT_SET_UNCHANGED; + + for(uint32 i = 0; i < EQUIPMENT_SLOT_END; ++i) + eqSet.Items[i] = fields[4+i].GetUInt32(); + + m_EquipmentSets[index] = eqSet; + + ++count; + + if(count >= MAX_EQUIPMENT_SET_INDEX) // client limit + break; + } while (result->NextRow()); + delete result; +} + bool Player::LoadPositionFromDB(uint32& mapid, float& x,float& y,float& z,float& o, bool& in_flight, uint64 guid) { QueryResult *result = CharacterDatabase.PQuery("SELECT position_x,position_y,position_z,orientation,map,taxi_path FROM characters WHERE guid = '%u'",GUID_LOPART(guid)); @@ -13911,13 +14307,13 @@ float Player::GetFloatValueFromDB(uint16 index, uint64 guid) bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) { - //// 0 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 [28] [29] 30 31 32 33 - //QueryResult *result = CharacterDatabase.PQuery("SELECT guid, account, data, name, race, class, position_x, position_y, position_z, map, orientation, taximask, cinematic, totaltime, leveltime, rest_bonus, logout_time, is_logout_resting, resettalents_cost, resettalents_time, trans_x, trans_y, trans_z, trans_o, transguid, extra_flags, stable_slots, at_login, zone, online, death_expire_time, taxi_path, dungeon_difficulty, arena_pending_points FROM characters WHERE guid = '%u'", guid); + //// 0 1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 [28] [29] 30 31 32 33 34 35 36 37 38 39 40 + //QueryResult *result = CharacterDatabase.PQuery("SELECT guid, account, data, name, race, class, position_x, position_y, position_z, map, orientation, taximask, cinematic, totaltime, leveltime, rest_bonus, logout_time, is_logout_resting, resettalents_cost, resettalents_time, trans_x, trans_y, trans_z, trans_o, transguid, extra_flags, stable_slots, at_login, zone, online, death_expire_time, taxi_path, dungeon_difficulty, arena_pending_points,bgid,bgteam,bgmap,bgx,bgy,bgz,bgo FROM characters WHERE guid = '%u'", guid); QueryResult *result = holder->GetResult(PLAYER_LOGIN_QUERY_LOADFROM); if(!result) { - sLog.outError("ERROR: Player (GUID: %u) not found in table `characters`, can't load. ",guid); + sLog.outError("Player (GUID: %u) not found in table `characters`, can't load. ",guid); return false; } @@ -13929,7 +14325,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // player should be able to load/delete character only with correct account! if( dbAccountId != GetSession()->GetAccountId() ) { - sLog.outError("ERROR: Player (GUID: %u) loading from wrong account (is: %u, should be: %u)",guid,GetSession()->GetAccountId(),dbAccountId); + sLog.outError("Player (GUID: %u) loading from wrong account (is: %u, should be: %u)",guid,GetSession()->GetAccountId(),dbAccountId); delete result; return false; } @@ -13939,7 +14335,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) m_name = fields[3].GetCppString(); // check name limitations - if(!ObjectMgr::IsValidName(m_name) || GetSession()->GetSecurity() == SEC_PLAYER && objmgr.IsReservedName(m_name)) + if(!ObjectMgr::IsValidName(m_name) || (GetSession()->GetSecurity() == SEC_PLAYER && objmgr.IsReservedName(m_name))) { delete result; CharacterDatabase.PExecute("UPDATE characters SET at_login = at_login | '%u' WHERE guid ='%u'", uint32(AT_LOGIN_RENAME),guid); @@ -13948,7 +14344,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!LoadValues( fields[2].GetString())) { - sLog.outError("ERROR: Player #%d have broken data in `data` field. Can't be loaded.",GUID_LOPART(guid)); + sLog.outError("Player #%d have broken data in `data` field. Can't be loaded.", GUID_LOPART(guid)); delete result; return false; } @@ -13959,8 +14355,8 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // cleanup inventory related item value fields (its will be filled correctly in _LoadInventory) for(uint8 slot = EQUIPMENT_SLOT_START; slot < EQUIPMENT_SLOT_END; ++slot) { - SetUInt64Value( (uint16)(PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2) ), 0 ); - SetVisibleItemSlot(slot,NULL); + SetUInt64Value( PLAYER_FIELD_INV_SLOT_HEAD + (slot * 2), 0 ); + SetVisibleItemSlot(slot, NULL); if (m_items[slot]) { @@ -13980,24 +14376,23 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) //Need to call it to initialize m_team (m_team can be calculated from m_race) //Other way is to saves m_team into characters table. setFactionForRace(m_race); - SetCharm(0); m_class = fields[5].GetUInt8(); - PlayerInfo const *info = objmgr.GetPlayerInfo(m_race, m_class); - if(!info) + // load home bind and check in same time class/race pair, it used later for restore broken positions + if(!_LoadHomeBind(holder->GetResult(PLAYER_LOGIN_QUERY_LOADHOMEBIND))) { - sLog.outError("Player have incorrect race/class pair. Can't be loaded."); delete result; return false; } - InitPrimaryProffesions(); // to max set before any spell loaded + InitPrimaryProfessions(); // to max set before any spell loaded + // init saved position, and fix it later if problematic uint32 transGUID = fields[24].GetUInt32(); Relocate(fields[6].GetFloat(),fields[7].GetFloat(),fields[8].GetFloat(),fields[10].GetFloat()); - SetFallInformation(0, fields[8].GetFloat()); SetMapId(fields[9].GetUInt32()); + SetInstanceId(fields[41].GetFloat()); SetDifficulty(fields[32].GetUInt32()); // may be changed in _LoadGroup _LoadGroup(holder->GetResult(PLAYER_LOGIN_QUERY_LOADGROUP)); @@ -14030,10 +14425,8 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!IsPositionValid()) { - sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); - - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + sLog.outError("Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + RelocateToHomebind(); transGUID = 0; @@ -14043,49 +14436,59 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) m_movementInfo.t_o = 0.0f; } - if(!_LoadHomeBind(holder->GetResult(PLAYER_LOGIN_QUERY_LOADHOMEBIND))) - return false; + uint32 bgid = fields[34].GetUInt32(); + uint32 bgteam = fields[35].GetUInt32(); - // load the player's map here if it's not already loaded - Map *map = GetMap(); - if (!map) + if(bgid) //saved in BattleGround { - AreaTrigger const* at = objmgr.GetGoBackTrigger(GetMapId()); - if(at) + SetBattleGroundEntryPoint(fields[36].GetUInt32(),fields[37].GetFloat(),fields[38].GetFloat(),fields[39].GetFloat(),fields[40].GetFloat()); + + // check entry point and fix to homebind if need + MapEntry const* mapEntry = sMapStore.LookupEntry(m_bgEntryPoint.mapid); + if(!mapEntry || mapEntry->Instanceable() || !MapManager::IsValidMapCoord(m_bgEntryPoint)) + SetBattleGroundEntryPoint(m_homebindMapId,m_homebindX,m_homebindY,m_homebindZ,0.0f); + + BattleGround *currentBg = sBattleGroundMgr.GetBattleGround(bgid, BATTLEGROUND_TYPE_NONE); + + if(currentBg && currentBg->IsPlayerInBattleGround(GetGUID())) { - SetMapId(at->target_mapId); - Relocate(at->target_X, at->target_Y, at->target_Z, GetOrientation()); - sLog.outError("Player (guidlow %d) is teleported to gobacktrigger (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + BattleGroundQueueTypeId bgQueueTypeId = sBattleGroundMgr.BGQueueTypeId(currentBg->GetTypeID(), currentBg->GetArenaType()); + AddBattleGroundQueueId(bgQueueTypeId); + + SetBattleGroundId(currentBg->GetInstanceID(), currentBg->GetTypeID()); + SetBGTeam(bgteam); + + //join player to battleground group + currentBg->EventPlayerLoggedIn(this, GetGUID()); + currentBg->AddOrSetPlayerToCorrectBgGroup(this, GetGUID(), bgteam); + + SetInviteForBattleGroundQueueType(bgQueueTypeId,currentBg->GetInstanceID()); } else { - SetMapId(m_homebindMapId); - Relocate(m_homebindX, m_homebindY, m_homebindZ, GetOrientation()); - sLog.outError("Player (guidlow %d) is teleported to home (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + const WorldLocation& _loc = GetBattleGroundEntryPoint(); + SetMapId(_loc.mapid); + Relocate(_loc.coord_x, _loc.coord_y, _loc.coord_z, _loc.orientation); + //RemoveArenaAuras(true); } - - map = GetMap(); - if(!map) + } + else + { + MapEntry const* mapEntry = sMapStore.LookupEntry(GetMapId()); + // if server restart after player save in BG or area + // player can have current coordinates in to BG/Arean map, fix this + if(!mapEntry || mapEntry->IsBattleGroundOrArena()) { - sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + // return to BG master + SetMapId(fields[36].GetUInt32()); + Relocate(fields[37].GetFloat(),fields[38].GetFloat(),fields[39].GetFloat(),fields[40].GetFloat()); - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); - - map = GetMap(); - if(!map) - { - sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); - sLog.outError("CRASH."); - assert(false); - } + // check entry point and fix to homebind if need + mapEntry = sMapStore.LookupEntry(GetMapId()); + if(!mapEntry || mapEntry->IsBattleGroundOrArena() || !IsPositionValid()) + RelocateToHomebind(); } } - // since the player may not be bound to the map yet, make sure subsequent - // getmap calls won't create new maps - SetInstanceId(map->GetInstanceId()); - - SaveRecallPosition(); if (transGUID != 0) { @@ -14100,12 +14503,11 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // transport size limited m_movementInfo.t_x > 50 || m_movementInfo.t_y > 50 || m_movementInfo.t_z > 50 ) { - sLog.outError("ERROR: Player (guidlow %d) have invalid transport coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.", + sLog.outError("Player (guidlow %d) have invalid transport coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.", guid,GetPositionX()+m_movementInfo.t_x,GetPositionY()+m_movementInfo.t_y, GetPositionZ()+m_movementInfo.t_z,GetOrientation()+m_movementInfo.t_o); - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + RelocateToHomebind(); m_movementInfo.t_x = 0.0f; m_movementInfo.t_y = 0.0f; @@ -14122,6 +14524,14 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) { if( (*iter)->GetGUIDLow() == transGUID) { + MapEntry const* transMapEntry = sMapStore.LookupEntry((*iter)->GetMapId()); + // client without expansion support + if(GetSession()->Expansion() < transMapEntry->Expansion()) + { + sLog.outDebug("Player %s using client without required expansion tried login at transport at non accessible map %u", GetName(), (*iter)->GetMapId()); + break; + } + m_transport = *iter; m_transport->AddPassenger(this); SetMapId(m_transport->GetMapId()); @@ -14131,11 +14541,10 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!m_transport) { - sLog.outError("ERROR: Player (guidlow %d) have invalid transport guid (%u). Teleport to default race/class locations.", + sLog.outError("Player (guidlow %d) have problems with transport guid (%u). Teleport to default race/class locations.", guid,transGUID); - SetMapId(info->mapId); - Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + RelocateToHomebind(); m_movementInfo.t_x = 0.0f; m_movementInfo.t_y = 0.0f; @@ -14145,6 +14554,71 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) transGUID = 0; } } + else // not transport case + { + MapEntry const* mapEntry = sMapStore.LookupEntry(GetMapId()); + // client without expansion support + if(GetSession()->Expansion() < mapEntry->Expansion()) + { + sLog.outDebug("Player %s using client without required expansion tried login at non accessible map %u", GetName(), GetMapId()); + RelocateToHomebind(); + } + } + + // NOW player must have valid map + // load the player's map here if it's not already loaded + Map *map = GetMap(); + + if (!map) + { + AreaTrigger const* at = objmgr.GetGoBackTrigger(GetMapId()); + if(at) + { + SetMapId(at->target_mapId); + Relocate(at->target_X, at->target_Y, at->target_Z, GetOrientation()); + sLog.outError("Player (guidlow %d) is teleported to gobacktrigger (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + } + else + { + RelocateToHomebind(); + sLog.outError("Player (guidlow %d) is teleported to home (Map: %u X: %f Y: %f Z: %f O: %f).",guid,GetMapId(),GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + } + + map = GetMap(); + if(!map) + { + sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + delete result; + return false; + + /*SetMapId(info->mapId); + Relocate(info->positionX,info->positionY,info->positionZ,0.0f); + + map = GetMap(); + if(!map) + { + sLog.outError("ERROR: Player (guidlow %d) have invalid coordinates (X: %f Y: %f Z: %f O: %f). Teleport to default race/class locations.",guid,GetPositionX(),GetPositionY(),GetPositionZ(),GetOrientation()); + sLog.outError("CRASH."); + assert(false); + }*/ + } + } + + // since the player may not be bound to the map yet, make sure subsequent + // getmap calls won't create new maps + SetInstanceId(map->GetInstanceId()); + + // if the player is in an instance and it has been reset in the meantime teleport him to the entrance + if(GetInstanceId() && !sInstanceSaveManager.GetInstanceSave(GetInstanceId())) + { + AreaTrigger const* at = objmgr.GetMapEntranceTrigger(GetMapId()); + if(at) + Relocate(at->target_X, at->target_Y, at->target_Z, at->target_Orientation); + else + sLog.outError("Player %s(GUID: %u) logged in to a reset instance (map: %u) and there is no area-trigger leading to this map. Thus he can't be ported back to the entrance. This _might_ be an exploit attempt.", GetName(), GetGUIDLow(), GetMapId()); + } + + SaveRecallPosition(); time_t now = time(NULL); time_t logoutTime = time_t(fields[16].GetUInt64()); @@ -14195,10 +14669,10 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) uint32 extraflags = fields[25].GetUInt32(); m_stableSlots = fields[26].GetUInt32(); - if(m_stableSlots > 2) + if(m_stableSlots > MAX_PET_STABLES) { - sLog.outError("Player can have not more 2 stable slots, but have in DB %u",uint32(m_stableSlots)); - m_stableSlots = 2; + sLog.outError("Player can have not more %u stable slots, but have in DB %u",MAX_PET_STABLES,uint32(m_stableSlots)); + m_stableSlots = MAX_PET_STABLES; } m_atLoginFlags = fields[27].GetUInt32(); @@ -14221,35 +14695,20 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) SetUInt32Value(UNIT_CHANNEL_SPELL,0); // clear charm/summon related fields - SetCharm(NULL); - SetPet(NULL); - SetCharmerGUID(NULL); - SetOwnerGUID(NULL); - SetCreatorGUID(NULL); + SetUInt64Value(UNIT_FIELD_SUMMONEDBY, 0); + SetUInt64Value(UNIT_FIELD_CHARMEDBY, 0); + SetUInt64Value(UNIT_FIELD_CHARM, 0); + SetUInt64Value(UNIT_FIELD_SUMMON, 0); + SetUInt64Value(PLAYER_FARSIGHT, 0); + SetCreatorGUID(0); + + RemoveFlag(UNIT_FIELD_FLAGS_2, UNIT_FLAG2_FORCE_MOVE); // reset some aura modifiers before aura apply - SetFarSight(NULL); SetUInt32Value(PLAYER_TRACK_CREATURES, 0 ); SetUInt32Value(PLAYER_TRACK_RESOURCES, 0 ); - // reset skill modifiers and set correct unlearn flags - for (uint32 i = 0; i < PLAYER_MAX_SKILLS; i++) - { - SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); - - // set correct unlearn bit - uint32 id = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; - if(!id) continue; - - SkillLineEntry const *pSkill = sSkillLineStore.LookupEntry(id); - if(!pSkill) continue; - - // enable unlearn button for primary professions only - if (pSkill->categoryId == SKILL_CATEGORY_PROFESSION) - SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,1)); - else - SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,0)); - } + _LoadSkills(); // make sure the unit is considered out of combat for proper loading ClearInCombat(); @@ -14267,6 +14726,8 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // reset stats before loading any modifiers InitStatsForLevel(); InitTaxiNodesForLevel(); + InitGlyphsForLevel(); + InitRunes(); // apply original stats mods before spell loading or item equipment that call before equip _RemoveStatsMods() @@ -14274,25 +14735,23 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) //_LoadMail(); _LoadAuras(holder->GetResult(PLAYER_LOGIN_QUERY_LOADAURAS), time_diff); - + _LoadGlyphAuras(); // add ghost flag (must be after aura load: PLAYER_FLAGS_GHOST set in aura) if( HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_GHOST) ) m_deathState = DEAD; _LoadSpells(holder->GetResult(PLAYER_LOGIN_QUERY_LOADSPELLS)); - // after spell load - InitTalentForLevel(); - learnSkillRewardedSpells(); - // after spell load, learn rewarded spell if need also _LoadQuestStatus(holder->GetResult(PLAYER_LOGIN_QUERY_LOADQUESTSTATUS)); _LoadDailyQuestStatus(holder->GetResult(PLAYER_LOGIN_QUERY_LOADDAILYQUESTSTATUS)); - _LoadTutorials(holder->GetResult(PLAYER_LOGIN_QUERY_LOADTUTORIALS)); + // after spell and quest load + InitTalentForLevel(); + learnDefaultSpells(); // must be before inventory (some items required reputation check) - _LoadReputation(holder->GetResult(PLAYER_LOGIN_QUERY_LOADREPUTATION)); + m_reputationMgr.LoadFromDB(holder->GetResult(PLAYER_LOGIN_QUERY_LOADREPUTATION)); _LoadInventory(holder->GetResult(PLAYER_LOGIN_QUERY_LOADINVENTORY), time_diff); @@ -14306,19 +14765,16 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) m_social = sSocialMgr.LoadFromDB(holder->GetResult(PLAYER_LOGIN_QUERY_LOADSOCIALLIST), GetGUIDLow()); - //if(!_LoadHomeBind(holder->GetResult(PLAYER_LOGIN_QUERY_LOADHOMEBIND))) - // return false; - // check PLAYER_CHOSEN_TITLE compatibility with PLAYER__FIELD_KNOWN_TITLES // note: PLAYER__FIELD_KNOWN_TITLES updated at quest status loaded if(uint32 curTitle = GetUInt32Value(PLAYER_CHOSEN_TITLE)) { if(!HasTitle(curTitle)) - SetUInt32Value(PLAYER_CHOSEN_TITLE,0); + SetUInt32Value(PLAYER_CHOSEN_TITLE, 0); } // Not finish taxi flight path - if(!m_taxi.LoadTaxiDestinationsFromString(taxi_nodes)) + if(!m_taxi.LoadTaxiDestinationsFromString(taxi_nodes,GetTeam())) { // problems with taxi path loading TaxiNodesEntry const* nodeEntry = NULL; @@ -14328,8 +14784,7 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) if(!nodeEntry) // don't know taxi start node, to homebind { sLog.outError("Character %u have wrong data in taxi destination list, teleport to homebind.",GetGUIDLow()); - SetMapId(m_homebindMapId); - Relocate( m_homebindX, m_homebindY, m_homebindZ,0.0f); + RelocateToHomebind(); SaveRecallPosition(); // save as recall also to prevent recall and fall from sky } else // have start node, to it @@ -14354,6 +14809,9 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) // flight will started later } + // has to be called after last Relocate() in Player::LoadFromDB + SetFallInformation(0, GetPositionZ()); + _LoadSpellCooldowns(holder->GetResult(PLAYER_LOGIN_QUERY_LOADSPELLCOOLDOWNS)); // Spell code allow apply any auras to dead character in load time in aura/spell/item loading @@ -14398,6 +14856,17 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) break; } + /*switch(sWorld.getConfig(CONFIG_GM_ACCEPT_TICKETS)) + { + default: + case 0: break; // disable + case 1: SetAcceptTicket(true); break; // enable + case 2: // save state + if(extraflags & PLAYER_EXTRA_GM_ACCEPT_TICKETS) + SetAcceptTicket(true); + break; + }*/ + switch(sWorld.getConfig(CONFIG_GM_CHAT)) { default: @@ -14423,6 +14892,11 @@ bool Player::LoadFromDB( uint32 guid, SqlQueryHolder *holder ) _LoadDeclinedNames(holder->GetResult(PLAYER_LOGIN_QUERY_LOADDECLINEDNAMES)); + m_achievementMgr.LoadFromDB(holder->GetResult(PLAYER_LOGIN_QUERY_LOADACHIEVEMENTS), holder->GetResult(PLAYER_LOGIN_QUERY_LOADCRITERIAPROGRESS)); + m_achievementMgr.CheckAllAchievementCriteria(); + + _LoadEquipmentSets(holder->GetResult(PLAYER_LOGIN_QUERY_LOADEQUIPMENTSETS)); + return true; } @@ -14463,9 +14937,15 @@ void Player::_LoadActions(QueryResult *result) uint8 button = fields[0].GetUInt8(); - addActionButton(button, fields[1].GetUInt16(), fields[2].GetUInt8(), fields[3].GetUInt8()); + if(addActionButton(button, fields[1].GetUInt16(), fields[2].GetUInt8(), fields[3].GetUInt8())) + m_actionButtons[button].uState = ACTIONBUTTON_UNCHANGED; + else + { + sLog.outError( " ...at loading, and will deleted in DB also"); - m_actionButtons[button].uState = ACTIONBUTTON_UNCHANGED; + // Will deleted in DB at next save (it can create data until save but marked as deleted) + m_actionButtons[button].uState = ACTIONBUTTON_DELETED; + } } while( result->NextRow() ); @@ -14475,45 +14955,36 @@ void Player::_LoadActions(QueryResult *result) void Player::_LoadAuras(QueryResult *result, uint32 timediff) { - m_Auras.clear(); - for (int i = 0; i < TOTAL_AURAS; i++) - m_modAuras[i].clear(); - - // all aura related fields - for(int i = UNIT_FIELD_AURA; i <= UNIT_FIELD_AURASTATE; ++i) - SetUInt32Value(i, 0); + sLog.outDebug("Loading auras for player %u",GetGUIDLow()); - //QueryResult *result = CharacterDatabase.PQuery("SELECT caster_guid,spell,effect_index,stackcount,amount,maxduration,remaintime,remaincharges FROM character_aura WHERE guid = '%u'",GetGUIDLow()); + //QueryResult *result = CharacterDatabase.PQuery("SELECT caster_guid,spell,effect_mask,stackcount,amount0,amount1,amount2,maxduration,remaintime,remaincharges FROM character_aura WHERE guid = '%u'",GetGUIDLow()); if(result) { do { + int32 damage[3]; Field *fields = result->Fetch(); uint64 caster_guid = fields[0].GetUInt64(); uint32 spellid = fields[1].GetUInt32(); - uint32 effindex = fields[2].GetUInt32(); + uint32 effmask = fields[2].GetUInt32(); uint32 stackcount = fields[3].GetUInt32(); - int32 damage = (int32)fields[4].GetUInt32(); - int32 maxduration = (int32)fields[5].GetUInt32(); - int32 remaintime = (int32)fields[6].GetUInt32(); - int32 remaincharges = (int32)fields[7].GetUInt32(); + damage[0] = int32(fields[4].GetUInt32()); + damage[1] = int32(fields[5].GetUInt32()); + damage[2] = int32(fields[6].GetUInt32()); + int32 maxduration = (int32)fields[7].GetUInt32(); + int32 remaintime = (int32)fields[8].GetUInt32(); + int32 remaincharges = (int32)fields[9].GetUInt32(); SpellEntry const* spellproto = sSpellStore.LookupEntry(spellid); if(!spellproto) { - sLog.outError("Unknown aura (spellid %u, effindex %u), ignore.",spellid,effindex); - continue; - } - - if(effindex >= 3) - { - sLog.outError("Invalid effect index (spellid %u, effindex %u), ignore.",spellid,effindex); + sLog.outError("Unknown aura (spellid %u), ignore.",spellid); continue; } // negative effects should continue counting down after logout - if (remaintime != -1 && !IsPositiveEffect(spellid, effindex)) + if (remaintime != -1 && !IsPositiveSpell(spellid)) { if(remaintime <= int32(timediff)) continue; @@ -14528,21 +14999,12 @@ void Player::_LoadAuras(QueryResult *result, uint32 timediff) remaincharges = spellproto->procCharges; } else - remaincharges = -1; + remaincharges = 0; - //do not load single target auras (unless they were cast by the player) - if (caster_guid != GetGUID() && IsSingleTargetSpell(spellproto)) - continue; - - for(uint32 i=0; i<stackcount; i++) - { - Aura* aura = CreateAura(spellproto, effindex, NULL, this, NULL); - if(!damage) - damage = aura->GetModifier()->m_amount; - aura->SetLoadedState(caster_guid,damage,maxduration,remaintime,remaincharges); - AddAura(aura); - sLog.outDetail("Added aura spellid %u, effect %u", spellproto->Id, effindex); - } + Aura* aura = new Aura(spellproto, effmask, NULL, this, NULL, NULL); + aura->SetLoadedState(caster_guid,maxduration,remaintime,remaincharges, stackcount, &damage[0]); + AddAura(aura); + sLog.outDetail("Added aura spellid %u, effectmask %u", spellproto->Id, effmask); } while( result->NextRow() ); @@ -14553,6 +15015,36 @@ void Player::_LoadAuras(QueryResult *result, uint32 timediff) CastSpell(this,SPELL_ID_PASSIVE_BATTLE_STANCE,true); } +void Player::_LoadGlyphAuras() +{ + for (uint8 i = 0; i < MAX_GLYPH_SLOT_INDEX; ++i) + { + if (uint32 glyph = GetGlyph(i)) + { + if (GlyphPropertiesEntry const *gp = sGlyphPropertiesStore.LookupEntry(glyph)) + { + if (GlyphSlotEntry const *gs = sGlyphSlotStore.LookupEntry(GetGlyphSlot(i))) + { + if(gp->TypeFlags == gs->TypeFlags) + { + CastSpell(this, gp->SpellId, true); + continue; + } + else + sLog.outError("Player %s has glyph with typeflags %u in slot with typeflags %u, removing.", m_name.c_str(), gp->TypeFlags, gs->TypeFlags); + } + else + sLog.outError("Player %s has not existing glyph slot entry %u on index %u", m_name.c_str(), GetGlyphSlot(i), i); + } + else + sLog.outError("Player %s has not existing glyph entry %u on index %u", m_name.c_str(), glyph, i); + + // On any error remove glyph + SetGlyph(i, 0); + } + } +} + void Player::LoadCorpse() { if( isAlive() ) @@ -14683,7 +15175,17 @@ void Player::_LoadInventory(QueryResult *result, uint32 timediff) // the item is in a bag, find the bag std::map<uint64, Bag*>::iterator itr = bagMap.find(bag_guid); if(itr != bagMap.end()) - itr->second->StoreItem(slot, item, true ); + { + ItemPosCountVec dest; + uint8 result = CanStoreItem(itr->second->GetSlot(), slot, dest, item); + if(result == EQUIP_ERR_OK) + itr->second->StoreItem(slot, item, true ); + else + { + sLog.outError("Player::_LoadInventory: Player %s has item (GUID: %u Entry: %u) can't be loaded to inventory (Bag GUID: %u Slot: %u) by reason %u.", GetName(),item_guid, item_id, bag_guid, slot, result); + success = false; + } + } else success = false; } @@ -14708,7 +15210,7 @@ void Player::_LoadInventory(QueryResult *result, uint32 timediff) // fill mail MailItemsInfo mi; // item list preparing - for(int i = 0; !problematicItems.empty() && i < MAX_MAIL_ITEMS; ++i) + for(uint8 i = 0; !problematicItems.empty() && i < MAX_MAIL_ITEMS; ++i) { Item* item = problematicItems.front(); problematicItems.pop_front(); @@ -14728,15 +15230,16 @@ void Player::_LoadInventory(QueryResult *result, uint32 timediff) // load mailed item which should receive current player void Player::_LoadMailedItems(Mail *mail) { - QueryResult* result = CharacterDatabase.PQuery("SELECT item_guid, item_template FROM mail_items WHERE mail_id='%u'", mail->messageID); + // data needs to be at first place for Item::LoadFromDB + QueryResult* result = CharacterDatabase.PQuery("SELECT data, item_guid, item_template FROM mail_items JOIN item_instance ON item_guid = guid WHERE mail_id='%u'", mail->messageID); if(!result) return; do { Field *fields = result->Fetch(); - uint32 item_guid_low = fields[0].GetUInt32(); - uint32 item_template = fields[1].GetUInt32(); + uint32 item_guid_low = fields[1].GetUInt32(); + uint32 item_template = fields[2].GetUInt32(); mail->AddItem(item_guid_low, item_template); @@ -14752,7 +15255,7 @@ void Player::_LoadMailedItems(Mail *mail) Item *item = NewItemOrBag(proto); - if(!item->LoadFromDB(item_guid_low, 0)) + if(!item->LoadFromDB(item_guid_low, 0, result)) { sLog.outError( "Player::_LoadMailedItems - Item in mail (%u) doesn't exist !!!! - item guid: %u, deleted from mail", mail->messageID, item_guid_low); CharacterDatabase.PExecute("DELETE FROM mail_items WHERE item_guid = '%u'", item_guid_low); @@ -14770,7 +15273,7 @@ void Player::_LoadMailedItems(Mail *mail) void Player::_LoadMailInit(QueryResult *resultUnread, QueryResult *resultDelivery) { //set a count of unread mails - //QueryResult *resultMails = CharacterDatabase.PQuery("SELECT COUNT(id) FROM mail WHERE receiver = '%u' AND (checked & 1)=0 AND deliver_time <= '" I64FMTD "'", GUID_LOPART(playerGuid),(uint64)cTime); + //QueryResult *resultMails = CharacterDatabase.PQuery("SELECT COUNT(id) FROM mail WHERE receiver = '%u' AND (checked & 1)=0 AND deliver_time <= '" UI64FMTD "'", GUID_LOPART(playerGuid),(uint64)cTime); if (resultUnread) { Field *fieldMail = resultUnread->Fetch(); @@ -14838,7 +15341,7 @@ void Player::LoadPet() // just not added to the map if(IsInWorld()) { - Pet *pet = new Pet; + Pet *pet = new Pet(this); if(!pet->LoadPetFromDB(this,0,0,true)) delete pet; } @@ -14888,7 +15391,7 @@ void Player::_LoadQuestStatus(QueryResult *result) if (quest_time <= sWorld.GetGameTime()) questStatusData.m_timer = 1; else - questStatusData.m_timer = (quest_time - sWorld.GetGameTime()) * 1000; + questStatusData.m_timer = (quest_time - sWorld.GetGameTime()) * IN_MILISECONDS; } else quest_time = 0; @@ -14906,18 +15409,18 @@ void Player::_LoadQuestStatus(QueryResult *result) // add to quest log if( slot < MAX_QUEST_LOG_SIZE && - ( questStatusData.m_status==QUEST_STATUS_INCOMPLETE || - questStatusData.m_status==QUEST_STATUS_COMPLETE && + ( questStatusData.m_status == QUEST_STATUS_INCOMPLETE || + questStatusData.m_status == QUEST_STATUS_COMPLETE && (!questStatusData.m_rewarded || pQuest->IsDaily()) ) ) { - SetQuestSlot(slot,quest_id,quest_time); + SetQuestSlot(slot, quest_id, quest_time); if(questStatusData.m_status == QUEST_STATUS_COMPLETE) - SetQuestSlotState(slot,QUEST_STATE_COMPLETE); + SetQuestSlotState(slot, QUEST_STATE_COMPLETE); for(uint8 idx = 0; idx < QUEST_OBJECTIVES_COUNT; ++idx) if(questStatusData.m_creatureOrGOcount[idx]) - SetQuestSlotCounter(slot,idx,questStatusData.m_creatureOrGOcount[idx]); + SetQuestSlotCounter(slot, idx, questStatusData.m_creatureOrGOcount[idx]); ++slot; } @@ -14933,6 +15436,9 @@ void Player::_LoadQuestStatus(QueryResult *result) if(CharTitlesEntry const* titleEntry = sCharTitlesStore.LookupEntry(pQuest->GetCharTitleId())) SetTitle(titleEntry); } + + if(pQuest->GetBonusTalents()) + m_questRewardTalentCount += pQuest->GetBonusTalents(); } sLog.outDebug("Quest status is {%u} for quest {%u} for player (GUID: %u)", questStatusData.m_status, quest_id, GetGUIDLow()); @@ -14945,7 +15451,7 @@ void Player::_LoadQuestStatus(QueryResult *result) // clear quest log tail for ( uint16 i = slot; i < MAX_QUEST_LOG_SIZE; ++i ) - SetQuestSlot(i,0); + SetQuestSlot(i, 0); } void Player::_LoadDailyQuestStatus(QueryResult *result) @@ -14991,86 +15497,9 @@ void Player::_LoadDailyQuestStatus(QueryResult *result) m_DailyQuestChanged = false; } -void Player::_LoadReputation(QueryResult *result) -{ - m_factions.clear(); - - // Set initial reputations (so everything is nifty before DB data load) - SetInitialFactions(); - - //QueryResult *result = CharacterDatabase.PQuery("SELECT faction,standing,flags FROM character_reputation WHERE guid = '%u'",GetGUIDLow()); - - if(result) - { - do - { - Field *fields = result->Fetch(); - - FactionEntry const *factionEntry = sFactionStore.LookupEntry(fields[0].GetUInt32()); - if( factionEntry && (factionEntry->reputationListID >= 0)) - { - FactionState* faction = &m_factions[factionEntry->reputationListID]; - - // update standing to current - faction->Standing = int32(fields[1].GetUInt32()); - - uint32 dbFactionFlags = fields[2].GetUInt32(); - - if( dbFactionFlags & FACTION_FLAG_VISIBLE ) - SetFactionVisible(faction); // have internal checks for forced invisibility - - if( dbFactionFlags & FACTION_FLAG_INACTIVE) - SetFactionInactive(faction,true); // have internal checks for visibility requirement - - if( dbFactionFlags & FACTION_FLAG_AT_WAR ) // DB at war - SetFactionAtWar(faction,true); // have internal checks for FACTION_FLAG_PEACE_FORCED - else // DB not at war - { - // allow remove if visible (and then not FACTION_FLAG_INVISIBLE_FORCED or FACTION_FLAG_HIDDEN) - if( faction->Flags & FACTION_FLAG_VISIBLE ) - SetFactionAtWar(faction,false); // have internal checks for FACTION_FLAG_PEACE_FORCED - } - - // set atWar for hostile - if(GetReputationRank(factionEntry) <= REP_HOSTILE) - SetFactionAtWar(faction,true); - - // reset changed flag if values similar to saved in DB - if(faction->Flags==dbFactionFlags) - faction->Changed = false; - } - } - while( result->NextRow() ); - - delete result; - } -} - void Player::_LoadSpells(QueryResult *result) { - for (PlayerSpellMap::iterator itr = m_spells.begin(); itr != m_spells.end(); ++itr) - delete itr->second; - m_spells.clear(); - - //QueryResult *result = CharacterDatabase.PQuery("SELECT spell,slot,active FROM character_spell WHERE guid = '%u'",GetGUIDLow()); - - if(result) - { - do - { - Field *fields = result->Fetch(); - - addSpell(fields[0].GetUInt16(), fields[2].GetBool(), false, true, fields[1].GetUInt16(), fields[3].GetBool()); - } - while( result->NextRow() ); - - delete result; - } -} - -void Player::_LoadTutorials(QueryResult *result) -{ - //QueryResult *result = CharacterDatabase.PQuery("SELECT tut0,tut1,tut2,tut3,tut4,tut5,tut6,tut7 FROM character_tutorial WHERE account = '%u' AND realmid = '%u'", GetAccountId(), realmid); + //QueryResult *result = CharacterDatabase.PQuery("SELECT spell,active,disabled FROM character_spell WHERE guid = '%u'",GetGUIDLow()); if(result) { @@ -15078,15 +15507,12 @@ void Player::_LoadTutorials(QueryResult *result) { Field *fields = result->Fetch(); - for (int iI=0; iI<8; iI++) - m_Tutorials[iI] = fields[iI].GetUInt32(); + addSpell(fields[0].GetUInt16(), fields[1].GetBool(), false, false, fields[2].GetBool()); } while( result->NextRow() ); delete result; } - - m_TutorialsChanged = false; } void Player::_LoadGroup(QueryResult *result) @@ -15132,6 +15558,14 @@ void Player::_LoadBoundInstances(QueryResult *result) // so the value read from the DB may be wrong here but only if the InstanceSave is loaded // and in that case it is not used + MapEntry const* mapEntry = sMapStore.LookupEntry(mapId); + if(!mapEntry || !mapEntry->IsDungeon()) + { + sLog.outError("_LoadBoundInstances: player %s(%d) has bind to not existed or not dungeon map %d", GetName(), GetGUIDLow(), mapId); + CharacterDatabase.PExecute("DELETE FROM character_instance WHERE guid = '%d' AND instance = '%d'", GetGUIDLow(), instanceId); + continue; + } + if(!perm && group) { sLog.outError("_LoadBoundInstances: player %s(%d) is in group %d but has a non-permanent character bind to map %d,%d,%d", GetName(), GetGUIDLow(), GUID_LOPART(group->GetLeaderGUID()), mapId, instanceId, difficulty); @@ -15209,29 +15643,32 @@ InstancePlayerBind* Player::BindToInstance(InstanceSave *save, bool permanent, b void Player::SendRaidInfo() { + uint32 counter = 0; + WorldPacket data(SMSG_RAID_INSTANCE_INFO, 4); - uint32 counter = 0, i; - for(i = 0; i < TOTAL_DIFFICULTIES; i++) - for (BoundInstancesMap::iterator itr = m_boundInstances[i].begin(); itr != m_boundInstances[i].end(); ++itr) - if(itr->second.perm) counter++; + size_t p_counter = data.wpos(); + data << uint32(counter); // placeholder - data << counter; - for(i = 0; i < TOTAL_DIFFICULTIES; i++) + time_t now = time(NULL); + + for(uint8 i = 0; i < TOTAL_DIFFICULTIES; ++i) { for (BoundInstancesMap::iterator itr = m_boundInstances[i].begin(); itr != m_boundInstances[i].end(); ++itr) { if(itr->second.perm) { InstanceSave *save = itr->second.save; - data << (save->GetMapId()); - data << (uint32)(save->GetResetTime() - time(NULL)); - data << save->GetInstanceId(); - data << uint32(counter); - counter--; + data << uint32(save->GetMapId()); // map id + data << uint32(save->GetDifficulty()); // difficulty + data << uint64(save->GetInstanceId()); // instance id + data << uint32(save->GetResetTime() - now); // reset time + data << uint32(0); // is extended + ++counter; } } } + data.put<uint32>(p_counter, counter); GetSession()->SendPacket(&data); } @@ -15320,12 +15757,18 @@ bool Player::Satisfy(AccessRequirement const *ar, uint32 target_map, bool report if(!isGameMaster() && ar) { uint32 LevelMin = 0; - if(getLevel() < ar->levelMin && !sWorld.getConfig(CONFIG_INSTANCE_IGNORE_LEVEL)) - LevelMin = ar->levelMin; - uint32 LevelMax = 0; - if(ar->levelMax >= ar->levelMin && getLevel() > ar->levelMax && !sWorld.getConfig(CONFIG_INSTANCE_IGNORE_LEVEL)) - LevelMax = ar->levelMax; + + if(!sWorld.getConfig(CONFIG_INSTANCE_IGNORE_LEVEL)) + { + if(ar->levelMin && getLevel() < ar->levelMin) + LevelMin = ar->levelMin; + else if(ar->heroicLevelMin && GetDifficulty() == DIFFICULTY_HEROIC + && getLevel() < ar->heroicLevelMin) + LevelMin = ar->heroicLevelMin; + if(ar->levelMax && getLevel() > ar->levelMax) + LevelMax = ar->levelMax; + } uint32 missingItem = 0; if(ar->item) @@ -15365,7 +15808,7 @@ bool Player::Satisfy(AccessRequirement const *ar, uint32 target_map, bool report if(missingItem) GetSession()->SendAreaTriggerMessage(GetSession()->GetTrinityString(LANG_LEVEL_MINREQUIRED_AND_ITEM), ar->levelMin, objmgr.GetItemPrototype(missingItem)->Name1); else if(missingKey) - SendTransferAborted(target_map, TRANSFER_ABORT_DIFFICULTY2); + SendTransferAborted(target_map, TRANSFER_ABORT_DIFFICULTY); else if(missingHeroicQuest) GetSession()->SendAreaTriggerMessage(ar->heroicQuestFailedText.c_str()); else if(missingQuest) @@ -15381,6 +15824,13 @@ bool Player::Satisfy(AccessRequirement const *ar, uint32 target_map, bool report bool Player::_LoadHomeBind(QueryResult *result) { + PlayerInfo const *info = objmgr.GetPlayerInfo(getRace(), getClass()); + if(!info) + { + sLog.outError("Player have incorrect race/class pair. Can't be loaded."); + return false; + } + bool ok = false; //QueryResult *result = CharacterDatabase.PQuery("SELECT map,zone,position_x,position_y,position_z FROM character_homebind WHERE guid = '%u'", GUID_LOPART(playerGuid)); if (result) @@ -15393,9 +15843,11 @@ bool Player::_LoadHomeBind(QueryResult *result) m_homebindZ = fields[4].GetFloat(); delete result; - // accept saved data only for valid position (and non instanceable) + MapEntry const* bindMapEntry = sMapStore.LookupEntry(m_homebindMapId); + + // accept saved data only for valid position (and non instanceable), and accessable if( MapManager::IsValidMapCoord(m_homebindMapId,m_homebindX,m_homebindY,m_homebindZ) && - !sMapStore.LookupEntry(m_homebindMapId)->Instanceable() ) + !bindMapEntry->Instanceable() && GetSession()->Expansion() >= bindMapEntry->Expansion()) { ok = true; } @@ -15405,9 +15857,6 @@ bool Player::_LoadHomeBind(QueryResult *result) if(!ok) { - PlayerInfo const *info = objmgr.GetPlayerInfo(getRace(), getClass()); - if(!info) return false; - m_homebindMapId = info->mapId; m_homebindZoneId = info->zoneId; m_homebindX = info->positionX; @@ -15417,7 +15866,7 @@ bool Player::_LoadHomeBind(QueryResult *result) CharacterDatabase.PExecute("INSERT INTO character_homebind (guid,map,zone,position_x,position_y,position_z) VALUES ('%u', '%u', '%u', '%f', '%f', '%f')", GetGUIDLow(), m_homebindMapId, (uint32)m_homebindZoneId, m_homebindX, m_homebindY, m_homebindZ); } - DEBUG_LOG("Setting player home position: mapid is: %u, zoneid is %u, X is %f, Y is %f, Z is %f\n", + DEBUG_LOG("Setting player home position: mapid is: %u, zoneid is %u, X is %f, Y is %f, Z is %f", m_homebindMapId, m_homebindZoneId, m_homebindX, m_homebindY, m_homebindZ); return true; @@ -15435,13 +15884,7 @@ void Player::SaveToDB() // first save/honor gain after midnight will also update the player's honor fields UpdateHonorFields(); - // players aren't saved on battleground maps - uint32 mapid = IsBeingTeleported() ? GetTeleportDest().mapid : GetMapId(); - const MapEntry * me = sMapStore.LookupEntry(mapid); - if(!me || me->IsBattleGroundOrArena()) - return; - - int is_save_resting = HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_RESTING) ? 1 : 0; + uint32 is_save_resting = HasFlag(PLAYER_FLAGS, PLAYER_FLAGS_RESTING) ? 1 : 0; //save, far from tavern/city //save, but in tavern/city sLog.outDebug("The value of player %s at save: ", m_name.c_str()); @@ -15455,10 +15898,9 @@ void Player::SaveToDB() uint32 tmp_displayid = GetDisplayId(); // Set player sit state to standing on save, also stealth and shifted form - SetByteValue(UNIT_FIELD_BYTES_1, 0, 0); // stand state + SetByteValue(UNIT_FIELD_BYTES_1, 0, UNIT_STAND_STATE_STAND); SetByteValue(UNIT_FIELD_BYTES_2, 3, 0); // shapeshift - SetByteValue(UNIT_FIELD_BYTES_1, 3, 0); // stand flags? - RemoveFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_DISABLE_ROTATE); + RemoveFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_STUNNED); SetDisplayId(GetNativeDisplayId()); bool inworld = IsInWorld(); @@ -15472,29 +15914,21 @@ void Player::SaveToDB() std::ostringstream ss; ss << "INSERT INTO characters (guid,account,name,race,class," - "map, dungeon_difficulty, position_x, position_y, position_z, orientation, data, " + "map, instance_id, dungeon_difficulty, position_x, position_y, position_z, orientation, data, " "taximask, online, cinematic, " "totaltime, leveltime, rest_bonus, logout_time, is_logout_resting, resettalents_cost, resettalents_time, " "trans_x, trans_y, trans_z, trans_o, transguid, extra_flags, stable_slots, at_login, zone, " - "death_expire_time, taxi_path, arena_pending_points, latency) VALUES (" + "death_expire_time, taxi_path, arena_pending_points, latency, bgid, bgteam, bgmap, bgx, bgy, bgz, bgo) VALUES (" << GetGUIDLow() << ", " << GetSession()->GetAccountId() << ", '" << sql_name << "', " << m_race << ", " << m_class << ", "; - bool save_to_dest = false; - if(IsBeingTeleported()) - { - // don't save to battlegrounds or arenas - const MapEntry *entry = sMapStore.LookupEntry(GetTeleportDest().mapid); - if(entry && entry->map_type != MAP_BATTLEGROUND && entry->map_type != MAP_ARENA) - save_to_dest = true; - } - - if(!save_to_dest) + if(!IsBeingTeleported()) { ss << GetMapId() << ", " + << (uint32)GetInstanceId() << ", " << (uint32)GetDifficulty() << ", " << finiteAlways(GetPositionX()) << ", " << finiteAlways(GetPositionY()) << ", " @@ -15504,11 +15938,12 @@ void Player::SaveToDB() else { ss << GetTeleportDest().mapid << ", " + << (uint32)0 << ", " << (uint32)GetDifficulty() << ", " - << finiteAlways(GetTeleportDest().x) << ", " - << finiteAlways(GetTeleportDest().y) << ", " - << finiteAlways(GetTeleportDest().z) << ", " - << finiteAlways(GetTeleportDest().o) << ", '"; + << finiteAlways(GetTeleportDest().coord_x) << ", " + << finiteAlways(GetTeleportDest().coord_y) << ", " + << finiteAlways(GetTeleportDest().coord_z) << ", " + << finiteAlways(GetTeleportDest().orientation) << ", '"; } uint16 i; @@ -15517,12 +15952,11 @@ void Player::SaveToDB() ss << GetUInt32Value(i) << " "; } - ss << "', '"; + ss << "', "; - for( i = 0; i < 8; i++ ) - ss << m_taxi.GetTaximask(i) << " "; + ss << m_taxi; // string with TaxiMaskSize numbers - ss << "', "; + ss << ", "; ss << (inworld ? 1 : 0); ss << ", "; @@ -15576,9 +16010,19 @@ void Player::SaveToDB() ss << ", '"; ss << m_taxi.SaveTaxiDestinationsToString(); - ss << "', '0', '"; + ss << "', '0', "; ss << GetSession()->GetLatency(); - ss << "' )"; + ss << ", "; + ss << GetBattleGroundId(); + ss << ", "; + ss << GetBGTeam(); + ss << ", "; + ss << m_bgEntryPoint.mapid << ", " + << finiteAlways(m_bgEntryPoint.coord_x) << ", " + << finiteAlways(m_bgEntryPoint.coord_y) << ", " + << finiteAlways(m_bgEntryPoint.coord_z) << ", " + << finiteAlways(m_bgEntryPoint.orientation); + ss << ")"; CharacterDatabase.Execute( ss.str().c_str() ); @@ -15588,12 +16032,14 @@ void Player::SaveToDB() _SaveInventory(); _SaveQuestStatus(); _SaveDailyQuestStatus(); - _SaveTutorials(); _SaveSpells(); _SaveSpellCooldowns(); _SaveActions(); _SaveAuras(); - _SaveReputation(); + m_achievementMgr.SaveToDB(); + m_reputationMgr.SaveToDB(); + _SaveEquipmentSets(); + GetSession()->SaveTutorialsData(); // changed only while character in game CharacterDatabase.CommitTransaction(); @@ -15607,23 +16053,6 @@ void Player::SaveToDB() // save pet (hunter pet level and experience and all type pets health/mana). if(Pet* pet = GetPet()) pet->SavePetToDB(PET_SAVE_AS_CURRENT); - - //to prevent access to DB we should cache some data, which is used very often - CachePlayerInfoMap::iterator _iter = objmgr.m_mPlayerInfoMap.find(GetGUIDLow()); - if(_iter != objmgr.m_mPlayerInfoMap.end())//skip new players - { - _iter->second->unLevel = getLevel(); - - _iter->second->unArenaInfoSlot0 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + 0 * 6 + 5); - _iter->second->unArenaInfoSlot1 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + 1 * 6 + 5); - _iter->second->unArenaInfoSlot2 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + 2 * 6 + 5); - - _iter->second->unfield = GetUInt32Value(UNIT_FIELD_BYTES_0); - - _iter->second->unArenaInfoId0 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + (0 * 6)); - _iter->second->unArenaInfoId1 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + (1 * 6)); - _iter->second->unArenaInfoId2 = GetUInt32Value(PLAYER_FIELD_ARENA_TEAM_INFO_1_1 + (2 * 6)); - } } // fast save function for item/money cheating preventing - save only inventory and money state @@ -15668,56 +16097,35 @@ void Player::_SaveAuras() CharacterDatabase.PExecute("DELETE FROM character_aura WHERE guid = '%u'",GetGUIDLow()); AuraMap const& auras = GetAuras(); + for(AuraMap::const_iterator itr = auras.begin(); itr !=auras.end() ; ++itr) + { + // skip: + // area auras or single cast auras casted by other unit + // passive auras and stances + if (itr->second->IsPassive() + || itr->second->IsAuraType(SPELL_AURA_MOD_SHAPESHIFT) + || itr->second->IsRemovedOnShapeLost()) + continue; + bool isCaster = itr->second->GetCasterGUID() == GetGUID(); + if (!isCaster) + if (itr->second->IsSingleTarget() + || itr->second->IsAreaAura()) + continue; - if (auras.empty()) - return; - - spellEffectPair lastEffectPair = auras.begin()->first; - uint32 stackCounter = 1; - - for(AuraMap::const_iterator itr = auras.begin(); ; ++itr) - { - if(itr == auras.end() || lastEffectPair != itr->first) + int32 amounts[MAX_SPELL_EFFECTS]; + for (uint8 i=0;i<MAX_SPELL_EFFECTS;++i) { - AuraMap::const_iterator itr2 = itr; - // save previous spellEffectPair to db - itr2--; - SpellEntry const *spellInfo = itr2->second->GetSpellProto(); - - //skip all auras from spells that are passive or need a shapeshift - if (!(itr2->second->IsPassive() || itr2->second->IsRemovedOnShapeLost())) - { - //do not save single target auras (unless they were cast by the player) - if (!(itr2->second->GetCasterGUID() != GetGUID() && IsSingleTargetSpell(spellInfo))) - { - uint8 i; - // or apply at cast SPELL_AURA_MOD_SHAPESHIFT or SPELL_AURA_MOD_STEALTH auras - for (i = 0; i < 3; i++) - if (spellInfo->EffectApplyAuraName[i] == SPELL_AURA_MOD_SHAPESHIFT || - spellInfo->EffectApplyAuraName[i] == SPELL_AURA_MOD_STEALTH) - break; - - if (i == 3) - { - CharacterDatabase.PExecute("INSERT INTO character_aura (guid,caster_guid,spell,effect_index,stackcount,amount,maxduration,remaintime,remaincharges) " - "VALUES ('%u', '" I64FMTD "' ,'%u', '%u', '%u', '%d', '%d', '%d', '%d')", - GetGUIDLow(), itr2->second->GetCasterGUID(), (uint32)itr2->second->GetId(), (uint32)itr2->second->GetEffIndex(), (uint32)itr2->second->GetStackAmount(), itr2->second->GetModifier()->m_amount,int(itr2->second->GetAuraMaxDuration()),int(itr2->second->GetAuraDuration()),int(itr2->second->m_procCharges)); - } - } - } - - if(itr == auras.end()) - break; + if (AuraEffect * partAura = itr->second->GetPartAura(i)) + amounts[i]=partAura->GetAmount(); + else + amounts[i]=0; } - //TODO: if need delete this - if (lastEffectPair == itr->first) - stackCounter++; - else - { - lastEffectPair = itr->first; - stackCounter = 1; - } + CharacterDatabase.PExecute("INSERT INTO character_aura (guid,caster_guid,spell,effect_mask,stackcount,amount0, amount1, amount2,maxduration,remaintime,remaincharges) " + "VALUES ('%u', '" UI64FMTD "', '%u', '%u', '%d', '%d', '%d', '%d', '%d', '%d', '%d')", + GetGUIDLow(), itr->second->GetCasterGUID(),(uint32)itr->second->GetId(), (uint32)itr->second->GetEffectMask(), + (int32)itr->second->GetStackAmount(), (int32)amounts[0], (int32)amounts[1], (int32)amounts[2] + ,int(itr->second->GetAuraMaxDuration()),int(itr->second->GetAuraDuration()),int(itr->second->GetAuraCharges())); } } @@ -15753,8 +16161,9 @@ void Player::_SaveInventory() if (test == NULL) { - sLog.outError("Player(GUID: %u Name: %s)::_SaveInventory - the bag(%d) and slot(%d) values for the item with guid %d are incorrect, the player doesn't have an item at that position!", GetGUIDLow(), GetName(), item->GetBagSlot(), item->GetSlot(), item->GetGUIDLow()); - error = true; + sLog.outCrash("Player(GUID: %u Name: %s)::_SaveInventory - the bag(%d) and slot(%d) values for the item with guid %d (state %d) are incorrect, the player doesn't have an item at that position!", GetGUIDLow(), GetName(), item->GetBagSlot(), item->GetSlot(), item->GetGUIDLow(), (int32)item->GetState()); + //error = true; + //now some items in bags cannot be saved but after cleansup they appear again } else if (test != item) { @@ -15808,7 +16217,7 @@ void Player::_SaveMail() Mail *m = (*itr); if (m->state == MAIL_STATE_CHANGED) { - CharacterDatabase.PExecute("UPDATE mail SET itemTextId = '%u',has_items = '%u',expire_time = '" I64FMTD "', deliver_time = '" I64FMTD "',money = '%u',cod = '%u',checked = '%u' WHERE id = '%u'", + CharacterDatabase.PExecute("UPDATE mail SET itemTextId = '%u',has_items = '%u',expire_time = '" UI64FMTD "', deliver_time = '" UI64FMTD "',money = '%u',cod = '%u',checked = '%u' WHERE id = '%u'", m->itemTextId, m->HasItems() ? 1 : 0, (uint64)m->expire_time, (uint64)m->deliver_time, m->money, m->COD, m->checked, m->messageID); if(m->removedItems.size()) { @@ -15856,12 +16265,12 @@ void Player::_SaveQuestStatus() { case QUEST_NEW : CharacterDatabase.PExecute("INSERT INTO character_queststatus (guid,quest,status,rewarded,explored,timer,mobcount1,mobcount2,mobcount3,mobcount4,itemcount1,itemcount2,itemcount3,itemcount4) " - "VALUES ('%u', '%u', '%u', '%u', '%u', '" I64FMTD "', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u')", - GetGUIDLow(), i->first, i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / 1000 + sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3]); + "VALUES ('%u', '%u', '%u', '%u', '%u', '" UI64FMTD "', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u')", + GetGUIDLow(), i->first, i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / IN_MILISECONDS+ sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3]); break; case QUEST_CHANGED : - CharacterDatabase.PExecute("UPDATE character_queststatus SET status = '%u',rewarded = '%u',explored = '%u',timer = '" I64FMTD "',mobcount1 = '%u',mobcount2 = '%u',mobcount3 = '%u',mobcount4 = '%u',itemcount1 = '%u',itemcount2 = '%u',itemcount3 = '%u',itemcount4 = '%u' WHERE guid = '%u' AND quest = '%u' ", - i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / 1000 + sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3], GetGUIDLow(), i->first ); + CharacterDatabase.PExecute("UPDATE character_queststatus SET status = '%u',rewarded = '%u',explored = '%u',timer = '" UI64FMTD "',mobcount1 = '%u',mobcount2 = '%u',mobcount3 = '%u',mobcount4 = '%u',itemcount1 = '%u',itemcount2 = '%u',itemcount3 = '%u',itemcount4 = '%u' WHERE guid = '%u' AND quest = '%u' ", + i->second.m_status, i->second.m_rewarded, i->second.m_explored, uint64(i->second.m_timer / IN_MILISECONDS + sWorld.GetGameTime()), i->second.m_creatureOrGOcount[0], i->second.m_creatureOrGOcount[1], i->second.m_creatureOrGOcount[2], i->second.m_creatureOrGOcount[3], i->second.m_itemcount[0], i->second.m_itemcount[1], i->second.m_itemcount[2], i->second.m_itemcount[3], GetGUIDLow(), i->first ); break; case QUEST_UNCHANGED: break; @@ -15883,65 +16292,33 @@ void Player::_SaveDailyQuestStatus() CharacterDatabase.PExecute("DELETE FROM character_queststatus_daily WHERE guid = '%u'",GetGUIDLow()); for(uint32 quest_daily_idx = 0; quest_daily_idx < PLAYER_MAX_DAILY_QUESTS; ++quest_daily_idx) if(GetUInt32Value(PLAYER_FIELD_DAILY_QUESTS_1+quest_daily_idx)) - CharacterDatabase.PExecute("INSERT INTO character_queststatus_daily (guid,quest,time) VALUES ('%u', '%u','" I64FMTD "')", + CharacterDatabase.PExecute("INSERT INTO character_queststatus_daily (guid,quest,time) VALUES ('%u', '%u','" UI64FMTD "')", GetGUIDLow(), GetUInt32Value(PLAYER_FIELD_DAILY_QUESTS_1+quest_daily_idx),uint64(m_lastDailyQuestTime)); } -void Player::_SaveReputation() -{ - for(FactionStateList::iterator itr = m_factions.begin(); itr != m_factions.end(); ++itr) - { - if (itr->second.Changed) - { - CharacterDatabase.PExecute("DELETE FROM character_reputation WHERE guid = '%u' AND faction='%u'", GetGUIDLow(), itr->second.ID); - CharacterDatabase.PExecute("INSERT INTO character_reputation (guid,faction,standing,flags) VALUES ('%u', '%u', '%i', '%u')", GetGUIDLow(), itr->second.ID, itr->second.Standing, itr->second.Flags); - itr->second.Changed = false; - } - } -} - void Player::_SaveSpells() { - for (PlayerSpellMap::const_iterator itr = m_spells.begin(), next = m_spells.begin(); itr != m_spells.end(); itr = next) + for (PlayerSpellMap::iterator itr = m_spells.begin(), next = m_spells.begin(); itr != m_spells.end();) { - ++next; if (itr->second->state == PLAYERSPELL_REMOVED || itr->second->state == PLAYERSPELL_CHANGED) CharacterDatabase.PExecute("DELETE FROM character_spell WHERE guid = '%u' and spell = '%u'", GetGUIDLow(), itr->first); - if (itr->second->state == PLAYERSPELL_NEW || itr->second->state == PLAYERSPELL_CHANGED) - CharacterDatabase.PExecute("INSERT INTO character_spell (guid,spell,slot,active,disabled) VALUES ('%u', '%u', '%u','%u','%u')", GetGUIDLow(), itr->first, itr->second->slotId,itr->second->active ? 1 : 0,itr->second->disabled ? 1 : 0); + + // add only changed/new not dependent spells + if (!itr->second->dependent && (itr->second->state == PLAYERSPELL_NEW || itr->second->state == PLAYERSPELL_CHANGED)) + CharacterDatabase.PExecute("INSERT INTO character_spell (guid,spell,active,disabled) VALUES ('%u', '%u', '%u', '%u')", GetGUIDLow(), itr->first, itr->second->active ? 1 : 0,itr->second->disabled ? 1 : 0); if (itr->second->state == PLAYERSPELL_REMOVED) - _removeSpell(itr->first); + { + delete itr->second; + m_spells.erase(itr++); + } else + { itr->second->state = PLAYERSPELL_UNCHANGED; - } -} - -void Player::_SaveTutorials() -{ - if(!m_TutorialsChanged) - return; - - uint32 Rows=0; - // it's better than rebuilding indexes multiple times - QueryResult *result = CharacterDatabase.PQuery("SELECT count(*) AS r FROM character_tutorial WHERE account = '%u' AND realmid = '%u'", GetSession()->GetAccountId(), realmID ); - if(result) - { - Rows = result->Fetch()[0].GetUInt32(); - delete result; - } + ++itr; + } - if (Rows) - { - CharacterDatabase.PExecute("UPDATE character_tutorial SET tut0='%u', tut1='%u', tut2='%u', tut3='%u', tut4='%u', tut5='%u', tut6='%u', tut7='%u' WHERE account = '%u' AND realmid = '%u'", - m_Tutorials[0], m_Tutorials[1], m_Tutorials[2], m_Tutorials[3], m_Tutorials[4], m_Tutorials[5], m_Tutorials[6], m_Tutorials[7], GetSession()->GetAccountId(), realmID ); } - else - { - CharacterDatabase.PExecute("INSERT INTO character_tutorial (account,realmid,tut0,tut1,tut2,tut3,tut4,tut5,tut6,tut7) VALUES ('%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u')", GetSession()->GetAccountId(), realmID, m_Tutorials[0], m_Tutorials[1], m_Tutorials[2], m_Tutorials[3], m_Tutorials[4], m_Tutorials[5], m_Tutorials[6], m_Tutorials[7]); - }; - - m_TutorialsChanged = false; } void Player::outDebugValues() const @@ -16041,7 +16418,7 @@ bool Player::SaveValuesArrayInDB(Tokens const& tokens, uint64 guid) { std::ostringstream ss2; ss2<<"UPDATE characters SET data='"; - int i=0; + uint32 i=0; for (Tokens::const_iterator iter = tokens.begin(); iter != tokens.end(); ++iter, ++i) { ss2<<tokens[i]<<" "; @@ -16085,10 +16462,40 @@ void Player::SetFloatValueInDB(uint16 index, float value, uint64 guid) Player::SetUInt32ValueInDB(index, temp, guid); } -void Player::SendAttackSwingNotStanding() +void Player::Customize(uint64 guid, uint8 gender, uint8 skin, uint8 face, uint8 hairStyle, uint8 hairColor, uint8 facialHair) { - WorldPacket data(SMSG_ATTACKSWING_NOTSTANDING, 0); - GetSession()->SendPacket( &data ); + Tokens tokens; + if(!LoadValuesArrayFromDB(tokens, guid)) + return; + + uint32 unit_bytes0 = GetUInt32ValueFromArray(tokens, UNIT_FIELD_BYTES_0); + uint8 race = unit_bytes0 & 0xFF; + uint8 class_ = (unit_bytes0 >> 8) & 0xFF; + + PlayerInfo const* info = objmgr.GetPlayerInfo(race, class_); + if(!info) + return; + + unit_bytes0 &= ~(0xFF << 16); + unit_bytes0 |= (gender << 16); + SetUInt32ValueInArray(tokens, UNIT_FIELD_BYTES_0, unit_bytes0); + + SetUInt32ValueInArray(tokens, UNIT_FIELD_DISPLAYID, gender ? info->displayId_f : info->displayId_m); + SetUInt32ValueInArray(tokens, UNIT_FIELD_NATIVEDISPLAYID, gender ? info->displayId_f : info->displayId_m); + + SetUInt32ValueInArray(tokens, PLAYER_BYTES, (skin | (face << 8) | (hairStyle << 16) | (hairColor << 24))); + + uint32 player_bytes2 = GetUInt32ValueFromArray(tokens, PLAYER_BYTES_2); + player_bytes2 &= ~0xFF; + player_bytes2 |= facialHair; + SetUInt32ValueInArray(tokens, PLAYER_BYTES_2, player_bytes2); + + uint32 player_bytes3 = GetUInt32ValueFromArray(tokens, PLAYER_BYTES_3); + player_bytes3 &= ~0xFF; + player_bytes3 |= gender; + SetUInt32ValueInArray(tokens, PLAYER_BYTES_3, player_bytes3); + + SaveValuesArrayInDB(tokens, guid); } void Player::SendAttackSwingDeadTarget() @@ -16117,20 +16524,11 @@ void Player::SendAttackSwingBadFacingAttack() void Player::SendAutoRepeatCancel() { - WorldPacket data(SMSG_CANCEL_AUTO_REPEAT, 0); + WorldPacket data(SMSG_CANCEL_AUTO_REPEAT, GetPackGUID().size()); + data.append(GetPackGUID()); // may be it's target guid GetSession()->SendPacket( &data ); } -void Player::PlaySound(uint32 Sound, bool OnlySelf) -{ - WorldPacket data(SMSG_PLAY_SOUND, 4); - data << Sound; - if (OnlySelf) - GetSession()->SendPacket( &data ); - else - SendMessageToSet( &data, true ); -} - void Player::SendExplorationExperience(uint32 Area, uint32 Experience) { WorldPacket data( SMSG_EXPLORATION_EXPERIENCE, 8 ); @@ -16271,11 +16669,37 @@ void Player::UpdateDuelFlag(time_t currTime) duel->opponent->duel->startTime = currTime; } +Pet* Player::GetPet() const +{ + if(uint64 pet_guid = GetPetGUID()) + { + if(!IS_PET_GUID(pet_guid)) + return NULL; + + if(Pet* pet = ObjectAccessor::GetPet(pet_guid)) + return pet; + + //there may be a guardian in slot + //sLog.outError("Player::GetPet: Pet %u not exist.",GUID_LOPART(pet_guid)); + //const_cast<Player*>(this)->SetPetGUID(0); + } + + return NULL; +} + void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) { if(!pet) pet = GetPet(); + if(pet) + { + sLog.outDebug("RemovePet %u, %u, %u", pet->GetEntry(), mode, returnreagent); + + if(pet->m_removed) + return; + } + if(returnreagent && (pet || m_temporaryUnsummonedPetNumber)) { //returning of reagents only for players, so best done here @@ -16305,25 +16729,6 @@ void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) if(!pet || pet->GetOwnerGUID()!=GetGUID()) return; - // only if current pet in slot - switch(pet->getPetType()) - { - case MINI_PET: - m_miniPet = 0; - break; - case GUARDIAN_PET: - m_guardianPets.erase(pet->GetGUID()); - break; - case POSSESSED_PET: - m_guardianPets.erase(pet->GetGUID()); - pet->RemoveCharmedOrPossessedBy(NULL); - break; - default: - if(GetPetGUID() == pet->GetGUID()) - SetPet(NULL); - break; - } - pet->CombatStop(); if(returnreagent) @@ -16340,8 +16745,11 @@ void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) } } + // only if current pet in slot pet->SavePetToDB(mode); + SetMinion(pet, false); + pet->CleanupsBeforeDelete(); pet->AddObjectToRemoveList(); pet->m_removed = true; @@ -16357,66 +16765,26 @@ void Player::RemovePet(Pet* pet, PetSaveMode mode, bool returnreagent) } } -void Player::RemoveMiniPet() -{ - if(Pet* pet = GetMiniPet()) - { - pet->Remove(PET_SAVE_AS_DELETED); - m_miniPet = 0; - } -} - -Pet* Player::GetMiniPet() -{ - if(!m_miniPet) - return NULL; - return ObjectAccessor::GetPet(m_miniPet); -} - -void Player::RemoveGuardians() -{ - while(!m_guardianPets.empty()) - { - uint64 guid = *m_guardianPets.begin(); - if(Pet* pet = ObjectAccessor::GetPet(guid)) - pet->Remove(PET_SAVE_AS_DELETED); - - m_guardianPets.erase(guid); - } -} - -bool Player::HasGuardianWithEntry(uint32 entry) -{ - // pet guid middle part is entry (and creature also) - // and in guardian list must be guardians with same entry _always_ - for(GuardianPetList::const_iterator itr = m_guardianPets.begin(); itr != m_guardianPets.end(); ++itr) - if(GUID_ENPART(*itr)==entry) - return true; - - return false; -} - -void Player::Uncharm() +void Player::StopCastingCharm() { Unit* charm = GetCharm(); if(!charm) return; - if(charm->GetTypeId() == TYPEID_UNIT && ((Creature*)charm)->isPet() - && ((Pet*)charm)->getPetType() == POSSESSED_PET) + if(charm->GetTypeId() == TYPEID_UNIT) { - ((Pet*)charm)->Remove(PET_SAVE_AS_DELETED); - } - else - { - charm->RemoveSpellsCausingAura(SPELL_AURA_MOD_CHARM); - charm->RemoveSpellsCausingAura(SPELL_AURA_MOD_POSSESS_PET); - charm->RemoveSpellsCausingAura(SPELL_AURA_MOD_POSSESS); + if(((Creature*)charm)->HasSummonMask(SUMMON_MASK_PUPPET)) + ((Puppet*)charm)->UnSummon(); + else if(((Creature*)charm)->isVehicle()) + ExitVehicle(); } + if(GetCharmGUID()) + charm->RemoveCharmAuras(); if(GetCharmGUID()) { - sLog.outError("CRASH ALARM! Player %s is not able to uncharm unit (Entry: %u, Type: %u)", GetName(), charm->GetEntry(), charm->GetTypeId()); + sLog.outCrash("Player %s is not able to uncharm unit (Entry: %u, Type: %u)", GetName(), charm->GetEntry(), charm->GetTypeId()); + assert(false); } } @@ -16437,6 +16805,10 @@ void Player::Say(const std::string& text, const uint32 language) WorldPacket data(SMSG_MESSAGECHAT, 200); BuildPlayerChat(&data, CHAT_MSG_SAY, text, language); SendMessageToSetInRange(&data,sWorld.getConfig(CONFIG_LISTEN_RANGE_SAY),true); + + if(sWorld.getConfig(CONFIG_CHATLOG_PUBLIC)) + sLog.outChat("[SAY] Player %s says (language %u): %s", + GetName(), language, text.c_str()); } void Player::Yell(const std::string& text, const uint32 language) @@ -16444,13 +16816,21 @@ void Player::Yell(const std::string& text, const uint32 language) WorldPacket data(SMSG_MESSAGECHAT, 200); BuildPlayerChat(&data, CHAT_MSG_YELL, text, language); SendMessageToSetInRange(&data,sWorld.getConfig(CONFIG_LISTEN_RANGE_YELL),true); + + if(sWorld.getConfig(CONFIG_CHATLOG_PUBLIC)) + sLog.outChat("[YELL] Player %s yells (language %u): %s", + GetName(), language, text.c_str()); } void Player::TextEmote(const std::string& text) { WorldPacket data(SMSG_MESSAGECHAT, 200); BuildPlayerChat(&data, CHAT_MSG_EMOTE, text, LANG_UNIVERSAL); - SendMessageToSetInRange(&data,sWorld.getConfig(CONFIG_LISTEN_RANGE_TEXTEMOTE),true, !sWorld.getConfig(CONFIG_ALLOW_TWO_SIDE_INTERACTION_CHAT), true ); + SendMessageToSetInRange(&data,sWorld.getConfig(CONFIG_LISTEN_RANGE_TEXTEMOTE),true, !sWorld.getConfig(CONFIG_ALLOW_TWO_SIDE_INTERACTION_CHAT)); + + if(sWorld.getConfig(CONFIG_CHATLOG_PUBLIC)) + sLog.outChat("[TEXTEMOTE] Player %s emotes: %s", + GetName(), text.c_str()); } void Player::Whisper(const std::string& text, uint32 language,uint64 receiver) @@ -16460,6 +16840,10 @@ void Player::Whisper(const std::string& text, uint32 language,uint64 receiver) Player *rPlayer = objmgr.GetPlayer(receiver); + if(sWorld.getConfig(CONFIG_CHATLOG_WHISPER)) + sLog.outChat("[WHISPER] Player %s tells %s: %s", + GetName(), rPlayer->GetName(), text.c_str()); + // when player you are whispering to is dnd, he cannot receive your message, unless you are in gm mode if(!rPlayer->isDND() || isGameMaster()) { @@ -16496,71 +16880,77 @@ void Player::PetSpellInitialize() { Pet* pet = GetPet(); - if(pet) - { - uint8 addlist = 0; + if(!pet) + return; - sLog.outDebug("Pet Spells Groups"); + sLog.outDebug("Pet Spells Groups"); - CreatureInfo const *cinfo = pet->GetCreatureInfo(); + CharmInfo *charmInfo = pet->GetCharmInfo(); - if(pet->isControlled() && (pet->getPetType() == HUNTER_PET || cinfo && cinfo->type == CREATURE_TYPE_DEMON && getClass() == CLASS_WARLOCK)) - { - for(PetSpellMap::iterator itr = pet->m_spells.begin();itr != pet->m_spells.end();++itr) - { - if(itr->second->state == PETSPELL_REMOVED) - continue; - ++addlist; - } - } + WorldPacket data(SMSG_PET_SPELLS, 8+2+4+4+4*MAX_UNIT_ACTION_BAR_INDEX+1+1); + data << uint64(pet->GetGUID()); + data << uint16(pet->GetCreatureInfo()->family); // creature family (required for pet talents) + data << uint32(0); + data << uint8(pet->GetReactState()) << uint8(charmInfo->GetCommandState()) << uint16(0); - // first line + actionbar + spellcount + spells + last adds - WorldPacket data(SMSG_PET_SPELLS, 16+40+1+4*addlist+25); + // action bar loop + charmInfo->BuildActionBar(&data); - CharmInfo *charmInfo = pet->GetCharmInfo(); + size_t spellsCountPos = data.wpos(); - //16 - data << (uint64)pet->GetGUID() << uint32(0x00000000) << uint8(pet->GetReactState()) << uint8(charmInfo->GetCommandState()) << uint16(0); + // spells count + uint8 addlist = 0; + data << uint8(addlist); // placeholder - for(uint32 i = 0; i < 10; i++) //40 + if (pet->IsPermanentPetFor(this)) + { + // spells loop + for (PetSpellMap::iterator itr = pet->m_spells.begin(); itr != pet->m_spells.end(); ++itr) { - data << uint16(charmInfo->GetActionBarEntry(i)->SpellOrAction) << uint16(charmInfo->GetActionBarEntry(i)->Type); + if(itr->second.state == PETSPELL_REMOVED) + continue; + + data << uint16(itr->first); + data << uint16(itr->second.active); // pet spell active state isn't boolean + ++addlist; } + } - data << uint8(addlist); //1 + data.put<uint8>(spellsCountPos, addlist); - if(addlist && pet->isControlled()) - { - for (PetSpellMap::iterator itr = pet->m_spells.begin(); itr != pet->m_spells.end(); ++itr) - { - if(itr->second->state == PETSPELL_REMOVED) - continue; + uint8 cooldownsCount = pet->m_CreatureSpellCooldowns.size() + pet->m_CreatureCategoryCooldowns.size(); + data << uint8(cooldownsCount); - data << uint16(itr->first); - data << uint16(itr->second->active); // pet spell active state isn't boolean - } - } + time_t curTime = time(NULL); - //data << uint8(0x01) << uint32(0x6010) << uint32(0x01) << uint32(0x05) << uint16(0x00); //15 - uint8 count = 3; //1+8+8+8=25 + for(CreatureSpellCooldowns::const_iterator itr = pet->m_CreatureSpellCooldowns.begin(); itr != pet->m_CreatureSpellCooldowns.end(); ++itr) + { + time_t cooldown = (itr->second > curTime) ? (itr->second - curTime) * IN_MILISECONDS : 0; - // if count = 0, then end of packet... - data << count; - // uint32 value is spell id... - // uint64 value is constant 0, unknown... - data << uint32(0x6010) << uint64(0); // if count = 1, 2 or 3 - //data << uint32(0x5fd1) << uint64(0); // if count = 2 - data << uint32(0x8e8c) << uint64(0); // if count = 3 - data << uint32(0x8e8b) << uint64(0); // if count = 3 + data << uint32(itr->first); // spellid + data << uint16(0); // spell category? + data << uint32(cooldown); // cooldown + data << uint32(0); // category cooldown + } - GetSession()->SendPacket(&data); + for(CreatureSpellCooldowns::const_iterator itr = pet->m_CreatureCategoryCooldowns.begin(); itr != pet->m_CreatureCategoryCooldowns.end(); ++itr) + { + time_t cooldown = (itr->second > curTime) ? (itr->second - curTime) * IN_MILISECONDS : 0; + + data << uint32(itr->first); // spellid + data << uint16(0); // spell category? + data << uint32(0); // cooldown + data << uint32(cooldown); // category cooldown } + + data.hexlike(); + + GetSession()->SendPacket(&data); } void Player::PossessSpellInitialize() { Unit* charm = GetCharm(); - if(!charm) return; @@ -16568,55 +16958,83 @@ void Player::PossessSpellInitialize() if(!charmInfo) { - sLog.outError("Player::PossessSpellInitialize(): charm ("I64FMTD") has no charminfo!", charm->GetGUID()); + sLog.outError("Player::PossessSpellInitialize(): charm ("UI64FMTD") has no charminfo!", charm->GetGUID()); return; } - uint8 addlist = 0; - WorldPacket data(SMSG_PET_SPELLS, 16+40+1+4*addlist+25);// first line + actionbar + spellcount + spells + last adds + WorldPacket data(SMSG_PET_SPELLS, 8+2+4+4+4*MAX_UNIT_ACTION_BAR_INDEX+1+1); + data << uint64(charm->GetGUID()); + data << uint16(0); + data << uint32(0); + data << uint32(0); - //16 - data << (uint64)charm->GetGUID() << uint32(0x00000000) << uint8(0) << uint8(0) << uint16(0); + charmInfo->BuildActionBar(&data); - for(uint32 i = 0; i < 10; i++) //40 + data << uint8(0); // spells count + data << uint8(0); // cooldowns count + + GetSession()->SendPacket(&data); +} + +void Player::VehicleSpellInitialize() +{ + Unit* charm = m_Vehicle; + if(!charm) + return; + + WorldPacket data(SMSG_PET_SPELLS, 8+2+4+4+4*10+1+1); + data << uint64(charm->GetGUID()); + data << uint16(0); + data << uint32(0); + data << uint32(0x00000101); + + for(uint32 i = 0; i < CREATURE_MAX_SPELLS; ++i) { - data << uint16(charmInfo->GetActionBarEntry(i)->SpellOrAction) << uint16(charmInfo->GetActionBarEntry(i)->Type); - } + uint32 spellId = ((Creature*)charm)->m_spells[i]; + if(!spellId) + continue; - data << uint8(addlist); //1 + SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellId); + if(!spellInfo) + continue; - uint8 count = 3; - data << count; - data << uint32(0x6010) << uint64(0); // if count = 1, 2 or 3 - data << uint32(0x8e8c) << uint64(0); // if count = 3 - data << uint32(0x8e8b) << uint64(0); // if count = 3 + if(IsPassiveSpell(spellId)) + { + charm->CastSpell(charm, spellId, true); + data << uint16(0) << uint8(0) << uint8(i+8); + } + else + data << uint16(spellId) << uint8(0) << uint8(i+8); + } + for(uint32 i = CREATURE_MAX_SPELLS; i < MAX_SPELL_CONTROL_BAR; ++i) + data << uint16(0) << uint8(0) << uint8(i+8); + + data << uint8(0); + data << uint8(0); GetSession()->SendPacket(&data); } void Player::CharmSpellInitialize() { - Unit* charm = GetCharm(); - + Unit* charm = GetFirstControlled(); if(!charm) return; CharmInfo *charmInfo = charm->GetCharmInfo(); if(!charmInfo) { - sLog.outError("Player::CharmSpellInitialize(): the player's charm ("I64FMTD") has no charminfo!", charm->GetGUID()); + sLog.outError("Player::CharmSpellInitialize(): the player's charm ("UI64FMTD") has no charminfo!", charm->GetGUID()); return; } uint8 addlist = 0; - if(charm->GetTypeId() != TYPEID_PLAYER) { CreatureInfo const *cinfo = ((Creature*)charm)->GetCreatureInfo(); - - if(cinfo && cinfo->type == CREATURE_TYPE_DEMON && getClass() == CLASS_WARLOCK) + //if(cinfo && cinfo->type == CREATURE_TYPE_DEMON && getClass() == CLASS_WARLOCK) { - for(uint32 i = 0; i < CREATURE_MAX_SPELLS; ++i) + for(uint32 i = 0; i < MAX_SPELL_CHARM; ++i) { if(charmInfo->GetCharmSpell(i)->spellId) ++addlist; @@ -16624,27 +17042,23 @@ void Player::CharmSpellInitialize() } } - WorldPacket data(SMSG_PET_SPELLS, 16+40+1+4*addlist+25);// first line + actionbar + spellcount + spells + last adds - - data << (uint64)charm->GetGUID() << uint32(0x00000000); + WorldPacket data(SMSG_PET_SPELLS, 8+2+4+4+4*MAX_UNIT_ACTION_BAR_INDEX+1+4*addlist+1); + data << uint64(charm->GetGUID()); + data << uint16(0); + data << uint32(0); if(charm->GetTypeId() != TYPEID_PLAYER) - data << uint8(((Creature*)charm)->GetReactState()) << uint8(charmInfo->GetCommandState()); + data << uint8(((Creature*)charm)->GetReactState()) << uint8(charmInfo->GetCommandState()) << uint16(0); else - data << uint8(0) << uint8(0); - - data << uint16(0); + data << uint8(0) << uint8(0) << uint16(0); - for(uint32 i = 0; i < 10; i++) //40 - { - data << uint16(charmInfo->GetActionBarEntry(i)->SpellOrAction) << uint16(charmInfo->GetActionBarEntry(i)->Type); - } + charmInfo->BuildActionBar(&data); - data << uint8(addlist); //1 + data << uint8(addlist); if(addlist) { - for(uint32 i = 0; i < CREATURE_MAX_SPELLS; ++i) + for(uint32 i = 0; i < MAX_SPELL_CHARM; ++i) { CharmSpellEntry *cspell = charmInfo->GetCharmSpell(i); if(cspell->spellId) @@ -16655,84 +17069,48 @@ void Player::CharmSpellInitialize() } } - uint8 count = 3; - data << count; - data << uint32(0x6010) << uint64(0); // if count = 1, 2 or 3 - data << uint32(0x8e8c) << uint64(0); // if count = 3 - data << uint32(0x8e8b) << uint64(0); // if count = 3 + data << uint8(0); // cooldowns count GetSession()->SendPacket(&data); } -int32 Player::GetTotalFlatMods(uint32 spellId, SpellModOp op) +void Player::SendRemoveControlBar() { - SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellId); - if (!spellInfo) return 0; - int32 total = 0; - for (SpellModList::iterator itr = m_spellMods[op].begin(); itr != m_spellMods[op].end(); ++itr) - { - SpellModifier *mod = *itr; - - if(!IsAffectedBySpellmod(spellInfo,mod)) - continue; - - if (mod->type == SPELLMOD_FLAT) - total += mod->value; - } - return total; + WorldPacket data(SMSG_PET_SPELLS, 8); + data << uint64(0); + GetSession()->SendPacket(&data); } -int32 Player::GetTotalPctMods(uint32 spellId, SpellModOp op) +bool Player::IsAffectedBySpellmod(SpellEntry const *spellInfo, SpellModifier *mod, Spell * spell) { - SpellEntry const *spellInfo = sSpellStore.LookupEntry(spellId); - if (!spellInfo) return 0; - int32 total = 0; - for (SpellModList::iterator itr = m_spellMods[op].begin(); itr != m_spellMods[op].end(); ++itr) - { - SpellModifier *mod = *itr; + if (!mod || !spellInfo) + return false; - if(!IsAffectedBySpellmod(spellInfo,mod)) - continue; - - if (mod->type == SPELLMOD_PCT) - total += mod->value; - } - return total; -} - -bool Player::IsAffectedBySpellmod(SpellEntry const *spellInfo, SpellModifier *mod, Spell const* spell) -{ - if (!mod || !spellInfo) + // Mod out of charges + if (spell && mod->charges == -1 && spell->m_appliedMods.find(mod->ownerAura) == spell->m_appliedMods.end()) return false; - if(mod->charges == -1 && mod->lastAffected ) // marked as expired but locked until spell casting finish - { - // prevent apply to any spell except spell that trigger expire - if(spell) - { - if(mod->lastAffected != spell) - return false; - } - else if(mod->lastAffected != FindCurrentSpellBySpellId(spellInfo->Id)) - return false; - } - - return spellmgr.IsAffectedBySpell(spellInfo,mod->spellId,mod->effectId,mod->mask); + return spellmgr.IsAffectedByMod(spellInfo, mod); } void Player::AddSpellMod(SpellModifier* mod, bool apply) { uint16 Opcode= (mod->type == SPELLMOD_FLAT) ? SMSG_SET_FLAT_SPELL_MODIFIER : SMSG_SET_PCT_SPELL_MODIFIER; - for(int eff=0;eff<64;++eff) + uint8 i=0; + flag96 _mask; + for(int eff=0;eff<96;++eff) { - uint64 _mask = uint64(1) << eff; + if ((eff!=0) && (eff%32==0)) + i++; + + _mask[i] = uint32(1) << (eff-(32*i)); if ( mod->mask & _mask) { int32 val = 0; for (SpellModList::iterator itr = m_spellMods[mod->op].begin(); itr != m_spellMods[mod->op].end(); ++itr) { - if ((*itr)->type == mod->type && (*itr)->mask & _mask) + if ((*itr)->type == mod->type && (*itr)->mask & _mask ) val += (*itr)->value; } val += apply ? mod->value : -(mod->value); @@ -16748,59 +17126,133 @@ void Player::AddSpellMod(SpellModifier* mod, bool apply) m_spellMods[mod->op].push_back(mod); else { - if (mod->charges == -1) - --m_SpellModRemoveCount; m_spellMods[mod->op].remove(mod); delete mod; } } // Restore spellmods in case of failed cast -void Player::RestoreSpellMods(Spell const* spell) +void Player::RestoreSpellMods(Spell * spell) { - if(!spell || (m_SpellModRemoveCount == 0)) + if (!spell || spell->m_appliedMods.empty()) return; - for(int i=0;i<MAX_SPELLMOD;++i) + for(uint8 i=0;i<MAX_SPELLMOD;++i) { for (SpellModList::iterator itr = m_spellMods[i].begin(); itr != m_spellMods[i].end();++itr) { SpellModifier *mod = *itr; - if (mod && mod->charges == -1 && mod->lastAffected == spell) - { - mod->lastAffected = NULL; + // spellmods without aura set cannot be charged + if (!mod->ownerAura || !mod->ownerAura->GetAuraCharges()) + continue; + + // check if mod affected this spell + Spell::UsedSpellMods::iterator iterMod = spell->m_appliedMods.find(mod->ownerAura); + if (iterMod == spell->m_appliedMods.end()) + continue; + + // remove from list + spell->m_appliedMods.erase(iterMod); + + // add mod charges back to mod + if (mod->charges == -1) mod->charges = 1; - m_SpellModRemoveCount--; - } + else + mod->charges++; + + // Skip this check for now - aura charges may change due to various reason + // TODO: trac these changes correctly + //assert (mod->ownerAura->GetAuraCharges() <= mod->charges); } } } -void Player::RemoveSpellMods(Spell const* spell) +void Player::RemoveSpellMods(Spell * spell) { - if(!spell || (m_SpellModRemoveCount == 0)) + if (!spell) + return; + std::set <Aura *> checkedSpells; + + AuraEffectList const & auraList = GetAurasByType(SPELL_AURA_ABILITY_IGNORE_AURASTATE); + for(AuraEffectList::const_iterator itr = auraList.begin(); itr != auraList.end();) + { + AuraEffect * aur = *itr; + ++itr; + if (!aur->GetParentAura()->GetAuraCharges()) + continue; + + SpellEntry const * spellInfo = aur->GetSpellProto(); + + if (spellInfo->SpellFamilyName != spell->m_spellInfo->SpellFamilyName || + checkedSpells.find(aur->GetParentAura()) != checkedSpells.end()) + continue; + + flag96 const * mask = spellmgr.GetSpellAffect(aur->GetId(), aur->GetEffIndex()); + if (!mask) + mask = &spellInfo->EffectSpellClassMask[aur->GetEffIndex()]; + + if (spell->m_spellInfo->SpellFamilyFlags & *mask) + { + checkedSpells.insert(aur->GetParentAura()); + spell->m_appliedMods.erase(aur->GetParentAura()); + if (aur->GetParentAura()->DropAuraCharge()) + itr = auraList.begin(); + } + } + + if (spell->m_appliedMods.empty()) return; - for(int i=0;i<MAX_SPELLMOD;++i) + for(uint8 i=0;i<MAX_SPELLMOD;++i) { for (SpellModList::iterator itr = m_spellMods[i].begin(); itr != m_spellMods[i].end();) { SpellModifier *mod = *itr; ++itr; - if (mod && mod->charges == -1 && (mod->lastAffected == spell || mod->lastAffected==NULL)) - { - RemoveAurasDueToSpell(mod->spellId); - if (m_spellMods[i].empty()) - break; - else - itr = m_spellMods[i].begin(); - } + // spellmods without aura set cannot be charged + if (!mod->ownerAura || !mod->ownerAura->GetAuraCharges()) + continue; + + // check if mod affected this spell + Spell::UsedSpellMods::iterator iterMod = spell->m_appliedMods.find(mod->ownerAura); + if (iterMod == spell->m_appliedMods.end()) + continue; + + // remove from list + spell->m_appliedMods.erase(iterMod); + + if (mod->ownerAura->DropAuraCharge()) + itr = m_spellMods[i].begin(); } } } +void Player::DropModCharge(SpellModifier * mod, Spell * spell) +{ + if (spell && mod->ownerAura && mod->charges > 0 ) + { + --mod->charges; + if (mod->charges == 0) + { + mod->charges = -1; + } + spell->m_appliedMods.insert(mod->ownerAura); + } +} + +void Player::SetSpellModTakingSpell(Spell * spell, bool apply) +{ + if (!spell || (m_spellModTakingSpell && m_spellModTakingSpell != spell)) + return; + + if (apply) + m_spellModTakingSpell = spell; + else + m_spellModTakingSpell = NULL; +} + // send Proficiency void Player::SendProficiency(uint8 pr1, uint32 pr2) { @@ -16853,6 +17305,27 @@ void Player::RemovePetitionsAndSigns(uint64 guid, uint32 type) CharacterDatabase.CommitTransaction(); } +void Player::LeaveAllArenaTeams(uint64 guid) +{ + QueryResult *result = CharacterDatabase.PQuery("SELECT arena_team_member.arenateamid FROM arena_team_member JOIN arena_team ON arena_team_member.arenateamid = arena_team.arenateamid WHERE guid='%u'", GUID_LOPART(guid)); + if(!result) + return; + + do + { + Field *fields = result->Fetch(); + uint32 at_id = fields[0].GetUInt32(); + if(at_id != 0) + { + ArenaTeam * at = objmgr.GetArenaTeamById(at_id); + if(at) + at->DelMember(guid); + } + } while (result->NextRow()); + + delete result; +} + void Player::SetRestBonus (float rest_bonus_new) { // Prevent resting on max level @@ -16883,7 +17356,7 @@ void Player::HandleStealthedUnitsDetection() { std::list<Unit*> stealthedUnits; Trinity::AnyStealthedCheck u_check; - Trinity::UnitListSearcher<Trinity::AnyStealthedCheck > searcher(stealthedUnits, u_check); + Trinity::UnitListSearcher<Trinity::AnyStealthedCheck > searcher(this, stealthedUnits, u_check); VisitNearbyObject(World::GetMaxVisibleDistance(), searcher); for (std::list<Unit*>::iterator i = stealthedUnits.begin(); i != stealthedUnits.end(); ++i) @@ -16903,53 +17376,98 @@ void Player::HandleStealthedUnitsDetection() } } -bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_id, Creature* npc) +bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, Creature* npc /*= NULL*/, uint32 spellid /*= 0*/) { if(nodes.size() < 2) return false; - // not let cheating with start flight mounted - if(IsMounted()) + // not let cheating with start flight in time of logout process || if casting not finished || while in combat || if not use Spell's with EffectSendTaxi + if(GetSession()->isLogingOut() || isInCombat()) { WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); - data << uint32(ERR_TAXIPLAYERALREADYMOUNTED); + data << uint32(ERR_TAXIPLAYERBUSY); GetSession()->SendPacket(&data); return false; } - if( m_ShapeShiftFormSpellId && m_form != FORM_BATTLESTANCE && m_form != FORM_BERSERKERSTANCE && m_form != FORM_DEFENSIVESTANCE && m_form != FORM_SHADOW ) - { - WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); - data << uint32(ERR_TAXIPLAYERSHAPESHIFTED); - GetSession()->SendPacket(&data); + if(HasFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_DISABLE_MOVE)) return false; - } - // not let cheating with start flight in time of logout process || if casting not finished || while in combat || if not use Spell's with EffectSendTaxi - if(GetSession()->isLogingOut() || - (!m_currentSpells[CURRENT_GENERIC_SPELL] || - m_currentSpells[CURRENT_GENERIC_SPELL]->m_spellInfo->Effect[0] != SPELL_EFFECT_SEND_TAXI)&& - IsNonMeleeSpellCasted(false) || - isInCombat()) + // taximaster case + if(npc) { - WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); - data << uint32(ERR_TAXIPLAYERBUSY); - GetSession()->SendPacket(&data); - return false; + // not let cheating with start flight mounted + if(IsMounted()) + { + WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); + data << uint32(ERR_TAXIPLAYERALREADYMOUNTED); + GetSession()->SendPacket(&data); + return false; + } + + if( m_ShapeShiftFormSpellId && m_form != FORM_BATTLESTANCE && m_form != FORM_BERSERKERSTANCE && m_form != FORM_DEFENSIVESTANCE && m_form != FORM_SHADOW ) + { + WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); + data << uint32(ERR_TAXIPLAYERSHAPESHIFTED); + GetSession()->SendPacket(&data); + return false; + } + + // not let cheating with start flight in time of logout process || if casting not finished || while in combat || if not use Spell's with EffectSendTaxi + if(IsNonMeleeSpellCasted(false)) + { + WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); + data << uint32(ERR_TAXIPLAYERBUSY); + GetSession()->SendPacket(&data); + return false; + } } + // cast case or scripted call case + else + { + RemoveAurasByType(SPELL_AURA_MOUNTED); - if(HasFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_DISABLE_MOVE)) - return false; + if( m_ShapeShiftFormSpellId && m_form != FORM_BATTLESTANCE && m_form != FORM_BERSERKERSTANCE && m_form != FORM_DEFENSIVESTANCE && m_form != FORM_SHADOW ) + RemoveAurasDueToSpell(m_ShapeShiftFormSpellId); + + if(m_currentSpells[CURRENT_GENERIC_SPELL] && m_currentSpells[CURRENT_GENERIC_SPELL]->m_spellInfo->Id != spellid) + InterruptSpell(CURRENT_GENERIC_SPELL,false); + + InterruptSpell(CURRENT_AUTOREPEAT_SPELL,false); + + if(m_currentSpells[CURRENT_CHANNELED_SPELL] && m_currentSpells[CURRENT_CHANNELED_SPELL]->m_spellInfo->Id != spellid) + InterruptSpell(CURRENT_CHANNELED_SPELL,true); + } uint32 sourcenode = nodes[0]; // starting node too far away (cheat?) TaxiNodesEntry const* node = sTaxiNodesStore.LookupEntry(sourcenode); - if( !node || node->map_id != GetMapId() || - (node->x - GetPositionX())*(node->x - GetPositionX())+ - (node->y - GetPositionY())*(node->y - GetPositionY())+ - (node->z - GetPositionZ())*(node->z - GetPositionZ()) > - (2*INTERACTION_DISTANCE)*(2*INTERACTION_DISTANCE)*(2*INTERACTION_DISTANCE) ) + if (!node) + { + WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); + data << uint32(ERR_TAXINOSUCHPATH); + GetSession()->SendPacket(&data); + return false; + } + + // check node starting pos data set case if provided + if (node->x != 0.0f || node->y != 0.0f || node->z != 0.0f) + { + if (node->map_id != GetMapId() || + (node->x - GetPositionX())*(node->x - GetPositionX())+ + (node->y - GetPositionY())*(node->y - GetPositionY())+ + (node->z - GetPositionZ())*(node->z - GetPositionZ()) > + (2*INTERACTION_DISTANCE)*(2*INTERACTION_DISTANCE)*(2*INTERACTION_DISTANCE)) + { + WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); + data << uint32(ERR_TAXITOOFARAWAY); + GetSession()->SendPacket(&data); + return false; + } + } + // node must have pos if taxi master case (npc != NULL) + else if (npc) { WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); data << uint32(ERR_TAXIUNSPECIFIEDSERVERERROR); @@ -16962,6 +17480,10 @@ bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_i // stop combat at start taxi flight if any CombatStop(); + StopCastingCharm(); + StopCastingBindSight(); + ExitVehicle(); + // stop trade (client cancel trade at taxi map open but cheating tools can be used for reopen it) TradeCancel(true); @@ -17001,10 +17523,11 @@ bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_i prevnode = lastnode; } - if(!mount_id) // if not provide then attempt use default. - mount_id = objmgr.GetTaxiMount(sourcenode, GetTeam()); + // get mount model (in case non taximaster (npc==NULL) allow more wide lookup) + uint32 mount_display_id = objmgr.GetTaxiMountDisplayId(sourcenode, GetTeam(), npc == NULL); - if (mount_id == 0 || sourcepath == 0) + // in spell case allow 0 model + if (mount_display_id == 0 && spellid == 0 || sourcepath == 0) { WorldPacket data(SMSG_ACTIVATETAXIREPLY, 4); data << uint32(ERR_TAXIUNSPECIFIEDSERVERERROR); @@ -17015,10 +17538,8 @@ bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_i uint32 money = GetMoney(); - if(npc) - { + if (npc) totalcost = (uint32)ceil(totalcost*GetReputationPriceDiscount(npc)); - } if(money < totalcost) { @@ -17031,6 +17552,8 @@ bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_i //Checks and preparations done, DO FLIGHT ModifyMoney(-(int32)totalcost); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_GOLD_SPENT_FOR_TRAVELLING, totalcost); + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_FLIGHT_PATHS_TAKEN, 1); // prevent stealth flight //RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_TALK); @@ -17041,11 +17564,26 @@ bool Player::ActivateTaxiPathTo(std::vector<uint32> const& nodes, uint32 mount_i sLog.outDebug("WORLD: Sent SMSG_ACTIVATETAXIREPLY"); - GetSession()->SendDoFlight(mount_id, sourcepath); + GetSession()->SendDoFlight(mount_display_id, sourcepath); return true; } +bool Player::ActivateTaxiPathTo( uint32 taxi_path_id, uint32 spellid /*= 0*/ ) +{ + TaxiPathEntry const* entry = sTaxiPathStore.LookupEntry(taxi_path_id); + if(!entry) + return false; + + std::vector<uint32> nodes; + + nodes.resize(2); + nodes[0] = entry->from; + nodes[1] = entry->to; + + return ActivateTaxiPathTo(nodes,NULL,spellid); +} + void Player::ProhibitSpellScholl(SpellSchoolMask idSchoolMask, uint32 unTimeMs ) { // last check 2.0.10 @@ -17074,9 +17612,9 @@ void Player::ProhibitSpellScholl(SpellSchoolMask idSchoolMask, uint32 unTimeMs ) if((idSchoolMask & GetSpellSchoolMask(spellInfo)) && GetSpellCooldownDelay(unSpellId) < unTimeMs ) { - data << unSpellId; - data << unTimeMs; // in m.secs - AddSpellCooldown(unSpellId, 0, curTime + unTimeMs/1000); + data << uint32(unSpellId); + data << uint32(unTimeMs); // in m.secs + AddSpellCooldown(unSpellId, 0, curTime + unTimeMs/IN_MILISECONDS); } } GetSession()->SendPacket(&data); @@ -17096,6 +17634,7 @@ void Player::InitDataForForm(bool reapplyMods) switch(m_form) { + case FORM_GHOUL: case FORM_CAT: { if(getPowerType()!=POWER_ENERGY) @@ -17133,7 +17672,7 @@ bool Player::BuyItemFromVendor(uint64 vendorguid, uint32 item, uint8 count, uint if(count < 1) count = 1; // cheating attempt - if(slot > MAX_BAG_SIZE && slot != NULL_SLOT) + if(slot > MAX_BAG_SIZE && slot !=NULL_SLOT) return false; if(!isAlive()) @@ -17146,7 +17685,7 @@ bool Player::BuyItemFromVendor(uint64 vendorguid, uint32 item, uint8 count, uint return false; } - Creature *pCreature = ObjectAccessor::GetNPCIfCanInteractWith(*this, vendorguid,UNIT_NPC_FLAG_VENDOR); + Creature *pCreature = GetNPCIfCanInteractWith(vendorguid,UNIT_NPC_FLAG_VENDOR); if (!pCreature) { sLog.outDebug( "WORLD: BuyItemFromVendor - Unit (GUID: %u) not found or you can't interact with him.", uint32(GUID_LOPART(vendorguid)) ); @@ -17243,17 +17782,15 @@ bool Player::BuyItemFromVendor(uint64 vendorguid, uint32 item, uint8 count, uint if (bagguid != NULL_BAG && slot != NULL_SLOT) { - Bag *pBag; if( bagguid == GetGUID() ) { bag = INVENTORY_SLOT_BAG_0; } else { - for (int i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END;i++) + for (uint8 i = INVENTORY_SLOT_BAG_START; i < INVENTORY_SLOT_BAG_END;i++) { - pBag = (Bag*)GetItemByPos(INVENTORY_SLOT_BAG_0,i); - if( pBag ) + if( Bag *pBag = (Bag*)GetItemByPos(INVENTORY_SLOT_BAG_0,i) ) { if( bagguid == pBag->GetGUID() ) { @@ -17263,7 +17800,7 @@ bool Player::BuyItemFromVendor(uint64 vendorguid, uint32 item, uint8 count, uint sLog.outDebug("CHEATING ATTEMPT slot > bagSize in BuyItemFromVendor playerGUID: "I64FMT" name: %s slot: %u", GetGUID(), GetName(), slot); return false; } - bag = i; + bag = i; break; } } @@ -17372,7 +17909,7 @@ uint32 Player::GetMaxPersonalArenaRatingRequirement() // the personal rating of the arena team must match the required limit as well // so return max[in arenateams](min(personalrating[teamtype], teamrating[teamtype])) uint32 max_personal_rating = 0; - for(int i = 0; i < MAX_ARENA_SLOT; ++i) + for(uint8 i = 0; i < MAX_ARENA_SLOT; ++i) { if(ArenaTeam * at = objmgr.GetArenaTeamById(GetArenaTeamId(i))) { @@ -17406,8 +17943,8 @@ void Player::UpdateHomebindTime(uint32 time) { if (time >= m_HomebindTimer) { - // teleport to homebind location - TeleportTo(m_homebindMapId, m_homebindX, m_homebindY, m_homebindZ, GetOrientation()); + // teleport to nearest graveyard + RepopAtGraveyard(); } else m_HomebindTimer -= time; @@ -17425,16 +17962,46 @@ void Player::UpdateHomebindTime(uint32 time) } } +void Player::UpdatePvPState(bool onlyFFA) +{ + // TODO: should we always synchronize UNIT_FIELD_BYTES_2, 1 of controller and controlled? + if(!pvpInfo.inNoPvPArea && !isGameMaster() + && (pvpInfo.inFFAPvPArea || sWorld.IsFFAPvPRealm())) + { + if(!HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP)) + { + SetByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); + for(ControlList::iterator itr = m_Controlled.begin(); itr != m_Controlled.end(); ++itr) + (*itr)->SetByteValue(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); + } + } + else if(HasByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP)) + { + RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); + for(ControlList::iterator itr = m_Controlled.begin(); itr != m_Controlled.end(); ++itr) + (*itr)->RemoveByteFlag(UNIT_FIELD_BYTES_2, 1, UNIT_BYTE2_FLAG_FFA_PVP); + } + + if(onlyFFA) + return; + + if(pvpInfo.inHostileArea) // in hostile area + { + if(!IsPvP() || pvpInfo.endTimer != 0) + UpdatePvP(true, true); + } + else // in friendly area + { + if(IsPvP() && !HasFlag(PLAYER_FLAGS,PLAYER_FLAGS_IN_PVP) && pvpInfo.endTimer == 0) + pvpInfo.endTimer = time(0); // start toggle-off + } +} + void Player::UpdatePvP(bool state, bool ovrride) { if(!state || ovrride) { SetPvP(state); - if(Pet* pet = GetPet()) - pet->SetPvP(state); - if(Unit* charmed = GetCharm()) - charmed->SetPvP(state); - pvpInfo.endTimer = 0; } else @@ -17442,13 +18009,102 @@ void Player::UpdatePvP(bool state, bool ovrride) if(pvpInfo.endTimer != 0) pvpInfo.endTimer = time(NULL); else - { SetPvP(state); + } +} - if(Pet* pet = GetPet()) - pet->SetPvP(state); - if(Unit* charmed = GetCharm()) - charmed->SetPvP(state); +void Player::AddSpellAndCategoryCooldowns(SpellEntry const* spellInfo, uint32 itemId, Spell* spell, bool infinityCooldown) +{ + // init cooldown values + uint32 cat = 0; + int32 rec = -1; + int32 catrec = -1; + + // some special item spells without correct cooldown in SpellInfo + // cooldown information stored in item prototype + // This used in same way in WorldSession::HandleItemQuerySingleOpcode data sending to client. + + if(itemId) + { + if(ItemPrototype const* proto = ObjectMgr::GetItemPrototype(itemId)) + { + for(uint8 idx = 0; idx < 5; ++idx) + { + if(proto->Spells[idx].SpellId == spellInfo->Id) + { + cat = proto->Spells[idx].SpellCategory; + rec = proto->Spells[idx].SpellCooldown; + catrec = proto->Spells[idx].SpellCategoryCooldown; + break; + } + } + } + } + + // if no cooldown found above then base at DBC data + if(rec < 0 && catrec < 0) + { + cat = spellInfo->Category; + rec = spellInfo->RecoveryTime; + catrec = spellInfo->CategoryRecoveryTime; + } + + time_t curTime = time(NULL); + + time_t catrecTime; + time_t recTime; + + // overwrite time for selected category + if(infinityCooldown) + { + // use +MONTH as infinity mark for spell cooldown (will checked as MONTH/2 at save ans skipped) + // but not allow ignore until reset or re-login + catrecTime = catrec > 0 ? curTime+MONTH : 0; + recTime = rec > 0 ? curTime+MONTH : catrecTime; + } + else + { + // shoot spells used equipped item cooldown values already assigned in GetAttackTime(RANGED_ATTACK) + // prevent 0 cooldowns set by another way + if (rec <= 0 && catrec <= 0 && (cat == 76 || IsAutoRepeatRangedSpell(spellInfo) && spellInfo->Id != SPELL_ID_AUTOSHOT)) + rec = GetAttackTime(RANGED_ATTACK); + + // Now we have cooldown data (if found any), time to apply mods + if(rec > 0) + ApplySpellMod(spellInfo->Id, SPELLMOD_COOLDOWN, rec, spell); + + if(catrec > 0) + ApplySpellMod(spellInfo->Id, SPELLMOD_COOLDOWN, catrec, spell); + + // replace negative cooldowns by 0 + if (rec < 0) rec = 0; + if (catrec < 0) catrec = 0; + + // no cooldown after applying spell mods + if( rec == 0 && catrec == 0) + return; + + catrecTime = catrec ? curTime+catrec/IN_MILISECONDS : 0; + recTime = rec ? curTime+rec/IN_MILISECONDS : catrecTime; + } + + // self spell cooldown + if(recTime > 0) + AddSpellCooldown(spellInfo->Id, itemId, recTime); + + // category spells + if (cat && catrec > 0) + { + SpellCategoryStore::const_iterator i_scstore = sSpellCategoryStore.find(cat); + if(i_scstore != sSpellCategoryStore.end()) + { + for(SpellCategorySet::const_iterator i_scset = i_scstore->second.begin(); i_scset != i_scstore->second.end(); ++i_scset) + { + if(*i_scset == spellInfo->Id) // skip main spell, already handled above + continue; + + AddSpellCooldown(*i_scset, itemId, catrecTime); + } } } } @@ -17461,25 +18117,41 @@ void Player::AddSpellCooldown(uint32 spellid, uint32 itemid, time_t end_time) m_spellCooldowns[spellid] = sc; } -void Player::SendCooldownEvent(SpellEntry const *spellInfo) +void Player::SendCooldownEvent(SpellEntry const *spellInfo, uint32 itemId, Spell* spell) { - if ( !(spellInfo->Attributes & SPELL_ATTR_DISABLED_WHILE_ACTIVE) ) - return; + // start cooldowns at server side, if any + AddSpellAndCategoryCooldowns(spellInfo,itemId,spell); - // Get spell cooldown - int32 cooldown = GetSpellRecoveryTime(spellInfo); - // Apply spellmods - ApplySpellMod(spellInfo->Id, SPELLMOD_COOLDOWN, cooldown); - if (cooldown < 0) - cooldown = 0; - // Add cooldown - AddSpellCooldown(spellInfo->Id, 0, time(NULL) + cooldown / 1000); - // Send activate + // Send activate cooldown timer (possible 0) at client side WorldPacket data(SMSG_COOLDOWN_EVENT, (4+8)); data << spellInfo->Id; data << GetGUID(); SendDirectMessage(&data); } + +void Player::UpdatePotionCooldown(Spell* spell) +{ + // no potion used i combat or still in combat + if(!m_lastPotionId || isInCombat()) + return; + + // Call not from spell cast, send cooldown event for item spells if no in combat + if(!spell) + { + // spell/item pair let set proper cooldown (except not existed charged spell cooldown spellmods for potions) + if(ItemPrototype const* proto = ObjectMgr::GetItemPrototype(m_lastPotionId)) + for(uint8 idx = 0; idx < 5; ++idx) + if(proto->Spells[idx].SpellId && proto->Spells[idx].SpellTrigger == ITEM_SPELLTRIGGER_ON_USE) + if(SpellEntry const* spellInfo = sSpellStore.LookupEntry(proto->Spells[idx].SpellId)) + SendCooldownEvent(spellInfo,m_lastPotionId); + } + // from spell cases (m_lastPotionId set in Spell::SendSpellCooldown) + else + SendCooldownEvent(spell->m_spellInfo,m_lastPotionId,spell); + + m_lastPotionId = 0; +} + //slot to be excluded while counting bool Player::EnchantmentFitsRequirements(uint32 enchantmentcondition, int8 slot) { @@ -17536,7 +18208,7 @@ bool Player::EnchantmentFitsRequirements(uint32 enchantmentcondition, int8 slot) bool activate = true; - for(int i = 0; i < 5; i++) + for(uint8 i = 0; i < 5; i++) { if(!Condition->Color[i]) continue; @@ -17644,13 +18316,14 @@ void Player::LeaveBattleground(bool teleportToEntryPoint) { if(BattleGround *bg = GetBattleGround()) { - bool need_debuf = bg->isBattleGround() && !isGameMaster() && (bg->GetStatus() == STATUS_IN_PROGRESS) && sWorld.getConfig(CONFIG_BATTLEGROUND_CAST_DESERTER); - bg->RemovePlayerAtLeave(GetGUID(), teleportToEntryPoint, true); // call after remove to be sure that player resurrected for correct cast - if(need_debuf) - CastSpell(this, 26013, true); // Deserter + if( bg->isBattleGround() && !isGameMaster() && sWorld.getConfig(CONFIG_BATTLEGROUND_CAST_DESERTER) ) + { + if( bg->GetStatus() == STATUS_IN_PROGRESS || bg->GetStatus() == STATUS_WAIT_JOIN ) + CastSpell(this, 26013, true); // Deserter + } } } @@ -17680,7 +18353,7 @@ void Player::ReportedAfkBy(Player* reporter) return; // check if player has 'Idle' or 'Inactive' debuff - if(m_bgAfkReporter.find(reporter->GetGUIDLow())==m_bgAfkReporter.end() && !HasAura(43680,0) && !HasAura(43681,0) && reporter->CanReportAfkDueToLimit()) + if(m_bgAfkReporter.find(reporter->GetGUIDLow())==m_bgAfkReporter.end() && !HasAura(43680) && !HasAura(43681) && reporter->CanReportAfkDueToLimit()) { m_bgAfkReporter.insert(reporter->GetGUIDLow()); // 3 players have to complain to apply debuff @@ -17696,9 +18369,13 @@ void Player::ReportedAfkBy(Player* reporter) bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool is3dDistance) const { // Always can see self - if (u == this) + if (m_mover == u || this == u) return true; + // phased visibility (both must phased in same way) + if(!InSamePhase(u)) + return false; + // player visible for other player if not logout and at same transport // including case when player is out of world bool at_same_transport = @@ -17712,50 +18389,45 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool return false; // forbidden to seen (at GM respawn command) - if(u->GetVisibility() == VISIBILITY_RESPAWN) - return false; - - // always seen by owner - if(GetGUID() == u->GetCharmerOrOwnerGUID()) - return true; + //if(u->GetVisibility() == VISIBILITY_RESPAWN) + // return false; // Grid dead/alive checks // non visible at grid for any stealth state if(!u->IsVisibleInGridForPlayer(this)) return false; - // If the player is currently channeling vision, update visibility from the target unit's location - const WorldObject* target = GetFarsightTarget(); - if (!target || !HasFarsightVision()) // Vision needs to be on the farsight target - target = this; + // always seen by owner + if(GetGUID() == u->GetCharmerOrOwnerGUID()) + return true; // different visible distance checks if(isInFlight()) // what see player in flight { - if (!target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceInFlight()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) + if (!m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceInFlight()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) return false; } else if(!u->isAlive()) // distance for show body { - if (!target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForObject()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) + if (!m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForObject()+(inVisibleList ? World::GetVisibleObjectGreyDistance() : 0.0f), is3dDistance)) return false; } else if(u->GetTypeId()==TYPEID_PLAYER) // distance for show player { // Players far than max visible distance for player or not in our map are not visible too - if (!at_same_transport && !target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) + if (!at_same_transport && !m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) return false; } else if(u->GetCharmerOrOwnerGUID()) // distance for show pet/charmed { // Pet/charmed far than max visible distance for player or not in our map are not visible too - if (!target->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) + if (!m_seer->IsWithinDistInMap(u,World::GetMaxVisibleDistanceForPlayer()+(inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f), is3dDistance)) return false; } else // distance for show creature { // Units far than max visible distance for creature or not in our map are not visible too - if (!target->IsWithinDistInMap(u + if (!m_seer->IsWithinDistInMap(u , u->isActiveObject() ? (MAX_VISIBILITY_DISTANCE - (inVisibleList ? 0.0f : World::GetVisibleUnitGreyDistance())) : (World::GetMaxVisibleDistanceForCreature() + (inVisibleList ? World::GetVisibleUnitGreyDistance() : 0.0f)) , is3dDistance)) @@ -17776,7 +18448,7 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool } // GM's can see everyone with invisibilitymask with less or equal security level - if(m_invisibilityMask || u->m_invisibilityMask) + if(m_mover->m_invisibilityMask || u->m_invisibilityMask) { if(isGameMaster()) { @@ -17787,7 +18459,7 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool } // player see other player with stealth/invisibility only if he in same group or raid or same team (raid/team case dependent from conf setting) - if(!canDetectInvisibilityOf(u)) + if(!m_mover->canDetectInvisibilityOf(u)) if(!(u->GetTypeId()==TYPEID_PLAYER && !IsHostileTo(u) && IsGroupVisibleFor(((Player*)u)))) return false; } @@ -17802,7 +18474,7 @@ bool Player::canSeeOrDetect(Unit const* u, bool detect, bool inVisibleList, bool detect = false; if(m_DetectInvTimer < 300 || !HaveAtClient(u)) if(!(u->GetTypeId()==TYPEID_PLAYER && !IsHostileTo(u) && IsGroupVisibleFor(((Player*)u)))) - if(!detect || !canDetectStealthOf(u, GetDistance(u))) + if(!detect || !m_mover->canDetectStealthOf(u, GetDistance(u))) return false; } @@ -17877,6 +18549,19 @@ bool Player::IsVisibleGloballyFor( Player* u ) const return true; } +template<class T> +inline void UpdateVisibilityOf_helper(std::set<uint64>& s64, T* target) +{ + s64.insert(target->GetGUID()); +} + +template<> +inline void UpdateVisibilityOf_helper(std::set<uint64>& s64, GameObject* target) +{ + if(!target->IsTransport()) + s64.insert(target->GetGUID()); +} + void Player::UpdateVisibilityOf(WorldObject* target) { if(HaveAtClient(target)) @@ -17897,8 +18582,7 @@ void Player::UpdateVisibilityOf(WorldObject* target) if(target->isVisibleForInState(this,false)) { target->SendUpdateToPlayer(this); - if(target->GetTypeId()!=TYPEID_GAMEOBJECT||!((GameObject*)target)->IsTransport()) - m_clientGUIDs.insert(target->GetGUID()); + UpdateVisibilityOf_helper(m_clientGUIDs, target); #ifdef TRINITY_DEBUG if((sLog.getLogFilter() & LOG_FILTER_VISIBILITY_CHANGES)==0) @@ -17915,34 +18599,19 @@ void Player::UpdateVisibilityOf(WorldObject* target) void Player::SendInitialVisiblePackets(Unit* target) { - SendAuraDurationsForTarget(target); + SendAurasForTarget(target); if(target->isAlive()) { if(target->GetMotionMaster()->GetCurrentMovementGeneratorType() != IDLE_MOTION_TYPE) target->SendMonsterMoveWithSpeedToCurrentDestination(this); if(target->hasUnitState(UNIT_STAT_MELEE_ATTACKING) && target->getVictim()) - target->SendAttackStart(target->getVictim()); + target->SendMeleeAttackStart(target->getVictim()); } } template<class T> -inline void UpdateVisibilityOf_helper(std::set<uint64>& s64, T* target) -{ - s64.insert(target->GetGUID()); -} - -template<> -inline void UpdateVisibilityOf_helper(std::set<uint64>& s64, GameObject* target) -{ - if(!target->IsTransport()) - s64.insert(target->GetGUID()); -} - -template<class T> void Player::UpdateVisibilityOf(T* target, UpdateData& data, std::set<WorldObject*>& visibleNow) { - if(!target) - return; if(HaveAtClient(target)) { if(!target->isVisibleForInState(this,true)) @@ -17956,7 +18625,7 @@ void Player::UpdateVisibilityOf(T* target, UpdateData& data, std::set<WorldObjec #endif } } - else if(visibleNow.size() < 30) + else if(visibleNow.size() < 30 || target->GetTypeId() == TYPEID_UNIT && ((Creature*)target)->isVehicle()) { if(target->isVisibleForInState(this,false)) { @@ -17972,50 +18641,15 @@ void Player::UpdateVisibilityOf(T* target, UpdateData& data, std::set<WorldObjec } } -/*template<> -void Player::UpdateVisibilityOf<Creature>(Creature* target, UpdateData& data, UpdateDataMapType& data_updates, std::set<WorldObject*>& visibleNow) -{ - if(HaveAtClient(target)) - { - if(!target->isVisibleForInState(this,true)) - { - target->DestroyForPlayer(this); - target->BuildOutOfRangeUpdateBlock(&data); - m_clientGUIDs.erase(target->GetGUID()); - - #ifdef TRINITY_DEBUG - if((sLog.getLogFilter() & LOG_FILTER_VISIBILITY_CHANGES)==0) - sLog.outDebug("Object %u (Type: %u, Entry: %u) is out of range for player %u. Distance = %f",target->GetGUIDLow(),target->GetTypeId(),target->GetEntry(),GetGUIDLow(),GetDistance(target)); - #endif - } - } - else - { - if(target->isVisibleForInState(this,false)) - { - visibleNow.insert(target); - target->BuildUpdate(data_updates); - target->SendUpdateToPlayer(this); - target->SendMonsterMoveWithSpeedToCurrentDestination(this); - UpdateVisibilityOf_helper(m_clientGUIDs,target); - - #ifdef TRINITY_DEBUG - if((sLog.getLogFilter() & LOG_FILTER_VISIBILITY_CHANGES)==0) - sLog.outDebug("Object %u (Type: %u, Entry: %u) is visible now for player %u. Distance = %f",target->GetGUIDLow(),target->GetTypeId(),target->GetEntry(),GetGUIDLow(),GetDistance(target)); - #endif - } - } -}*/ - template void Player::UpdateVisibilityOf(Player* target, UpdateData& data, std::set<WorldObject*>& visibleNow); template void Player::UpdateVisibilityOf(Creature* target, UpdateData& data, std::set<WorldObject*>& visibleNow); template void Player::UpdateVisibilityOf(Corpse* target, UpdateData& data, std::set<WorldObject*>& visibleNow); template void Player::UpdateVisibilityOf(GameObject* target, UpdateData& data, std::set<WorldObject*>& visibleNow); template void Player::UpdateVisibilityOf(DynamicObject* target, UpdateData& data, std::set<WorldObject*>& visibleNow); -void Player::InitPrimaryProffesions() +void Player::InitPrimaryProfessions() { - SetFreePrimaryProffesions(sWorld.getConfig(CONFIG_MAX_PRIMARY_TRADE_SKILL)); + SetFreePrimaryProfessions(sWorld.getConfig(CONFIG_MAX_PRIMARY_TRADE_SKILL)); } void Player::SendComboPoints() @@ -18030,32 +18664,47 @@ void Player::SendComboPoints() } } -void Player::AddComboPoints(Unit* target, int8 count) +void Player::AddComboPoints(Unit* target, int8 count, Spell * spell) { if(!count) return; + int8 * comboPoints = spell ? &spell->m_comboPointGain : &m_comboPoints; + // without combo points lost (duration checked in aura) - RemoveSpellsCausingAura(SPELL_AURA_RETAIN_COMBO_POINTS); + RemoveAurasByType(SPELL_AURA_RETAIN_COMBO_POINTS); if(target->GetGUID() == m_comboTarget) { - m_comboPoints += count; + *comboPoints += count; } else { if(m_comboTarget) - if(Unit* target = ObjectAccessor::GetUnit(*this,m_comboTarget)) - target->RemoveComboPointHolder(GetGUIDLow()); + if(Unit* target2 = ObjectAccessor::GetUnit(*this,m_comboTarget)) + target2->RemoveComboPointHolder(GetGUIDLow()); m_comboTarget = target->GetGUID(); - m_comboPoints = count; + *comboPoints = count; target->AddComboPointHolder(GetGUIDLow()); } + if (*comboPoints > 5) *comboPoints = 5; + else if (*comboPoints < 0) *comboPoints = 0; + + if (!spell) + SendComboPoints(); +} + +void Player::GainSpellComboPoints(int8 count) +{ + if(!count) + return; + + m_comboPoints += count; if (m_comboPoints > 5) m_comboPoints = 5; - if (m_comboPoints < 0) m_comboPoints = 0; + else if (m_comboPoints < 0) m_comboPoints = 0; SendComboPoints(); } @@ -18066,7 +18715,7 @@ void Player::ClearComboPoints() return; // without combopoints lost (duration checked in aura) - RemoveSpellsCausingAura(SPELL_AURA_RETAIN_COMBO_POINTS); + RemoveAurasByType(SPELL_AURA_RETAIN_COMBO_POINTS); m_comboPoints = 0; @@ -18080,7 +18729,8 @@ void Player::ClearComboPoints() void Player::SetGroup(Group *group, int8 subgroup) { - if(group == NULL) m_group.unlink(); + if(group == NULL) + m_group.unlink(); else { // never use SetGroup without a subgroup unless you specify NULL for group @@ -18092,10 +18742,12 @@ void Player::SetGroup(Group *group, int8 subgroup) void Player::SendInitialPacketsBeforeAddToMap() { - WorldPacket data(SMSG_SET_REST_START, 4); + WorldPacket data(SMSG_SET_REST_START_OBSOLETE, 4); data << uint32(0); // unknown, may be rest state time or experience GetSession()->SendPacket(&data); + GetSocial()->SendSocialList(); + // Homebind data.Initialize(SMSG_BINDPOINTUPDATE, 5*4); data << m_homebindX << m_homebindY << m_homebindZ; @@ -18106,12 +18758,7 @@ void Player::SendInitialPacketsBeforeAddToMap() // SMSG_SET_PROFICIENCY // SMSG_UPDATE_AURA_DURATION - // tutorial stuff - data.Initialize(SMSG_TUTORIAL_FLAGS, 8*4); - for (int i = 0; i < 8; ++i) - data << uint32( GetTutorialInt(i) ); - GetSession()->SendPacket(&data); - + SendTalentsInfoData(false); SendInitialSpells(); data.Initialize(SMSG_SEND_UNLEARN_SPELLS, 4); @@ -18119,24 +18766,29 @@ void Player::SendInitialPacketsBeforeAddToMap() GetSession()->SendPacket(&data); SendInitialActionButtons(); - SendInitialReputations(); - UpdateZone(GetZoneId()); - SendInitWorldStates(); + m_reputationMgr.SendInitialReputations(); + m_achievementMgr.SendAllAchievementData(); + + // update zone + uint32 newzone, newarea; + GetZoneAndAreaId(newzone,newarea); + UpdateZone(newzone,newarea); // also call SendInitWorldStates(); - // SMSG_SET_AURA_SINGLE + SendEquipmentSetList(); - data.Initialize(SMSG_LOGIN_SETTIMESPEED, 8); + data.Initialize(SMSG_LOGIN_SETTIMESPEED, 4 + 4 + 4); data << uint32(secsToTimeBitFields(sWorld.GetGameTime())); data << (float)0.01666667f; // game speed + data << uint32(0); // added in 3.1.2 GetSession()->SendPacket( &data ); - - // set fly flag if in fly form or taxi flight to prevent visually drop at ground in showup moment - if(HasAuraType(SPELL_AURA_MOD_INCREASE_FLIGHT_SPEED) || isInFlight()) - AddUnitMovementFlag(MOVEMENTFLAG_FLYING2); } void Player::SendInitialPacketsAfterAddToMap() { + WorldPacket data(SMSG_TIME_SYNC_REQ, 4); // new 2.0.x, enable movement + data << uint32(0x00000000); // on blizz it increments periodically + GetSession()->SendPacket(&data); + CastSpell(this, 836, true); // LOGINEFFECT // set some aura effects that send packet to player client after add player to map @@ -18146,11 +18798,11 @@ void Player::SendInitialPacketsAfterAddToMap() { SPELL_AURA_MOD_FEAR, SPELL_AURA_TRANSFORM, SPELL_AURA_WATER_WALK, SPELL_AURA_FEATHER_FALL, SPELL_AURA_HOVER, SPELL_AURA_SAFE_FALL, - SPELL_AURA_FLY, SPELL_AURA_MOD_INCREASE_FLIGHT_SPEED, SPELL_AURA_NONE + SPELL_AURA_FLY, SPELL_AURA_MOD_INCREASE_MOUNTED_FLIGHT_SPEED, SPELL_AURA_NONE }; for(AuraType const* itr = &auratypes[0]; itr && itr[0] != SPELL_AURA_NONE; ++itr) { - Unit::AuraList const& auraList = GetAurasByType(*itr); + Unit::AuraEffectList const& auraList = GetAurasByType(*itr); if(!auraList.empty()) auraList.front()->ApplyModifier(true,true); } @@ -18161,12 +18813,13 @@ void Player::SendInitialPacketsAfterAddToMap() // manual send package (have code in ApplyModifier(true,true); that don't must be re-applied. if(HasAuraType(SPELL_AURA_MOD_ROOT)) { - WorldPacket data(SMSG_FORCE_MOVE_ROOT, 10); - data.append(GetPackGUID()); - data << (uint32)2; - SendMessageToSet(&data,true); + WorldPacket data2(SMSG_FORCE_MOVE_ROOT, 10); + data2.append(GetPackGUID()); + data2 << (uint32)2; + SendMessageToSet(&data2,true); } + SendAurasForTarget(this); SendEnchantmentDurations(); // must be after add to map SendItemDurations(); // must be after add to map } @@ -18179,20 +18832,28 @@ void Player::SendUpdateToOutOfRangeGroupMembers() group->UpdatePlayerOutOfRange(this); m_groupUpdateMask = GROUP_UPDATE_FLAG_NONE; - m_auraUpdateMask = 0; + m_auraRaidUpdateMask = 0; if(Pet *pet = GetPet()) - pet->ResetAuraUpdateMask(); + pet->ResetAuraUpdateMaskForRaid(); } -void Player::SendTransferAborted(uint32 mapid, uint16 reason) +void Player::SendTransferAborted(uint32 mapid, uint8 reason, uint8 arg) { WorldPacket data(SMSG_TRANSFER_ABORTED, 4+2); data << uint32(mapid); - data << uint16(reason); // transfer abort reason + data << uint8(reason); // transfer abort reason + switch(reason) + { + case TRANSFER_ABORT_INSUF_EXPAN_LVL: + case TRANSFER_ABORT_DIFFICULTY: + case TRANSFER_ABORT_UNIQUE_MESSAGE: + data << uint8(arg); + break; + } GetSession()->SendPacket(&data); } -void Player::SendInstanceResetWarning(uint32 mapid, uint32 time) +void Player::SendInstanceResetWarning( uint32 mapid, uint32 difficulty, uint32 time ) { // type of warning, based on the time remaining until reset uint32 type; @@ -18204,16 +18865,23 @@ void Player::SendInstanceResetWarning(uint32 mapid, uint32 time) type = RAID_INSTANCE_WARNING_MIN; else type = RAID_INSTANCE_WARNING_MIN_SOON; - WorldPacket data(SMSG_RAID_INSTANCE_MESSAGE, 4+4+4); + + WorldPacket data(SMSG_RAID_INSTANCE_MESSAGE, 4+4+4+4); data << uint32(type); data << uint32(mapid); + data << uint32(difficulty); // difficulty data << uint32(time); + if(type == RAID_INSTANCE_WELCOME) + { + data << uint8(0); // is your (1) + data << uint8(0); // is extended (1), ignored if prev field is 0 + } GetSession()->SendPacket(&data); } void Player::ApplyEquipCooldown( Item * pItem ) { - for(int i = 0; i <5; ++i) + for(uint8 i = 0; i < MAX_ITEM_PROTO_SPELLS; ++i) { _Spell const& spellData = pItem->GetProto()->Spells[i]; @@ -18238,10 +18906,7 @@ void Player::resetSpells() { // not need after this call if(HasAtLoginFlag(AT_LOGIN_RESET_SPELLS)) - { - m_atLoginFlags = m_atLoginFlags & ~AT_LOGIN_RESET_SPELLS; - CharacterDatabase.PExecute("UPDATE characters SET at_login = at_login & ~ %u WHERE guid ='%u'", uint32(AT_LOGIN_RESET_SPELLS), GetGUIDLow()); - } + RemoveAtLoginFlag(AT_LOGIN_RESET_SPELLS,true); // make full copy of map (spells removed and marked as deleted at another spell remove // and we can't use original map for safe iterative with visit each spell at loop end @@ -18254,22 +18919,18 @@ void Player::resetSpells() learnQuestRewardedSpells(); } -void Player::learnDefaultSpells(bool loading) +void Player::learnDefaultSpells() { // learn default race/class spells PlayerInfo const *info = objmgr.GetPlayerInfo(getRace(),getClass()); - std::list<CreateSpellPair>::const_iterator spell_itr; - for (spell_itr = info->spell.begin(); spell_itr!=info->spell.end(); ++spell_itr) + for (PlayerCreateInfoSpells::const_iterator itr = info->spell.begin(); itr!=info->spell.end(); ++itr) { - uint16 tspell = spell_itr->first; - if (tspell) - { - sLog.outDebug("PLAYER: Adding initial spell, id = %u",tspell); - if(loading || !spell_itr->second) // not care about passive spells or loading case - addSpell(tspell,spell_itr->second); - else // but send in normal spell in game learn case - learnSpell(tspell); - } + uint32 tspell = *itr; + sLog.outDebug("PLAYER (Class: %u Race: %u): Adding initial spell, id = %u",uint32(getClass()),uint32(getRace()), tspell); + if(!IsInWorld()) // will send in INITIAL_SPELLS in list anyway at map add + addSpell(tspell,true,true,true,false); + else // but send in normal spell in game learn case + learnSpell(tspell,true); } } @@ -18287,7 +18948,7 @@ void Player::learnQuestRewardedSpells(Quest const* quest) // check learned spells state bool found = false; - for(int i=0; i < 3; ++i) + for(uint8 i=0; i < 3; ++i) { if(spellInfo->Effect[i] == SPELL_EFFECT_LEARN_SPELL && !HasSpell(spellInfo->EffectTriggerSpell[i])) { @@ -18361,7 +19022,7 @@ void Player::learnQuestRewardedSpells() } } -void Player::learnSkillRewardedSpells(uint32 skill_id ) +void Player::learnSkillRewardedSpells(uint32 skill_id, uint32 skill_value ) { uint32 raceMask = getRaceMask(); uint32 classMask = getClassMask(); @@ -18379,35 +19040,56 @@ void Player::learnSkillRewardedSpells(uint32 skill_id ) if (sSpellStore.LookupEntry(pAbility->spellId)) { - // Ok need learn spell - learnSpell(pAbility->spellId); + // need unlearn spell + if (skill_value < pAbility->req_skill_value) + removeSpell(pAbility->spellId); + // need learn + else if (!IsInWorld()) + addSpell(pAbility->spellId,true,true,true,false); + else + learnSpell(pAbility->spellId,true); } } } -void Player::learnSkillRewardedSpells() +void Player::SendAurasForTarget(Unit *target) { - for (uint16 i=0; i < PLAYER_MAX_SKILLS; i++) - { - if(!GetUInt32Value(PLAYER_SKILL_INDEX(i))) - continue; - - uint32 pskill = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; + if(!target || target->GetVisibleAuras()->empty()) // speedup things + return; - learnSkillRewardedSpells(pskill); - } -} + WorldPacket data(SMSG_AURA_UPDATE_ALL); + data.append(target->GetPackGUID()); -void Player::SendAuraDurationsForTarget(Unit* target) -{ - for(Unit::AuraMap::const_iterator itr = target->GetAuras().begin(); itr != target->GetAuras().end(); ++itr) + Unit::VisibleAuraMap const *visibleAuras = target->GetVisibleAuras(); + for(Unit::VisibleAuraMap::const_iterator itr = visibleAuras->begin(); itr != visibleAuras->end(); ++itr) { - Aura* aura = itr->second; - if(aura->GetAuraSlot() >= MAX_AURAS || aura->IsPassive() || aura->GetCasterGUID()!=GetGUID()) - continue; + Aura * aura=itr->second; + data << uint8(aura->GetAuraSlot()); + data << uint32(aura->GetId()); - aura->SendAuraDurationForCaster(this); + // flags + data << aura->m_auraFlags; + // level + data << aura->m_auraLevel; + // charges + data << uint8(aura->GetStackAmount()>1 ? aura->GetStackAmount() : aura->GetAuraCharges()); + + if(!(aura->m_auraFlags & AFLAG_CASTER)) + { + if (Unit * caster = aura->GetCaster()) + data.append(caster->GetPackGUID()); + else + data << uint8(0); + } + + if(aura->m_auraFlags & AFLAG_DURATION) // include aura duration + { + data << uint32(aura->GetAuraMaxDuration()); + data << uint32(aura->GetAuraDuration()); + } } + + GetSession()->SendPacket(&data); } void Player::SetDailyQuestStatus( uint32 quest_id ) @@ -18439,7 +19121,7 @@ BattleGround* Player::GetBattleGround() const if(GetBattleGroundId()==0) return NULL; - return sBattleGroundMgr.GetBattleGround(GetBattleGroundId()); + return sBattleGroundMgr.GetBattleGround(GetBattleGroundId(), m_bgTypeID); } bool Player::InArena() const @@ -18451,7 +19133,7 @@ bool Player::InArena() const return true; } -bool Player::GetBGAccessByLevel(uint32 bgTypeId) const +bool Player::GetBGAccessByLevel(BattleGroundTypeId bgTypeId) const { // get a template bg instead of running one BattleGround *bg = sBattleGroundMgr.GetBattleGroundTemplate(bgTypeId); @@ -18464,46 +19146,26 @@ bool Player::GetBGAccessByLevel(uint32 bgTypeId) const return true; } -uint32 Player::GetMinLevelForBattleGroundQueueId(uint32 queue_id) -{ - if(queue_id < 1) - return 0; - - if(queue_id >=6) - queue_id = 6; - - return 10*(queue_id+1); -} - -uint32 Player::GetMaxLevelForBattleGroundQueueId(uint32 queue_id) -{ - if(queue_id >=6) - return 255; // hardcoded max level - - return 10*(queue_id+2)-1; -} - -//TODO make this more generic - current implementation is wrong -uint32 Player::GetBattleGroundQueueIdFromLevel() const +BGQueueIdBasedOnLevel Player::GetBattleGroundQueueIdFromLevel(BattleGroundTypeId bgTypeId) const { + //returned to hardcoded version of this function, because there is no way to code it dynamic uint32 level = getLevel(); - if(level <= 19) - return 0; - else if (level > 69) - return 6; - else - return level/10 - 1; // 20..29 -> 1, 30-39 -> 2, ... - /* - assert(bgTypeId < MAX_BATTLEGROUND_TYPES); - BattleGround *bg = sBattleGroundMgr.GetBattleGroundTemplate(bgTypeId); - assert(bg); - return (getLevel() - bg->GetMinLevel()) / 10;*/ + if( bgTypeId == BATTLEGROUND_AV ) + level--; + + uint32 queue_id = (level / 10) - 1; // for ranges 0 - 19, 20 - 29, 30 - 39, 40 - 49, 50 - 59, 60 - 69, 70 -79, 80 + if( queue_id >= MAX_BATTLEGROUND_QUEUES ) + { + sLog.outError("BattleGround: too high queue_id %u this shouldn't happen", queue_id); + return QUEUE_ID_MAX_LEVEL_80; + } + return BGQueueIdBasedOnLevel(queue_id); } float Player::GetReputationPriceDiscount( Creature const* pCreature ) const { FactionTemplateEntry const* vendor_faction = pCreature->getFactionTemplateEntry(); - if(!vendor_faction) + if(!vendor_faction || !vendor_faction->faction) return 1.0f; ReputationRank rank = GetReputationRank(vendor_faction->faction); @@ -18520,28 +19182,42 @@ bool Player::IsSpellFitByClassAndRace( uint32 spell_id ) const SkillLineAbilityMap::const_iterator lower = spellmgr.GetBeginSkillLineAbilityMap(spell_id); SkillLineAbilityMap::const_iterator upper = spellmgr.GetEndSkillLineAbilityMap(spell_id); + if(lower==upper) + return true; for(SkillLineAbilityMap::const_iterator _spell_idx = lower; _spell_idx != upper; ++_spell_idx) { // skip wrong race skills if( _spell_idx->second->racemask && (_spell_idx->second->racemask & racemask) == 0) - return false; + continue; // skip wrong class skills if( _spell_idx->second->classmask && (_spell_idx->second->classmask & classmask) == 0) - return false; + continue; + + return true; } - return true; + + return false; } -bool Player::HasQuestForGO(int32 GOId) +bool Player::HasQuestForGO(int32 GOId) const { - for( QuestStatusMap::iterator i = mQuestStatus.begin( ); i != mQuestStatus.end( ); ++i ) + for( uint8 i = 0; i < MAX_QUEST_LOG_SIZE; ++i ) { - QuestStatusData qs=i->second; + uint32 questid = GetQuestSlotQuestId(i); + if ( questid == 0 ) + continue; + + QuestStatusMap::const_iterator qs_itr = mQuestStatus.find(questid); + if(qs_itr == mQuestStatus.end()) + continue; + + QuestStatusData const& qs = qs_itr->second; + if (qs.m_status == QUEST_STATUS_INCOMPLETE) { - Quest const* qinfo = objmgr.GetQuestTemplate(i->first); + Quest const* qinfo = objmgr.GetQuestTemplate(questid); if(!qinfo) continue; @@ -18561,7 +19237,7 @@ bool Player::HasQuestForGO(int32 GOId) return false; } -void Player::UpdateForQuestsGO() +void Player::UpdateForQuestWorldObjects() { if(m_clientGUIDs.empty()) return; @@ -18576,6 +19252,26 @@ void Player::UpdateForQuestsGO() if(obj) obj->BuildValuesUpdateBlockForPlayer(&udata,this); } + else if(IS_CREATURE_GUID(*itr) || IS_VEHICLE_GUID(*itr)) + { + Creature *obj = ObjectAccessor::GetCreatureOrPetOrVehicle(*this, *itr); + if(!obj) + continue; + + // check if this unit requires quest specific flags + if(!obj->HasFlag(UNIT_NPC_FLAGS,UNIT_NPC_FLAG_SPELLCLICK)) + continue; + + SpellClickInfoMapBounds clickPair = objmgr.GetSpellClickInfoMapBounds(obj->GetEntry()); + for(SpellClickInfoMap::const_iterator itr = clickPair.first; itr != clickPair.second; ++itr) + { + if(itr->second.questStart || itr->second.questEnd) + { + obj->BuildCreateUpdateBlockForPlayer(&udata,this); + break; + } + } + } } udata.BuildPacket(&packet); GetSession()->SendPacket(&packet); @@ -18601,11 +19297,14 @@ void Player::SummonIfPossible(bool agree) } // drop flag at summon + // this code can be reached only when GM is summoning player who carries flag, because player should be immune to summoning spells when he carries flag if(BattleGround *bg = GetBattleGround()) bg->EventPlayerDroppedFlag(this); m_summon_expire = 0; + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_ACCEPTED_SUMMONINGS, 1); + TeleportTo(m_summon_mapid, m_summon_x, m_summon_y, m_summon_z,GetOrientation()); } @@ -18636,9 +19335,8 @@ void Player::AutoUnequipOffhandIfNeed() if(!offItem) return; - Item *mainItem = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_MAINHAND ); - - if(!mainItem || mainItem->GetProto()->InventoryType != INVTYPE_2HWEAPON) + // need unequip offhand for 2h-weapon without TitanGrip (in any from hands) + if (CanTitanGrip() || (offItem->GetProto()->InventoryType != INVTYPE_2HWEAPON && !IsTwoHandUsed())) return; ItemPosCountVec off_dest; @@ -18650,7 +19348,16 @@ void Player::AutoUnequipOffhandIfNeed() } else { - sLog.outError("Player::EquipItem: Can's store offhand item at 2hand item equip for player (GUID: %u).",GetGUIDLow()); + MailItemsInfo mi; + mi.AddItem(offItem->GetGUIDLow(), offItem->GetEntry(), offItem); + MoveItemFromInventory(INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND, true); + CharacterDatabase.BeginTransaction(); + offItem->DeleteFromInventoryDB(); // deletes item from character's inventory + offItem->SaveToDB(); // recursive and not have transaction guard into self, item not in inventory and can be save standalone + CharacterDatabase.CommitTransaction(); + + std::string subject = GetSession()->GetMangosString(LANG_NOT_EQUIPPED_ITEM); + WorldSession::SendMailTo(this, MAIL_NORMAL, MAIL_STATIONERY_GM, GetGUIDLow(), GetGUIDLow(), subject, 0, &mi, 0, 0, MAIL_CHECK_MASK_NONE); } } @@ -18670,8 +19377,8 @@ bool Player::HasItemFitToSpellReqirements(SpellEntry const* spellInfo, Item cons { case ITEM_CLASS_WEAPON: { - for(int i= EQUIPMENT_SLOT_MAINHAND; i < EQUIPMENT_SLOT_TABARD; ++i) - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + for(uint8 i= EQUIPMENT_SLOT_MAINHAND; i < EQUIPMENT_SLOT_TABARD; ++i) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i )) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; break; @@ -18679,18 +19386,18 @@ bool Player::HasItemFitToSpellReqirements(SpellEntry const* spellInfo, Item cons case ITEM_CLASS_ARMOR: { // tabard not have dependent spells - for(int i= EQUIPMENT_SLOT_START; i< EQUIPMENT_SLOT_MAINHAND; ++i) - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, i )) + for(uint8 i= EQUIPMENT_SLOT_START; i< EQUIPMENT_SLOT_MAINHAND; ++i) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, i )) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; // shields can be equipped to offhand slot - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND)) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_OFFHAND)) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; // ranged slot can have some armor subclasses - if(Item *item = GetItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_RANGED)) + if(Item *item = GetUseableItemByPos( INVENTORY_SLOT_BAG_0, EQUIPMENT_SLOT_RANGED)) if(item!=ignoreItem && item->IsFitToSpellRequirements(spellInfo)) return true; @@ -18704,6 +19411,24 @@ bool Player::HasItemFitToSpellReqirements(SpellEntry const* spellInfo, Item cons return false; } +bool Player::CanNoReagentCast(SpellEntry const* spellInfo) const +{ + // don't take reagents for spells with SPELL_ATTR_EX5_NO_REAGENT_WHILE_PREP + if (spellInfo->AttributesEx5 & SPELL_ATTR_EX5_NO_REAGENT_WHILE_PREP && + HasFlag(UNIT_FIELD_FLAGS, UNIT_FLAG_PREPARATION)) + return true; + + // Check no reagent use mask + flag96 noReagentMask; + noReagentMask[0] = GetUInt32Value(PLAYER_NO_REAGENT_COST_1); + noReagentMask[1] = GetUInt32Value(PLAYER_NO_REAGENT_COST_1+1); + noReagentMask[2] = GetUInt32Value(PLAYER_NO_REAGENT_COST_1+2); + if (spellInfo->SpellFamilyFlags & noReagentMask) + return true; + + return false; +} + void Player::RemoveItemDependentAurasAndCasts( Item * pItem ) { AuraMap& auras = GetAuras(); @@ -18727,8 +19452,7 @@ void Player::RemoveItemDependentAurasAndCasts( Item * pItem ) } // no alt item, remove aura, restart check - RemoveAurasDueToSpell(aura->GetId()); - itr = auras.begin(); + RemoveAura(itr); } // currently casted spells can be dependent from item @@ -18745,11 +19469,11 @@ uint32 Player::GetResurrectionSpellId() // search priceless resurrection possibilities uint32 prio = 0; uint32 spell_id = 0; - AuraList const& dummyAuras = GetAurasByType(SPELL_AURA_DUMMY); - for(AuraList::const_iterator itr = dummyAuras.begin(); itr != dummyAuras.end(); ++itr) + AuraEffectList const& dummyAuras = GetAurasByType(SPELL_AURA_DUMMY); + for(AuraEffectList::const_iterator itr = dummyAuras.begin(); itr != dummyAuras.end(); ++itr) { // Soulstone Resurrection // prio: 3 (max, non death persistent) - if( prio < 2 && (*itr)->GetSpellProto()->SpellVisual == 99 && (*itr)->GetSpellProto()->SpellIconID == 92 ) + if( prio < 2 && (*itr)->GetSpellProto()->SpellVisual[0] == 99 && (*itr)->GetSpellProto()->SpellIconID == 92 ) { switch((*itr)->GetId()) { @@ -18759,8 +19483,9 @@ uint32 Player::GetResurrectionSpellId() case 20764: spell_id = 20760; break; // rank 4 case 20765: spell_id = 20761; break; // rank 5 case 27239: spell_id = 27240; break; // rank 6 + case 47883: spell_id = 47882; break; // rank 7 default: - sLog.outError("Unhandled spell %%u: S.Resurrection",(*itr)->GetId()); + sLog.outError("Unhandled spell %u: S.Resurrection",(*itr)->GetId()); continue; } @@ -18774,13 +19499,33 @@ uint32 Player::GetResurrectionSpellId() } } - // Reincarnation (passive spell) // prio: 1 - if(prio < 1 && HasSpell(20608) && !HasSpellCooldown(21169) && HasItemCount(17030,1)) + // Reincarnation (passive spell) // prio: 1 // Glyph of Renewed Life + if(prio < 1 && HasSpell(20608) && !HasSpellCooldown(21169) && (HasAura(58059) || HasItemCount(17030,1))) spell_id = 21169; return spell_id; } +// Used in triggers for check "Only to targets that grant experience or honor" req +bool Player::isHonorOrXPTarget(Unit* pVictim) +{ + uint32 v_level = pVictim->getLevel(); + uint32 k_grey = Trinity::XP::GetGrayLevel(getLevel()); + + // Victim level less gray level + if(v_level<=k_grey) + return false; + + if(pVictim->GetTypeId() == TYPEID_UNIT) + { + if (((Creature*)pVictim)->isTotem() || + ((Creature*)pVictim)->isPet() || + ((Creature*)pVictim)->GetCreatureInfo()->flags_extra & CREATURE_FLAG_EXTRA_NO_XP_AT_KILL) + return false; + } + return true; +} + bool Player::RewardPlayerAndGroupAtKill(Unit* pVictim) { bool PvP = pVictim->isCharmedOwnedByPlayerOrPlayer(); @@ -18878,6 +19623,31 @@ bool Player::RewardPlayerAndGroupAtKill(Unit* pVictim) return xp || honored_kill; } +void Player::RewardPlayerAndGroupAtEvent(uint32 creature_id, WorldObject* pRewardSource) +{ + uint64 creature_guid = pRewardSource->GetTypeId()==TYPEID_UNIT ? pRewardSource->GetGUID() : uint64(0); + + // prepare data for near group iteration + if(Group *pGroup = GetGroup()) + { + for(GroupReference *itr = pGroup->GetFirstMember(); itr != NULL; itr = itr->next()) + { + Player* pGroupGuy = itr->getSource(); + if(!pGroupGuy) + continue; + + if(!pGroupGuy->IsAtGroupRewardDistance(pRewardSource)) + continue; // member (alive or dead) or his corpse at req. distance + + // quest objectives updated only for alive group member or dead but with not released body + if(pGroupGuy->isAlive()|| !pGroupGuy->GetCorpse()) + pGroupGuy->KilledMonster(creature_id, creature_guid); + } + } + else // if (!pGroup) + KilledMonster(creature_id, creature_guid); +} + bool Player::IsAtGroupRewardDistance(WorldObject const* pRewardSource) const { const WorldObject* player = GetCorpse(); @@ -18899,12 +19669,16 @@ uint32 Player::GetBaseWeaponSkillValue (WeaponAttackType attType) const return 0; // weapon skill or (unarmed for base attack) - uint32 skill = item ? item->GetSkill() : SKILL_UNARMED; + uint32 skill = item ? item->GetSkill() : uint32(SKILL_UNARMED); return GetBaseSkillValue(skill); } void Player::ResurectUsingRequestData() { + /// Teleport before resurrecting by player, otherwise the player might get attacked from creatures near his corpse + if(IS_PLAYER_GUID(m_resurrectGUID)) + TeleportTo(m_resurrectMap, m_resurrectX, m_resurrectY, m_resurrectZ, GetOrientation()); + ResurrectPlayer(0.0f,false); if(GetMaxHealth() > m_resurrectHealth) @@ -18922,8 +19696,6 @@ void Player::ResurectUsingRequestData() SetPower(POWER_ENERGY, GetMaxPower(POWER_ENERGY) ); SpawnCorpseBones(); - - TeleportTo(m_resurrectMap, m_resurrectX, m_resurrectY, m_resurrectZ, GetOrientation()); } void Player::SetClientControl(Unit* target, uint8 allowMove) @@ -18932,34 +19704,25 @@ void Player::SetClientControl(Unit* target, uint8 allowMove) data.append(target->GetPackGUID()); data << uint8(allowMove); GetSession()->SendPacket(&data); + if(target == this) + SetMover(this); } void Player::UpdateZoneDependentAuras( uint32 newZone ) { // remove new continent flight forms - if( !isGameMaster() && - GetVirtualMapForMapAndZone(GetMapId(),newZone) != 530) + if( !IsAllowUseFlyMountsHere() ) { - RemoveSpellsCausingAura(SPELL_AURA_MOD_INCREASE_FLIGHT_SPEED); - RemoveSpellsCausingAura(SPELL_AURA_FLY); + RemoveAurasByType(SPELL_AURA_MOD_INCREASE_MOUNTED_FLIGHT_SPEED); + RemoveAurasByType(SPELL_AURA_FLY); } - // Some spells applied at enter into zone (with subzones) - // Human Illusion - // NOTE: these are removed by RemoveAurasWithInterruptFlags(AURA_INTERRUPT_FLAG_CHANGE_MAP); - if ( newZone == 2367 ) // Old Hillsbrad Foothills - { - uint32 spellid = 0; - // all horde races - if( GetTeam() == HORDE ) - spellid = getGender() == GENDER_FEMALE ? 35481 : 35480; - // and some alliance races - else if( getRace() == RACE_NIGHTELF || getRace() == RACE_DRAENEI ) - spellid = getGender() == GENDER_FEMALE ? 35483 : 35482; - - if(spellid && !HasAura(spellid,0) ) - CastSpell(this,spellid,true); - } + // Some spells applied at enter into zone (with subzones), aura removed in UpdateAreaDependentAuras that called always at zone->area update + SpellAreaForAreaMapBounds saBounds = spellmgr.GetSpellAreaForAreaMapBounds(newZone); + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,newZone,0)) + if( !HasAura(itr->second->spellId) ) + CastSpell(this,itr->second->spellId,true); } void Player::UpdateAreaDependentAuras( uint32 newArea ) @@ -18968,26 +19731,18 @@ void Player::UpdateAreaDependentAuras( uint32 newArea ) for(AuraMap::iterator iter = m_Auras.begin(); iter != m_Auras.end();) { // use m_zoneUpdateId for speed: UpdateArea called from UpdateZone or instead UpdateZone in both cases m_zoneUpdateId up-to-date - if(!IsSpellAllowedInLocation(iter->second->GetSpellProto(),GetMapId(),m_zoneUpdateId,newArea)) + if(spellmgr.GetSpellAllowedInLocationError(iter->second->GetSpellProto(),GetMapId(),m_zoneUpdateId,newArea,this) != SPELL_CAST_OK) RemoveAura(iter); else ++iter; } - // unmount if enter in this subzone - if( newArea == 35) - RemoveSpellsCausingAura(SPELL_AURA_MOUNTED); - // Dragonmaw Illusion - else if( newArea == 3759 || newArea == 3966 || newArea == 3939 ) - { - if( GetDummyAura(40214) ) - { - if( !HasAura(40216,0) ) - CastSpell(this,40216,true); - if( !HasAura(42016,0) ) - CastSpell(this,42016,true); - } - } + // some auras applied at subzone enter + SpellAreaForAreaMapBounds saBounds = spellmgr.GetSpellAreaForAreaMapBounds(newArea); + for(SpellAreaForAreaMap::const_iterator itr = saBounds.first; itr != saBounds.second; ++itr) + if(itr->second->autocast && itr->second->IsFitToRequirements(this,m_zoneUpdateId,newArea)) + if( !HasAura(itr->second->spellId) ) + CastSpell(this,itr->second->spellId,true); } uint32 Player::GetCorpseReclaimDelay(bool pvp) const @@ -19073,7 +19828,7 @@ void Player::SendCorpseReclaimDelay(bool load) //! corpse reclaim delay 30 * 1000ms or longer at often deaths WorldPacket data(SMSG_CORPSE_RECLAIM_DELAY, 4); - data << uint32(delay*1000); + data << uint32(delay*IN_MILISECONDS); GetSession()->SendPacket( &data ); } @@ -19099,7 +19854,7 @@ Player* Player::GetNextRandomRaidMember(float radius) if (nearMembers.empty()) return NULL; - uint32 randTarget = GetMap()->urand(0,nearMembers.size()-1); + uint32 randTarget = urand(0,nearMembers.size()-1); return nearMembers[randTarget]; } @@ -19118,21 +19873,85 @@ PartyResult Player::CanUninviteFromGroup() const return PARTY_RESULT_OK; } +void Player::SetBattleGroundRaid(Group* group, int8 subgroup) +{ + //we must move references from m_group to m_originalGroup + SetOriginalGroup(GetGroup(), GetSubGroup()); + + m_group.unlink(); + m_group.link(group, this); + m_group.setSubGroup((uint8)subgroup); +} + +void Player::RemoveFromBattleGroundRaid() +{ + //remove existing reference + m_group.unlink(); + if( Group* group = GetOriginalGroup() ) + { + m_group.link(group, this); + m_group.setSubGroup(GetOriginalSubGroup()); + } + SetOriginalGroup(NULL); +} + +void Player::SetOriginalGroup(Group *group, int8 subgroup) +{ + if( group == NULL ) + m_originalGroup.unlink(); + else + { + // never use SetOriginalGroup without a subgroup unless you specify NULL for group + assert(subgroup >= 0); + m_originalGroup.link(group, this); + m_originalGroup.setSubGroup((uint8)subgroup); + } +} + void Player::UpdateUnderwaterState( Map* m, float x, float y, float z ) { - float water_z = m->GetWaterLevel(x,y); - float height_z = m->GetHeight(x,y,z, false); // use .map base surface height - uint8 flag1 = m->GetTerrainType(x,y); + LiquidData liquid_status; + ZLiquidStatus res = m->getLiquidStatus(x, y, z, MAP_ALL_LIQUIDS, &liquid_status); + if (!res) + { + m_MirrorTimerFlags &= ~(UNDERWATER_INWATER|UNDERWATER_INLAVA|UNDERWATER_INSLIME|UNDERWARER_INDARKWATER); + // Small hack for enable breath in WMO + if (IsInWater()) + m_MirrorTimerFlags|=UNDERWATER_INWATER; + return; + } + + // All liquids type - check under water position + if (liquid_status.type&(MAP_LIQUID_TYPE_WATER|MAP_LIQUID_TYPE_OCEAN|MAP_LIQUID_TYPE_MAGMA|MAP_LIQUID_TYPE_SLIME)) + { + if ( res & LIQUID_MAP_UNDER_WATER) + m_MirrorTimerFlags |= UNDERWATER_INWATER; + else + m_MirrorTimerFlags &= ~UNDERWATER_INWATER; + } - //!Underwater check, not in water if underground or above water level - if (height_z <= INVALID_HEIGHT || z < (height_z-2) || z > (water_z - 2) ) - m_isunderwater &= 0x7A; - else if ((z < (water_z - 2)) && (flag1 & 0x01)) - m_isunderwater |= 0x01; + // Allow travel in dark water on taxi or transport + if ((liquid_status.type & MAP_LIQUID_TYPE_DARK_WATER) && !isInFlight() && !GetTransport()) + m_MirrorTimerFlags |= UNDERWARER_INDARKWATER; + else + m_MirrorTimerFlags &= ~UNDERWARER_INDARKWATER; - //!in lava check, anywhere under lava level - if ((height_z <= INVALID_HEIGHT || z < (height_z - 0)) && (flag1 == 0x00) && IsInWater()) - m_isunderwater |= 0x80; + // in lava check, anywhere in lava level + if (liquid_status.type&MAP_LIQUID_TYPE_MAGMA) + { + if (res & (LIQUID_MAP_UNDER_WATER|LIQUID_MAP_IN_WATER|LIQUID_MAP_WATER_WALK)) + m_MirrorTimerFlags |= UNDERWATER_INLAVA; + else + m_MirrorTimerFlags &= ~UNDERWATER_INLAVA; + } + // in slime check, anywhere in slime level + if (liquid_status.type&MAP_LIQUID_TYPE_SLIME) + { + if (res & (LIQUID_MAP_UNDER_WATER|LIQUID_MAP_IN_WATER|LIQUID_MAP_WATER_WALK)) + m_MirrorTimerFlags |= UNDERWATER_INSLIME; + else + m_MirrorTimerFlags &= ~UNDERWATER_INSLIME; + } } void Player::SetCanParry( bool value ) @@ -19165,20 +19984,503 @@ bool ItemPosCount::isContainedIn(ItemPosCountVec const& vec) const //-------------TRINITY--------------- //*********************************** -void Player::HandleFallDamage(MovementInfo& movementInfo) +void Player::StopCastingBindSight() +{ + if(WorldObject* target = GetViewpoint()) + { + if(target->isType(TYPEMASK_UNIT)) + { + ((Unit*)target)->RemoveAura(SPELL_AURA_BIND_SIGHT, GetGUID()); + ((Unit*)target)->RemoveAura(SPELL_AURA_MOD_POSSESS, GetGUID()); + ((Unit*)target)->RemoveAura(SPELL_AURA_MOD_POSSESS_PET, GetGUID()); + } + } +} + +void Player::SetViewpoint(WorldObject* target, bool apply) +{ + if(apply) + { + sLog.outDebug("Player::CreateViewpoint: Player %s create seer %u (TypeId: %u).", GetName(), target->GetEntry(), target->GetTypeId()); + + if(!AddUInt64Value(PLAYER_FARSIGHT, target->GetGUID())) + { + sLog.outCrash("Player::CreateViewpoint: Player %s cannot add new viewpoint!", GetName()); + return; + } + + if(target->isType(TYPEMASK_UNIT) && !m_Vehicle) + ((Unit*)target)->AddPlayerToVision(this); + } + else + { + sLog.outDebug("Player::CreateViewpoint: Player %s remove seer", GetName()); + + if(!RemoveUInt64Value(PLAYER_FARSIGHT, target->GetGUID())) + { + sLog.outCrash("Player::CreateViewpoint: Player %s cannot remove current viewpoint!", GetName()); + return; + } + + if(target->isType(TYPEMASK_UNIT) && !m_Vehicle) + ((Unit*)target)->RemovePlayerFromVision(this); + + //must immediately set seer back otherwise may crash + m_seer = this; + + //WorldPacket data(SMSG_CLEAR_FAR_SIGHT_IMMEDIATE, 0); + //GetSession()->SendPacket(&data); + } +} + +WorldObject* Player::GetViewpoint() const +{ + if(uint64 guid = GetUInt64Value(PLAYER_FARSIGHT)) + return (WorldObject*)ObjectAccessor::GetObjectByTypeMask(*this, guid, TYPEMASK_SEER); + return NULL; +} + +bool Player::CanUseBattleGroundObject() +{ + // TODO : some spells gives player ForceReaction to one faction (ReputationMgr::ApplyForceReaction) + // maybe gameobject code should handle that ForceReaction usage + // BUG: sometimes when player clicks on flag in AB - client won't send gameobject_use, only gameobject_report_use packet + return ( //InBattleGround() && // in battleground - not need, check in other cases + //!IsMounted() && - not correct, player is dismounted when he clicks on flag + //player cannot use object when he is invulnerable (immune) + !isTotalImmune() && // not totally immune + //i'm not sure if these two are correct, because invisible players should get visible when they click on flag + !HasStealthAura() && // not stealthed + !HasInvisibilityAura() && // not invisible + !HasAura(SPELL_RECENTLY_DROPPED_FLAG) && // can't pickup + isAlive() // live player + ); +} + +bool Player::CanCaptureTowerPoint() +{ + return ( !HasStealthAura() && // not stealthed + !HasInvisibilityAura() && // not invisible + isAlive() // live player + ); +} + +uint32 Player::GetBarberShopCost(uint8 newhairstyle, uint8 newhaircolor, uint8 newfacialhair) +{ + uint32 level = getLevel(); + + if(level > GT_MAX_LEVEL) + level = GT_MAX_LEVEL; // max level in this dbc + + uint8 hairstyle = GetByteValue(PLAYER_BYTES, 2); + uint8 haircolor = GetByteValue(PLAYER_BYTES, 3); + uint8 facialhair = GetByteValue(PLAYER_BYTES_2, 0); + + if((hairstyle == newhairstyle) && (haircolor == newhaircolor) && (facialhair == newfacialhair)) + return 0; + + GtBarberShopCostBaseEntry const *bsc = sGtBarberShopCostBaseStore.LookupEntry(level - 1); + + if(!bsc) // shouldn't happen + return 0xFFFFFFFF; + + float cost = 0; + + if(hairstyle != newhairstyle) + cost += bsc->cost; // full price + + if((haircolor != newhaircolor) && (hairstyle == newhairstyle)) + cost += bsc->cost * 0.5f; // +1/2 of price + + if(facialhair != newfacialhair) + cost += bsc->cost * 0.75f; // +3/4 of price + + return uint32(cost); +} + +void Player::InitGlyphsForLevel() { - if(movementInfo.fallTime < 1500) + for(uint32 i = 0; i < sGlyphSlotStore.GetNumRows(); ++i) + if(GlyphSlotEntry const * gs = sGlyphSlotStore.LookupEntry(i)) + if(gs->Order) + SetGlyphSlot(gs->Order - 1, gs->Id); + + uint32 level = getLevel(); + uint32 value = 0; + + // 0x3F = 0x01 | 0x02 | 0x04 | 0x08 | 0x10 | 0x20 for 80 level + if(level >= 15) + value |= (0x01 | 0x02); + if(level >= 30) + value |= 0x08; + if(level >= 50) + value |= 0x04; + if(level >= 70) + value |= 0x10; + if(level >= 80) + value |= 0x20; + + SetUInt32Value(PLAYER_GLYPHS_ENABLED, value); +} + +bool Player::isTotalImmune() +{ + AuraEffectList const& immune = GetAurasByType(SPELL_AURA_SCHOOL_IMMUNITY); + + uint32 immuneMask = 0; + for(AuraEffectList::const_iterator itr = immune.begin(); itr != immune.end(); ++itr) + { + immuneMask |= (*itr)->GetMiscValue(); + if( immuneMask & SPELL_SCHOOL_MASK_ALL ) // total immunity + return true; + } + return false; +} + +bool Player::HasTitle(uint32 bitIndex) +{ + if (bitIndex > 192) + return false; + + uint32 fieldIndexOffset = bitIndex / 32; + uint32 flag = 1 << (bitIndex % 32); + return HasFlag(PLAYER__FIELD_KNOWN_TITLES + fieldIndexOffset, flag); +} + +void Player::SetTitle(CharTitlesEntry const* title) +{ + uint32 fieldIndexOffset = title->bit_index / 32; + uint32 flag = 1 << (title->bit_index % 32); + SetFlag(PLAYER__FIELD_KNOWN_TITLES + fieldIndexOffset, flag); +} + +/*-----------------------TRINITY--------------------------*/ +bool Player::isTotalImmunity() +{ + AuraEffectList const& immune = GetAurasByType(SPELL_AURA_SCHOOL_IMMUNITY); + + for(AuraEffectList::const_iterator itr = immune.begin(); itr != immune.end(); ++itr) + { + if (((*itr)->GetMiscValue() & SPELL_SCHOOL_MASK_ALL) !=0) // total immunity + { + return true; + } + if (((*itr)->GetMiscValue() & SPELL_SCHOOL_MASK_NORMAL) !=0) // physical damage immunity + { + for(AuraEffectList::const_iterator i = immune.begin(); i != immune.end(); ++i) + { + if (((*i)->GetMiscValue() & SPELL_SCHOOL_MASK_MAGIC) !=0) // magic immunity + { + return true; + } + } + } + } + return false; +} + +void Player::UpdateCharmedAI() +{ + //This should only called in Player::Update + Creature *charmer = (Creature*)GetCharmer(); + + //kill self if charm aura has infinite duration + if(charmer->IsInEvadeMode()) + { + AuraEffectList const& auras = GetAurasByType(SPELL_AURA_MOD_CHARM); + for(AuraEffectList::const_iterator iter = auras.begin(); iter != auras.end(); ++iter) + if((*iter)->GetCasterGUID() == charmer->GetGUID() && (*iter)->GetParentAura()->IsPermanent()) + { + charmer->DealDamage(this, GetHealth(), NULL, DIRECT_DAMAGE, SPELL_SCHOOL_MASK_NORMAL, NULL, false); + return; + } + } + + if(!charmer->isInCombat()) + GetMotionMaster()->MoveFollow(charmer, PET_FOLLOW_DIST, PET_FOLLOW_ANGLE); + + Unit *target = getVictim(); + if(!target || !charmer->canAttack(target)) + { + target = charmer->SelectNearestTarget(); + if(!target) + return; + + GetMotionMaster()->MoveChase(target); + Attack(target, true); + } +} + +void Player::ConvertRune(uint8 index, uint8 newType) +{ + SetCurrentRune(index, newType); + + WorldPacket data(SMSG_CONVERT_RUNE, 2); + data << uint8(index); + data << uint8(newType); + GetSession()->SendPacket(&data); +} + +void Player::ResyncRunes(uint8 count) +{ + WorldPacket data(SMSG_RESYNC_RUNES, count * 2); + for(uint32 i = 0; i < count; ++i) + { + data << uint8(GetCurrentRune(i)); // rune type + data << uint8(255 - (GetRuneCooldown(i) * 51)); // passed cooldown time (0-255) + } + GetSession()->SendPacket(&data); +} + +void Player::AddRunePower(uint8 index) +{ + WorldPacket data(SMSG_ADD_RUNE_POWER, 4); + data << uint32(1 << index); // mask (0x00-0x3F probably) + GetSession()->SendPacket(&data); +} + +void Player::InitRunes() +{ + if(getClass() != CLASS_DEATH_KNIGHT) return; + m_runes = new Runes; + + m_runes->runeState = 0; + + for(uint32 i = 0; i < MAX_RUNES; ++i) + { + SetBaseRune(i, i / 2); // init base types + SetCurrentRune(i, i / 2); // init current types + SetRuneCooldown(i, 0); // reset cooldowns + m_runes->SetRuneState(i); + } + + for(uint32 i = 0; i < NUM_RUNE_TYPES; ++i) + SetFloatValue(PLAYER_RUNE_REGEN_1 + i, 0.1f); +} + +void Player::AutoStoreLoot(uint8 bag, uint8 slot, uint32 loot_id, LootStore const& store, bool broadcast) +{ + Loot loot; + loot.FillLoot (loot_id,store,this,true); + + uint32 max_slot = loot.GetMaxSlotInLootFor(this); + for(uint32 i = 0; i < max_slot; ++i) + { + LootItem* lootItem = loot.LootItemInSlot(i,this); + + ItemPosCountVec dest; + uint8 msg = CanStoreNewItem (bag,slot,dest,lootItem->itemid,lootItem->count); + if(msg != EQUIP_ERR_OK && slot != NULL_SLOT) + msg = CanStoreNewItem( bag, NULL_SLOT,dest,lootItem->itemid,lootItem->count); + if( msg != EQUIP_ERR_OK && bag != NULL_BAG) + msg = CanStoreNewItem( NULL_BAG, NULL_SLOT,dest,lootItem->itemid,lootItem->count); + if(msg != EQUIP_ERR_OK) + { + SendEquipError( msg, NULL, NULL ); + continue; + } + + Item* pItem = StoreNewItem (dest,lootItem->itemid,true,lootItem->randomPropertyId); + SendNewItem(pItem, lootItem->count, false, false, broadcast); + } +} + +uint32 Player::CalculateTalentsPoints() const +{ + uint32 base_talent = getLevel() < 10 ? 0 : uint32((getLevel()-9)*sWorld.getRate(RATE_TALENT)); + + if(getClass() != CLASS_DEATH_KNIGHT) + return base_talent; + + uint32 talentPointsForLevel = + (getLevel() < 56 ? 0 : uint32((getLevel()-55)*sWorld.getRate(RATE_TALENT))) + + m_questRewardTalentCount; + + if(talentPointsForLevel > base_talent) + talentPointsForLevel = base_talent; + + return talentPointsForLevel; +} + +bool Player::IsAllowUseFlyMountsHere() const +{ + if (isGameMaster()) + return true; + + uint32 zoneId = GetZoneId(); + uint32 v_map = GetVirtualMapForMapAndZone(GetMapId(), zoneId); + return v_map == 530 || v_map == 571 && HasSpell(54197) && zoneId != 4197; +} + +void Player::learnSpellHighRank(uint32 spellid) +{ + learnSpell(spellid,false); + + if(uint32 next = spellmgr.GetNextSpellInChain(spellid)) + learnSpellHighRank(next); +} + +void Player::_LoadSkills() +{ + // Note: skill data itself loaded from `data` field. This is only cleanup part of load + + // reset skill modifiers and set correct unlearn flags + for (uint32 i = 0; i < PLAYER_MAX_SKILLS; i++) + { + SetUInt32Value(PLAYER_SKILL_BONUS_INDEX(i),0); + + // set correct unlearn bit + uint32 id = GetUInt32Value(PLAYER_SKILL_INDEX(i)) & 0x0000FFFF; + if(!id) continue; + + SkillLineEntry const *pSkill = sSkillLineStore.LookupEntry(id); + if(!pSkill) continue; + + // enable unlearn button for primary professions only + if (pSkill->categoryId == SKILL_CATEGORY_PROFESSION) + SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,1)); + else + SetUInt32Value(PLAYER_SKILL_INDEX(i), MAKE_PAIR32(id,0)); + + // set fixed skill ranges + switch(GetSkillRangeType(pSkill,false)) + { + case SKILL_RANGE_LANGUAGE: // 300..300 + SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(300,300)); + break; + case SKILL_RANGE_MONO: // 1..1, grey monolite bar + SetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i),MAKE_SKILL_VALUE(1,1)); + break; + default: + break; + } + + uint32 vskill = SKILL_VALUE(GetUInt32Value(PLAYER_SKILL_VALUE_INDEX(i))); + learnSkillRewardedSpells(id, vskill); + } + + // special settings + if(getClass()==CLASS_DEATH_KNIGHT) + { + uint32 base_level = std::min(getLevel(),sWorld.getConfig (CONFIG_START_HEROIC_PLAYER_LEVEL)); + if(base_level < 1) + base_level = 1; + uint32 base_skill = (base_level-1)*5; // 270 at starting level 55 + if(base_skill < 1) + base_skill = 1; // skill mast be known and then > 0 in any case + + if(GetPureSkillValue (SKILL_FIRST_AID) < base_skill) + SetSkill(SKILL_FIRST_AID,base_skill, base_skill); + if(GetPureSkillValue (SKILL_AXES) < base_skill) + SetSkill(SKILL_AXES, base_skill,base_skill); + if(GetPureSkillValue (SKILL_DEFENSE) < base_skill) + SetSkill(SKILL_DEFENSE, base_skill,base_skill); + if(GetPureSkillValue (SKILL_POLEARMS) < base_skill) + SetSkill(SKILL_POLEARMS, base_skill,base_skill); + if(GetPureSkillValue (SKILL_SWORDS) < base_skill) + SetSkill(SKILL_SWORDS, base_skill,base_skill); + if(GetPureSkillValue (SKILL_2H_AXES) < base_skill) + SetSkill(SKILL_2H_AXES, base_skill,base_skill); + if(GetPureSkillValue (SKILL_2H_SWORDS) < base_skill) + SetSkill(SKILL_2H_SWORDS, base_skill,base_skill); + if(GetPureSkillValue (SKILL_UNARMED) < base_skill) + SetSkill(SKILL_UNARMED, base_skill,base_skill); + } +} + +uint32 Player::GetPhaseMaskForSpawn() const +{ + uint32 phase = PHASEMASK_NORMAL; + if(!isGameMaster()) + phase = GetPhaseMask(); + else + { + AuraEffectList const& phases = GetAurasByType(SPELL_AURA_PHASE); + if(!phases.empty()) + phase = phases.front()->GetMiscValue(); + } + + // some aura phases include 1 normal map in addition to phase itself + if(uint32 n_phase = phase & ~PHASEMASK_NORMAL) + return n_phase; + + return PHASEMASK_NORMAL; +} + +uint8 Player::CanEquipUniqueItem(Item* pItem, uint8 eslot, uint32 limit_count) const +{ + ItemPrototype const* pProto = pItem->GetProto(); + + // proto based limitations + if(uint8 res = CanEquipUniqueItem(pProto,eslot,limit_count)) + return res; + + // check unique-equipped on gems + for(uint32 enchant_slot = SOCK_ENCHANTMENT_SLOT; enchant_slot < SOCK_ENCHANTMENT_SLOT+3; ++enchant_slot) + { + uint32 enchant_id = pItem->GetEnchantmentId(EnchantmentSlot(enchant_slot)); + if(!enchant_id) + continue; + SpellItemEnchantmentEntry const* enchantEntry = sSpellItemEnchantmentStore.LookupEntry(enchant_id); + if(!enchantEntry) + continue; + + ItemPrototype const* pGem = objmgr.GetItemPrototype(enchantEntry->GemID); + if(!pGem) + continue; + + // include for check equip another gems with same limit category for not equipped item (and then not counted) + uint32 gem_limit_count = !pItem->IsEquipped() && pGem->ItemLimitCategory + ? pItem->GetGemCountWithLimitCategory(pGem->ItemLimitCategory) : 1; + + if(uint8 res = CanEquipUniqueItem(pGem, eslot,gem_limit_count)) + return res; + } + + return EQUIP_ERR_OK; +} + +uint8 Player::CanEquipUniqueItem( ItemPrototype const* itemProto, uint8 except_slot, uint32 limit_count) const +{ + // check unique-equipped on item + if (itemProto->Flags & ITEM_FLAGS_UNIQUE_EQUIPPED) + { + // there is an equip limit on this item + if(HasItemOrGemWithIdEquipped(itemProto->ItemId,1,except_slot)) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; + } + + // check unique-equipped limit + if (itemProto->ItemLimitCategory) + { + ItemLimitCategoryEntry const* limitEntry = sItemLimitCategoryStore.LookupEntry(itemProto->ItemLimitCategory); + if(!limitEntry) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; + + if(limit_count > limitEntry->maxCount) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; // attempt add too many limit category items (gems) + + // there is an equip limit on this item + if(HasItemOrGemWithLimitCategoryEquipped(itemProto->ItemLimitCategory,limitEntry->maxCount-limit_count+1,except_slot)) + return EQUIP_ERR_ITEM_UNIQUE_EQUIPABLE; + } + + return EQUIP_ERR_OK; +} + +void Player::HandleFall(MovementInfo const& movementInfo) +{ // calculate total z distance of the fall float z_diff = m_lastFallZ - movementInfo.z; - sLog.outDebug("zDiff = %f", z_diff); + //sLog.outDebug("zDiff = %f", z_diff); //Players with low fall distance, Feather Fall or physical immunity (charges used) are ignored - // 14.57 can be calculated by resolving damageperc formular below to 0 + // 14.57 can be calculated by resolving damageperc formula below to 0 if (z_diff >= 14.57f && !isDead() && !isGameMaster() && !HasAuraType(SPELL_AURA_HOVER) && !HasAuraType(SPELL_AURA_FEATHER_FALL) && - !HasAuraType(SPELL_AURA_FLY) && !IsImmunedToDamage(SPELL_SCHOOL_MASK_NORMAL,true) ) + !HasAuraType(SPELL_AURA_FLY) && !IsImmunedToDamage(SPELL_SCHOOL_MASK_NORMAL) ) { //Safe fall, fall height reduction int32 safe_fall = GetTotalAuraModifier(SPELL_AURA_SAFE_FALL); @@ -19202,7 +20504,11 @@ void Player::HandleFallDamage(MovementInfo& movementInfo) if (GetDummyAura(43621)) damage = GetMaxHealth()/2; - EnvironmentalDamage(GetGUID(), DAMAGE_FALL, damage); + EnvironmentalDamage(DAMAGE_FALL, damage); + + // recheck alive, might have died of EnvironmentalDamage + if (isAlive()) + GetAchievementMgr().UpdateAchievementCriteria(ACHIEVEMENT_CRITERIA_TYPE_FALL_WITHOUT_DYING, uint32(z_diff*100)); } //Z given by moveinfo, LastZ, FallTime, WaterZ, MapZ, Damage, Safefall reduction @@ -19211,168 +20517,649 @@ void Player::HandleFallDamage(MovementInfo& movementInfo) } } -void Player::HandleFallUnderMap() +void Player::UpdateAchievementCriteria( AchievementCriteriaTypes type, uint32 miscvalue1/*=0*/, uint32 miscvalue2/*=0*/, Unit *unit/*=NULL*/, uint32 time/*=0*/ ) +{ + GetAchievementMgr().UpdateAchievementCriteria(type, miscvalue1,miscvalue2,unit,time); +} + +void Player::LearnTalent(uint32 talentId, uint32 talentRank) { - if(InBattleGround() - && GetBattleGround() - && GetBattleGround()->HandlePlayerUnderMap(this)) + uint32 CurTalentPoints = GetFreeTalentPoints(); + + if(CurTalentPoints == 0) + return; + + if (talentRank >= MAX_TALENT_RANK) + return; + + TalentEntry const *talentInfo = sTalentStore.LookupEntry( talentId ); + + if(!talentInfo) + return; + + TalentTabEntry const *talentTabInfo = sTalentTabStore.LookupEntry( talentInfo->TalentTab ); + + if(!talentTabInfo) + return; + + // prevent learn talent for different class (cheating) + if( (getClassMask() & talentTabInfo->ClassMask) == 0 ) + return; + + // find current max talent rank + int32 curtalent_maxrank = 0; + for(int8 k = MAX_TALENT_RANK-1; k > -1; --k) { - // do nothing, the handle already did if returned true + if(talentInfo->RankID[k] && HasSpell(talentInfo->RankID[k])) + { + curtalent_maxrank = k + 1; + break; + } } - else + + // we already have same or higher talent rank learned + if(curtalent_maxrank >= (talentRank + 1)) + return; + + // check if we have enough talent points + if(CurTalentPoints < (talentRank - curtalent_maxrank + 1)) + return; + + // Check if it requires another talent + if (talentInfo->DependsOn > 0) { - // NOTE: this is actually called many times while falling - // even after the player has been teleported away - // TODO: discard movement packets after the player is rooted - if(isAlive()) + if(TalentEntry const *depTalentInfo = sTalentStore.LookupEntry(talentInfo->DependsOn)) { - EnvironmentalDamage(GetGUID(),DAMAGE_FALL_TO_VOID, GetMaxHealth()); - // change the death state to CORPSE to prevent the death timer from - // starting in the next player update - KillPlayer(); - BuildPlayerRepop(); + bool hasEnoughRank = false; + for (uint32 i = talentInfo->DependsOnRank; i < MAX_TALENT_RANK; i++) + { + if (depTalentInfo->RankID[i] != 0) + if (HasSpell(depTalentInfo->RankID[i])) + hasEnoughRank = true; + } + if (!hasEnoughRank) + return; } + } - // cancel the death timer here if started - RepopAtGraveyard(); + // Find out how many points we have in this field + uint32 spentPoints = 0; + + uint32 tTab = talentInfo->TalentTab; + if (talentInfo->Row > 0) + { + uint32 numRows = sTalentStore.GetNumRows(); + for (uint32 i = 0; i < numRows; i++) // Loop through all talents. + { + // Someday, someone needs to revamp + const TalentEntry *tmpTalent = sTalentStore.LookupEntry(i); + if (tmpTalent) // the way talents are tracked + { + if (tmpTalent->TalentTab == tTab) + { + for (int j = 0; j < MAX_TALENT_RANK; j++) + { + if (tmpTalent->RankID[j] != 0) + { + if (HasSpell(tmpTalent->RankID[j])) + { + spentPoints += j + 1; + } + } + } + } + } + } } -} -void Player::SetViewport(uint64 guid, bool moveable) -{ - WorldPacket data(SMSG_CLIENT_CONTROL_UPDATE, 8+1); - data.appendPackGUID(guid); // Packed guid of object to set client's view to - data << (moveable ? uint8(0x01) : uint8(0x00)); // 0 - can't move; 1 - can move - m_session->SendPacket(&data); - sLog.outDetail("Viewport for "I64FMT" (%s) changed to "I64FMT, GetGUID(), GetName(), guid); -} + // not have required min points spent in talent tree + if(spentPoints < (talentInfo->Row * MAX_TALENT_RANK)) + return; -WorldObject* Player::GetFarsightTarget() const -{ - // Players can have in farsight field another player's guid, a creature's guid, or a dynamic object's guid - if (uint64 guid = GetUInt64Value(PLAYER_FARSIGHT)) - return (WorldObject*)ObjectAccessor::GetObjectByTypeMask(*this, guid, TYPEMASK_PLAYER | TYPEMASK_UNIT | TYPEMASK_DYNAMICOBJECT); - return NULL; + // spell not set in talent.dbc + uint32 spellid = talentInfo->RankID[talentRank]; + if( spellid == 0 ) + { + sLog.outError("Talent.dbc have for talent: %u Rank: %u spell id = 0", talentId, talentRank); + return; + } + + // already known + if(HasSpell(spellid)) + return; + + // learn! (other talent ranks will unlearned at learning) + learnSpell(spellid, false); + sLog.outDetail("TalentID: %u Rank: %u Spell: %u\n", talentId, talentRank, spellid); + + // update free talent points + SetFreeTalentPoints(CurTalentPoints - (talentRank - curtalent_maxrank + 1)); } -void Player::StopCastingBindSight() +void Player::LearnPetTalent(uint64 petGuid, uint32 talentId, uint32 talentRank) { - if(WorldObject* target = GetFarsightTarget()) + Pet *pet = GetPet(); + + if(!pet) + return; + + if(petGuid != pet->GetGUID()) + return; + + uint32 CurTalentPoints = pet->GetFreeTalentPoints(); + + if(CurTalentPoints == 0) + return; + + if (talentRank >= MAX_PET_TALENT_RANK) + return; + + TalentEntry const *talentInfo = sTalentStore.LookupEntry(talentId); + + if(!talentInfo) + return; + + TalentTabEntry const *talentTabInfo = sTalentTabStore.LookupEntry(talentInfo->TalentTab); + + if(!talentTabInfo) + return; + + CreatureInfo const *ci = pet->GetCreatureInfo(); + + if(!ci) + return; + + CreatureFamilyEntry const *pet_family = sCreatureFamilyStore.LookupEntry(ci->family); + + if(!pet_family) + return; + + if(pet_family->petTalentType < 0) // not hunter pet + return; + + // prevent learn talent for different family (cheating) + if(!((1 << pet_family->petTalentType) & talentTabInfo->petTalentMask)) + return; + + // find current max talent rank + int32 curtalent_maxrank = 0; + for(int8 k = MAX_TALENT_RANK-1; k > -1; --k) { - if(target->isType(TYPEMASK_UNIT)) + if(talentInfo->RankID[k] && pet->HasSpell(talentInfo->RankID[k])) { - ((Unit*)target)->RemoveAuraTypeByCaster(SPELL_AURA_BIND_SIGHT, GetGUID()); - ((Unit*)target)->RemoveAuraTypeByCaster(SPELL_AURA_MOD_POSSESS, GetGUID()); - ((Unit*)target)->RemoveAuraTypeByCaster(SPELL_AURA_MOD_POSSESS_PET, GetGUID()); + curtalent_maxrank = k + 1; + break; + } + } + + // we already have same or higher talent rank learned + if(curtalent_maxrank >= (talentRank + 1)) + return; + + // check if we have enough talent points + if(CurTalentPoints < (talentRank - curtalent_maxrank + 1)) + return; + + // Check if it requires another talent + if (talentInfo->DependsOn > 0) + { + if(TalentEntry const *depTalentInfo = sTalentStore.LookupEntry(talentInfo->DependsOn)) + { + bool hasEnoughRank = false; + for (uint32 i = talentInfo->DependsOnRank; i < MAX_TALENT_RANK; i++) + { + if (depTalentInfo->RankID[i] != 0) + if (pet->HasSpell(depTalentInfo->RankID[i])) + hasEnoughRank = true; + } + if (!hasEnoughRank) + return; + } + } + + // Find out how many points we have in this field + uint32 spentPoints = 0; + + uint32 tTab = talentInfo->TalentTab; + if (talentInfo->Row > 0) + { + uint32 numRows = sTalentStore.GetNumRows(); + for (uint32 i = 0; i < numRows; ++i) // Loop through all talents. + { + // Someday, someone needs to revamp + const TalentEntry *tmpTalent = sTalentStore.LookupEntry(i); + if (tmpTalent) // the way talents are tracked + { + if (tmpTalent->TalentTab == tTab) + { + for (int j = 0; j < MAX_TALENT_RANK; j++) + { + if (tmpTalent->RankID[j] != 0) + { + if (pet->HasSpell(tmpTalent->RankID[j])) + { + spentPoints += j + 1; + } + } + } + } + } } } + + // not have required min points spent in talent tree + if(spentPoints < (talentInfo->Row * MAX_PET_TALENT_RANK)) + return; + + // spell not set in talent.dbc + uint32 spellid = talentInfo->RankID[talentRank]; + if( spellid == 0 ) + { + sLog.outError("Talent.dbc have for talent: %u Rank: %u spell id = 0", talentId, talentRank); + return; + } + + // already known + if(pet->HasSpell(spellid)) + return; + + // learn! (other talent ranks will unlearned at learning) + pet->learnSpell(spellid); + sLog.outDetail("PetTalentID: %u Rank: %u Spell: %u\n", talentId, talentRank, spellid); + + // update free talent points + pet->SetFreeTalentPoints(CurTalentPoints - (talentRank - curtalent_maxrank + 1)); } -void Player::ClearFarsight() +void Player::UpdateKnownCurrencies(uint32 itemId, bool apply) { - if (GetUInt64Value(PLAYER_FARSIGHT)) + if(CurrencyTypesEntry const* ctEntry = sCurrencyTypesStore.LookupEntry(itemId)) { - SetUInt64Value(PLAYER_FARSIGHT, 0); - WorldPacket data(SMSG_CLEAR_FAR_SIGHT_IMMEDIATE, 0); - GetSession()->SendPacket(&data); + if(apply) + SetFlag64(PLAYER_FIELD_KNOWN_CURRENCIES,(1LL << (ctEntry->BitIndex-1))); + else + RemoveFlag64(PLAYER_FIELD_KNOWN_CURRENCIES,(1LL << (ctEntry->BitIndex-1))); } } -void Player::SetFarsightTarget(WorldObject* obj) +void Player::UpdateFallInformationIfNeed( MovementInfo const& minfo,uint16 opcode ) +{ + if (m_lastFallTime >= minfo.fallTime || m_lastFallZ <=minfo.z || opcode == MSG_MOVE_FALL_LAND) + SetFallInformation(minfo.fallTime, minfo.z); +} + +void Player::UnsummonPetTemporaryIfAny() { - if (!obj || !obj->isType(TYPEMASK_PLAYER | TYPEMASK_UNIT | TYPEMASK_DYNAMICOBJECT)) + Pet* pet = GetPet(); + if(!pet) return; - // Remove the current target if there is one - StopCastingBindSight(); + if(!m_temporaryUnsummonedPetNumber && pet->isControlled() && !pet->isTemporarySummoned() ) + { + m_temporaryUnsummonedPetNumber = pet->GetCharmInfo()->GetPetNumber(); + m_oldpetspell = pet->GetUInt32Value(UNIT_CREATED_BY_SPELL); + } - SetUInt64Value(PLAYER_FARSIGHT, obj->GetGUID()); + RemovePet(pet, PET_SAVE_AS_CURRENT); } -bool Player::isAllowUseBattleGroundObject() +void Player::ResummonPetTemporaryUnSummonedIfAny() { - return ( //InBattleGround() && // in battleground - not need, check in other cases - !IsMounted() && // not mounted - !isTotalImmunity() && // not totally immuned - !HasStealthAura() && // not stealthed - !HasInvisibilityAura() && // not invisible - !HasAura(SPELL_RECENTLY_DROPPED_FLAG, 0) && // can't pickup - isAlive() // live player - ); + if(!m_temporaryUnsummonedPetNumber) + return; + + // not resummon in not appropriate state + if(IsPetNeedBeTemporaryUnsummoned()) + return; + + if(GetPetGUID()) + return; + + Pet* NewPet = new Pet(this); + if(!NewPet->LoadPetFromDB(this, 0, m_temporaryUnsummonedPetNumber, true)) + delete NewPet; + + m_temporaryUnsummonedPetNumber = 0; } -bool Player::HasTitle(uint32 bitIndex) +bool Player::canSeeSpellClickOn(Creature const *c) const { - if (bitIndex > 128) + if(!c->HasFlag(UNIT_NPC_FLAGS,UNIT_NPC_FLAG_SPELLCLICK)) return false; - uint32 fieldIndexOffset = bitIndex/32; - uint32 flag = 1 << (bitIndex%32); - return HasFlag(PLAYER__FIELD_KNOWN_TITLES+fieldIndexOffset, flag); -} + SpellClickInfoMapBounds clickPair = objmgr.GetSpellClickInfoMapBounds(c->GetEntry()); + if(clickPair.first == clickPair.second) + return true; -void Player::SetTitle(CharTitlesEntry const* title) -{ - uint32 fieldIndexOffset = title->bit_index/32; - uint32 flag = 1 << (title->bit_index%32); - SetFlag(PLAYER__FIELD_KNOWN_TITLES+fieldIndexOffset, flag); -} + for(SpellClickInfoMap::const_iterator itr = clickPair.first; itr != clickPair.second; ++itr) + if(itr->second.IsFitToRequirements(this)) + return true; + return false; +} -/*-----------------------TRINITY--------------------------*/ -bool Player::isTotalImmunity() +void Player::BuildPlayerTalentsInfoData(WorldPacket *data) { - AuraList const& immune = GetAurasByType(SPELL_AURA_SCHOOL_IMMUNITY); + *data << uint32(GetFreeTalentPoints()); // unspentTalentPoints + *data << uint8(m_specsCount); // talent group count (0, 1 or 2) + *data << uint8(m_activeSpec); // talent group index (0 or 1) - for(AuraList::const_iterator itr = immune.begin(); itr != immune.end(); ++itr) + if(m_specsCount) { - if (((*itr)->GetModifier()->m_miscvalue & SPELL_SCHOOL_MASK_ALL) !=0) // total immunity + // loop through all specs (only 1 for now) + for(uint32 specIdx = 0; specIdx < m_specsCount; ++specIdx) { - return true; + uint8 talentIdCount = 0; + size_t pos = data->wpos(); + *data << uint8(talentIdCount); // [PH], talentIdCount + + // find class talent tabs (all players have 3 talent tabs) + uint32 const* talentTabIds = GetTalentTabPages(getClass()); + + for(uint8 i = 0; i < 3; ++i) + { + uint32 talentTabId = talentTabIds[i]; + + for(uint32 talentId = 0; talentId < sTalentStore.GetNumRows(); ++talentId) + { + TalentEntry const* talentInfo = sTalentStore.LookupEntry(talentId); + if(!talentInfo) + continue; + + // skip another tab talents + if(talentInfo->TalentTab != talentTabId) + continue; + + // find max talent rank + int32 curtalent_maxrank = -1; + for(int32 k = MAX_TALENT_RANK-1; k > -1; --k) + { + if(talentInfo->RankID[k] && HasSpell(talentInfo->RankID[k])) + { + curtalent_maxrank = k; + break; + } + } + + // not learned talent + if(curtalent_maxrank < 0) + continue; + + *data << uint32(talentInfo->TalentID); // Talent.dbc + *data << uint8(curtalent_maxrank); // talentMaxRank (0-4) + + ++talentIdCount; + } + } + + data->put<uint8>(pos, talentIdCount); // put real count + + *data << uint8(MAX_GLYPH_SLOT_INDEX); // glyphs count + + for(uint8 i = 0; i < MAX_GLYPH_SLOT_INDEX; ++i) + *data << uint16(GetGlyph(i)); // GlyphProperties.dbc } - if (((*itr)->GetModifier()->m_miscvalue & SPELL_SCHOOL_MASK_NORMAL) !=0) // physical damage immunity + } +} + +void Player::BuildPetTalentsInfoData(WorldPacket *data) +{ + uint32 unspentTalentPoints = 0; + size_t pointsPos = data->wpos(); + *data << uint32(unspentTalentPoints); // [PH], unspentTalentPoints + + uint8 talentIdCount = 0; + size_t countPos = data->wpos(); + *data << uint8(talentIdCount); // [PH], talentIdCount + + Pet *pet = GetPet(); + if(!pet) + return; + + unspentTalentPoints = pet->GetFreeTalentPoints(); + + data->put<uint32>(pointsPos, unspentTalentPoints); // put real points + + CreatureInfo const *ci = pet->GetCreatureInfo(); + if(!ci) + return; + + CreatureFamilyEntry const *pet_family = sCreatureFamilyStore.LookupEntry(ci->family); + if(!pet_family || pet_family->petTalentType < 0) + return; + + for(uint32 talentTabId = 1; talentTabId < sTalentTabStore.GetNumRows(); ++talentTabId) + { + TalentTabEntry const *talentTabInfo = sTalentTabStore.LookupEntry( talentTabId ); + if(!talentTabInfo) + continue; + + if(!((1 << pet_family->petTalentType) & talentTabInfo->petTalentMask)) + continue; + + for(uint32 talentId = 0; talentId < sTalentStore.GetNumRows(); ++talentId) { - for(AuraList::const_iterator i = immune.begin(); i != immune.end(); ++i) + TalentEntry const* talentInfo = sTalentStore.LookupEntry(talentId); + if(!talentInfo) + continue; + + // skip another tab talents + if(talentInfo->TalentTab != talentTabId) + continue; + + // find max talent rank + int32 curtalent_maxrank = -1; + for(int32 k = 4; k > -1; --k) { - if (((*i)->GetModifier()->m_miscvalue & SPELL_SCHOOL_MASK_MAGIC) !=0) // magic immunity + if(talentInfo->RankID[k] && pet->HasSpell(talentInfo->RankID[k])) { - return true; + curtalent_maxrank = k; + break; } } + + // not learned talent + if(curtalent_maxrank < 0) + continue; + + *data << uint32(talentInfo->TalentID); // Talent.dbc + *data << uint8(curtalent_maxrank); // talentMaxRank (0-4) + + ++talentIdCount; } + + data->put<uint8>(countPos, talentIdCount); // put real count + + break; } - return false; } -void Player::UpdateCharmedAI() +void Player::SendTalentsInfoData(bool pet) { - //This should only called in Player::Update - Creature *charmer = (Creature*)GetCharmer(); + WorldPacket data(SMSG_TALENTS_INFO, 50); + data << uint8(pet ? 1 : 0); + if(pet) + BuildPetTalentsInfoData(&data); + else + BuildPlayerTalentsInfoData(&data); + GetSession()->SendPacket(&data); +} - //kill self if charm aura has infinite duration - if(charmer->IsInEvadeMode()) +void Player::BuildEnchantmentsInfoData(WorldPacket *data) +{ + uint32 slotUsedMask = 0; + size_t slotUsedMaskPos = data->wpos(); + *data << uint32(slotUsedMask); // slotUsedMask < 0x80000 + + for(uint32 i = 0; i < EQUIPMENT_SLOT_END; ++i) { - AuraList const& auras = GetAurasByType(SPELL_AURA_MOD_CHARM); - for(AuraList::const_iterator iter = auras.begin(); iter != auras.end(); ++iter) - if((*iter)->GetCasterGUID() == charmer->GetGUID() && (*iter)->IsPermanent()) + Item *item = GetItemByPos(INVENTORY_SLOT_BAG_0, i); + + if(!item) + continue; + + slotUsedMask |= (1 << i); + + *data << uint32(item->GetEntry()); // item entry + + uint16 enchantmentMask = 0; + size_t enchantmentMaskPos = data->wpos(); + *data << uint16(enchantmentMask); // enchantmentMask < 0x1000 + + for(uint32 j = 0; j < MAX_ENCHANTMENT_SLOT; ++j) + { + uint32 enchId = item->GetEnchantmentId(EnchantmentSlot(j)); + + if(!enchId) + continue; + + enchantmentMask |= (1 << j); + + *data << uint16(enchId); // enchantmentId? + } + + data->put<uint16>(enchantmentMaskPos, enchantmentMask); + + *data << uint16(0); // ? + *data << uint8(0); // PGUID! + *data << uint32(0); // seed? + } + + data->put<uint32>(slotUsedMaskPos, slotUsedMask); +} + +void Player::SendEquipmentSetList() +{ + uint32 count = 0; + WorldPacket data(SMSG_EQUIPMENT_SET_LIST, 4); + size_t count_pos = data.wpos(); + data << uint32(count); // count placeholder + for(EquipmentSets::iterator itr = m_EquipmentSets.begin(); itr != m_EquipmentSets.end(); ++itr) + { + if(itr->second.state==EQUIPMENT_SET_DELETED) + continue; + data.appendPackGUID(itr->second.Guid); + data << uint32(itr->first); + data << itr->second.Name; + data << itr->second.IconName; + for(uint32 i = 0; i < EQUIPMENT_SLOT_END; ++i) + data.appendPackGUID(MAKE_NEW_GUID(itr->second.Items[i], 0, HIGHGUID_ITEM)); + + ++count; // client have limit but it checked at loading and set + } + data.put<uint32>(count_pos, count); + GetSession()->SendPacket(&data); +} + +void Player::SetEquipmentSet(uint32 index, EquipmentSet eqset) +{ + if(eqset.Guid != 0) + { + bool found = false; + + for(EquipmentSets::iterator itr = m_EquipmentSets.begin(); itr != m_EquipmentSets.end(); ++itr) + { + if((itr->second.Guid == eqset.Guid) && (itr->first == index)) { - charmer->DealDamage(this, GetHealth(), NULL, DIRECT_DAMAGE, SPELL_SCHOOL_MASK_NORMAL, NULL, false); - return; + found = true; + break; } + } + + if(!found) // something wrong... + { + sLog.outError("Player %s tried to save equipment set "UI64FMTD" (index %u), but that equipment set not found!", GetName(), eqset.Guid, index); + return; + } } - if(!charmer->isInCombat()) - GetMotionMaster()->MoveFollow(charmer, PET_FOLLOW_DIST, PET_FOLLOW_ANGLE); + EquipmentSet& eqslot = m_EquipmentSets[index]; - Unit *target = getVictim(); - if(!target || !charmer->canAttack(target)) + EquipmentSetUpdateState old_state = eqslot.state; + + eqslot = eqset; + + if(eqset.Guid == 0) { - target = charmer->SelectNearestTarget(); - if(!target) - return; + eqslot.Guid = objmgr.GenerateEquipmentSetGuid(); - GetMotionMaster()->MoveChase(target); - Attack(target, true); + WorldPacket data(SMSG_EQUIPMENT_SET_SAVED, 4 + 1); + data << uint32(index); + data.appendPackGUID(eqslot.Guid); + GetSession()->SendPacket(&data); } + + eqslot.state = old_state == EQUIPMENT_SET_NEW ? EQUIPMENT_SET_NEW : EQUIPMENT_SET_CHANGED; } +void Player::_SaveEquipmentSets() +{ + for(EquipmentSets::iterator itr = m_EquipmentSets.begin(); itr != m_EquipmentSets.end();) + { + uint32 index = itr->first; + EquipmentSet& eqset = itr->second; + switch(eqset.state) + { + case EQUIPMENT_SET_UNCHANGED: + ++itr; + break; // nothing do + case EQUIPMENT_SET_CHANGED: + CharacterDatabase.PExecute("UPDATE character_equipmentsets SET name='%s', iconname='%s', item0='%u', item1='%u', item2='%u', item3='%u', item4='%u', item5='%u', item6='%u', item7='%u', item8='%u', item9='%u', item10='%u', item11='%u', item12='%u', item13='%u', item14='%u', item15='%u', item16='%u', item17='%u', item18='%u' WHERE guid='%u' AND setguid='"UI64FMTD"' AND setindex='%u'", + eqset.Name.c_str(), eqset.IconName.c_str(), eqset.Items[0], eqset.Items[1], eqset.Items[2], eqset.Items[3], eqset.Items[4], eqset.Items[5], eqset.Items[6], eqset.Items[7], + eqset.Items[8], eqset.Items[9], eqset.Items[10], eqset.Items[11], eqset.Items[12], eqset.Items[13], eqset.Items[14], eqset.Items[15], eqset.Items[16], eqset.Items[17], eqset.Items[18], GetGUIDLow(), eqset.Guid, index); + eqset.state = EQUIPMENT_SET_UNCHANGED; + ++itr; + break; + case EQUIPMENT_SET_NEW: + CharacterDatabase.PExecute("INSERT INTO character_equipmentsets VALUES ('%u', '"UI64FMTD"', '%u', '%s', '%s', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u', '%u')", + GetGUIDLow(), eqset.Guid, index, eqset.Name.c_str(), eqset.IconName.c_str(), eqset.Items[0], eqset.Items[1], eqset.Items[2], eqset.Items[3], eqset.Items[4], eqset.Items[5], eqset.Items[6], eqset.Items[7], + eqset.Items[8], eqset.Items[9], eqset.Items[10], eqset.Items[11], eqset.Items[12], eqset.Items[13], eqset.Items[14], eqset.Items[15], eqset.Items[16], eqset.Items[17], eqset.Items[18]); + eqset.state = EQUIPMENT_SET_UNCHANGED; + ++itr; + break; + case EQUIPMENT_SET_DELETED: + CharacterDatabase.PExecute("DELETE FROM character_equipmentsets WHERE setguid="UI64FMTD, eqset.Guid); + m_EquipmentSets.erase(itr++); + break; + } + } +} + +void Player::DeleteEquipmentSet(uint64 setGuid) +{ + for(EquipmentSets::iterator itr = m_EquipmentSets.begin(); itr != m_EquipmentSets.end(); ++itr) + { + if(itr->second.Guid == setGuid) + { + if(itr->second.state == EQUIPMENT_SET_NEW) + m_EquipmentSets.erase(itr); + else + itr->second.state = EQUIPMENT_SET_DELETED; + break; + } + } +} + +void Player::ActivateSpec(uint32 specNum) +{ + if(GetActiveSpec() == specNum) + return; + + resetTalents(true); +} + +void Player::RemoveAtLoginFlag( AtLoginFlags f, bool in_db_also /*= false*/ ) +{ + m_atLoginFlags &= ~f; + + if(in_db_also) + CharacterDatabase.PExecute("UPDATE characters set at_login = at_login & ~ %u WHERE guid ='%u'", uint32(f), GetGUIDLow()); +} + +void Player::SendClearCooldown( uint32 spell_id, Unit* target ) +{ + WorldPacket data(SMSG_CLEAR_COOLDOWN, 4+8); + data << uint32(spell_id); + data << uint64(target->GetGUID()); + SendDirectMessage(&data); +} |